版本重构，加web管理方式

conf/app.conf

@@ -0,0 +1,6 @@
+appname = httpMonitor
+httpport = 8080
+runmode = dev
+password=123
+hostPort=8028
+

conf/hosts.csv

@@ -0,0 +1,3 @@
+a.proxy.com,127.0.0.1:81,o2430bnq22jgnmcl
+b.proxy.com,127.0.0.1:82,o2430bnq22jgnmcl
+a.o.com,10.1.50.203:80,o2430bnq22jgnmcl

conf/tasks.csv

@@ -0,0 +1,8 @@
+8021,tunnelServer,10.1.50.203:80,um80bbyvcaiw7n17,,,,1
+8001,tunnelServer,10.1.50.101:22,h8vcpciko9lczxmb,,,gzip,0
+8022,tunnelServer,10.1.50.196:4000,vcerzo01q16cdn9n,,,snappy,1
+8002,udpServer,10.1.50.102:53,zcbsx5kp53cg5yqv,,,,0
+8003,sock5Server,,9mq856pqq3jq05qv,,,snappy,1
+8010,sock5Server,,0aj2xfec0mbkann5,test,test,gzip,0
+8004,httpProxyServer,,y72zj8t074lslln0,,,gzip,0
+0,hostServer,,o2430bnq22jgnmcl,,,,1

controllers/base.go

@@ -0,0 +1,117 @@
+package controllers
+
+import (
+	"github.com/astaxie/beego"
+	"github.com/cnlh/easyProxy/lib"
+	"strconv"
+	"strings"
+)
+
+type BaseController struct {
+	beego.Controller
+	controllerName string
+	actionName     string
+}
+
+//初始化参数
+func (s *BaseController) Prepare() {
+	controllerName, actionName := s.GetControllerAndAction()
+	s.controllerName = strings.ToLower(controllerName[0 : len(controllerName)-10])
+	s.actionName = strings.ToLower(actionName)
+	if s.GetSession("auth") != true {
+		s.Redirect("/login/index", 302)
+	}
+}
+
+//加载模板
+func (s *BaseController) display(tpl ...string) {
+	var tplname string
+	if len(tpl) > 0 {
+		tplname = strings.Join([]string{tpl[0], "html"}, ".")
+	} else {
+		tplname = s.controllerName + "/" + s.actionName + ".html"
+	}
+	s.Data["menu"] = s.actionName
+	ip := s.Ctx.Request.Host
+	s.Data["ip"] = lib.Gethostbyname(ip[0:strings.LastIndex(ip, ":")])
+	s.Data["p"] = *lib.TcpPort
+	s.Data["proxyPort"] = beego.AppConfig.String("hostPort")
+	s.Layout = "public/layout.html"
+	s.TplName = tplname
+}
+
+//错误
+func (s *BaseController) error() {
+	s.Layout = "public/layout.html"
+	s.TplName = "public/error.html"
+}
+
+//去掉没有err返回值的int
+func (s *BaseController) GetIntNoErr(key string, def ...int) int {
+	strv := s.Ctx.Input.Query(key)
+	if len(strv) == 0 && len(def) > 0 {
+		return def[0]
+	}
+	val, _ := strconv.Atoi(strv)
+	return val
+}
+
+//获取去掉错误的bool值
+func (s *BaseController) GetBoolNoErr(key string, def ...bool) bool {
+	strv := s.Ctx.Input.Query(key)
+	if len(strv) == 0 && len(def) > 0 {
+		return def[0]
+	}
+	val, _ := strconv.ParseBool(strv)
+	return val
+}
+
+//ajax正确返回
+func (s *BaseController) AjaxOk(str string) {
+	s.Data["json"] = ajax(str, 1)
+	s.ServeJSON()
+	s.StopRun()
+}
+
+//ajax错误返回
+func (s *BaseController) AjaxErr(str string) {
+	s.Data["json"] = ajax(str, 0)
+	s.ServeJSON()
+	s.StopRun()
+}
+
+//组装ajax
+func ajax(str string, status int) (map[string]interface{}) {
+	json := make(map[string]interface{})
+	json["status"] = status
+	json["msg"] = str
+	return json
+}
+
+//ajax table返回
+func (s *BaseController) AjaxTable(list interface{}, cnt int, recordsTotal int) {
+	json := make(map[string]interface{})
+	json["data"] = list
+	json["draw"] = s.GetIntNoErr("draw")
+	json["err"] = ""
+	json["recordsTotal"] = recordsTotal
+	json["recordsFiltered"] = cnt
+	s.Data["json"] = json
+	s.ServeJSON()
+	s.StopRun()
+}
+
+//ajax table参数
+func (s *BaseController) GetAjaxParams() (start, limit int) {
+	s.Ctx.Input.Bind(&start, "start")
+	s.Ctx.Input.Bind(&limit, "length")
+	return
+}
+
+func (s *BaseController) SetInfo(name string) {
+	s.Data["name"] = name
+}
+
+func (s *BaseController) SetType(name string) {
+	s.Data["type"] = name
+}

controllers/index.go

@@ -0,0 +1,165 @@
+package controllers
+
+import (
+	"github.com/cnlh/easyProxy/lib"
+)
+
+type IndexController struct {
+	BaseController
+}
+
+func (s *IndexController) Index() {
+	s.SetInfo("使用说明")
+	s.display("index/index")
+}
+
+func (s *IndexController) Tcp() {
+	s.SetInfo("tcp隧道管理")
+	s.SetType("tunnelServer")
+	s.display("index/list")
+}
+
+func (s *IndexController) Udp() {
+	s.SetInfo("udp隧道管理")
+	s.SetType("udpServer")
+	s.display("index/list")
+}
+
+func (s *IndexController) Socks5() {
+	s.SetInfo("socks5管理")
+	s.SetType("sock5Server")
+	s.display("index/list")
+}
+
+func (s *IndexController) Http() {
+	s.SetInfo("http代理管理")
+	s.SetType("httpProxyServer")
+	s.display("index/list")
+}
+
+func (s *IndexController) Host() {
+	s.SetInfo("host模式管理")
+	s.SetType("hostServer")
+	s.display("index/list")
+}
+
+func (s *IndexController) GetTaskList() {
+	start, length := s.GetAjaxParams()
+	taskType := s.GetString("type")
+	list, cnt := lib.CsvDb.GetTaskList(start, length, taskType)
+	s.AjaxTable(list, cnt, cnt)
+}
+
+func (s *IndexController) Add() {
+	if s.Ctx.Request.Method == "GET" {
+		s.Data["type"] = s.GetString("type")
+		s.SetInfo("新增")
+		s.display()
+	} else {
+		t := &lib.TaskList{
+			TcpPort:   s.GetIntNoErr("port"),
+			Mode:      s.GetString("type"),
+			Target:    s.GetString("target"),
+			VerifyKey: lib.GetRandomString(16),
+			U:         s.GetString("u"),
+			P:         s.GetString("p"),
+			Compress:  s.GetString("compress"),
+			IsRun:     0,
+		}
+		lib.CsvDb.NewTask(t)
+		if err := lib.AddTask(t); err != nil {
+			s.AjaxErr(err.Error())
+		} else {
+			s.AjaxOk("添加成功")
+		}
+	}
+}
+
+func (s *IndexController) Edit() {
+	if s.Ctx.Request.Method == "GET" {
+		vKey := s.GetString("vKey")
+		if t, err := lib.CsvDb.GetTask(vKey); err != nil {
+			s.error()
+		} else {
+			s.Data["t"] = t
+		}
+		s.SetInfo("修改")
+		s.display()
+	} else {
+		vKey := s.GetString("vKey")
+		if t, err := lib.CsvDb.GetTask(vKey); err != nil {
+			s.error()
+		} else {
+			t.TcpPort = s.GetIntNoErr("port")
+			t.Mode = s.GetString("type")
+			t.Target = s.GetString("target")
+			t.U = s.GetString("u")
+			t.P = s.GetString("p")
+			t.Compress = s.GetString("compress")
+			lib.CsvDb.UpdateTask(t)
+			lib.StopServer(t.VerifyKey)
+			lib.StartTask(t.VerifyKey)
+		}
+		s.AjaxOk("修改成功")
+	}
+}
+
+func (s *IndexController) Stop() {
+	vKey := s.GetString("vKey")
+	if err := lib.StopServer(vKey); err != nil {
+		s.AjaxErr("停止失败")
+	}
+	s.AjaxOk("停止成功")
+}
+func (s *IndexController) Del() {
+	vKey := s.GetString("vKey")
+	if err := lib.DelTask(vKey); err != nil {
+		s.AjaxErr("删除失败")
+	}
+	s.AjaxOk("删除成功")
+}
+
+func (s *IndexController) Start() {
+	vKey := s.GetString("vKey")
+	if err := lib.StartTask(vKey); err != nil {
+		s.AjaxErr("开启失败")
+	}
+	s.AjaxOk("开启成功")
+}
+
+func (s *IndexController) HostList() {
+	if s.Ctx.Request.Method == "GET" {
+		s.Data["vkey"] = s.GetString("vkey")
+		s.SetInfo("域名列表")
+		s.display("index/hlist")
+	} else {
+		start, length := s.GetAjaxParams()
+		vkey := s.GetString("vkey")
+		list, cnt := lib.CsvDb.GetHostList(start, length, vkey)
+		s.AjaxTable(list, cnt, cnt)
+	}
+}
+
+func (s *IndexController) DelHost() {
+	host := s.GetString("host")
+	if err := lib.CsvDb.DelHost(host); err != nil {
+		s.AjaxErr("删除失败")
+	}
+	s.AjaxOk("删除成功")
+}
+
+func (s *IndexController) AddHost() {
+	if s.Ctx.Request.Method == "GET" {
+		s.Data["vkey"] = s.GetString("vkey")
+		s.SetInfo("新增")
+		s.display("index/hadd")
+	} else {
+		h := &lib.HostList{
+			Vkey:   s.GetString("vkey"),
+			Host:   s.GetString("host"),
+			Target: s.GetString("target"),
+		}
+		lib.CsvDb.NewHost(h)
+		s.AjaxOk("添加成功")
+	}
+}

controllers/login.go

@@ -0,0 +1,27 @@
+package controllers
+
+import (
+	"github.com/astaxie/beego"
+)
+
+type LoginController struct {
+	beego.Controller
+}
+
+func (self *LoginController) Index() {
+	self.TplName = "login/index.html"
+}
+func (self *LoginController) Verify() {
+	if self.GetString("psd") == beego.AppConfig.String("password") {
+		self.SetSession("auth", true)
+		self.Data["json"] = map[string]interface{}{"status": 1, "msg": "验证成功"}
+		self.ServeJSON()
+	} else {
+		self.Data["json"] = map[string]interface{}{"status": 0, "msg": "验证失败"}
+		self.ServeJSON()
+	}
+}
+func (self *LoginController) Out() {
+	self.SetSession("auth", false)
+	self.Redirect("/login/index", 302)
+}

http.go

@@ -1,121 +0,0 @@
-package main
-
-import  (
-	"bufio"
-	"bytes"
-	"compress/gzip"
-	"encoding/binary"
-	"errors"
-	"fmt"
-	"net/http"
-	"net/http/httputil"
-	"net/url"
-	"strconv"
-	"strings"
-)
-
-/*
-
-  http.ReadRequest()
-  http.ReadResponse()
-  httputil.DumpRequest()
-  httputil.DumpResponse()
-*/
-
-// 将request 的处理
-func EncodeRequest(r *http.Request) ([]byte, error) {
-	raw := bytes.NewBuffer([]byte{})
-	// 写签名
-	binary.Write(raw, binary.LittleEndian, []byte("sign"))
-	reqBytes, err := httputil.DumpRequest(r, true)
-	if err != nil {
-		return nil, err
-	}
-	// 写body数据长度 + 1
-	binary.Write(raw, binary.LittleEndian, int32(len(reqBytes)+1))
-	// 判断是否为http或者https的标识1字节
-	binary.Write(raw, binary.LittleEndian, bool(r.URL.Scheme == "https"))
-	if err := binary.Write(raw, binary.LittleEndian, reqBytes); err != nil {
-		return nil, err
-	}
-	return raw.Bytes(), nil
-}
-
-// 将字节转为request
-func DecodeRequest(data []byte) (*http.Request, error) {
-	if len(data) <= 100 {
-		return nil, errors.New("待解码的字节长度太小")
-	}
-	req, err := http.ReadRequest(bufio.NewReader(bytes.NewReader(data[1:])))
-	if err != nil {
-		return nil, err
-	}
-	str := strings.Split(req.Host, ":")
-	req.Host, err = getHost(str[0])
-	if err != nil {
-		return nil, err
-	}
-	scheme := "http"
-	if data[0] == 1 {
-		scheme = "https"
-	}
-	req.URL, _ = url.Parse(fmt.Sprintf("%s://%s%s", scheme, req.Host, req.RequestURI))
-	req.RequestURI = ""
-
-	return req, nil
-}
-
-//// 将response转为字节
-func EncodeResponse(r *http.Response) ([]byte, error) {
-	raw := bytes.NewBuffer([]byte{})
-	binary.Write(raw, binary.LittleEndian, []byte("sign"))
-	respBytes, err := httputil.DumpResponse(r, true)
-	if config.Replace == 1 {
-		respBytes = replaceHost(respBytes)
-	}
-	if err != nil {
-		return nil, err
-	}
-	var buf bytes.Buffer
-	zw := gzip.NewWriter(&buf)
-	zw.Write(respBytes)
-	zw.Close()
-	binary.Write(raw, binary.LittleEndian, int32(len(buf.Bytes())))
-	if err := binary.Write(raw, binary.LittleEndian, buf.Bytes()); err != nil {
-		fmt.Println(err)
-		return nil, err
-	}
-	return raw.Bytes(), nil
-}
-
-//// 将字节转为response
-func DecodeResponse(data []byte) (*http.Response, error) {
-	zr, err := gzip.NewReader(bytes.NewReader(data))
-	if err != nil {
-		return nil, err
-	}
-	defer zr.Close()
-	resp, err := http.ReadResponse(bufio.NewReader(zr), nil)
-	if err != nil {
-		return nil, err
-	}
-	return resp, nil
-}
-
-func getHost(str string) (string, error) {
-	for _, v := range config.SiteList {
-		if v.Host == str {
-			return v.Url + ":" + strconv.Itoa(v.Port), nil
-		}
-	}
-	return "", errors.New("没有找到解析的的host!")
-}
-
-func replaceHost(resp []byte) []byte {
-	str := string(resp)
-	for _, v := range config.SiteList {
-		str = strings.Replace(str, v.Url+":"+strconv.Itoa(v.Port), v.Host, -1)
-		str = strings.Replace(str, v.Url, v.Host, -1)
-	}
-	return []byte(str)
-}

json.go

@@ -1,51 +0,0 @@
-package main
-
-import (
-	"encoding/json"
-	"errors"
-	"io/ioutil"
-)
-
-//定义配置文件解析后的结构
-type Server struct {
-	Ip   string
-	Port int
-	Tcp  int
-	Vkey string
-	Num  int
-}
-
-type Site struct {
-	Host string
-	Url  string
-	Port int
-}
-type Config struct {
-	Server   Server
-	SiteList []Site
-	Replace  int
-}
-type JsonStruct struct {
-}
-
-func NewJsonStruct() *JsonStruct {
-	return &JsonStruct{}
-}
-func (jst *JsonStruct) Load(filename string) (Config, error) {
-	data, err := ioutil.ReadFile(filename)
-	config := Config{}
-	if err != nil {
-		return config, errors.New("配置文件打开错误")
-	}
-	err = json.Unmarshal(data, &config)
-	if err != nil {
-		return config, errors.New("配置文件解析错误")
-	}
-	if config.Server.Tcp <= 0 || config.Server.Tcp >= 65536 {
-		return config, errors.New("请输入正确的tcp端口")
-	}
-	if config.Server.Vkey == "" {
-		return config, errors.New("密钥不能为空！")
-	}
-	return config, nil
-}

client.go → lib/client.go

@@ -1,4 +1,4 @@
-package main
+package lib
 
 import (
 	"errors"
@@ -13,12 +13,14 @@ type TRPClient struct {
 	svrAddr string
 	tcpNum  int
 	sync.Mutex
+	vKey string
 }
 
-func NewRPClient(svraddr string, tcpNum int) *TRPClient {
+func NewRPClient(svraddr string, tcpNum int, vKey string) *TRPClient {
 	c := new(TRPClient)
 	c.svrAddr = svraddr
 	c.tcpNum = tcpNum
+	c.vKey = vKey
 	return c
 }
 
@@ -26,9 +28,6 @@ func (s *TRPClient) Start() error {
 	for i := 0; i < s.tcpNum; i++ {
 		go s.newConn()
 	}
-	for {
-		time.Sleep(time.Second * 5)
-	}
 	return nil
 }
 
@@ -49,7 +48,7 @@ func (s *TRPClient) newConn() error {
 
 func (s *TRPClient) process(c *Conn) error {
 	c.SetAlive()
-	if _, err := c.Write(getverifyval()); err != nil {
+	if _, err := c.Write([]byte(getverifyval(s.vKey))); err != nil {
 		return err
 	}
 	c.wMain()
@@ -63,20 +62,20 @@ func (s *TRPClient) process(c *Conn) error {
 		}
 		switch flags {
 		case VERIFY_EER:
-			log.Fatal("vkey不正确,请检查配置文件")
+			log.Fatalln("vkey:", s.vKey, "不正确,服务端拒绝连接,请检查")
 		case RES_SIGN: //代理请求模式
 			if err := s.dealHttp(c); err != nil {
 				log.Println(err)
 				return err
 			}
 		case WORK_CHAN: //隧道模式，每次开启10个，加快连接速度
-			for i := 0; i < 100; i++ {
+			for i := 0; i < 10; i++ {
 				go s.dealChan()
 			}
 		case RES_MSG:
 			log.Println("服务端返回错误。")
 		default:
-			log.Println("无法解析该错误。")
+			log.Println("无法解析该错误。", flags)
 		}
 	}
 	return nil
@@ -90,7 +89,7 @@ func (s *TRPClient) dealChan() error {
 		return err
 	}
 	//验证
-	if _, err := conn.Write(getverifyval()); err != nil {
+	if _, err := conn.Write([]byte(getverifyval(s.vKey))); err != nil {
 		return err
 	}
 	//默认长连接保持
@@ -99,7 +98,7 @@ func (s *TRPClient) dealChan() error {
 	//写标志
 	c.wChan()
 	//获取连接的host type(tcp or udp)
-	typeStr, host, err := c.GetHostFromConn()
+	typeStr, host, en, de, err := c.GetHostFromConn()
 	if err != nil {
 		return err
 	}
@@ -109,15 +108,16 @@ func (s *TRPClient) dealChan() error {
 		log.Println(err)
 		return err
 	}
-	go relay(NewConn(server), c, DataDecode)
-	relay(c, NewConn(server), DataEncode)
+	go relay(NewConn(server), c, de)
+	relay(c, NewConn(server), en)
 	return nil
 }
 
 //http模式处理
 func (s *TRPClient) dealHttp(c *Conn) error {
 	buf := make([]byte, 1024*32)
-	n, err := c.ReadFromCompress(buf, DataDecode)
+	en, de := c.GetCompressTypeFromConn()
+	n, err := c.ReadFromCompress(buf, de)
 	if err != nil {
 		c.wError()
 		return err
@@ -133,7 +133,7 @@ func (s *TRPClient) dealHttp(c *Conn) error {
 		return err
 	}
 	c.wSign()
-	n, err = c.WriteCompress(respBytes, DataEncode)
+	n, err = c.WriteCompress(respBytes, en)
 	if err != nil {
 		return err
 	}

conn.go → lib/conn.go

@@ -1,6 +1,7 @@
-package main
+package lib
 
 import (
+	"bufio"
 	"bytes"
 	"compress/gzip"
 	"encoding/binary"
@@ -10,12 +11,63 @@ import (
 	"io"
 	"log"
 	"net"
+	"net/http"
 	"net/url"
-	"regexp"
+	"strconv"
 	"strings"
 	"time"
 )
 
+type SnappyConn struct {
+	w *snappy.Writer
+	r *snappy.Reader
+}
+
+func NewSnappyConn(conn net.Conn) *SnappyConn {
+	c := new(SnappyConn)
+	c.w = snappy.NewBufferedWriter(conn)
+	c.r = snappy.NewReader(conn)
+	return c
+}
+
+func (s *SnappyConn) Write(b []byte) (n int, err error) {
+	if n, err = s.w.Write(b); err != nil {
+		return
+	}
+	err = s.w.Flush()
+	return
+}
+
+func (s *SnappyConn) Read(b []byte) (n int, err error) {
+	return s.r.Read(b)
+}
+
+type GzipConn struct {
+	w *gzip.Writer
+	r *gzip.Reader
+}
+
+func NewGzipConn(conn net.Conn) *GzipConn {
+	c := new(GzipConn)
+	c.w = gzip.NewWriter(conn)
+	c.r, err = gzip.NewReader(conn)
+	return c
+}
+
+func (s *GzipConn) Write(b []byte) (n int, err error) {
+	if n, err = s.w.Write(b); err != nil || err == io.EOF {
+		err = s.w.Flush()
+		s.w.Close()
+		return
+	}
+	err = s.w.Flush()
+	return
+}
+
+func (s *GzipConn) Read(b []byte) (n int, err error) {
+	return s.r.Read(b)
+}
+
 type Conn struct {
 	conn net.Conn
 }
@@ -32,7 +84,7 @@ func (s *Conn) ReadLen(len int) ([]byte, error) {
 	buff := make([]byte, 1024)
 	c := 0
 	for {
-		clen, err := s.conn.Read(buff)
+		clen, err := s.Read(buff)
 		if err != nil && err != io.EOF {
 			return raw, err
 		}
@@ -64,7 +116,6 @@ func (s *Conn) GetLen() (int, error) {
 //写入长度
 func (s *Conn) WriteLen(buf []byte) (int, error) {
 	raw := bytes.NewBuffer([]byte{})
-
 	if err := binary.Write(raw, binary.LittleEndian, int32(len(buf))); err != nil {
 		log.Println(err)
 		return 0, err
@@ -79,23 +130,22 @@ func (s *Conn) WriteLen(buf []byte) (int, error) {
 //读取flag
 func (s *Conn) ReadFlag() (string, error) {
 	val := make([]byte, 4)
-	_, err := s.conn.Read(val)
+	_, err := s.Read(val)
 	if err != nil {
 		return "", err
 	}
 	return string(val), err
 }
 
-//读取host
-func (s *Conn) GetHostFromConn() (typeStr string, host string, err error) {
+//读取host 连接地址 压缩类型
+func (s *Conn) GetHostFromConn() (typeStr string, host string, en, de int, err error) {
 retry:
 	ltype := make([]byte, 3)
-	_, err = s.Read(ltype)
-	if err != nil {
+	if _, err = s.Read(ltype); err != nil {
 		return
 	}
-	typeStr = string(ltype)
-	if typeStr == TEST_FLAG {
+	if typeStr = string(ltype); typeStr == TEST_FLAG {
+		en, de = s.GetCompressTypeFromConn()
 		goto retry
 	}
 	len, err := s.GetLen()
@@ -103,15 +153,14 @@ retry:
 		return
 	}
 	hostByte := make([]byte, len)
-	_, err = s.conn.Read(hostByte)
-	if err != nil {
+	if _, err = s.Read(hostByte); err != nil {
 		return
 	}
 	host = string(hostByte)
 	return
 }
 
-//写tcp host
+//写连接类型 和 host地址
 func (s *Conn) WriteHost(ltype string, host string) (int, error) {
 	raw := bytes.NewBuffer([]byte{})
 	binary.Write(raw, binary.LittleEndian, []byte(ltype))
@@ -130,45 +179,34 @@ func (s *Conn) SetAlive() {
 
 //从tcp报文中解析出host
 func (s *Conn) GetHost() (method, address string, rb []byte, err error) {
-	var b [2048]byte
+	var b [32 * 1024]byte
 	var n int
-	var host string
 	if n, err = s.Read(b[:]); err != nil {
 		return
 	}
 	rb = b[:n]
-	//TODO：某些不规范报文可能会有问题
-	fmt.Sscanf(string(b[:n]), "%s", &method)
-	reg, err := regexp.Compile(`(\w+:\/\/)([^/:]+)(:\d*)?`)
+	r, err := http.ReadRequest(bufio.NewReader(bytes.NewReader(rb)))
 	if err != nil {
+		log.Println("解析host出错：", err)
 		return
 	}
-	host = string(reg.Find(b[:]))
-	hostPortURL, err := url.Parse(host)
+	hostPortURL, err := url.Parse(r.Host)
 	if err != nil {
 		return
 	}
 	if hostPortURL.Opaque == "443" { //https访问
-		address = hostPortURL.Scheme + ":443"
+		address = r.Host + ":443"
 	} else { //http访问
 		if strings.Index(hostPortURL.Host, ":") == -1 { //host不带端口， 默认80
-			address = hostPortURL.Host + ":80"
+			address = r.Host + ":80"
 		} else {
-			address = hostPortURL.Host
+			address = r.Host
 		}
 	}
 	return
 }
 
-func (s *Conn) Close() error {
-	return s.conn.Close()
-}
-func (s *Conn) Write(b []byte) (int, error) {
-	return s.conn.Write(b)
-}
-func (s *Conn) Read(b []byte) (int, error) {
-	return s.conn.Read(b)
-}
+//压缩方式读
 func (s *Conn) ReadFromCompress(b []byte, compress int) (int, error) {
 	switch compress {
 	case COMPRESS_GZIP_DECODE:
@@ -186,6 +224,7 @@ func (s *Conn) ReadFromCompress(b []byte, compress int) (int, error) {
 	return 0, nil
 }
 
+//压缩方式写
 func (s *Conn) WriteCompress(b []byte, compress int) (n int, err error) {
 	switch compress {
 	case COMPRESS_GZIP_ENCODE:
@@ -193,32 +232,61 @@ func (s *Conn) WriteCompress(b []byte, compress int) (n int, err error) {
 		if n, err = w.Write(b); err == nil {
 			w.Flush()
 		}
+		err = w.Close()
 	case COMPRESS_SNAPY_ENCODE:
 		w := snappy.NewBufferedWriter(s)
 		if n, err = w.Write(b); err == nil {
 			w.Flush()
 		}
+		err = w.Close()
 	case COMPRESS_NONE:
 		n, err = s.Write(b)
 	}
 	return
 }
 
+//写压缩方式
+func (s *Conn) WriteCompressType(en, de int) {
+	s.Write([]byte(strconv.Itoa(en) + strconv.Itoa(de)))
+}
+
+//获取压缩方式
+func (s *Conn) GetCompressTypeFromConn() (en, de int) {
+	buf := make([]byte, 2)
+	s.Read(buf)
+	en, _ = strconv.Atoi(string(buf[0]))
+	de, _ = strconv.Atoi(string(buf[1]))
+	return
+}
+
+func (s *Conn) Close() error {
+	return s.conn.Close()
+}
+
+func (s *Conn) Write(b []byte) (int, error) {
+	return s.conn.Write(b)
+}
+
+func (s *Conn) Read(b []byte) (int, error) {
+	return s.conn.Read(b)
+}
+
 func (s *Conn) wError() (int, error) {
-	return s.conn.Write([]byte(RES_MSG))
+	return s.Write([]byte(RES_MSG))
 }
+
 func (s *Conn) wSign() (int, error) {
-	return s.conn.Write([]byte(RES_SIGN))
+	return s.Write([]byte(RES_SIGN))
 }
 
 func (s *Conn) wMain() (int, error) {
-	return s.conn.Write([]byte(WORK_MAIN))
+	return s.Write([]byte(WORK_MAIN))
 }
 
 func (s *Conn) wChan() (int, error) {
-	return s.conn.Write([]byte(WORK_CHAN))
+	return s.Write([]byte(WORK_CHAN))
 }
 
 func (s *Conn) wTest() (int, error) {
-	return s.conn.Write([]byte(TEST_FLAG))
+	return s.Write([]byte(TEST_FLAG))
 }

lib/csv.go

@@ -0,0 +1,285 @@
+package lib
+
+import (
+	"encoding/csv"
+	"errors"
+	"log"
+	"os"
+	"strconv"
+)
+
+type TaskList struct {
+	TcpPort      int    //服务端与客户端通信端口
+	Mode         string //启动方式
+	Target       string //目标
+	VerifyKey    string //flag
+	U            string //socks5验证用户名
+	P            string //socks5验证密码
+	Compress     string //压缩方式
+	Start        int    //是否开启
+	IsRun        int    //是否在运行
+	ClientStatus int    //客户端状态
+}
+
+type HostList struct {
+	Vkey   string //服务端与客户端通信端口
+	Host   string //启动方式
+	Target string //目标
+}
+
+func NewCsv(path string, bridge *Tunnel, runList map[string]interface{}) *Csv {
+	c := new(Csv)
+	c.Path = path
+	c.Bridge = bridge
+	c.RunList = runList
+	return c
+}
+
+type Csv struct {
+	Tasks   []*TaskList
+	Path    string
+	Bridge  *Tunnel
+	RunList map[string]interface{}
+	Hosts   []*HostList //域名列表
+}
+
+func (s *Csv) Init() {
+	s.LoadTaskFromCsv()
+	s.LoadHostFromCsv()
+}
+
+func (s *Csv) StoreTasksToCsv() {
+	// 创建文件
+	csvFile, err := os.Create(s.Path + "tasks.csv")
+	if err != nil {
+		log.Fatalf(err.Error())
+	}
+	defer csvFile.Close()
+	writer := csv.NewWriter(csvFile)
+	for _, task := range s.Tasks {
+		record := []string{
+			strconv.Itoa(task.TcpPort),
+			task.Mode,
+			task.Target,
+			task.VerifyKey,
+			task.U,
+			task.P,
+			task.Compress,
+			strconv.Itoa(task.Start),
+		}
+		err := writer.Write(record)
+		if err != nil {
+			log.Fatalf(err.Error())
+		}
+	}
+	writer.Flush()
+}
+
+func (s *Csv) LoadTaskFromCsv() {
+	// 打开文件
+	file, err := os.Open(s.Path + "tasks.csv")
+	if err != nil {
+		panic(err)
+	}
+	defer file.Close()
+
+	// 获取csv的reader
+	reader := csv.NewReader(file)
+
+	// 设置FieldsPerRecord为-1
+	reader.FieldsPerRecord = -1
+
+	// 读取文件中所有行保存到slice中
+	records, err := reader.ReadAll()
+	if err != nil {
+		panic(err)
+	}
+	var tasks []*TaskList
+	// 将每一行数据保存到内存slice中
+	for _, item := range records {
+		tcpPort, _ := strconv.Atoi(item[0])
+		Start, _ := strconv.Atoi(item[7])
+		post := &TaskList{
+			TcpPort:   tcpPort,
+			Mode:      item[1],
+			Target:    item[2],
+			VerifyKey: item[3],
+			U:         item[4],
+			P:         item[5],
+			Compress:  item[6],
+			Start:     Start,
+		}
+		tasks = append(tasks, post)
+	}
+	s.Tasks = tasks
+}
+
+func (s *Csv) StoreHostToCsv() {
+	// 创建文件
+	csvFile, err := os.Create(s.Path + "hosts.csv")
+	if err != nil {
+		panic(err)
+	}
+	defer csvFile.Close()
+	// 获取csv的Writer
+	writer := csv.NewWriter(csvFile)
+	// 将map中的Post转换成slice，因为csv的Write需要slice参数
+	// 并写入csv文件
+	for _, host := range s.Hosts {
+		record := []string{
+			host.Host,
+			host.Target,
+			host.Vkey,
+		}
+		err1 := writer.Write(record)
+		if err1 != nil {
+			panic(err1)
+		}
+	}
+	// 确保所有内存数据刷到csv文件
+	writer.Flush()
+}
+
+func (s *Csv) LoadHostFromCsv() {
+	// 打开文件
+	file, err := os.Open(s.Path + "hosts.csv")
+	if err != nil {
+		panic(err)
+	}
+	defer file.Close()
+
+	// 获取csv的reader
+	reader := csv.NewReader(file)
+
+	// 设置FieldsPerRecord为-1
+	reader.FieldsPerRecord = -1
+
+	// 读取文件中所有行保存到slice中
+	records, err := reader.ReadAll()
+	if err != nil {
+		panic(err)
+	}
+	var hosts []*HostList
+	// 将每一行数据保存到内存slice中
+	for _, item := range records {
+		post := &HostList{
+			Vkey:   item[2],
+			Host:   item[0],
+			Target: item[1],
+		}
+		hosts = append(hosts, post)
+	}
+	s.Hosts = hosts
+}
+
+func (s *Csv) GetTaskList(start, length int, typeVal string) ([]*TaskList, int) {
+	list := make([]*TaskList, 0)
+	var cnt int
+	for _, v := range s.Tasks {
+		if v.Mode != typeVal {
+			continue
+		}
+		cnt++
+		if start--; start < 0 {
+			if length--; length > 0 {
+				if _, ok := s.RunList[v.VerifyKey]; ok {
+					v.IsRun = 1
+				} else {
+					v.IsRun = 0
+				}
+				if s, ok := s.Bridge.signalList[getverifyval(v.VerifyKey)]; ok {
+					if s.Len() > 0 {
+						v.ClientStatus = 1
+					} else {
+						v.ClientStatus = 0
+					}
+				} else {
+					v.ClientStatus = 0
+				}
+				list = append(list, v)
+			}
+		}
+
+	}
+	return list, cnt
+}
+
+func (s *Csv) NewTask(t *TaskList) {
+	s.Tasks = append(s.Tasks, t)
+	s.StoreTasksToCsv()
+}
+
+func (s *Csv) UpdateTask(t *TaskList) error {
+	for k, v := range s.Tasks {
+		if v.VerifyKey == t.VerifyKey {
+			s.Tasks = append(s.Tasks[:k], s.Tasks[k+1:]...)
+			s.Tasks = append(s.Tasks, t)
+			s.StoreTasksToCsv()
+			return nil
+		}
+	}
+	//TODO:待测试
+	return errors.New("不存在")
+}
+
+func (s *Csv) AddRunList(vKey string, svr interface{}) {
+	s.RunList[vKey] = svr
+}
+
+func (s *Csv) DelRunList(vKey string) {
+	delete(s.RunList, vKey)
+}
+
+func (s *Csv) DelTask(vKey string) error {
+	for k, v := range s.Tasks {
+		if v.VerifyKey == vKey {
+			s.Tasks = append(s.Tasks[:k], s.Tasks[k+1:]...)
+			s.StoreTasksToCsv()
+			return nil
+		}
+	}
+	return errors.New("不存在")
+}
+
+func (s *Csv) GetTask(vKey string) (v *TaskList, err error) {
+	for _, v = range s.Tasks {
+		if v.VerifyKey == vKey {
+			return
+		}
+	}
+	err = errors.New("未找到")
+	return
+}
+
+func (s *Csv) DelHost(host string) error {
+	for k, v := range s.Hosts {
+		if v.Host == host {
+			s.Hosts = append(s.Hosts[:k], s.Hosts[k+1:]...)
+			s.StoreHostToCsv()
+			return nil
+		}
+	}
+	return errors.New("不存在")
+}
+
+func (s *Csv) NewHost(t *HostList) {
+	s.Hosts = append(s.Hosts, t)
+	s.StoreHostToCsv()
+
+}
+
+func (s *Csv) GetHostList(start, length int, vKey string) ([]*HostList, int) {
+	list := make([]*HostList, 0)
+	var cnt int
+	for _, v := range s.Hosts {
+		if v.Vkey == vKey {
+			cnt++
+			if start--; start < 0 {
+				if length--; length > 0 {
+					list = append(list, v)
+				}
+			}
+		}
+	}
+	return list, cnt
+}

lib/init.go

@@ -0,0 +1,165 @@
+package lib
+
+import (
+	"errors"
+	"flag"
+	"log"
+	"reflect"
+	"strings"
+	"sync"
+)
+
+var (
+	configPath   = flag.String("config", "config.json", "配置文件路径")
+	TcpPort      = flag.Int("tcpport", 8284, "客户端与服务端通信端口")
+	httpPort     = flag.Int("httpport", 8024, "对外监听的端口")
+	rpMode       = flag.String("mode", "client", "启动模式")
+	tunnelTarget = flag.String("target", "10.1.50.203:80", "远程目标")
+	verifyKey    = flag.String("vkey", "", "验证密钥")
+	u            = flag.String("u", "", "socks5验证用户名")
+	p            = flag.String("p", "", "socks5验证密码")
+	compress     = flag.String("compress", "", "数据压缩方式（gzip|snappy）")
+	serverAddr   = flag.String("server", "", "服务器地址ip:端口")
+	config       Config
+	err          error
+	RunList      map[string]interface{} //运行中的任务
+	bridge       *Tunnel
+	CsvDb        *Csv
+)
+
+func init() {
+	RunList = make(map[string]interface{})
+}
+
+func InitMode() {
+	flag.Parse()
+	de, en := getCompressType(*compress)
+	if *rpMode == "client" {
+		JsonParse := NewJsonStruct()
+		if config, err = JsonParse.Load(*configPath); err != nil {
+			log.Println("配置文件加载失败")
+		}
+		stop := make(chan int)
+		for _, v := range strings.Split(*verifyKey, ",") {
+			log.Println("客户端启动，连接：", *serverAddr, " 验证令牌：", v)
+			go NewRPClient(*serverAddr, 2, v).Start()
+		}
+		<-stop
+	} else {
+		bridge = newTunnel(*TcpPort)
+		if err := bridge.StartTunnel(); err != nil {
+			log.Fatalln("服务端开启失败", err)
+		}
+		log.Println("服务端启动，监听tcp服务端端口：", *TcpPort)
+		if svr := newMode(*rpMode, bridge, *httpPort, *tunnelTarget, *u, *p, en, de, *verifyKey); svr != nil {
+			reflect.ValueOf(svr).MethodByName("Start").Call(nil)
+		} else {
+			log.Fatalln("启动模式不正确")
+		}
+	}
+}
+
+//从csv文件中恢复任务
+func InitFromCsv() {
+	for _, v := range CsvDb.Tasks {
+		if v.Start == 1 {
+			log.Println(""+
+				"启动模式：", v.Mode, "监听端口：", v.TcpPort, "客户端令牌：", v.VerifyKey)
+			AddTask(v)
+		}
+	}
+}
+
+func newMode(mode string, bridge *Tunnel, httpPort int, tunnelTarget string, u string, p string, enCompress int, deCompress int, vkey string) interface{} {
+	switch mode {
+	case "httpServer":
+		return NewHttpModeServer(httpPort, bridge, enCompress, deCompress, vkey)
+	case "tunnelServer":
+		return NewTunnelModeServer(httpPort, tunnelTarget, ProcessTunnel, bridge, enCompress, deCompress, vkey)
+	case "sock5Server":
+		return NewSock5ModeServer(httpPort, u, p, bridge, enCompress, deCompress, vkey)
+	case "httpProxyServer":
+		return NewTunnelModeServer(httpPort, tunnelTarget, ProcessHttp, bridge, enCompress, deCompress, vkey)
+	case "udpServer":
+		return NewUdpModeServer(httpPort, tunnelTarget, bridge, enCompress, deCompress, vkey)
+	case "webServer":
+		InitCsvDb()
+		return NewWebServer(bridge)
+	case "hostServer":
+		return NewHostServer()
+	case "httpHostServer":
+		return NewTunnelModeServer(httpPort, tunnelTarget, ProcessHost, bridge, enCompress, deCompress, vkey)
+	}
+	return nil
+}
+
+func StopServer(cFlag string) error {
+	if v, ok := RunList[cFlag]; ok {
+		reflect.ValueOf(v).MethodByName("Close").Call(nil)
+		delete(RunList, cFlag)
+		if t := bridge.signalList[getverifyval(cFlag)]; t != nil {
+			if *verifyKey == "" { //多客户端模式重启相关隧道
+				for {
+					if t.Len() <= 0 {
+						break
+					}
+					t.Pop().Close()
+				}
+				delete(bridge.signalList, getverifyval(cFlag))
+				delete(bridge.tunnelList, getverifyval(cFlag))
+			}
+		}
+		if t, err := CsvDb.GetTask(cFlag); err != nil {
+			return err
+		} else {
+			t.Start = 0
+			CsvDb.UpdateTask(t)
+		}
+		return nil
+	}
+	return errors.New("未在运行中")
+}
+
+func AddTask(t *TaskList) error {
+	de, en := getCompressType(t.Compress)
+	if svr := newMode(t.Mode, bridge, t.TcpPort, t.Target, t.U, t.P, en, de, t.VerifyKey); svr != nil {
+		RunList[t.VerifyKey] = svr
+		go func() {
+			err := reflect.ValueOf(svr).MethodByName("Start").Call(nil)[0]
+			if err.Interface() != nil {
+				log.Println("客户端", t.VerifyKey, "启动失败，错误：", err)
+				delete(RunList, t.VerifyKey)
+			}
+		}()
+	} else {
+		return errors.New("启动模式不正确")
+	}
+	return nil
+}
+
+func StartTask(vKey string) error {
+	if t, err := CsvDb.GetTask(vKey); err != nil {
+		return err
+	} else {
+		AddTask(t)
+		t.Start = 1
+		CsvDb.UpdateTask(t)
+	}
+	return nil
+}
+
+func DelTask(vKey string) error {
+	if err := StopServer(vKey); err != nil {
+		return err
+	}
+	return CsvDb.DelTask(vKey)
+}
+
+func InitCsvDb() *Csv {
+	var once sync.Once
+	once.Do(func() {
+		CsvDb = NewCsv("./conf/", bridge, RunList)
+		CsvDb.Init()
+	})
+	return CsvDb
+}

lib/server.go

@@ -0,0 +1,290 @@
+package lib
+
+import (
+	"errors"
+	"fmt"
+	"github.com/astaxie/beego"
+	"io/ioutil"
+	"log"
+	"net"
+	"net/http"
+	"strings"
+)
+
+const (
+	VERIFY_EER = "vkey"
+	WORK_MAIN  = "main"
+	WORK_CHAN  = "chan"
+	RES_SIGN   = "sign"
+	RES_MSG    = "msg0"
+	TEST_FLAG  = "tst"
+	CONN_TCP   = "tcp"
+	CONN_UDP   = "udp"
+)
+
+type HttpModeServer struct {
+	bridge     *Tunnel
+	httpPort   int
+	enCompress int
+	deCompress int
+	vKey       string
+}
+
+func NewHttpModeServer(httpPort int, bridge *Tunnel, enCompress int, deCompress int, vKey string) *HttpModeServer {
+	s := new(HttpModeServer)
+	s.bridge = bridge
+	s.httpPort = httpPort
+	s.enCompress = enCompress
+	s.deCompress = deCompress
+	s.vKey = vKey
+	return s
+}
+
+//开始
+func (s *HttpModeServer) Start() {
+	http.HandleFunc("/", func(w http.ResponseWriter, r *http.Request) {
+	retry:
+		err, conn := s.bridge.GetSignal(getverifyval(s.vKey))
+		if err != nil {
+			BadRequest(w)
+		}
+		if err := s.writeRequest(r, conn); err != nil {
+			log.Println(err)
+			conn.Close()
+			goto retry
+			return
+		}
+		err = s.writeResponse(w, conn)
+		if err != nil {
+			log.Println(err)
+			conn.Close()
+			goto retry
+			return
+		}
+		s.bridge.ReturnSignal(conn, getverifyval(s.vKey))
+	})
+	log.Fatalln(http.ListenAndServe(fmt.Sprintf(":%d", s.httpPort), nil))
+}
+
+//req转为bytes发送给client端
+func (s *HttpModeServer) writeRequest(r *http.Request, conn *Conn) error {
+	raw, err := EncodeRequest(r)
+	if err != nil {
+		return err
+	}
+	conn.wSign()
+	conn.WriteCompressType(s.enCompress, s.deCompress)
+	c, err := conn.WriteCompress(raw, s.enCompress)
+	if err != nil {
+		return err
+	}
+	if c != len(raw) {
+		return errors.New("写出长度与字节长度不一致。")
+	}
+	return nil
+}
+
+//从client读取出Response
+func (s *HttpModeServer) writeResponse(w http.ResponseWriter, c *Conn) error {
+	flags, err := c.ReadFlag()
+	if err != nil {
+		return err
+	}
+	switch flags {
+	case RES_SIGN:
+		buf := make([]byte, 1024*32)
+		n, err := c.ReadFromCompress(buf, s.deCompress)
+		if err != nil {
+			return err
+		}
+		resp, err := DecodeResponse(buf[:n])
+		if err != nil {
+			return err
+		}
+		bodyBytes, err := ioutil.ReadAll(resp.Body)
+		if err != nil {
+			return err
+		}
+		for k, v := range resp.Header {
+			for _, v2 := range v {
+				w.Header().Set(k, v2)
+			}
+		}
+		w.WriteHeader(resp.StatusCode)
+		w.Write(bodyBytes)
+	case RES_MSG:
+		BadRequest(w)
+		return errors.New("客户端请求出错")
+	default:
+		BadRequest(w)
+		return errors.New("无法解析此错误")
+	}
+	return nil
+}
+
+type process func(c *Conn, s *TunnelModeServer) error
+
+type TunnelModeServer struct {
+	httpPort     int
+	tunnelTarget string
+	process      process
+	bridge       *Tunnel
+	listener     *net.TCPListener
+	enCompress   int
+	deCompress   int
+	vKey         string
+}
+
+func NewTunnelModeServer(httpPort int, tunnelTarget string, process process, bridge *Tunnel, enCompress int, deCompress int, vKey string) *TunnelModeServer {
+	s := new(TunnelModeServer)
+	s.httpPort = httpPort
+	s.bridge = bridge
+	s.tunnelTarget = tunnelTarget
+	s.process = process
+	s.enCompress = enCompress
+	s.deCompress = deCompress
+	s.vKey = vKey
+	return s
+}
+
+//开始
+func (s *TunnelModeServer) Start() error {
+	s.listener, err = net.ListenTCP("tcp", &net.TCPAddr{net.ParseIP("0.0.0.0"), s.httpPort, ""})
+	if err != nil {
+		return err
+	}
+	for {
+		conn, err := s.listener.AcceptTCP()
+		if err != nil {
+			if strings.Contains(err.Error(), "use of closed network connection") {
+				break
+			}
+			log.Println(err)
+			continue
+		}
+		go s.process(NewConn(conn), s)
+	}
+	return nil
+}
+
+func (s *TunnelModeServer) Close() error {
+	return s.listener.Close()
+}
+
+//tcp隧道模式
+func ProcessTunnel(c *Conn, s *TunnelModeServer) error {
+	link := s.bridge.GetTunnel(getverifyval(s.vKey), s.enCompress, s.deCompress)
+	if _, err := link.WriteHost(CONN_TCP, s.tunnelTarget); err != nil {
+		link.Close()
+		c.Close()
+		log.Println(err)
+		return err
+	}
+	go relay(link, c, s.enCompress)
+	relay(c, link, s.deCompress)
+	return nil
+}
+
+//http代理模式
+func ProcessHttp(c *Conn, s *TunnelModeServer) error {
+	method, addr, rb, err := c.GetHost()
+	if err != nil {
+		c.Close()
+		return err
+	}
+	link := s.bridge.GetTunnel(getverifyval(s.vKey), s.enCompress, s.deCompress)
+	if _, err := link.WriteHost(CONN_TCP, addr); err != nil {
+		c.Close()
+		link.Close()
+		log.Println(err)
+		return err
+	}
+	if method == "CONNECT" {
+		fmt.Fprint(c, "HTTP/1.1 200 Connection established\r\n")
+	} else {
+		link.WriteCompress(rb, s.enCompress)
+	}
+	go relay(link, c, s.enCompress)
+	relay(c, link, s.deCompress)
+	return nil
+}
+
+//多客户端域名代理
+func ProcessHost(c *Conn, s *TunnelModeServer) error {
+	method, addr, rb, err := c.GetHost()
+	if err != nil {
+		c.Close()
+		return err
+	}
+	host, task, err := getKeyByHost(addr)
+	if err != nil {
+		c.Close()
+		return err
+	}
+	de, en := getCompressType(task.Compress)
+	link := s.bridge.GetTunnel(getverifyval(host.Vkey), en, de)
+	if _, err := link.WriteHost(CONN_TCP, host.Target); err != nil {
+		c.Close()
+		link.Close()
+		log.Println(err)
+		return err
+	}
+	if method == "CONNECT" {
+		fmt.Fprint(c, "HTTP/1.1 200 Connection established\r\n")
+	} else {
+		link.WriteCompress(rb, en)
+	}
+	go relay(link, c, en)
+	relay(c, link, de)
+	return nil
+}
+
+//web管理方式
+type WebServer struct {
+	bridge *Tunnel
+}
+
+//开始
+func (s *WebServer) Start() {
+	InitFromCsv()
+	p, _ := beego.AppConfig.Int("hostPort")
+	t := &TaskList{
+		TcpPort:      p,
+		Mode:         "httpHostServer",
+		Target:       "",
+		VerifyKey:    "",
+		U:            "",
+		P:            "",
+		Compress:     "",
+		Start:        1,
+		IsRun:        0,
+		ClientStatus: 0,
+	}
+	AddTask(t)
+	beego.BConfig.WebConfig.Session.SessionOn = true
+	log.Println("web管理启动，访问端口为",beego.AppConfig.String("httpport"))
+	beego.Run()
+}
+
+func NewWebServer(bridge *Tunnel) *WebServer {
+	s := new(WebServer)
+	s.bridge = bridge
+	return s
+}
+
+//host
+type HostServer struct {
+}
+
+//开始
+func (s *HostServer) Start() error {
+	return nil
+}
+func NewHostServer() *HostServer {
+	s := new(HostServer)
+	return s
+}
+
+func (s *HostServer) Close() error {
+	return nil
+}

sock5.go → lib/sock5.go

@@ -1,4 +1,4 @@
-package main
+package lib
 
 import (
 	"encoding/binary"
@@ -7,6 +7,7 @@ import (
 	"log"
 	"net"
 	"strconv"
+	"strings"
 )
 
 const (
@@ -43,11 +44,15 @@ const (
 )
 
 type Sock5ModeServer struct {
-	Tunnel
-	httpPort int
-	u        string //用户名
-	p        string //密码
-	isVerify bool
+	bridge     *Tunnel
+	httpPort   int
+	u          string //用户名
+	p          string //密码
+	enCompress int
+	deCompress int
+	isVerify   bool
+	listener   net.Listener
+	vKey       string
 }
 
 func (s *Sock5ModeServer) handleRequest(c net.Conn) {
@@ -131,7 +136,7 @@ func (s *Sock5ModeServer) doConnect(c net.Conn, command uint8) (proxyConn *Conn,
 	binary.Read(c, binary.BigEndian, &port)
 	// connect to host
 	addr := net.JoinHostPort(host, strconv.Itoa(int(port)))
-	client := s.GetTunnel()
+	client := s.bridge.GetTunnel(getverifyval(s.vKey),s.enCompress,s.deCompress)
 	s.sendReply(c, succeeded)
 	var ltype string
 	if command == associateMethod {
@@ -149,8 +154,8 @@ func (s *Sock5ModeServer) handleConnect(c net.Conn) {
 		log.Println(err)
 		c.Close()
 	} else {
-		go relay(proxyConn, NewConn(c), DataEncode)
-		go relay(NewConn(c), proxyConn, DataDecode)
+		go relay(proxyConn, NewConn(c), s.enCompress)
+		go relay(NewConn(c), proxyConn, s.deCompress)
 	}
 
 }
@@ -182,8 +187,8 @@ func (s *Sock5ModeServer) handleUDP(c net.Conn) {
 	if err != nil {
 		c.Close()
 	} else {
-		go relay(proxyConn, NewConn(c), DataEncode)
-		go relay(NewConn(c), proxyConn, DataDecode)
+		go relay(proxyConn, NewConn(c), s.enCompress)
+		go relay(NewConn(c), proxyConn, s.deCompress)
 	}
 }
 
@@ -258,27 +263,32 @@ func (s *Sock5ModeServer) Auth(c net.Conn) error {
 	return errors.New("未知错误")
 }
 
-func (s *Sock5ModeServer) Start() {
-	l, err := net.Listen("tcp", ":"+strconv.Itoa(s.httpPort))
+func (s *Sock5ModeServer) Start() error {
+	s.listener, err = net.Listen("tcp", ":"+strconv.Itoa(s.httpPort))
 	if err != nil {
-		log.Fatal("listen error: ", err)
+		return err
 	}
-	s.StartTunnel()
 	for {
-		conn, err := l.Accept()
+		conn, err := s.listener.Accept()
 		if err != nil {
+			if strings.Contains(err.Error(), "use of closed network connection") {
+				break
+			}
 			log.Fatal("accept error: ", err)
 		}
 		go s.handleNewConn(conn)
 	}
+	return nil
+}
+
+func (s *Sock5ModeServer) Close() error {
+	return s.listener.Close()
 }
 
-func NewSock5ModeServer(tcpPort, httpPort int, u, p string) *Sock5ModeServer {
+func NewSock5ModeServer(httpPort int, u, p string, brige *Tunnel, enCompress int, deCompress int, vKey string) *Sock5ModeServer {
 	s := new(Sock5ModeServer)
-	s.tunnelPort = tcpPort
 	s.httpPort = httpPort
-	s.tunnelList = make(chan *Conn, 1000)
-	s.signalList = make(chan *Conn, 10)
+	s.bridge = brige
 	if u != "" && p != "" {
 		s.isVerify = true
 		s.u = u
@@ -286,5 +296,8 @@ func NewSock5ModeServer(tcpPort, httpPort int, u, p string) *Sock5ModeServer {
 	} else {
 		s.isVerify = false
 	}
+	s.enCompress = enCompress
+	s.deCompress = deCompress
+	s.vKey = vKey
 	return s
 }

lib/tunnel.go

@@ -0,0 +1,184 @@
+package lib
+
+import (
+	"errors"
+	"log"
+	"net"
+	"sync"
+	"time"
+)
+
+type list struct {
+	connList chan *Conn
+}
+
+func (l *list) Add(c *Conn) {
+	l.connList <- c
+}
+
+func (l *list) Pop() *Conn {
+	return <-l.connList
+}
+func (l *list) Len() int {
+	return len(l.connList)
+}
+
+func newList() *list {
+	l := new(list)
+	l.connList = make(chan *Conn, 100)
+	return l
+}
+
+type Tunnel struct {
+	tunnelPort int              //通信隧道端口
+	listener   *net.TCPListener //server端监听
+	signalList map[string]*list //通信
+	tunnelList map[string]*list //隧道
+	sync.Mutex
+}
+
+func newTunnel(tunnelPort int) *Tunnel {
+	t := new(Tunnel)
+	t.tunnelPort = tunnelPort
+	t.signalList = make(map[string]*list)
+	t.tunnelList = make(map[string]*list)
+	return t
+}
+
+func (s *Tunnel) StartTunnel() error {
+	var err error
+	s.listener, err = net.ListenTCP("tcp", &net.TCPAddr{net.ParseIP("0.0.0.0"), s.tunnelPort, ""})
+	if err != nil {
+		return err
+	}
+	go s.tunnelProcess()
+	return nil
+}
+
+//tcp server
+func (s *Tunnel) tunnelProcess() error {
+	var err error
+	for {
+		conn, err := s.listener.Accept()
+		if err != nil {
+			log.Println(err)
+			continue
+		}
+		go s.cliProcess(NewConn(conn))
+	}
+	return err
+}
+
+//验证失败，返回错误验证flag，并且关闭连接
+func (s *Tunnel) verifyError(c *Conn) {
+	c.conn.Write([]byte(VERIFY_EER))
+	c.conn.Close()
+}
+
+func (s *Tunnel) cliProcess(c *Conn) error {
+	c.conn.(*net.TCPConn).SetReadDeadline(time.Now().Add(time.Duration(5) * time.Second))
+	vval := make([]byte, 32)
+	if _, err := c.conn.Read(vval); err != nil {
+		log.Println("客户端读超时。客户端地址为：:", c.conn.RemoteAddr())
+		c.conn.Close()
+		return err
+	}
+	//TODO:暂时取消
+	if !verify(string(vval)) {
+		log.Println("当前客户端连接校验错误，关闭此客户端:", c.conn.RemoteAddr())
+		s.verifyError(c)
+		return err
+	}
+	c.conn.(*net.TCPConn).SetReadDeadline(time.Time{})
+	//做一个判断 添加到对应的channel里面以供使用
+	if flag, err := c.ReadFlag(); err != nil {
+		return err
+	} else {
+		return s.typeDeal(flag, c, string(vval))
+	}
+}
+
+//tcp连接类型区分
+func (s *Tunnel) typeDeal(typeVal string, c *Conn, cFlag string) error {
+	switch typeVal {
+	case WORK_MAIN:
+		s.addList(s.signalList, c, cFlag)
+	case WORK_CHAN:
+		s.addList(s.tunnelList, c, cFlag)
+	default:
+		return errors.New("无法识别")
+	}
+	c.SetAlive()
+	return nil
+}
+
+//加到对应的list中
+func (s *Tunnel) addList(m map[string]*list, c *Conn, cFlag string) {
+	s.Lock()
+	if v, ok := m[cFlag]; ok {
+		v.Add(c)
+	} else {
+		l := newList()
+		l.Add(c)
+		m[cFlag] = l
+	}
+	s.Unlock()
+}
+
+//新建隧道
+func (s *Tunnel) newChan(cFlag string) {
+	s.wait(s.signalList, cFlag)
+retry:
+	connPass := s.signalList[cFlag].Pop()
+	_, err := connPass.conn.Write([]byte("chan"))
+	if err != nil {
+		log.Println(err)
+		goto retry
+	}
+	s.signalList[cFlag].Add(connPass)
+}
+
+//得到一个tcp隧道
+func (s *Tunnel) GetTunnel(cFlag string, en, de int) *Conn {
+	if v, ok := s.tunnelList[cFlag]; !ok || v.Len() < 10 { //新建通道
+		go s.newChan(cFlag)
+	}
+retry:
+	s.wait(s.tunnelList, cFlag)
+	c := s.tunnelList[cFlag].Pop()
+	if _, err := c.wTest(); err != nil {
+		c.Close()
+		goto retry
+	}
+	c.WriteCompressType(en, de)
+	return c
+}
+
+//得到一个通信通道
+func (s *Tunnel) GetSignal(cFlag string) (err error, conn *Conn) {
+	if v, ok := s.signalList[cFlag]; !ok || v.Len() == 0 {
+		err = errors.New("客户端未连接")
+		return
+	}
+	conn = s.signalList[cFlag].Pop()
+	return
+}
+
+//重回slice 复用
+func (s *Tunnel) ReturnSignal(conn *Conn, cFlag string) {
+	if v, ok := s.signalList[cFlag]; ok {
+		v.Add(conn)
+	}
+}
+
+//等待
+func (s *Tunnel) wait(m map[string]*list, cFlag string) {
+	ticker := time.NewTicker(time.Millisecond * 100)
+	for {
+		<-ticker.C
+		if _, ok := m[cFlag]; ok {
+			ticker.Stop()
+			break
+		}
+	}
+}

lib/udp.go

@@ -0,0 +1,81 @@
+package lib
+
+import (
+	"fmt"
+	"io"
+	"log"
+	"net"
+	"strings"
+	"time"
+)
+
+type UdpModeServer struct {
+	bridge       *Tunnel
+	udpPort      int    //监听的udp端口
+	tunnelTarget string //udp目标地址
+	listener     *net.UDPConn
+	udpMap       map[string]*Conn
+	enCompress   int
+	deCompress   int
+	vKey         string
+}
+
+func NewUdpModeServer(udpPort int, tunnelTarget string, bridge *Tunnel, enCompress int, deCompress int, vKey string) *UdpModeServer {
+	s := new(UdpModeServer)
+	s.udpPort = udpPort
+	s.tunnelTarget = tunnelTarget
+	s.bridge = bridge
+	s.udpMap = make(map[string]*Conn)
+	s.enCompress = enCompress
+	s.deCompress = deCompress
+	s.vKey = vKey
+	return s
+}
+
+//开始
+func (s *UdpModeServer) Start() error {
+	s.listener, err = net.ListenUDP("udp", &net.UDPAddr{net.ParseIP("0.0.0.0"), s.udpPort, ""})
+	if err != nil {
+		return err
+	}
+	data := make([]byte, 1472) //udp数据包大小
+	for {
+		n, addr, err := s.listener.ReadFromUDP(data)
+		if err != nil {
+			if strings.Contains(err.Error(), "use of closed network connection") {
+				break
+			}
+			log.Println(err)
+			continue
+		}
+		go s.process(addr, data[:n])
+	}
+	return nil
+}
+
+//TODO:效率问题有待解决
+func (s *UdpModeServer) process(addr *net.UDPAddr, data []byte) {
+	fmt.Println(addr.String())
+	fmt.Println(string(data))
+	conn := s.bridge.GetTunnel(getverifyval(s.vKey),s.enCompress,s.deCompress)
+	if _, err := conn.WriteHost(CONN_UDP, s.tunnelTarget); err != nil {
+		conn.Close()
+		return
+	}
+	conn.WriteCompress(data, s.enCompress)
+	go func(addr *net.UDPAddr, conn *Conn) {
+		buf := make([]byte, 1024)
+		conn.conn.SetReadDeadline(time.Now().Add(time.Duration(time.Second * 3)))
+		n, err := conn.ReadFromCompress(buf, s.deCompress)
+		if err != nil || err == io.EOF {
+			conn.Close()
+			return
+		}
+		s.listener.WriteToUDP(buf[:n], addr)
+		conn.Close()
+	}(addr, conn)
+}
+
+func (s *UdpModeServer) Close() error {
+	return s.listener.Close()
+}

util.go → lib/util.go

@@ -1,20 +1,27 @@
-package main
+package lib
 
 import (
 	"bufio"
 	"bytes"
 	"compress/gzip"
+	"crypto/md5"
 	"encoding/binary"
+	"encoding/hex"
+	"encoding/json"
 	"errors"
 	"fmt"
-	"github.com/golang/snappy"
 	"io"
+	"io/ioutil"
 	"log"
+	"math/rand"
+	"net"
 	"net/http"
 	"net/http/httputil"
 	"net/url"
+	"regexp"
 	"strconv"
 	"strings"
+	"time"
 )
 
 var (
@@ -130,6 +137,7 @@ func relay(in, out *Conn, compressType int) {
 	buf := make([]byte, 32*1024)
 	switch compressType {
 	case COMPRESS_GZIP_ENCODE:
+		//TODO:GZIP压缩存在问题有待解决
 		w := gzip.NewWriter(in)
 		for {
 			n, err := out.Read(buf)
@@ -146,32 +154,140 @@ func relay(in, out *Conn, compressType int) {
 		}
 		w.Close()
 	case COMPRESS_SNAPY_ENCODE:
-		w := snappy.NewBufferedWriter(in)
-		for {
-			n, err := out.Read(buf)
-			if err != nil || err == io.EOF {
-				break
-			}
-			if _, err = w.Write(buf[:n]); err != nil {
-				break
-			}
-			if err = w.Flush(); err != nil {
-				log.Println(err)
-				break
-			}
-		}
-		w.Close()
+		io.Copy(NewSnappyConn(in.conn), out)
 	case COMPRESS_GZIP_DECODE:
-		r, err := gzip.NewReader(out)
-		if err != nil {
-			return
-		}
-		io.Copy(in, r)
+		io.Copy(in, NewGzipConn(out.conn))
 	case COMPRESS_SNAPY_DECODE:
-		r := snappy.NewReader(out)
-		io.Copy(in, r)
+		io.Copy(in, NewSnappyConn(out.conn))
 	default:
 		io.Copy(in, out)
 	}
 	out.Close()
+	in.Close()
+}
+
+type Site struct {
+	Host string
+	Url  string
+	Port int
+}
+type Config struct {
+	SiteList []Site
+	Replace  int
+}
+type JsonStruct struct {
+}
+
+func NewJsonStruct() *JsonStruct {
+	return &JsonStruct{}
+}
+func (jst *JsonStruct) Load(filename string) (Config, error) {
+	data, err := ioutil.ReadFile(filename)
+	config := Config{}
+	if err != nil {
+		return config, errors.New("配置文件打开错误")
+	}
+	err = json.Unmarshal(data, &config)
+	if err != nil {
+		return config, errors.New("配置文件解析错误")
+	}
+	return config, nil
+}
+
+//判断压缩方式
+func getCompressType(compress string) (int, int) {
+	switch compress {
+	case "":
+		return COMPRESS_NONE, COMPRESS_NONE
+	case "gzip":
+		return COMPRESS_GZIP_DECODE, COMPRESS_GZIP_ENCODE
+	case "snappy":
+		return COMPRESS_SNAPY_DECODE, COMPRESS_SNAPY_ENCODE
+	default:
+		log.Fatalln("数据压缩格式错误")
+	}
+	return COMPRESS_NONE, COMPRESS_NONE
+}
+
+// 简单的一个校验值
+func getverifyval(vkey string) string {
+	//单客户端模式
+	if *verifyKey != "" {
+		return Md5(*verifyKey)
+	}
+	return Md5(vkey)
+}
+
+func verify(verifyKeyMd5 string) bool {
+	if getverifyval(*verifyKey) == verifyKeyMd5 {
+		return true
+	}
+	if *verifyKey == "" {
+		for _, v := range CsvDb.Tasks {
+			if _, ok := RunList[v.VerifyKey]; getverifyval(v.VerifyKey) == verifyKeyMd5 && ok {
+				return true
+			}
+		}
+	}
+	return false
+}
+
+func getKeyByHost(host string) (h *HostList, t *TaskList, err error) {
+	for _, v := range CsvDb.Hosts {
+		if strings.Contains(host, v.Host) {
+			h = v
+			t, err = CsvDb.GetTask(v.Vkey)
+			if err != nil {
+				return
+			}
+			return
+		}
+	}
+	err = errors.New("未找到host对应的内网目标")
+	return
+}
+
+//生成32位md5字串
+func Md5(s string) string {
+	h := md5.New()
+	h.Write([]byte(s))
+	return hex.EncodeToString(h.Sum(nil))
+}
+
+//生成随机验证密钥
+func GetRandomString(l int) string {
+	str := "0123456789abcdefghijklmnopqrstuvwxyz"
+	bytes := []byte(str)
+	result := []byte{}
+	r := rand.New(rand.NewSource(time.Now().UnixNano()))
+	for i := 0; i < l; i++ {
+		result = append(result, bytes[r.Intn(len(bytes))])
+	}
+	return string(result)
+}
+
+func Gethostbyname(hostname string) string {
+	if !DomainCheck(hostname) {
+		return hostname
+	}
+	ips, _ := net.LookupIP(hostname)
+	if ips != nil {
+		for _, v := range ips {
+			if v.To4() != nil {
+				return v.String()
+			}
+		}
+	}
+	return ""
+}
+
+func DomainCheck(domain string) bool {
+	var match bool
+	IsLine := "^((http://)|(https://))?([a-zA-Z0-9]([a-zA-Z0-9\\-]{0,61}[a-zA-Z0-9])?\\.)+[a-zA-Z]{2,6}(/)"
+	NotLine := "^((http://)|(https://))?([a-zA-Z0-9]([a-zA-Z0-9\\-]{0,61}[a-zA-Z0-9])?\\.)+[a-zA-Z]{2,6}"
+	match, _ = regexp.MatchString(IsLine, domain)
+	if !match {
+		match, _ = regexp.MatchString(NotLine, domain)
+	}
+	return match
 }

main.go

@@ -1,81 +1,10 @@
 package main
 
 import (
-	"flag"
-	"fmt"
-	"log"
-)
-
-var (
-	configPath   = flag.String("config", "config.json", "配置文件路径")
-	tcpPort      = flag.Int("tcpport", 8284, "Socket连接或者监听的端口")
-	httpPort     = flag.Int("httpport", 8024, "当mode为server时为服务端监听端口，当为mode为client时为转发至本地客户端的端口")
-	rpMode       = flag.String("mode", "client", "启动模式，可选为client|server")
-	tunnelTarget = flag.String("target", "10.1.50.203:80", "远程目标")
-	verifyKey    = flag.String("vkey", "", "验证密钥")
-	u            = flag.String("u", "", "socks5验证用户名")
-	p            = flag.String("p", "", "socks5验证密码")
-	compress     = flag.String("compress", "", "数据压缩（gzip|snappy）")
-	config       Config
-	err          error
-	DataEncode   int
-	DataDecode   int
+	"github.com/cnlh/easyProxy/lib"
+	_ "github.com/cnlh/easyProxy/routers"
 )
 
 func main() {
-	flag.Parse()
-	log.SetFlags(log.Ldate | log.Ltime | log.Lshortfile)
-	switch *compress {
-	case "":
-		DataDecode = COMPRESS_NONE
-		DataEncode = COMPRESS_NONE
-	case "gzip":
-		DataDecode = COMPRESS_GZIP_DECODE
-		DataEncode = COMPRESS_GZIP_ENCODE
-	case "snnapy":
-		DataDecode = COMPRESS_SNAPY_DECODE
-		DataEncode = COMPRESS_SNAPY_ENCODE
-	default:
-		log.Fatalln("数据压缩格式错误")
-	}
-	if *rpMode == "client" {
-		JsonParse := NewJsonStruct()
-		config, err = JsonParse.Load(*configPath)
-		if err != nil {
-			log.Fatalln(err)
-		}
-		*verifyKey = config.Server.Vkey
-		log.Println("客户端启动，连接：", config.Server.Ip, "， 端口：", config.Server.Tcp)
-		cli := NewRPClient(fmt.Sprintf("%s:%d", config.Server.Ip, config.Server.Tcp), config.Server.Num)
-		cli.Start()
-	} else {
-		if *verifyKey == "" {
-			log.Fatalln("必须输入一个验证的key")
-		}
-		if *tcpPort <= 0 || *tcpPort >= 65536 {
-			log.Fatalln("请输入正确的tcp端口。")
-		}
-		if *httpPort <= 0 || *httpPort >= 65536 {
-			log.Fatalln("请输入正确的http端口。")
-		}
-		log.Println("服务端启动，监听tcp服务端端口：", *tcpPort, "， 外部服务端端口：", *httpPort)
-		if *rpMode == "httpServer" {
-			svr := NewHttpModeServer(*tcpPort, *httpPort)
-			if err := svr.Start(); err != nil {
-				log.Fatalln(err)
-			}
-		} else if *rpMode == "tunnelServer" {
-			svr := NewTunnelModeServer(*tcpPort, *httpPort, *tunnelTarget, ProcessTunnel)
-			svr.Start()
-		} else if *rpMode == "sock5Server" {
-			svr := NewSock5ModeServer(*tcpPort, *httpPort, *u, *p)
-			svr.Start()
-		} else if *rpMode == "httpProxyServer" {
-			svr := NewTunnelModeServer(*tcpPort, *httpPort, *tunnelTarget, ProcessHttp)
-			svr.Start()
-		} else if *rpMode == "udpServer" {
-			svr := NewUdpModeServer(*tcpPort, *httpPort, *tunnelTarget)
-			svr.Start()
-		}
-	}
+	lib.InitMode()
 }

routers/router.go

@@ -0,0 +1,12 @@
+package routers
+
+import (
+	"github.com/astaxie/beego"
+	"github.com/cnlh/easyProxy/controllers"
+)
+
+func init() {
+	beego.Router("/", &controllers.IndexController{}, "*:Index")
+	beego.AutoRouter(&controllers.IndexController{})
+	beego.AutoRouter(&controllers.LoginController{})
+}

server.go

@@ -1,212 +0,0 @@
-package main
-
-import (
-	"errors"
-	"fmt"
-	"io/ioutil"
-	"log"
-	"net"
-	"net/http"
-)
-
-const (
-	VERIFY_EER = "vkey"
-	WORK_MAIN  = "main"
-	WORK_CHAN  = "chan"
-	RES_SIGN   = "sign"
-	RES_MSG    = "msg0"
-	TEST_FLAG  = "tst"
-	CONN_TCP   = "tcp"
-	CONN_UDP   = "udp"
-)
-
-type HttpModeServer struct {
-	Tunnel
-	httpPort int
-}
-
-func NewHttpModeServer(tcpPort, httpPort int) *HttpModeServer {
-	s := new(HttpModeServer)
-	s.tunnelPort = tcpPort
-	s.httpPort = httpPort
-	s.signalList = make(chan *Conn, 1000)
-	return s
-}
-
-//开始
-func (s *HttpModeServer) Start() (error) {
-	err := s.StartTunnel()
-	if err != nil {
-		log.Fatalln("开启客户端失败!", err)
-		return err
-	}
-	s.startHttpServer()
-	return nil
-}
-
-//开启http端口监听
-func (s *HttpModeServer) startHttpServer() {
-	http.HandleFunc("/", func(w http.ResponseWriter, r *http.Request) {
-	retry:
-		if len(s.signalList) == 0 {
-			BadRequest(w)
-			return
-		}
-		conn := <-s.signalList
-		if err := s.writeRequest(r, conn); err != nil {
-			log.Println(err)
-			conn.Close()
-			goto retry
-			return
-		}
-		err = s.writeResponse(w, conn)
-		if err != nil {
-			log.Println(err)
-			conn.Close()
-			goto retry
-			return
-		}
-		s.signalList <- conn
-	})
-	log.Fatalln(http.ListenAndServe(fmt.Sprintf(":%d", s.httpPort), nil))
-}
-
-//req转为bytes发送给client端
-func (s *HttpModeServer) writeRequest(r *http.Request, conn *Conn) error {
-	raw, err := EncodeRequest(r)
-	if err != nil {
-		return err
-	}
-	conn.wSign()
-	c, err := conn.WriteCompress(raw, DataEncode)
-	if err != nil {
-		return err
-	}
-	if c != len(raw) {
-		return errors.New("写出长度与字节长度不一致。")
-	}
-	return nil
-}
-
-//从client读取出Response
-func (s *HttpModeServer) writeResponse(w http.ResponseWriter, c *Conn) error {
-	flags, err := c.ReadFlag()
-	if err != nil {
-		return err
-	}
-	switch flags {
-	case RES_SIGN:
-		buf := make([]byte, 1024*32)
-		n, err := c.ReadFromCompress(buf, DataDecode)
-		if err != nil {
-			return err
-		}
-		resp, err := DecodeResponse(buf[:n])
-		if err != nil {
-			return err
-		}
-		bodyBytes, err := ioutil.ReadAll(resp.Body)
-		if err != nil {
-			return err
-		}
-		for k, v := range resp.Header {
-			for _, v2 := range v {
-				w.Header().Set(k, v2)
-			}
-		}
-		w.WriteHeader(resp.StatusCode)
-		w.Write(bodyBytes)
-	case RES_MSG:
-		BadRequest(w)
-		return errors.New("客户端请求出错")
-	default:
-		BadRequest(w)
-		return errors.New("无法解析此错误")
-	}
-	return nil
-}
-
-type process func(c *Conn, s *TunnelModeServer) error
-type TunnelModeServer struct {
-	Tunnel
-	httpPort     int
-	tunnelTarget string
-	process      process
-}
-
-func NewTunnelModeServer(tcpPort, httpPort int, tunnelTarget string, process process) *TunnelModeServer {
-	s := new(TunnelModeServer)
-	s.tunnelPort = tcpPort
-	s.httpPort = httpPort
-	s.tunnelTarget = tunnelTarget
-	s.tunnelList = make(chan *Conn, 1000)
-	s.signalList = make(chan *Conn, 10)
-	s.process = process
-	return s
-}
-
-//开始
-func (s *TunnelModeServer) Start() (error) {
-	err := s.StartTunnel()
-	if err != nil {
-		log.Fatalln("开启客户端失败!", err)
-		return err
-	}
-	s.startTunnelServer()
-	return nil
-}
-
-//隧道模式server
-func (s *TunnelModeServer) startTunnelServer() {
-	listener, err := net.ListenTCP("tcp", &net.TCPAddr{net.ParseIP("0.0.0.0"), s.httpPort, ""})
-	if err != nil {
-		log.Fatalln(err)
-	}
-	for {
-		conn, err := listener.AcceptTCP()
-		if err != nil {
-			log.Println(err)
-			continue
-		}
-		go s.process(NewConn(conn), s)
-	}
-}
-
-//TODO：这种实现方式……
-//tcp隧道模式
-func ProcessTunnel(c *Conn, s *TunnelModeServer) error {
-	link := s.GetTunnel()
-	if _, err := link.WriteHost(CONN_TCP, s.tunnelTarget); err != nil {
-		link.Close()
-		c.Close()
-		log.Println(err)
-		return err
-	}
-	go relay(link, c, DataEncode)
-	relay(c, link, DataDecode)
-	return nil
-}
-
-//http代理模式
-func ProcessHttp(c *Conn, s *TunnelModeServer) error {
-	method, addr, rb, err := c.GetHost()
-	if err != nil {
-		c.Close()
-		return err
-	}
-	link := s.GetTunnel()
-	if _, err := link.WriteHost("tcp", addr); err != nil {
-		c.Close()
-		link.Close()
-		log.Println(err)
-		return err
-	}
-	if method == "CONNECT" {
-		fmt.Fprint(c, "HTTP/1.1 200 Connection established\r\n")
-	} else {
-		link.WriteCompress(rb, DataEncode)
-	}
-	go relay(link, c, DataEncode)
-	relay(c, link, DataDecode)
-	return nil
-}

static/css/main.css

@@ -0,0 +1,15240 @@
+@charset "UTF-8";
+/*!
+ * Vali Admin
+ * Author: Pratik Borsadiya
+ * ================================*/
+@import url(https://fonts.googleapis.com/css?family=Lato:300,400,400i,700);
+@import url(https://fonts.googleapis.com/css?family=Niconne);
+/*!
+ * Bootstrap v4.1.1 (https://getbootstrap.com/)
+ * Copyright 2011-2018 The Bootstrap Authors
+ * Copyright 2011-2018 Twitter, Inc.
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
+ */
+:root {
+  --blue: #007bff;
+  --indigo: #6610f2;
+  --purple: #6f42c1;
+  --pink: #e83e8c;
+  --red: #dc3545;
+  --orange: #fd7e14;
+  --yellow: #ffc107;
+  --green: #28a745;
+  --teal: #20c997;
+  --cyan: #17a2b8;
+  --white: #FFF;
+  --gray: #6c757d;
+  --gray-dark: #343a40;
+  --primary: #009688;
+  --secondary: #6c757d;
+  --success: #28a745;
+  --info: #17a2b8;
+  --warning: #ffc107;
+  --danger: #dc3545;
+  --light: #f8f9fa;
+  --dark: #343a40;
+  --breakpoint-xs: 0;
+  --breakpoint-sm: 576px;
+  --breakpoint-md: 768px;
+  --breakpoint-lg: 992px;
+  --breakpoint-xl: 1200px;
+  --font-family-sans-serif: "Lato", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif;
+  --font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+}
+
+*,
+*::before,
+*::after {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+}
+
+html {
+  font-family: sans-serif;
+  line-height: 1.15;
+  -webkit-text-size-adjust: 100%;
+  -ms-text-size-adjust: 100%;
+  -ms-overflow-style: scrollbar;
+  -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+
+@-ms-viewport {
+  width: device-width;
+}
+
+article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
+  display: block;
+}
+
+body {
+  margin: 0;
+  font-family: "Lato", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif;
+  font-size: 0.875rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #212529;
+  text-align: left;
+  background-color: #FFF;
+}
+
+[tabindex="-1"]:focus {
+  outline: 0 !important;
+}
+
+hr {
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+  height: 0;
+  overflow: visible;
+}
+
+h1, h2, h3, h4, h5, h6 {
+  margin-top: 0;
+  margin-bottom: 0.5rem;
+}
+
+p {
+  margin-top: 0;
+  margin-bottom: 1rem;
+}
+
+abbr[title],
+abbr[data-original-title] {
+  text-decoration: underline;
+  -webkit-text-decoration: underline dotted;
+          text-decoration: underline dotted;
+  cursor: help;
+  border-bottom: 0;
+}
+
+address {
+  margin-bottom: 1rem;
+  font-style: normal;
+  line-height: inherit;
+}
+
+ol,
+ul,
+dl {
+  margin-top: 0;
+  margin-bottom: 1rem;
+}
+
+ol ol,
+ul ul,
+ol ul,
+ul ol {
+  margin-bottom: 0;
+}
+
+dt {
+  font-weight: 700;
+}
+
+dd {
+  margin-bottom: .5rem;
+  margin-left: 0;
+}
+
+blockquote {
+  margin: 0 0 1rem;
+}
+
+dfn {
+  font-style: italic;
+}
+
+b,
+strong {
+  font-weight: bolder;
+}
+
+small {
+  font-size: 80%;
+}
+
+sub,
+sup {
+  position: relative;
+  font-size: 75%;
+  line-height: 0;
+  vertical-align: baseline;
+}
+
+sub {
+  bottom: -.25em;
+}
+
+sup {
+  top: -.5em;
+}
+
+a {
+  color: #009688;
+  text-decoration: none;
+  background-color: transparent;
+  -webkit-text-decoration-skip: objects;
+}
+
+a:hover {
+  color: #004a43;
+  text-decoration: underline;
+}
+
+a:not([href]):not([tabindex]) {
+  color: inherit;
+  text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus {
+  color: inherit;
+  text-decoration: none;
+}
+
+a:not([href]):not([tabindex]):focus {
+  outline: 0;
+}
+
+pre,
+code,
+kbd,
+samp {
+  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+  font-size: 1em;
+}
+
+pre {
+  margin-top: 0;
+  margin-bottom: 1rem;
+  overflow: auto;
+  -ms-overflow-style: scrollbar;
+}
+
+figure {
+  margin: 0 0 1rem;
+}
+
+img {
+  vertical-align: middle;
+  border-style: none;
+}
+
+svg:not(:root) {
+  overflow: hidden;
+}
+
+table {
+  border-collapse: collapse;
+}
+
+caption {
+  padding-top: 0.75rem;
+  padding-bottom: 0.75rem;
+  color: #6c757d;
+  text-align: left;
+  caption-side: bottom;
+}
+
+th {
+  text-align: inherit;
+}
+
+label {
+  display: inline-block;
+  margin-bottom: 0.5rem;
+}
+
+button {
+  border-radius: 0;
+}
+
+button:focus {
+  outline: 1px dotted;
+  outline: 5px auto -webkit-focus-ring-color;
+}
+
+input,
+button,
+select,
+optgroup,
+textarea {
+  margin: 0;
+  font-family: inherit;
+  font-size: inherit;
+  line-height: inherit;
+}
+
+button,
+input {
+  overflow: visible;
+}
+
+button,
+select {
+  text-transform: none;
+}
+
+button,
+html [type="button"],
+[type="reset"],
+[type="submit"] {
+  -webkit-appearance: button;
+}
+
+button::-moz-focus-inner,
+[type="button"]::-moz-focus-inner,
+[type="reset"]::-moz-focus-inner,
+[type="submit"]::-moz-focus-inner {
+  padding: 0;
+  border-style: none;
+}
+
+input[type="radio"],
+input[type="checkbox"] {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  padding: 0;
+}
+
+input[type="date"],
+input[type="time"],
+input[type="datetime-local"],
+input[type="month"] {
+  -webkit-appearance: listbox;
+}
+
+textarea {
+  overflow: auto;
+  resize: vertical;
+}
+
+fieldset {
+  min-width: 0;
+  padding: 0;
+  margin: 0;
+  border: 0;
+}
+
+legend {
+  display: block;
+  width: 100%;
+  max-width: 100%;
+  padding: 0;
+  margin-bottom: .5rem;
+  font-size: 1.5rem;
+  line-height: inherit;
+  color: inherit;
+  white-space: normal;
+}
+
+progress {
+  vertical-align: baseline;
+}
+
+[type="number"]::-webkit-inner-spin-button,
+[type="number"]::-webkit-outer-spin-button {
+  height: auto;
+}
+
+[type="search"] {
+  outline-offset: -2px;
+  -webkit-appearance: none;
+}
+
+[type="search"]::-webkit-search-cancel-button,
+[type="search"]::-webkit-search-decoration {
+  -webkit-appearance: none;
+}
+
+::-webkit-file-upload-button {
+  font: inherit;
+  -webkit-appearance: button;
+}
+
+output {
+  display: inline-block;
+}
+
+summary {
+  display: list-item;
+  cursor: pointer;
+}
+
+template {
+  display: none;
+}
+
+[hidden] {
+  display: none !important;
+}
+
+h1, h2, h3, h4, h5, h6,
+.h1, .h2, .h3, .h4, .h5, .h6 {
+  margin-bottom: 0.5rem;
+  font-family: inherit;
+  font-weight: bold;
+  line-height: 1.2;
+  color: inherit;
+}
+
+h1, .h1 {
+  font-size: 2.1875rem;
+}
+
+h2, .h2 {
+  font-size: 1.75rem;
+}
+
+h3, .h3 {
+  font-size: 1.53125rem;
+}
+
+h4, .h4 {
+  font-size: 1.3125rem;
+}
+
+h5, .h5 {
+  font-size: 1.09375rem;
+}
+
+h6, .h6 {
+  font-size: 0.875rem;
+}
+
+.lead {
+  font-size: 1.09375rem;
+  font-weight: 300;
+}
+
+.display-1 {
+  font-size: 6rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+.display-2 {
+  font-size: 5.5rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+.display-3 {
+  font-size: 4.5rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+.display-4 {
+  font-size: 3.5rem;
+  font-weight: 300;
+  line-height: 1.2;
+}
+
+hr {
+  margin-top: 1rem;
+  margin-bottom: 1rem;
+  border: 0;
+  border-top: 1px solid rgba(0, 0, 0, 0.1);
+}
+
+small,
+.small {
+  font-size: 80%;
+  font-weight: 400;
+}
+
+mark,
+.mark {
+  padding: 0.2em;
+  background-color: #fcf8e3;
+}
+
+.list-unstyled, .app-nav, .app-menu, .treeview-menu {
+  padding-left: 0;
+  list-style: none;
+}
+
+.list-inline {
+  padding-left: 0;
+  list-style: none;
+}
+
+.list-inline-item {
+  display: inline-block;
+}
+
+.list-inline-item:not(:last-child) {
+  margin-right: 0.5rem;
+}
+
+.initialism {
+  font-size: 90%;
+  text-transform: uppercase;
+}
+
+.blockquote {
+  margin-bottom: 1rem;
+  font-size: 1.09375rem;
+}
+
+.blockquote-footer {
+  display: block;
+  font-size: 80%;
+  color: #6c757d;
+}
+
+.blockquote-footer::before {
+  content: "\2014 \00A0";
+}
+
+.img-fluid {
+  max-width: 100%;
+  height: auto;
+}
+
+.img-thumbnail {
+  padding: 0.25rem;
+  background-color: #FFF;
+  border: 1px solid #dee2e6;
+  border-radius: 0.25rem;
+  max-width: 100%;
+  height: auto;
+}
+
+.figure {
+  display: inline-block;
+}
+
+.figure-img {
+  margin-bottom: 0.5rem;
+  line-height: 1;
+}
+
+.figure-caption {
+  font-size: 90%;
+  color: #6c757d;
+}
+
+code {
+  font-size: 87.5%;
+  color: #e83e8c;
+  word-break: break-word;
+}
+
+a > code {
+  color: inherit;
+}
+
+kbd {
+  padding: 0.2rem 0.4rem;
+  font-size: 87.5%;
+  color: #FFF;
+  background-color: #212529;
+  border-radius: 0.2rem;
+}
+
+kbd kbd {
+  padding: 0;
+  font-size: 100%;
+  font-weight: 700;
+}
+
+pre {
+  display: block;
+  font-size: 87.5%;
+  color: #212529;
+}
+
+pre code {
+  font-size: inherit;
+  color: inherit;
+  word-break: normal;
+}
+
+.pre-scrollable {
+  max-height: 340px;
+  overflow-y: scroll;
+}
+
+.container {
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+
+@media (min-width: 576px) {
+  .container {
+    max-width: 540px;
+  }
+}
+
+@media (min-width: 768px) {
+  .container {
+    max-width: 720px;
+  }
+}
+
+@media (min-width: 992px) {
+  .container {
+    max-width: 960px;
+  }
+}
+
+@media (min-width: 1200px) {
+  .container {
+    max-width: 1140px;
+  }
+}
+
+.container-fluid {
+  width: 100%;
+  padding-right: 15px;
+  padding-left: 15px;
+  margin-right: auto;
+  margin-left: auto;
+}
+
+.row {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  margin-right: -15px;
+  margin-left: -15px;
+}
+
+.no-gutters {
+  margin-right: 0;
+  margin-left: 0;
+}
+
+.no-gutters > .col,
+.no-gutters > [class*="col-"] {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col,
+.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm,
+.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md,
+.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg,
+.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl,
+.col-xl-auto {
+  position: relative;
+  width: 100%;
+  min-height: 1px;
+  padding-right: 15px;
+  padding-left: 15px;
+}
+
+.col {
+  -ms-flex-preferred-size: 0;
+      flex-basis: 0;
+  -webkit-box-flex: 1;
+      -ms-flex-positive: 1;
+          flex-grow: 1;
+  max-width: 100%;
+}
+
+.col-auto {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 auto;
+          flex: 0 0 auto;
+  width: auto;
+  max-width: none;
+}
+
+.col-1 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 8.3333333333%;
+          flex: 0 0 8.3333333333%;
+  max-width: 8.3333333333%;
+}
+
+.col-2 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 16.6666666667%;
+          flex: 0 0 16.6666666667%;
+  max-width: 16.6666666667%;
+}
+
+.col-3 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 25%;
+          flex: 0 0 25%;
+  max-width: 25%;
+}
+
+.col-4 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 33.3333333333%;
+          flex: 0 0 33.3333333333%;
+  max-width: 33.3333333333%;
+}
+
+.col-5 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 41.6666666667%;
+          flex: 0 0 41.6666666667%;
+  max-width: 41.6666666667%;
+}
+
+.col-6 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 50%;
+          flex: 0 0 50%;
+  max-width: 50%;
+}
+
+.col-7 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 58.3333333333%;
+          flex: 0 0 58.3333333333%;
+  max-width: 58.3333333333%;
+}
+
+.col-8 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 66.6666666667%;
+          flex: 0 0 66.6666666667%;
+  max-width: 66.6666666667%;
+}
+
+.col-9 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 75%;
+          flex: 0 0 75%;
+  max-width: 75%;
+}
+
+.col-10 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 83.3333333333%;
+          flex: 0 0 83.3333333333%;
+  max-width: 83.3333333333%;
+}
+
+.col-11 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 91.6666666667%;
+          flex: 0 0 91.6666666667%;
+  max-width: 91.6666666667%;
+}
+
+.col-12 {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 100%;
+          flex: 0 0 100%;
+  max-width: 100%;
+}
+
+.order-first {
+  -webkit-box-ordinal-group: 0;
+      -ms-flex-order: -1;
+          order: -1;
+}
+
+.order-last {
+  -webkit-box-ordinal-group: 14;
+      -ms-flex-order: 13;
+          order: 13;
+}
+
+.order-0 {
+  -webkit-box-ordinal-group: 1;
+      -ms-flex-order: 0;
+          order: 0;
+}
+
+.order-1 {
+  -webkit-box-ordinal-group: 2;
+      -ms-flex-order: 1;
+          order: 1;
+}
+
+.order-2 {
+  -webkit-box-ordinal-group: 3;
+      -ms-flex-order: 2;
+          order: 2;
+}
+
+.order-3 {
+  -webkit-box-ordinal-group: 4;
+      -ms-flex-order: 3;
+          order: 3;
+}
+
+.order-4 {
+  -webkit-box-ordinal-group: 5;
+      -ms-flex-order: 4;
+          order: 4;
+}
+
+.order-5 {
+  -webkit-box-ordinal-group: 6;
+      -ms-flex-order: 5;
+          order: 5;
+}
+
+.order-6 {
+  -webkit-box-ordinal-group: 7;
+      -ms-flex-order: 6;
+          order: 6;
+}
+
+.order-7 {
+  -webkit-box-ordinal-group: 8;
+      -ms-flex-order: 7;
+          order: 7;
+}
+
+.order-8 {
+  -webkit-box-ordinal-group: 9;
+      -ms-flex-order: 8;
+          order: 8;
+}
+
+.order-9 {
+  -webkit-box-ordinal-group: 10;
+      -ms-flex-order: 9;
+          order: 9;
+}
+
+.order-10 {
+  -webkit-box-ordinal-group: 11;
+      -ms-flex-order: 10;
+          order: 10;
+}
+
+.order-11 {
+  -webkit-box-ordinal-group: 12;
+      -ms-flex-order: 11;
+          order: 11;
+}
+
+.order-12 {
+  -webkit-box-ordinal-group: 13;
+      -ms-flex-order: 12;
+          order: 12;
+}
+
+.offset-1 {
+  margin-left: 8.3333333333%;
+}
+
+.offset-2 {
+  margin-left: 16.6666666667%;
+}
+
+.offset-3 {
+  margin-left: 25%;
+}
+
+.offset-4 {
+  margin-left: 33.3333333333%;
+}
+
+.offset-5 {
+  margin-left: 41.6666666667%;
+}
+
+.offset-6 {
+  margin-left: 50%;
+}
+
+.offset-7 {
+  margin-left: 58.3333333333%;
+}
+
+.offset-8 {
+  margin-left: 66.6666666667%;
+}
+
+.offset-9 {
+  margin-left: 75%;
+}
+
+.offset-10 {
+  margin-left: 83.3333333333%;
+}
+
+.offset-11 {
+  margin-left: 91.6666666667%;
+}
+
+@media (min-width: 576px) {
+  .col-sm {
+    -ms-flex-preferred-size: 0;
+        flex-basis: 0;
+    -webkit-box-flex: 1;
+        -ms-flex-positive: 1;
+            flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-sm-auto {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 auto;
+            flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-sm-1 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 8.3333333333%;
+            flex: 0 0 8.3333333333%;
+    max-width: 8.3333333333%;
+  }
+  .col-sm-2 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 16.6666666667%;
+            flex: 0 0 16.6666666667%;
+    max-width: 16.6666666667%;
+  }
+  .col-sm-3 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 25%;
+            flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-sm-4 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 33.3333333333%;
+            flex: 0 0 33.3333333333%;
+    max-width: 33.3333333333%;
+  }
+  .col-sm-5 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 41.6666666667%;
+            flex: 0 0 41.6666666667%;
+    max-width: 41.6666666667%;
+  }
+  .col-sm-6 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 50%;
+            flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-sm-7 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 58.3333333333%;
+            flex: 0 0 58.3333333333%;
+    max-width: 58.3333333333%;
+  }
+  .col-sm-8 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 66.6666666667%;
+            flex: 0 0 66.6666666667%;
+    max-width: 66.6666666667%;
+  }
+  .col-sm-9 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 75%;
+            flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-sm-10 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 83.3333333333%;
+            flex: 0 0 83.3333333333%;
+    max-width: 83.3333333333%;
+  }
+  .col-sm-11 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 91.6666666667%;
+            flex: 0 0 91.6666666667%;
+    max-width: 91.6666666667%;
+  }
+  .col-sm-12 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 100%;
+            flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-sm-first {
+    -webkit-box-ordinal-group: 0;
+        -ms-flex-order: -1;
+            order: -1;
+  }
+  .order-sm-last {
+    -webkit-box-ordinal-group: 14;
+        -ms-flex-order: 13;
+            order: 13;
+  }
+  .order-sm-0 {
+    -webkit-box-ordinal-group: 1;
+        -ms-flex-order: 0;
+            order: 0;
+  }
+  .order-sm-1 {
+    -webkit-box-ordinal-group: 2;
+        -ms-flex-order: 1;
+            order: 1;
+  }
+  .order-sm-2 {
+    -webkit-box-ordinal-group: 3;
+        -ms-flex-order: 2;
+            order: 2;
+  }
+  .order-sm-3 {
+    -webkit-box-ordinal-group: 4;
+        -ms-flex-order: 3;
+            order: 3;
+  }
+  .order-sm-4 {
+    -webkit-box-ordinal-group: 5;
+        -ms-flex-order: 4;
+            order: 4;
+  }
+  .order-sm-5 {
+    -webkit-box-ordinal-group: 6;
+        -ms-flex-order: 5;
+            order: 5;
+  }
+  .order-sm-6 {
+    -webkit-box-ordinal-group: 7;
+        -ms-flex-order: 6;
+            order: 6;
+  }
+  .order-sm-7 {
+    -webkit-box-ordinal-group: 8;
+        -ms-flex-order: 7;
+            order: 7;
+  }
+  .order-sm-8 {
+    -webkit-box-ordinal-group: 9;
+        -ms-flex-order: 8;
+            order: 8;
+  }
+  .order-sm-9 {
+    -webkit-box-ordinal-group: 10;
+        -ms-flex-order: 9;
+            order: 9;
+  }
+  .order-sm-10 {
+    -webkit-box-ordinal-group: 11;
+        -ms-flex-order: 10;
+            order: 10;
+  }
+  .order-sm-11 {
+    -webkit-box-ordinal-group: 12;
+        -ms-flex-order: 11;
+            order: 11;
+  }
+  .order-sm-12 {
+    -webkit-box-ordinal-group: 13;
+        -ms-flex-order: 12;
+            order: 12;
+  }
+  .offset-sm-0 {
+    margin-left: 0;
+  }
+  .offset-sm-1 {
+    margin-left: 8.3333333333%;
+  }
+  .offset-sm-2 {
+    margin-left: 16.6666666667%;
+  }
+  .offset-sm-3 {
+    margin-left: 25%;
+  }
+  .offset-sm-4 {
+    margin-left: 33.3333333333%;
+  }
+  .offset-sm-5 {
+    margin-left: 41.6666666667%;
+  }
+  .offset-sm-6 {
+    margin-left: 50%;
+  }
+  .offset-sm-7 {
+    margin-left: 58.3333333333%;
+  }
+  .offset-sm-8 {
+    margin-left: 66.6666666667%;
+  }
+  .offset-sm-9 {
+    margin-left: 75%;
+  }
+  .offset-sm-10 {
+    margin-left: 83.3333333333%;
+  }
+  .offset-sm-11 {
+    margin-left: 91.6666666667%;
+  }
+}
+
+@media (min-width: 768px) {
+  .col-md {
+    -ms-flex-preferred-size: 0;
+        flex-basis: 0;
+    -webkit-box-flex: 1;
+        -ms-flex-positive: 1;
+            flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-md-auto {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 auto;
+            flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-md-1 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 8.3333333333%;
+            flex: 0 0 8.3333333333%;
+    max-width: 8.3333333333%;
+  }
+  .col-md-2 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 16.6666666667%;
+            flex: 0 0 16.6666666667%;
+    max-width: 16.6666666667%;
+  }
+  .col-md-3 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 25%;
+            flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-md-4 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 33.3333333333%;
+            flex: 0 0 33.3333333333%;
+    max-width: 33.3333333333%;
+  }
+  .col-md-5 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 41.6666666667%;
+            flex: 0 0 41.6666666667%;
+    max-width: 41.6666666667%;
+  }
+  .col-md-6 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 50%;
+            flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-md-7 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 58.3333333333%;
+            flex: 0 0 58.3333333333%;
+    max-width: 58.3333333333%;
+  }
+  .col-md-8 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 66.6666666667%;
+            flex: 0 0 66.6666666667%;
+    max-width: 66.6666666667%;
+  }
+  .col-md-9 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 75%;
+            flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-md-10 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 83.3333333333%;
+            flex: 0 0 83.3333333333%;
+    max-width: 83.3333333333%;
+  }
+  .col-md-11 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 91.6666666667%;
+            flex: 0 0 91.6666666667%;
+    max-width: 91.6666666667%;
+  }
+  .col-md-12 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 100%;
+            flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-md-first {
+    -webkit-box-ordinal-group: 0;
+        -ms-flex-order: -1;
+            order: -1;
+  }
+  .order-md-last {
+    -webkit-box-ordinal-group: 14;
+        -ms-flex-order: 13;
+            order: 13;
+  }
+  .order-md-0 {
+    -webkit-box-ordinal-group: 1;
+        -ms-flex-order: 0;
+            order: 0;
+  }
+  .order-md-1 {
+    -webkit-box-ordinal-group: 2;
+        -ms-flex-order: 1;
+            order: 1;
+  }
+  .order-md-2 {
+    -webkit-box-ordinal-group: 3;
+        -ms-flex-order: 2;
+            order: 2;
+  }
+  .order-md-3 {
+    -webkit-box-ordinal-group: 4;
+        -ms-flex-order: 3;
+            order: 3;
+  }
+  .order-md-4 {
+    -webkit-box-ordinal-group: 5;
+        -ms-flex-order: 4;
+            order: 4;
+  }
+  .order-md-5 {
+    -webkit-box-ordinal-group: 6;
+        -ms-flex-order: 5;
+            order: 5;
+  }
+  .order-md-6 {
+    -webkit-box-ordinal-group: 7;
+        -ms-flex-order: 6;
+            order: 6;
+  }
+  .order-md-7 {
+    -webkit-box-ordinal-group: 8;
+        -ms-flex-order: 7;
+            order: 7;
+  }
+  .order-md-8 {
+    -webkit-box-ordinal-group: 9;
+        -ms-flex-order: 8;
+            order: 8;
+  }
+  .order-md-9 {
+    -webkit-box-ordinal-group: 10;
+        -ms-flex-order: 9;
+            order: 9;
+  }
+  .order-md-10 {
+    -webkit-box-ordinal-group: 11;
+        -ms-flex-order: 10;
+            order: 10;
+  }
+  .order-md-11 {
+    -webkit-box-ordinal-group: 12;
+        -ms-flex-order: 11;
+            order: 11;
+  }
+  .order-md-12 {
+    -webkit-box-ordinal-group: 13;
+        -ms-flex-order: 12;
+            order: 12;
+  }
+  .offset-md-0 {
+    margin-left: 0;
+  }
+  .offset-md-1 {
+    margin-left: 8.3333333333%;
+  }
+  .offset-md-2 {
+    margin-left: 16.6666666667%;
+  }
+  .offset-md-3 {
+    margin-left: 25%;
+  }
+  .offset-md-4 {
+    margin-left: 33.3333333333%;
+  }
+  .offset-md-5 {
+    margin-left: 41.6666666667%;
+  }
+  .offset-md-6 {
+    margin-left: 50%;
+  }
+  .offset-md-7 {
+    margin-left: 58.3333333333%;
+  }
+  .offset-md-8 {
+    margin-left: 66.6666666667%;
+  }
+  .offset-md-9 {
+    margin-left: 75%;
+  }
+  .offset-md-10 {
+    margin-left: 83.3333333333%;
+  }
+  .offset-md-11 {
+    margin-left: 91.6666666667%;
+  }
+}
+
+@media (min-width: 992px) {
+  .col-lg {
+    -ms-flex-preferred-size: 0;
+        flex-basis: 0;
+    -webkit-box-flex: 1;
+        -ms-flex-positive: 1;
+            flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-lg-auto {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 auto;
+            flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-lg-1 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 8.3333333333%;
+            flex: 0 0 8.3333333333%;
+    max-width: 8.3333333333%;
+  }
+  .col-lg-2 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 16.6666666667%;
+            flex: 0 0 16.6666666667%;
+    max-width: 16.6666666667%;
+  }
+  .col-lg-3 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 25%;
+            flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-lg-4 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 33.3333333333%;
+            flex: 0 0 33.3333333333%;
+    max-width: 33.3333333333%;
+  }
+  .col-lg-5 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 41.6666666667%;
+            flex: 0 0 41.6666666667%;
+    max-width: 41.6666666667%;
+  }
+  .col-lg-6 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 50%;
+            flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-lg-7 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 58.3333333333%;
+            flex: 0 0 58.3333333333%;
+    max-width: 58.3333333333%;
+  }
+  .col-lg-8 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 66.6666666667%;
+            flex: 0 0 66.6666666667%;
+    max-width: 66.6666666667%;
+  }
+  .col-lg-9 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 75%;
+            flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-lg-10 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 83.3333333333%;
+            flex: 0 0 83.3333333333%;
+    max-width: 83.3333333333%;
+  }
+  .col-lg-11 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 91.6666666667%;
+            flex: 0 0 91.6666666667%;
+    max-width: 91.6666666667%;
+  }
+  .col-lg-12 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 100%;
+            flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-lg-first {
+    -webkit-box-ordinal-group: 0;
+        -ms-flex-order: -1;
+            order: -1;
+  }
+  .order-lg-last {
+    -webkit-box-ordinal-group: 14;
+        -ms-flex-order: 13;
+            order: 13;
+  }
+  .order-lg-0 {
+    -webkit-box-ordinal-group: 1;
+        -ms-flex-order: 0;
+            order: 0;
+  }
+  .order-lg-1 {
+    -webkit-box-ordinal-group: 2;
+        -ms-flex-order: 1;
+            order: 1;
+  }
+  .order-lg-2 {
+    -webkit-box-ordinal-group: 3;
+        -ms-flex-order: 2;
+            order: 2;
+  }
+  .order-lg-3 {
+    -webkit-box-ordinal-group: 4;
+        -ms-flex-order: 3;
+            order: 3;
+  }
+  .order-lg-4 {
+    -webkit-box-ordinal-group: 5;
+        -ms-flex-order: 4;
+            order: 4;
+  }
+  .order-lg-5 {
+    -webkit-box-ordinal-group: 6;
+        -ms-flex-order: 5;
+            order: 5;
+  }
+  .order-lg-6 {
+    -webkit-box-ordinal-group: 7;
+        -ms-flex-order: 6;
+            order: 6;
+  }
+  .order-lg-7 {
+    -webkit-box-ordinal-group: 8;
+        -ms-flex-order: 7;
+            order: 7;
+  }
+  .order-lg-8 {
+    -webkit-box-ordinal-group: 9;
+        -ms-flex-order: 8;
+            order: 8;
+  }
+  .order-lg-9 {
+    -webkit-box-ordinal-group: 10;
+        -ms-flex-order: 9;
+            order: 9;
+  }
+  .order-lg-10 {
+    -webkit-box-ordinal-group: 11;
+        -ms-flex-order: 10;
+            order: 10;
+  }
+  .order-lg-11 {
+    -webkit-box-ordinal-group: 12;
+        -ms-flex-order: 11;
+            order: 11;
+  }
+  .order-lg-12 {
+    -webkit-box-ordinal-group: 13;
+        -ms-flex-order: 12;
+            order: 12;
+  }
+  .offset-lg-0 {
+    margin-left: 0;
+  }
+  .offset-lg-1 {
+    margin-left: 8.3333333333%;
+  }
+  .offset-lg-2 {
+    margin-left: 16.6666666667%;
+  }
+  .offset-lg-3 {
+    margin-left: 25%;
+  }
+  .offset-lg-4 {
+    margin-left: 33.3333333333%;
+  }
+  .offset-lg-5 {
+    margin-left: 41.6666666667%;
+  }
+  .offset-lg-6 {
+    margin-left: 50%;
+  }
+  .offset-lg-7 {
+    margin-left: 58.3333333333%;
+  }
+  .offset-lg-8 {
+    margin-left: 66.6666666667%;
+  }
+  .offset-lg-9 {
+    margin-left: 75%;
+  }
+  .offset-lg-10 {
+    margin-left: 83.3333333333%;
+  }
+  .offset-lg-11 {
+    margin-left: 91.6666666667%;
+  }
+}
+
+@media (min-width: 1200px) {
+  .col-xl {
+    -ms-flex-preferred-size: 0;
+        flex-basis: 0;
+    -webkit-box-flex: 1;
+        -ms-flex-positive: 1;
+            flex-grow: 1;
+    max-width: 100%;
+  }
+  .col-xl-auto {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 auto;
+            flex: 0 0 auto;
+    width: auto;
+    max-width: none;
+  }
+  .col-xl-1 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 8.3333333333%;
+            flex: 0 0 8.3333333333%;
+    max-width: 8.3333333333%;
+  }
+  .col-xl-2 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 16.6666666667%;
+            flex: 0 0 16.6666666667%;
+    max-width: 16.6666666667%;
+  }
+  .col-xl-3 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 25%;
+            flex: 0 0 25%;
+    max-width: 25%;
+  }
+  .col-xl-4 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 33.3333333333%;
+            flex: 0 0 33.3333333333%;
+    max-width: 33.3333333333%;
+  }
+  .col-xl-5 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 41.6666666667%;
+            flex: 0 0 41.6666666667%;
+    max-width: 41.6666666667%;
+  }
+  .col-xl-6 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 50%;
+            flex: 0 0 50%;
+    max-width: 50%;
+  }
+  .col-xl-7 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 58.3333333333%;
+            flex: 0 0 58.3333333333%;
+    max-width: 58.3333333333%;
+  }
+  .col-xl-8 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 66.6666666667%;
+            flex: 0 0 66.6666666667%;
+    max-width: 66.6666666667%;
+  }
+  .col-xl-9 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 75%;
+            flex: 0 0 75%;
+    max-width: 75%;
+  }
+  .col-xl-10 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 83.3333333333%;
+            flex: 0 0 83.3333333333%;
+    max-width: 83.3333333333%;
+  }
+  .col-xl-11 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 91.6666666667%;
+            flex: 0 0 91.6666666667%;
+    max-width: 91.6666666667%;
+  }
+  .col-xl-12 {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 100%;
+            flex: 0 0 100%;
+    max-width: 100%;
+  }
+  .order-xl-first {
+    -webkit-box-ordinal-group: 0;
+        -ms-flex-order: -1;
+            order: -1;
+  }
+  .order-xl-last {
+    -webkit-box-ordinal-group: 14;
+        -ms-flex-order: 13;
+            order: 13;
+  }
+  .order-xl-0 {
+    -webkit-box-ordinal-group: 1;
+        -ms-flex-order: 0;
+            order: 0;
+  }
+  .order-xl-1 {
+    -webkit-box-ordinal-group: 2;
+        -ms-flex-order: 1;
+            order: 1;
+  }
+  .order-xl-2 {
+    -webkit-box-ordinal-group: 3;
+        -ms-flex-order: 2;
+            order: 2;
+  }
+  .order-xl-3 {
+    -webkit-box-ordinal-group: 4;
+        -ms-flex-order: 3;
+            order: 3;
+  }
+  .order-xl-4 {
+    -webkit-box-ordinal-group: 5;
+        -ms-flex-order: 4;
+            order: 4;
+  }
+  .order-xl-5 {
+    -webkit-box-ordinal-group: 6;
+        -ms-flex-order: 5;
+            order: 5;
+  }
+  .order-xl-6 {
+    -webkit-box-ordinal-group: 7;
+        -ms-flex-order: 6;
+            order: 6;
+  }
+  .order-xl-7 {
+    -webkit-box-ordinal-group: 8;
+        -ms-flex-order: 7;
+            order: 7;
+  }
+  .order-xl-8 {
+    -webkit-box-ordinal-group: 9;
+        -ms-flex-order: 8;
+            order: 8;
+  }
+  .order-xl-9 {
+    -webkit-box-ordinal-group: 10;
+        -ms-flex-order: 9;
+            order: 9;
+  }
+  .order-xl-10 {
+    -webkit-box-ordinal-group: 11;
+        -ms-flex-order: 10;
+            order: 10;
+  }
+  .order-xl-11 {
+    -webkit-box-ordinal-group: 12;
+        -ms-flex-order: 11;
+            order: 11;
+  }
+  .order-xl-12 {
+    -webkit-box-ordinal-group: 13;
+        -ms-flex-order: 12;
+            order: 12;
+  }
+  .offset-xl-0 {
+    margin-left: 0;
+  }
+  .offset-xl-1 {
+    margin-left: 8.3333333333%;
+  }
+  .offset-xl-2 {
+    margin-left: 16.6666666667%;
+  }
+  .offset-xl-3 {
+    margin-left: 25%;
+  }
+  .offset-xl-4 {
+    margin-left: 33.3333333333%;
+  }
+  .offset-xl-5 {
+    margin-left: 41.6666666667%;
+  }
+  .offset-xl-6 {
+    margin-left: 50%;
+  }
+  .offset-xl-7 {
+    margin-left: 58.3333333333%;
+  }
+  .offset-xl-8 {
+    margin-left: 66.6666666667%;
+  }
+  .offset-xl-9 {
+    margin-left: 75%;
+  }
+  .offset-xl-10 {
+    margin-left: 83.3333333333%;
+  }
+  .offset-xl-11 {
+    margin-left: 91.6666666667%;
+  }
+}
+
+.table {
+  width: 100%;
+  max-width: 100%;
+  margin-bottom: 1rem;
+  background-color: transparent;
+}
+
+.table th,
+.table td {
+  padding: 0.75rem;
+  vertical-align: top;
+  border-top: 1px solid #dee2e6;
+}
+
+.table thead th {
+  vertical-align: bottom;
+  border-bottom: 2px solid #dee2e6;
+}
+
+.table tbody + tbody {
+  border-top: 2px solid #dee2e6;
+}
+
+.table .table {
+  background-color: #FFF;
+}
+
+.table-sm th,
+.table-sm td {
+  padding: 0.3rem;
+}
+
+.table-bordered {
+  border: 1px solid #dee2e6;
+}
+
+.table-bordered th,
+.table-bordered td {
+  border: 1px solid #dee2e6;
+}
+
+.table-bordered thead th,
+.table-bordered thead td {
+  border-bottom-width: 2px;
+}
+
+.table-borderless th,
+.table-borderless td,
+.table-borderless thead th,
+.table-borderless tbody + tbody {
+  border: 0;
+}
+
+.table-striped tbody tr:nth-of-type(odd) {
+  background-color: rgba(0, 0, 0, 0.05);
+}
+
+.table-hover tbody tr:hover {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-primary,
+.table-primary > th,
+.table-primary > td {
+  background-color: #b8e2de;
+}
+
+.table-hover .table-primary:hover {
+  background-color: #a6dbd6;
+}
+
+.table-hover .table-primary:hover > td,
+.table-hover .table-primary:hover > th {
+  background-color: #a6dbd6;
+}
+
+.table-secondary,
+.table-secondary > th,
+.table-secondary > td {
+  background-color: #d6d8db;
+}
+
+.table-hover .table-secondary:hover {
+  background-color: #c8cbcf;
+}
+
+.table-hover .table-secondary:hover > td,
+.table-hover .table-secondary:hover > th {
+  background-color: #c8cbcf;
+}
+
+.table-success,
+.table-success > th,
+.table-success > td {
+  background-color: #c3e6cb;
+}
+
+.table-hover .table-success:hover {
+  background-color: #b1dfbb;
+}
+
+.table-hover .table-success:hover > td,
+.table-hover .table-success:hover > th {
+  background-color: #b1dfbb;
+}
+
+.table-info,
+.table-info > th,
+.table-info > td {
+  background-color: #bee5eb;
+}
+
+.table-hover .table-info:hover {
+  background-color: #abdde5;
+}
+
+.table-hover .table-info:hover > td,
+.table-hover .table-info:hover > th {
+  background-color: #abdde5;
+}
+
+.table-warning,
+.table-warning > th,
+.table-warning > td {
+  background-color: #ffeeba;
+}
+
+.table-hover .table-warning:hover {
+  background-color: #ffe8a1;
+}
+
+.table-hover .table-warning:hover > td,
+.table-hover .table-warning:hover > th {
+  background-color: #ffe8a1;
+}
+
+.table-danger,
+.table-danger > th,
+.table-danger > td {
+  background-color: #f5c6cb;
+}
+
+.table-hover .table-danger:hover {
+  background-color: #f1b0b7;
+}
+
+.table-hover .table-danger:hover > td,
+.table-hover .table-danger:hover > th {
+  background-color: #f1b0b7;
+}
+
+.table-light,
+.table-light > th,
+.table-light > td {
+  background-color: #fdfdfe;
+}
+
+.table-hover .table-light:hover {
+  background-color: #ececf6;
+}
+
+.table-hover .table-light:hover > td,
+.table-hover .table-light:hover > th {
+  background-color: #ececf6;
+}
+
+.table-dark,
+.table-dark > th,
+.table-dark > td {
+  background-color: #c6c8ca;
+}
+
+.table-hover .table-dark:hover {
+  background-color: #b9bbbe;
+}
+
+.table-hover .table-dark:hover > td,
+.table-hover .table-dark:hover > th {
+  background-color: #b9bbbe;
+}
+
+.table-active,
+.table-active > th,
+.table-active > td {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-hover .table-active:hover {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table-hover .table-active:hover > td,
+.table-hover .table-active:hover > th {
+  background-color: rgba(0, 0, 0, 0.075);
+}
+
+.table .thead-dark th {
+  color: #FFF;
+  background-color: #212529;
+  border-color: #32383e;
+}
+
+.table .thead-light th {
+  color: #495057;
+  background-color: #e9ecef;
+  border-color: #dee2e6;
+}
+
+.table-dark {
+  color: #FFF;
+  background-color: #212529;
+}
+
+.table-dark th,
+.table-dark td,
+.table-dark thead th {
+  border-color: #32383e;
+}
+
+.table-dark.table-bordered {
+  border: 0;
+}
+
+.table-dark.table-striped tbody tr:nth-of-type(odd) {
+  background-color: rgba(255, 255, 255, 0.05);
+}
+
+.table-dark.table-hover tbody tr:hover {
+  background-color: rgba(255, 255, 255, 0.075);
+}
+
+@media (max-width: 575.98px) {
+  .table-responsive-sm {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-sm > .table-bordered {
+    border: 0;
+  }
+}
+
+@media (max-width: 767.98px) {
+  .table-responsive-md {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-md > .table-bordered {
+    border: 0;
+  }
+}
+
+@media (max-width: 991.98px) {
+  .table-responsive-lg {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-lg > .table-bordered {
+    border: 0;
+  }
+}
+
+@media (max-width: 1199.98px) {
+  .table-responsive-xl {
+    display: block;
+    width: 100%;
+    overflow-x: auto;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+  }
+  .table-responsive-xl > .table-bordered {
+    border: 0;
+  }
+}
+
+.table-responsive {
+  display: block;
+  width: 100%;
+  overflow-x: auto;
+  -webkit-overflow-scrolling: touch;
+  -ms-overflow-style: -ms-autohiding-scrollbar;
+}
+
+.table-responsive > .table-bordered {
+  border: 0;
+}
+
+.form-control {
+  display: block;
+  width: 100%;
+  padding: 0.375rem 0.75rem;
+  font-size: 0.875rem;
+  line-height: 1.5;
+  color: #495057;
+  background-color: #FFF;
+  background-clip: padding-box;
+  border: 2px solid #ced4da;
+  border-radius: 4px;
+  -webkit-transition: border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out;
+  transition: border-color 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out;
+  -o-transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
+  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-box-shadow 0.15s ease-in-out;
+}
+
+@media screen and (prefers-reduced-motion: reduce) {
+  .form-control {
+    -webkit-transition: none;
+    -o-transition: none;
+    transition: none;
+  }
+}
+
+.form-control::-ms-expand {
+  background-color: transparent;
+  border: 0;
+}
+
+.form-control:focus {
+  color: #495057;
+  background-color: #FFF;
+  border-color: #009688;
+  outline: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.form-control::-webkit-input-placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control:-ms-input-placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control::-ms-input-placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control::placeholder {
+  color: #6c757d;
+  opacity: 1;
+}
+
+.form-control:disabled, .form-control[readonly] {
+  background-color: #e9ecef;
+  opacity: 1;
+}
+
+select.form-control:not([size]):not([multiple]) {
+  height: calc(2.0625rem + 4px);
+}
+
+select.form-control:focus::-ms-value {
+  color: #495057;
+  background-color: #FFF;
+}
+
+.form-control-file,
+.form-control-range {
+  display: block;
+  width: 100%;
+}
+
+.col-form-label {
+  padding-top: calc(0.375rem + 2px);
+  padding-bottom: calc(0.375rem + 2px);
+  margin-bottom: 0;
+  font-size: inherit;
+  line-height: 1.5;
+}
+
+.col-form-label-lg {
+  padding-top: calc(0.5rem + 2px);
+  padding-bottom: calc(0.5rem + 2px);
+  font-size: 1.09375rem;
+  line-height: 1.5;
+}
+
+.col-form-label-sm {
+  padding-top: calc(0.25rem + 2px);
+  padding-bottom: calc(0.25rem + 2px);
+  font-size: 0.765625rem;
+  line-height: 1.5;
+}
+
+.form-control-plaintext {
+  display: block;
+  width: 100%;
+  padding-top: 0.375rem;
+  padding-bottom: 0.375rem;
+  margin-bottom: 0;
+  line-height: 1.5;
+  color: #212529;
+  background-color: transparent;
+  border: solid transparent;
+  border-width: 2px 0;
+}
+
+.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control,
+.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text,
+.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text,
+.input-group-sm > .input-group-prepend > .form-control-plaintext.btn,
+.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control,
+.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text,
+.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text,
+.input-group-lg > .input-group-prepend > .form-control-plaintext.btn,
+.input-group-lg > .input-group-append > .form-control-plaintext.btn {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.form-control-sm, .input-group-sm > .form-control,
+.input-group-sm > .input-group-prepend > .input-group-text,
+.input-group-sm > .input-group-append > .input-group-text,
+.input-group-sm > .input-group-prepend > .btn,
+.input-group-sm > .input-group-append > .btn {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.765625rem;
+  line-height: 1.5;
+  border-radius: 4px;
+}
+
+select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]),
+.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]),
+.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]),
+.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]),
+.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) {
+  height: calc(1.6484375rem + 4px);
+}
+
+.form-control-lg, .input-group-lg > .form-control,
+.input-group-lg > .input-group-prepend > .input-group-text,
+.input-group-lg > .input-group-append > .input-group-text,
+.input-group-lg > .input-group-prepend > .btn,
+.input-group-lg > .input-group-append > .btn {
+  padding: 0.5rem 1rem;
+  font-size: 1.09375rem;
+  line-height: 1.5;
+  border-radius: 4px;
+}
+
+select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]),
+.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]),
+.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]),
+.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]),
+.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) {
+  height: calc(2.640625rem + 4px);
+}
+
+.form-group {
+  margin-bottom: 1rem;
+}
+
+.form-text {
+  display: block;
+  margin-top: 0.25rem;
+}
+
+.form-row {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  margin-right: -5px;
+  margin-left: -5px;
+}
+
+.form-row > .col,
+.form-row > [class*="col-"] {
+  padding-right: 5px;
+  padding-left: 5px;
+}
+
+.form-check {
+  position: relative;
+  display: block;
+  padding-left: 1.25rem;
+}
+
+.form-check-input {
+  position: absolute;
+  margin-top: 0.3rem;
+  margin-left: -1.25rem;
+}
+
+.form-check-input:disabled ~ .form-check-label {
+  color: #6c757d;
+}
+
+.form-check-label {
+  margin-bottom: 0;
+}
+
+.form-check-inline {
+  display: -webkit-inline-box;
+  display: -ms-inline-flexbox;
+  display: inline-flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding-left: 0;
+  margin-right: 0.75rem;
+}
+
+.form-check-inline .form-check-input {
+  position: static;
+  margin-top: 0;
+  margin-right: 0.3125rem;
+  margin-left: 0;
+}
+
+.valid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 80%;
+  color: #28a745;
+}
+
+.valid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: .5rem;
+  margin-top: .1rem;
+  font-size: .875rem;
+  line-height: 1;
+  color: #FFF;
+  background-color: rgba(40, 167, 69, 0.8);
+  border-radius: .2rem;
+}
+
+.was-validated .form-control:valid, .form-control.is-valid, .was-validated
+.custom-select:valid,
+.custom-select.is-valid {
+  border-color: #28a745;
+}
+
+.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated
+.custom-select:valid:focus,
+.custom-select.is-valid:focus {
+  border-color: #28a745;
+  -webkit-box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.25);
+          box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.25);
+}
+
+.was-validated .form-control:valid ~ .valid-feedback,
+.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback,
+.form-control.is-valid ~ .valid-tooltip, .was-validated
+.custom-select:valid ~ .valid-feedback,
+.was-validated
+.custom-select:valid ~ .valid-tooltip,
+.custom-select.is-valid ~ .valid-feedback,
+.custom-select.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .form-control-file:valid ~ .valid-feedback,
+.was-validated .form-control-file:valid ~ .valid-tooltip, .form-control-file.is-valid ~ .valid-feedback,
+.form-control-file.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
+  color: #28a745;
+}
+
+.was-validated .form-check-input:valid ~ .valid-feedback,
+.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback,
+.form-check-input.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label {
+  color: #28a745;
+}
+
+.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before {
+  background-color: #71dd8a;
+}
+
+.was-validated .custom-control-input:valid ~ .valid-feedback,
+.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback,
+.custom-control-input.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before {
+  background-color: #34ce57;
+}
+
+.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before {
+  -webkit-box-shadow: 0 0 0 1px #FFF, 0 0 0 0 rgba(40, 167, 69, 0.25);
+          box-shadow: 0 0 0 1px #FFF, 0 0 0 0 rgba(40, 167, 69, 0.25);
+}
+
+.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label {
+  border-color: #28a745;
+}
+
+.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before {
+  border-color: inherit;
+}
+
+.was-validated .custom-file-input:valid ~ .valid-feedback,
+.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback,
+.custom-file-input.is-valid ~ .valid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label {
+  -webkit-box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.25);
+          box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.25);
+}
+
+.invalid-feedback {
+  display: none;
+  width: 100%;
+  margin-top: 0.25rem;
+  font-size: 80%;
+  color: #dc3545;
+}
+
+.invalid-tooltip {
+  position: absolute;
+  top: 100%;
+  z-index: 5;
+  display: none;
+  max-width: 100%;
+  padding: .5rem;
+  margin-top: .1rem;
+  font-size: .875rem;
+  line-height: 1;
+  color: #FFF;
+  background-color: rgba(220, 53, 69, 0.8);
+  border-radius: .2rem;
+}
+
+.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated
+.custom-select:invalid,
+.custom-select.is-invalid {
+  border-color: #dc3545;
+}
+
+.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated
+.custom-select:invalid:focus,
+.custom-select.is-invalid:focus {
+  border-color: #dc3545;
+  -webkit-box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.25);
+          box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.25);
+}
+
+.was-validated .form-control:invalid ~ .invalid-feedback,
+.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback,
+.form-control.is-invalid ~ .invalid-tooltip, .was-validated
+.custom-select:invalid ~ .invalid-feedback,
+.was-validated
+.custom-select:invalid ~ .invalid-tooltip,
+.custom-select.is-invalid ~ .invalid-feedback,
+.custom-select.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .form-control-file:invalid ~ .invalid-feedback,
+.was-validated .form-control-file:invalid ~ .invalid-tooltip, .form-control-file.is-invalid ~ .invalid-feedback,
+.form-control-file.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
+  color: #dc3545;
+}
+
+.was-validated .form-check-input:invalid ~ .invalid-feedback,
+.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback,
+.form-check-input.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label {
+  color: #dc3545;
+}
+
+.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before {
+  background-color: #efa2a9;
+}
+
+.was-validated .custom-control-input:invalid ~ .invalid-feedback,
+.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback,
+.custom-control-input.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before {
+  background-color: #e4606d;
+}
+
+.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before {
+  -webkit-box-shadow: 0 0 0 1px #FFF, 0 0 0 0 rgba(220, 53, 69, 0.25);
+          box-shadow: 0 0 0 1px #FFF, 0 0 0 0 rgba(220, 53, 69, 0.25);
+}
+
+.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label {
+  border-color: #dc3545;
+}
+
+.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before {
+  border-color: inherit;
+}
+
+.was-validated .custom-file-input:invalid ~ .invalid-feedback,
+.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback,
+.custom-file-input.is-invalid ~ .invalid-tooltip {
+  display: block;
+}
+
+.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label {
+  -webkit-box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.25);
+          box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.25);
+}
+
+.form-inline {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+      -ms-flex-flow: row wrap;
+          flex-flow: row wrap;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+}
+
+.form-inline .form-check {
+  width: 100%;
+}
+
+@media (min-width: 576px) {
+  .form-inline label {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-align: center;
+        -ms-flex-align: center;
+            align-items: center;
+    -webkit-box-pack: center;
+        -ms-flex-pack: center;
+            justify-content: center;
+    margin-bottom: 0;
+  }
+  .form-inline .form-group {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 auto;
+            flex: 0 0 auto;
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-flow: row wrap;
+            flex-flow: row wrap;
+    -webkit-box-align: center;
+        -ms-flex-align: center;
+            align-items: center;
+    margin-bottom: 0;
+  }
+  .form-inline .form-control {
+    display: inline-block;
+    width: auto;
+    vertical-align: middle;
+  }
+  .form-inline .form-control-plaintext {
+    display: inline-block;
+  }
+  .form-inline .input-group,
+  .form-inline .custom-select {
+    width: auto;
+  }
+  .form-inline .form-check {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-align: center;
+        -ms-flex-align: center;
+            align-items: center;
+    -webkit-box-pack: center;
+        -ms-flex-pack: center;
+            justify-content: center;
+    width: auto;
+    padding-left: 0;
+  }
+  .form-inline .form-check-input {
+    position: relative;
+    margin-top: 0;
+    margin-right: 0.25rem;
+    margin-left: 0;
+  }
+  .form-inline .custom-control {
+    -webkit-box-align: center;
+        -ms-flex-align: center;
+            align-items: center;
+    -webkit-box-pack: center;
+        -ms-flex-pack: center;
+            justify-content: center;
+  }
+  .form-inline .custom-control-label {
+    margin-bottom: 0;
+  }
+}
+
+.btn {
+  display: inline-block;
+  font-weight: 700;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: middle;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  border: 2px solid transparent;
+  padding: 0.375rem 0.75rem;
+  font-size: 0.875rem;
+  line-height: 1.5;
+  border-radius: 3px;
+  -webkit-transition: background-color 0.3s ease-in-out, border-color 0.3s ease-in-out, -webkit-box-shadow 0.3s cubic-bezier(0.35, 0, 0.25, 1), -webkit-transform 0.2s cubic-bezier(0.35, 0, 0.25, 1);
+  transition: background-color 0.3s ease-in-out, border-color 0.3s ease-in-out, -webkit-box-shadow 0.3s cubic-bezier(0.35, 0, 0.25, 1), -webkit-transform 0.2s cubic-bezier(0.35, 0, 0.25, 1);
+  -o-transition: box-shadow 0.3s cubic-bezier(0.35, 0, 0.25, 1), transform 0.2s cubic-bezier(0.35, 0, 0.25, 1), background-color 0.3s ease-in-out, border-color 0.3s ease-in-out;
+  transition: box-shadow 0.3s cubic-bezier(0.35, 0, 0.25, 1), transform 0.2s cubic-bezier(0.35, 0, 0.25, 1), background-color 0.3s ease-in-out, border-color 0.3s ease-in-out;
+  transition: box-shadow 0.3s cubic-bezier(0.35, 0, 0.25, 1), transform 0.2s cubic-bezier(0.35, 0, 0.25, 1), background-color 0.3s ease-in-out, border-color 0.3s ease-in-out, -webkit-box-shadow 0.3s cubic-bezier(0.35, 0, 0.25, 1), -webkit-transform 0.2s cubic-bezier(0.35, 0, 0.25, 1);
+}
+
+@media screen and (prefers-reduced-motion: reduce) {
+  .btn {
+    -webkit-transition: none;
+    -o-transition: none;
+    transition: none;
+  }
+}
+
+.btn:hover, .btn:focus {
+  text-decoration: none;
+}
+
+.btn:focus, .btn.focus {
+  outline: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.btn.disabled, .btn:disabled {
+  opacity: 0.65;
+}
+
+.btn:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active {
+  background-image: none;
+}
+
+a.btn.disabled,
+fieldset:disabled a.btn {
+  pointer-events: none;
+}
+
+.btn-primary {
+  color: #FFF;
+  background-color: #009688;
+  border-color: #009688;
+}
+
+.btn-primary:hover {
+  color: #FFF;
+  background-color: #007065;
+  border-color: #00635a;
+}
+
+.btn-primary:focus, .btn-primary.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+          box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+}
+
+.btn-primary.disabled, .btn-primary:disabled {
+  color: #FFF;
+  background-color: #009688;
+  border-color: #009688;
+}
+
+.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active,
+.show > .btn-primary.dropdown-toggle {
+  color: #FFF;
+  background-color: #00635a;
+  border-color: #00564e;
+}
+
+.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-primary.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+          box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+}
+
+.btn-secondary {
+  color: #FFF;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-secondary:hover {
+  color: #FFF;
+  background-color: #5a6268;
+  border-color: #545b62;
+}
+
+.btn-secondary:focus, .btn-secondary.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+          box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+}
+
+.btn-secondary.disabled, .btn-secondary:disabled {
+  color: #FFF;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active,
+.show > .btn-secondary.dropdown-toggle {
+  color: #FFF;
+  background-color: #545b62;
+  border-color: #4e555b;
+}
+
+.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-secondary.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+          box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+}
+
+.btn-success {
+  color: #FFF;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-success:hover {
+  color: #FFF;
+  background-color: #218838;
+  border-color: #1e7e34;
+}
+
+.btn-success:focus, .btn-success.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+}
+
+.btn-success.disabled, .btn-success:disabled {
+  color: #FFF;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active,
+.show > .btn-success.dropdown-toggle {
+  color: #FFF;
+  background-color: #1e7e34;
+  border-color: #1c7430;
+}
+
+.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus,
+.show > .btn-success.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+}
+
+.btn-info {
+  color: #FFF;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-info:hover {
+  color: #FFF;
+  background-color: #138496;
+  border-color: #117a8b;
+}
+
+.btn-info:focus, .btn-info.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+          box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+}
+
+.btn-info.disabled, .btn-info:disabled {
+  color: #FFF;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active,
+.show > .btn-info.dropdown-toggle {
+  color: #FFF;
+  background-color: #117a8b;
+  border-color: #10707f;
+}
+
+.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus,
+.show > .btn-info.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+          box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+}
+
+.btn-warning {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-warning:hover {
+  color: #212529;
+  background-color: #e0a800;
+  border-color: #d39e00;
+}
+
+.btn-warning:focus, .btn-warning.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+          box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+}
+
+.btn-warning.disabled, .btn-warning:disabled {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active,
+.show > .btn-warning.dropdown-toggle {
+  color: #212529;
+  background-color: #d39e00;
+  border-color: #c69500;
+}
+
+.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus,
+.show > .btn-warning.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+          box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+}
+
+.btn-danger {
+  color: #FFF;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-danger:hover {
+  color: #FFF;
+  background-color: #c82333;
+  border-color: #bd2130;
+}
+
+.btn-danger:focus, .btn-danger.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+}
+
+.btn-danger.disabled, .btn-danger:disabled {
+  color: #FFF;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active,
+.show > .btn-danger.dropdown-toggle {
+  color: #FFF;
+  background-color: #bd2130;
+  border-color: #b21f2d;
+}
+
+.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus,
+.show > .btn-danger.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+}
+
+.btn-light {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-light:hover {
+  color: #212529;
+  background-color: #e2e6ea;
+  border-color: #dae0e5;
+}
+
+.btn-light:focus, .btn-light.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+          box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+}
+
+.btn-light.disabled, .btn-light:disabled {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active,
+.show > .btn-light.dropdown-toggle {
+  color: #212529;
+  background-color: #dae0e5;
+  border-color: #d3d9df;
+}
+
+.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus,
+.show > .btn-light.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+          box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+}
+
+.btn-dark {
+  color: #FFF;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-dark:hover {
+  color: #FFF;
+  background-color: #23272b;
+  border-color: #1d2124;
+}
+
+.btn-dark:focus, .btn-dark.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+          box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+}
+
+.btn-dark.disabled, .btn-dark:disabled {
+  color: #FFF;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active,
+.show > .btn-dark.dropdown-toggle {
+  color: #FFF;
+  background-color: #1d2124;
+  border-color: #171a1d;
+}
+
+.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus,
+.show > .btn-dark.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+          box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+}
+
+.btn-outline-primary {
+  color: #009688;
+  background-color: transparent;
+  background-image: none;
+  border-color: #009688;
+}
+
+.btn-outline-primary:hover {
+  color: #FFF;
+  background-color: #009688;
+  border-color: #009688;
+}
+
+.btn-outline-primary:focus, .btn-outline-primary.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+          box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+}
+
+.btn-outline-primary.disabled, .btn-outline-primary:disabled {
+  color: #009688;
+  background-color: transparent;
+}
+
+.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active,
+.show > .btn-outline-primary.dropdown-toggle {
+  color: #FFF;
+  background-color: #009688;
+  border-color: #009688;
+}
+
+.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-primary.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+          box-shadow: 0 0 0 0 rgba(0, 150, 136, 0.5);
+}
+
+.btn-outline-secondary {
+  color: #6c757d;
+  background-color: transparent;
+  background-image: none;
+  border-color: #6c757d;
+}
+
+.btn-outline-secondary:hover {
+  color: #FFF;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-outline-secondary:focus, .btn-outline-secondary.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+          box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+}
+
+.btn-outline-secondary.disabled, .btn-outline-secondary:disabled {
+  color: #6c757d;
+  background-color: transparent;
+}
+
+.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active,
+.show > .btn-outline-secondary.dropdown-toggle {
+  color: #FFF;
+  background-color: #6c757d;
+  border-color: #6c757d;
+}
+
+.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-secondary.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+          box-shadow: 0 0 0 0 rgba(108, 117, 125, 0.5);
+}
+
+.btn-outline-success {
+  color: #28a745;
+  background-color: transparent;
+  background-image: none;
+  border-color: #28a745;
+}
+
+.btn-outline-success:hover {
+  color: #FFF;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-outline-success:focus, .btn-outline-success.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+}
+
+.btn-outline-success.disabled, .btn-outline-success:disabled {
+  color: #28a745;
+  background-color: transparent;
+}
+
+.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active,
+.show > .btn-outline-success.dropdown-toggle {
+  color: #FFF;
+  background-color: #28a745;
+  border-color: #28a745;
+}
+
+.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-success.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(40, 167, 69, 0.5);
+}
+
+.btn-outline-info {
+  color: #17a2b8;
+  background-color: transparent;
+  background-image: none;
+  border-color: #17a2b8;
+}
+
+.btn-outline-info:hover {
+  color: #FFF;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-outline-info:focus, .btn-outline-info.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+          box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+}
+
+.btn-outline-info.disabled, .btn-outline-info:disabled {
+  color: #17a2b8;
+  background-color: transparent;
+}
+
+.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active,
+.show > .btn-outline-info.dropdown-toggle {
+  color: #FFF;
+  background-color: #17a2b8;
+  border-color: #17a2b8;
+}
+
+.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-info.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+          box-shadow: 0 0 0 0 rgba(23, 162, 184, 0.5);
+}
+
+.btn-outline-warning {
+  color: #ffc107;
+  background-color: transparent;
+  background-image: none;
+  border-color: #ffc107;
+}
+
+.btn-outline-warning:hover {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-outline-warning:focus, .btn-outline-warning.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+          box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+}
+
+.btn-outline-warning.disabled, .btn-outline-warning:disabled {
+  color: #ffc107;
+  background-color: transparent;
+}
+
+.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active,
+.show > .btn-outline-warning.dropdown-toggle {
+  color: #212529;
+  background-color: #ffc107;
+  border-color: #ffc107;
+}
+
+.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-warning.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+          box-shadow: 0 0 0 0 rgba(255, 193, 7, 0.5);
+}
+
+.btn-outline-danger {
+  color: #dc3545;
+  background-color: transparent;
+  background-image: none;
+  border-color: #dc3545;
+}
+
+.btn-outline-danger:hover {
+  color: #FFF;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-outline-danger:focus, .btn-outline-danger.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+}
+
+.btn-outline-danger.disabled, .btn-outline-danger:disabled {
+  color: #dc3545;
+  background-color: transparent;
+}
+
+.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active,
+.show > .btn-outline-danger.dropdown-toggle {
+  color: #FFF;
+  background-color: #dc3545;
+  border-color: #dc3545;
+}
+
+.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-danger.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+          box-shadow: 0 0 0 0 rgba(220, 53, 69, 0.5);
+}
+
+.btn-outline-light {
+  color: #f8f9fa;
+  background-color: transparent;
+  background-image: none;
+  border-color: #f8f9fa;
+}
+
+.btn-outline-light:hover {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-outline-light:focus, .btn-outline-light.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+          box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+}
+
+.btn-outline-light.disabled, .btn-outline-light:disabled {
+  color: #f8f9fa;
+  background-color: transparent;
+}
+
+.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active,
+.show > .btn-outline-light.dropdown-toggle {
+  color: #212529;
+  background-color: #f8f9fa;
+  border-color: #f8f9fa;
+}
+
+.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-light.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+          box-shadow: 0 0 0 0 rgba(248, 249, 250, 0.5);
+}
+
+.btn-outline-dark {
+  color: #343a40;
+  background-color: transparent;
+  background-image: none;
+  border-color: #343a40;
+}
+
+.btn-outline-dark:hover {
+  color: #FFF;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-outline-dark:focus, .btn-outline-dark.focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+          box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+}
+
+.btn-outline-dark.disabled, .btn-outline-dark:disabled {
+  color: #343a40;
+  background-color: transparent;
+}
+
+.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active,
+.show > .btn-outline-dark.dropdown-toggle {
+  color: #FFF;
+  background-color: #343a40;
+  border-color: #343a40;
+}
+
+.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus,
+.show > .btn-outline-dark.dropdown-toggle:focus {
+  -webkit-box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+          box-shadow: 0 0 0 0 rgba(52, 58, 64, 0.5);
+}
+
+.btn-link {
+  font-weight: 400;
+  color: #009688;
+  background-color: transparent;
+}
+
+.btn-link:hover {
+  color: #004a43;
+  text-decoration: underline;
+  background-color: transparent;
+  border-color: transparent;
+}
+
+.btn-link:focus, .btn-link.focus {
+  text-decoration: underline;
+  border-color: transparent;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.btn-link:disabled, .btn-link.disabled {
+  color: #6c757d;
+  pointer-events: none;
+}
+
+.btn-lg, .btn-group-lg > .btn {
+  padding: 0.5rem 1rem;
+  font-size: 1.09375rem;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+
+.btn-sm, .btn-group-sm > .btn {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.765625rem;
+  line-height: 1.5;
+  border-radius: 3px;
+}
+
+.btn-block {
+  display: block;
+  width: 100%;
+}
+
+.btn-block + .btn-block {
+  margin-top: 0.5rem;
+}
+
+input[type="submit"].btn-block,
+input[type="reset"].btn-block,
+input[type="button"].btn-block {
+  width: 100%;
+}
+
+.fade {
+  -webkit-transition: opacity 0.15s linear;
+  -o-transition: opacity 0.15s linear;
+  transition: opacity 0.15s linear;
+}
+
+@media screen and (prefers-reduced-motion: reduce) {
+  .fade {
+    -webkit-transition: none;
+    -o-transition: none;
+    transition: none;
+  }
+}
+
+.fade:not(.show) {
+  opacity: 0;
+}
+
+.collapse:not(.show) {
+  display: none;
+}
+
+.collapsing {
+  position: relative;
+  height: 0;
+  overflow: hidden;
+  -webkit-transition: height 0.35s ease;
+  -o-transition: height 0.35s ease;
+  transition: height 0.35s ease;
+}
+
+@media screen and (prefers-reduced-motion: reduce) {
+  .collapsing {
+    -webkit-transition: none;
+    -o-transition: none;
+    transition: none;
+  }
+}
+
+.dropup,
+.dropright,
+.dropdown,
+.dropleft {
+  position: relative;
+}
+
+.dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid;
+  border-right: 0.3em solid transparent;
+  border-bottom: 0;
+  border-left: 0.3em solid transparent;
+}
+
+.dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropdown-menu {
+  position: absolute;
+  top: 100%;
+  left: 0;
+  z-index: 1000;
+  display: none;
+  float: left;
+  min-width: 10rem;
+  padding: 0 0;
+  margin: 0 0 0;
+  font-size: 0.875rem;
+  color: #212529;
+  text-align: left;
+  list-style: none;
+  background-color: #FFF;
+  background-clip: padding-box;
+  border: 0 solid rgba(0, 0, 0, 0.15);
+  border-radius: 0.25rem;
+}
+
+.dropdown-menu-right {
+  right: 0;
+  left: auto;
+}
+
+.dropup .dropdown-menu {
+  top: auto;
+  bottom: 100%;
+  margin-top: 0;
+  margin-bottom: 0;
+}
+
+.dropup .dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0;
+  border-right: 0.3em solid transparent;
+  border-bottom: 0.3em solid;
+  border-left: 0.3em solid transparent;
+}
+
+.dropup .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropright .dropdown-menu {
+  top: 0;
+  right: auto;
+  left: 100%;
+  margin-top: 0;
+  margin-left: 0;
+}
+
+.dropright .dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-right: 0;
+  border-bottom: 0.3em solid transparent;
+  border-left: 0.3em solid;
+}
+
+.dropright .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropright .dropdown-toggle::after {
+  vertical-align: 0;
+}
+
+.dropleft .dropdown-menu {
+  top: 0;
+  right: 100%;
+  left: auto;
+  margin-top: 0;
+  margin-right: 0;
+}
+
+.dropleft .dropdown-toggle::after {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-left: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+}
+
+.dropleft .dropdown-toggle::after {
+  display: none;
+}
+
+.dropleft .dropdown-toggle::before {
+  display: inline-block;
+  width: 0;
+  height: 0;
+  margin-right: 0.255em;
+  vertical-align: 0.255em;
+  content: "";
+  border-top: 0.3em solid transparent;
+  border-right: 0.3em solid;
+  border-bottom: 0.3em solid transparent;
+}
+
+.dropleft .dropdown-toggle:empty::after {
+  margin-left: 0;
+}
+
+.dropleft .dropdown-toggle::before {
+  vertical-align: 0;
+}
+
+.dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] {
+  right: auto;
+  bottom: auto;
+}
+
+.dropdown-divider {
+  height: 0;
+  margin: 0.5rem 0;
+  overflow: hidden;
+  border-top: 1px solid #e9ecef;
+}
+
+.dropdown-item {
+  display: block;
+  width: 100%;
+  padding: 8px 20px;
+  clear: both;
+  font-weight: 400;
+  color: #212529;
+  text-align: inherit;
+  white-space: nowrap;
+  background-color: transparent;
+  border: 0;
+}
+
+.dropdown-item:hover, .dropdown-item:focus {
+  color: #16181b;
+  text-decoration: none;
+  background-color: #f8f9fa;
+}
+
+.dropdown-item.active, .dropdown-item:active {
+  color: #FFF;
+  text-decoration: none;
+  background-color: #009688;
+}
+
+.dropdown-item.disabled, .dropdown-item:disabled {
+  color: #6c757d;
+  background-color: transparent;
+}
+
+.dropdown-menu.show {
+  display: block;
+}
+
+.dropdown-header {
+  display: block;
+  padding: 0 20px;
+  margin-bottom: 0;
+  font-size: 0.765625rem;
+  color: #6c757d;
+  white-space: nowrap;
+}
+
+.dropdown-item-text {
+  display: block;
+  padding: 8px 20px;
+  color: #212529;
+}
+
+.btn-group,
+.btn-group-vertical {
+  position: relative;
+  display: -webkit-inline-box;
+  display: -ms-inline-flexbox;
+  display: inline-flex;
+  vertical-align: middle;
+}
+
+.btn-group > .btn,
+.btn-group-vertical > .btn {
+  position: relative;
+  -webkit-box-flex: 0;
+      -ms-flex: 0 1 auto;
+          flex: 0 1 auto;
+}
+
+.btn-group > .btn:hover,
+.btn-group-vertical > .btn:hover {
+  z-index: 1;
+}
+
+.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active,
+.btn-group-vertical > .btn:focus,
+.btn-group-vertical > .btn:active,
+.btn-group-vertical > .btn.active {
+  z-index: 1;
+}
+
+.btn-group .btn + .btn,
+.btn-group .btn + .btn-group,
+.btn-group .btn-group + .btn,
+.btn-group .btn-group + .btn-group,
+.btn-group-vertical .btn + .btn,
+.btn-group-vertical .btn + .btn-group,
+.btn-group-vertical .btn-group + .btn,
+.btn-group-vertical .btn-group + .btn-group {
+  margin-left: -2px;
+}
+
+.btn-toolbar {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  -webkit-box-pack: start;
+      -ms-flex-pack: start;
+          justify-content: flex-start;
+}
+
+.btn-toolbar .input-group {
+  width: auto;
+}
+
+.btn-group > .btn:first-child {
+  margin-left: 0;
+}
+
+.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group > .btn-group:not(:last-child) > .btn {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.btn-group > .btn:not(:first-child),
+.btn-group > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.dropdown-toggle-split {
+  padding-right: 0.5625rem;
+  padding-left: 0.5625rem;
+}
+
+.dropdown-toggle-split::after,
+.dropup .dropdown-toggle-split::after,
+.dropright .dropdown-toggle-split::after {
+  margin-left: 0;
+}
+
+.dropleft .dropdown-toggle-split::before {
+  margin-right: 0;
+}
+
+.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
+  padding-right: 0.375rem;
+  padding-left: 0.375rem;
+}
+
+.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
+  padding-right: 0.75rem;
+  padding-left: 0.75rem;
+}
+
+.btn-group-vertical {
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  -webkit-box-align: start;
+      -ms-flex-align: start;
+          align-items: flex-start;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+}
+
+.btn-group-vertical .btn,
+.btn-group-vertical .btn-group {
+  width: 100%;
+}
+
+.btn-group-vertical > .btn + .btn,
+.btn-group-vertical > .btn + .btn-group,
+.btn-group-vertical > .btn-group + .btn,
+.btn-group-vertical > .btn-group + .btn-group {
+  margin-top: -2px;
+  margin-left: 0;
+}
+
+.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
+.btn-group-vertical > .btn-group:not(:last-child) > .btn {
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.btn-group-vertical > .btn:not(:first-child),
+.btn-group-vertical > .btn-group:not(:first-child) > .btn {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.btn-group-toggle > .btn,
+.btn-group-toggle > .btn-group > .btn {
+  margin-bottom: 0;
+}
+
+.btn-group-toggle > .btn input[type="radio"],
+.btn-group-toggle > .btn input[type="checkbox"],
+.btn-group-toggle > .btn-group > .btn input[type="radio"],
+.btn-group-toggle > .btn-group > .btn input[type="checkbox"] {
+  position: absolute;
+  clip: rect(0, 0, 0, 0);
+  pointer-events: none;
+}
+
+.input-group {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  -webkit-box-align: stretch;
+      -ms-flex-align: stretch;
+          align-items: stretch;
+  width: 100%;
+}
+
+.input-group > .form-control,
+.input-group > .custom-select,
+.input-group > .custom-file {
+  position: relative;
+  -webkit-box-flex: 1;
+      -ms-flex: 1 1 auto;
+          flex: 1 1 auto;
+  width: 1%;
+  margin-bottom: 0;
+}
+
+.input-group > .form-control:focus,
+.input-group > .custom-select:focus,
+.input-group > .custom-file:focus {
+  z-index: 3;
+}
+
+.input-group > .form-control + .form-control,
+.input-group > .form-control + .custom-select,
+.input-group > .form-control + .custom-file,
+.input-group > .custom-select + .form-control,
+.input-group > .custom-select + .custom-select,
+.input-group > .custom-select + .custom-file,
+.input-group > .custom-file + .form-control,
+.input-group > .custom-file + .custom-select,
+.input-group > .custom-file + .custom-file {
+  margin-left: -2px;
+}
+
+.input-group > .form-control:not(:last-child),
+.input-group > .custom-select:not(:last-child) {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.input-group > .form-control:not(:first-child),
+.input-group > .custom-select:not(:first-child) {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.input-group > .custom-file {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+}
+
+.input-group > .custom-file:not(:last-child) .custom-file-label,
+.input-group > .custom-file:not(:last-child) .custom-file-label::after {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.input-group > .custom-file:not(:first-child) .custom-file-label {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.input-group-prepend,
+.input-group-append {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.input-group-prepend .btn,
+.input-group-append .btn {
+  position: relative;
+  z-index: 2;
+}
+
+.input-group-prepend .btn + .btn,
+.input-group-prepend .btn + .input-group-text,
+.input-group-prepend .input-group-text + .input-group-text,
+.input-group-prepend .input-group-text + .btn,
+.input-group-append .btn + .btn,
+.input-group-append .btn + .input-group-text,
+.input-group-append .input-group-text + .input-group-text,
+.input-group-append .input-group-text + .btn {
+  margin-left: -2px;
+}
+
+.input-group-prepend {
+  margin-right: -2px;
+}
+
+.input-group-append {
+  margin-left: -2px;
+}
+
+.input-group-text {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding: 0.375rem 0.75rem;
+  margin-bottom: 0;
+  font-size: 0.875rem;
+  font-weight: 400;
+  line-height: 1.5;
+  color: #495057;
+  text-align: center;
+  white-space: nowrap;
+  background-color: #e9ecef;
+  border: 2px solid #ced4da;
+  border-radius: 4px;
+}
+
+.input-group-text input[type="radio"],
+.input-group-text input[type="checkbox"] {
+  margin-top: 0;
+}
+
+.input-group > .input-group-prepend > .btn,
+.input-group > .input-group-prepend > .input-group-text,
+.input-group > .input-group-append:not(:last-child) > .btn,
+.input-group > .input-group-append:not(:last-child) > .input-group-text,
+.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle),
+.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) {
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.input-group > .input-group-append > .btn,
+.input-group > .input-group-append > .input-group-text,
+.input-group > .input-group-prepend:not(:first-child) > .btn,
+.input-group > .input-group-prepend:not(:first-child) > .input-group-text,
+.input-group > .input-group-prepend:first-child > .btn:not(:first-child),
+.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) {
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.custom-control {
+  position: relative;
+  display: block;
+  min-height: 1.5rem;
+  padding-left: 1.5rem;
+}
+
+.custom-control-inline {
+  display: -webkit-inline-box;
+  display: -ms-inline-flexbox;
+  display: inline-flex;
+  margin-right: 1rem;
+}
+
+.custom-control-input {
+  position: absolute;
+  z-index: -1;
+  opacity: 0;
+}
+
+.custom-control-input:checked ~ .custom-control-label::before {
+  color: #FFF;
+  background-color: #009688;
+}
+
+.custom-control-input:focus ~ .custom-control-label::before {
+  -webkit-box-shadow: 0 0 0 1px #FFF, none;
+          box-shadow: 0 0 0 1px #FFF, none;
+}
+
+.custom-control-input:active ~ .custom-control-label::before {
+  color: #FFF;
+  background-color: #4affee;
+}
+
+.custom-control-input:disabled ~ .custom-control-label {
+  color: #6c757d;
+}
+
+.custom-control-input:disabled ~ .custom-control-label::before {
+  background-color: #e9ecef;
+}
+
+.custom-control-label {
+  position: relative;
+  margin-bottom: 0;
+}
+
+.custom-control-label::before {
+  position: absolute;
+  top: 0.25rem;
+  left: -1.5rem;
+  display: block;
+  width: 1rem;
+  height: 1rem;
+  pointer-events: none;
+  content: "";
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  background-color: #dee2e6;
+}
+
+.custom-control-label::after {
+  position: absolute;
+  top: 0.25rem;
+  left: -1.5rem;
+  display: block;
+  width: 1rem;
+  height: 1rem;
+  content: "";
+  background-repeat: no-repeat;
+  background-position: center center;
+  background-size: 50% 50%;
+}
+
+.custom-checkbox .custom-control-label::before {
+  border-radius: 0.25rem;
+}
+
+.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before {
+  background-color: #009688;
+}
+
+.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23FFF' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E");
+}
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before {
+  background-color: #009688;
+}
+
+.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23FFF' d='M0 2h4'/%3E%3C/svg%3E");
+}
+
+.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
+  background-color: rgba(0, 150, 136, 0.5);
+}
+
+.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before {
+  background-color: rgba(0, 150, 136, 0.5);
+}
+
+.custom-radio .custom-control-label::before {
+  border-radius: 50%;
+}
+
+.custom-radio .custom-control-input:checked ~ .custom-control-label::before {
+  background-color: #009688;
+}
+
+.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23FFF'/%3E%3C/svg%3E");
+}
+
+.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
+  background-color: rgba(0, 150, 136, 0.5);
+}
+
+.custom-select {
+  display: inline-block;
+  width: 100%;
+  height: calc(2.0625rem + 4px);
+  padding: 0.375rem 1.75rem 0.375rem 0.75rem;
+  line-height: 1.5;
+  color: #495057;
+  vertical-align: middle;
+  background: #FFF url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 5'%3E%3Cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3E%3C/svg%3E") no-repeat right 0.75rem center;
+  background-size: 8px 10px;
+  border: 2px solid #ced4da;
+  border-radius: 0.25rem;
+  -webkit-appearance: none;
+     -moz-appearance: none;
+          appearance: none;
+}
+
+.custom-select:focus {
+  border-color: #009688;
+  outline: 0;
+  -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(0, 150, 136, 0.5);
+          box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(0, 150, 136, 0.5);
+}
+
+.custom-select:focus::-ms-value {
+  color: #495057;
+  background-color: #FFF;
+}
+
+.custom-select[multiple], .custom-select[size]:not([size="1"]) {
+  height: auto;
+  padding-right: 0.75rem;
+  background-image: none;
+}
+
+.custom-select:disabled {
+  color: #6c757d;
+  background-color: #e9ecef;
+}
+
+.custom-select::-ms-expand {
+  opacity: 0;
+}
+
+.custom-select-sm {
+  height: calc(1.6484375rem + 4px);
+  padding-top: 0.375rem;
+  padding-bottom: 0.375rem;
+  font-size: 75%;
+}
+
+.custom-select-lg {
+  height: calc(2.640625rem + 4px);
+  padding-top: 0.375rem;
+  padding-bottom: 0.375rem;
+  font-size: 125%;
+}
+
+.custom-file {
+  position: relative;
+  display: inline-block;
+  width: 100%;
+  height: calc(2.0625rem + 4px);
+  margin-bottom: 0;
+}
+
+.custom-file-input {
+  position: relative;
+  z-index: 2;
+  width: 100%;
+  height: calc(2.0625rem + 4px);
+  margin: 0;
+  opacity: 0;
+}
+
+.custom-file-input:focus ~ .custom-file-label {
+  border-color: #009688;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.custom-file-input:focus ~ .custom-file-label::after {
+  border-color: #009688;
+}
+
+.custom-file-input:lang(en) ~ .custom-file-label::after {
+  content: "Browse";
+}
+
+.custom-file-label {
+  position: absolute;
+  top: 0;
+  right: 0;
+  left: 0;
+  z-index: 1;
+  height: calc(2.0625rem + 4px);
+  padding: 0.375rem 0.75rem;
+  line-height: 1.5;
+  color: #495057;
+  background-color: #FFF;
+  border: 2px solid #ced4da;
+  border-radius: 4px;
+}
+
+.custom-file-label::after {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  z-index: 3;
+  display: block;
+  height: 2.0625rem;
+  padding: 0.375rem 0.75rem;
+  line-height: 1.5;
+  color: #495057;
+  content: "Browse";
+  background-color: #e9ecef;
+  border-left: 2px solid #ced4da;
+  border-radius: 0 4px 4px 0;
+}
+
+.custom-range {
+  width: 100%;
+  padding-left: 0;
+  background-color: transparent;
+  -webkit-appearance: none;
+     -moz-appearance: none;
+          appearance: none;
+}
+
+.custom-range:focus {
+  outline: none;
+}
+
+.custom-range::-moz-focus-outer {
+  border: 0;
+}
+
+.custom-range::-webkit-slider-thumb {
+  width: 1rem;
+  height: 1rem;
+  margin-top: -0.25rem;
+  background-color: #009688;
+  border: 0;
+  border-radius: 1rem;
+  -webkit-appearance: none;
+          appearance: none;
+}
+
+.custom-range::-webkit-slider-thumb:focus {
+  outline: none;
+  -webkit-box-shadow: 0 0 0 1px #FFF, none;
+          box-shadow: 0 0 0 1px #FFF, none;
+}
+
+.custom-range::-webkit-slider-thumb:active {
+  background-color: #4affee;
+}
+
+.custom-range::-webkit-slider-runnable-track {
+  width: 100%;
+  height: 0.5rem;
+  color: transparent;
+  cursor: pointer;
+  background-color: #dee2e6;
+  border-color: transparent;
+  border-radius: 1rem;
+}
+
+.custom-range::-moz-range-thumb {
+  width: 1rem;
+  height: 1rem;
+  background-color: #009688;
+  border: 0;
+  border-radius: 1rem;
+  -moz-appearance: none;
+       appearance: none;
+}
+
+.custom-range::-moz-range-thumb:focus {
+  outline: none;
+  box-shadow: 0 0 0 1px #FFF, none;
+}
+
+.custom-range::-moz-range-thumb:active {
+  background-color: #4affee;
+}
+
+.custom-range::-moz-range-track {
+  width: 100%;
+  height: 0.5rem;
+  color: transparent;
+  cursor: pointer;
+  background-color: #dee2e6;
+  border-color: transparent;
+  border-radius: 1rem;
+}
+
+.custom-range::-ms-thumb {
+  width: 1rem;
+  height: 1rem;
+  background-color: #009688;
+  border: 0;
+  border-radius: 1rem;
+  appearance: none;
+}
+
+.custom-range::-ms-thumb:focus {
+  outline: none;
+  box-shadow: 0 0 0 1px #FFF, none;
+}
+
+.custom-range::-ms-thumb:active {
+  background-color: #4affee;
+}
+
+.custom-range::-ms-track {
+  width: 100%;
+  height: 0.5rem;
+  color: transparent;
+  cursor: pointer;
+  background-color: transparent;
+  border-color: transparent;
+  border-width: 0.5rem;
+}
+
+.custom-range::-ms-fill-lower {
+  background-color: #dee2e6;
+  border-radius: 1rem;
+}
+
+.custom-range::-ms-fill-upper {
+  margin-right: 15px;
+  background-color: #dee2e6;
+  border-radius: 1rem;
+}
+
+.nav {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+
+.nav-link {
+  display: block;
+  padding: 0.5rem 1rem;
+}
+
+.nav-link:hover, .nav-link:focus {
+  text-decoration: none;
+}
+
+.nav-link.disabled {
+  color: #6c757d;
+}
+
+.nav-tabs {
+  border-bottom: 1px solid #dee2e6;
+}
+
+.nav-tabs .nav-item {
+  margin-bottom: -1px;
+}
+
+.nav-tabs .nav-link {
+  border: 1px solid transparent;
+  border-top-left-radius: 0.25rem;
+  border-top-right-radius: 0.25rem;
+}
+
+.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
+  border-color: #e9ecef #e9ecef #dee2e6;
+}
+
+.nav-tabs .nav-link.disabled {
+  color: #6c757d;
+  background-color: transparent;
+  border-color: transparent;
+}
+
+.nav-tabs .nav-link.active,
+.nav-tabs .nav-item.show .nav-link {
+  color: #495057;
+  background-color: #FFF;
+  border-color: #dee2e6 #dee2e6 #FFF;
+}
+
+.nav-tabs .dropdown-menu {
+  margin-top: -1px;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.nav-pills .nav-link {
+  border-radius: 0.25rem;
+}
+
+.nav-pills .nav-link.active,
+.nav-pills .show > .nav-link {
+  color: #FFF;
+  background-color: #009688;
+}
+
+.nav-fill .nav-item {
+  -webkit-box-flex: 1;
+      -ms-flex: 1 1 auto;
+          flex: 1 1 auto;
+  text-align: center;
+}
+
+.nav-justified .nav-item {
+  -ms-flex-preferred-size: 0;
+      flex-basis: 0;
+  -webkit-box-flex: 1;
+      -ms-flex-positive: 1;
+          flex-grow: 1;
+  text-align: center;
+}
+
+.tab-content > .tab-pane {
+  display: none;
+}
+
+.tab-content > .active {
+  display: block;
+}
+
+.navbar {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: justify;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+  padding: 0.5rem 1rem;
+}
+
+.navbar > .container,
+.navbar > .container-fluid {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: justify;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+}
+
+.navbar-brand {
+  display: inline-block;
+  padding-top: 0.3359375rem;
+  padding-bottom: 0.3359375rem;
+  margin-right: 1rem;
+  font-size: 1.09375rem;
+  line-height: inherit;
+  white-space: nowrap;
+}
+
+.navbar-brand:hover, .navbar-brand:focus {
+  text-decoration: none;
+}
+
+.navbar-nav {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0;
+  list-style: none;
+}
+
+.navbar-nav .nav-link {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.navbar-nav .dropdown-menu {
+  position: static;
+  float: none;
+}
+
+.navbar-text {
+  display: inline-block;
+  padding-top: 0.5rem;
+  padding-bottom: 0.5rem;
+}
+
+.navbar-collapse {
+  -ms-flex-preferred-size: 100%;
+      flex-basis: 100%;
+  -webkit-box-flex: 1;
+      -ms-flex-positive: 1;
+          flex-grow: 1;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+}
+
+.navbar-toggler {
+  padding: 0.25rem 0.75rem;
+  font-size: 1.09375rem;
+  line-height: 1;
+  background-color: transparent;
+  border: 1px solid transparent;
+  border-radius: 3px;
+}
+
+.navbar-toggler:hover, .navbar-toggler:focus {
+  text-decoration: none;
+}
+
+.navbar-toggler:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+.navbar-toggler-icon {
+  display: inline-block;
+  width: 1.5em;
+  height: 1.5em;
+  vertical-align: middle;
+  content: "";
+  background: no-repeat center center;
+  background-size: 100% 100%;
+}
+
+@media (max-width: 575.98px) {
+  .navbar-expand-sm > .container,
+  .navbar-expand-sm > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 576px) {
+  .navbar-expand-sm {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-flow: row nowrap;
+            flex-flow: row nowrap;
+    -webkit-box-pack: start;
+        -ms-flex-pack: start;
+            justify-content: flex-start;
+  }
+  .navbar-expand-sm .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-direction: row;
+            flex-direction: row;
+  }
+  .navbar-expand-sm .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-sm .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-sm > .container,
+  .navbar-expand-sm > .container-fluid {
+    -ms-flex-wrap: nowrap;
+        flex-wrap: nowrap;
+  }
+  .navbar-expand-sm .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+        flex-basis: auto;
+  }
+  .navbar-expand-sm .navbar-toggler {
+    display: none;
+  }
+}
+
+@media (max-width: 767.98px) {
+  .navbar-expand-md > .container,
+  .navbar-expand-md > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 768px) {
+  .navbar-expand-md {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-flow: row nowrap;
+            flex-flow: row nowrap;
+    -webkit-box-pack: start;
+        -ms-flex-pack: start;
+            justify-content: flex-start;
+  }
+  .navbar-expand-md .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-direction: row;
+            flex-direction: row;
+  }
+  .navbar-expand-md .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-md .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-md > .container,
+  .navbar-expand-md > .container-fluid {
+    -ms-flex-wrap: nowrap;
+        flex-wrap: nowrap;
+  }
+  .navbar-expand-md .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+        flex-basis: auto;
+  }
+  .navbar-expand-md .navbar-toggler {
+    display: none;
+  }
+}
+
+@media (max-width: 991.98px) {
+  .navbar-expand-lg > .container,
+  .navbar-expand-lg > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 992px) {
+  .navbar-expand-lg {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-flow: row nowrap;
+            flex-flow: row nowrap;
+    -webkit-box-pack: start;
+        -ms-flex-pack: start;
+            justify-content: flex-start;
+  }
+  .navbar-expand-lg .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-direction: row;
+            flex-direction: row;
+  }
+  .navbar-expand-lg .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-lg .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-lg > .container,
+  .navbar-expand-lg > .container-fluid {
+    -ms-flex-wrap: nowrap;
+        flex-wrap: nowrap;
+  }
+  .navbar-expand-lg .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+        flex-basis: auto;
+  }
+  .navbar-expand-lg .navbar-toggler {
+    display: none;
+  }
+}
+
+@media (max-width: 1199.98px) {
+  .navbar-expand-xl > .container,
+  .navbar-expand-xl > .container-fluid {
+    padding-right: 0;
+    padding-left: 0;
+  }
+}
+
+@media (min-width: 1200px) {
+  .navbar-expand-xl {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-flow: row nowrap;
+            flex-flow: row nowrap;
+    -webkit-box-pack: start;
+        -ms-flex-pack: start;
+            justify-content: flex-start;
+  }
+  .navbar-expand-xl .navbar-nav {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-direction: row;
+            flex-direction: row;
+  }
+  .navbar-expand-xl .navbar-nav .dropdown-menu {
+    position: absolute;
+  }
+  .navbar-expand-xl .navbar-nav .nav-link {
+    padding-right: 0.5rem;
+    padding-left: 0.5rem;
+  }
+  .navbar-expand-xl > .container,
+  .navbar-expand-xl > .container-fluid {
+    -ms-flex-wrap: nowrap;
+        flex-wrap: nowrap;
+  }
+  .navbar-expand-xl .navbar-collapse {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+    -ms-flex-preferred-size: auto;
+        flex-basis: auto;
+  }
+  .navbar-expand-xl .navbar-toggler {
+    display: none;
+  }
+}
+
+.navbar-expand {
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+      -ms-flex-flow: row nowrap;
+          flex-flow: row nowrap;
+  -webkit-box-pack: start;
+      -ms-flex-pack: start;
+          justify-content: flex-start;
+}
+
+.navbar-expand > .container,
+.navbar-expand > .container-fluid {
+  padding-right: 0;
+  padding-left: 0;
+}
+
+.navbar-expand .navbar-nav {
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: row;
+          flex-direction: row;
+}
+
+.navbar-expand .navbar-nav .dropdown-menu {
+  position: absolute;
+}
+
+.navbar-expand .navbar-nav .nav-link {
+  padding-right: 0.5rem;
+  padding-left: 0.5rem;
+}
+
+.navbar-expand > .container,
+.navbar-expand > .container-fluid {
+  -ms-flex-wrap: nowrap;
+      flex-wrap: nowrap;
+}
+
+.navbar-expand .navbar-collapse {
+  display: -webkit-box !important;
+  display: -ms-flexbox !important;
+  display: flex !important;
+  -ms-flex-preferred-size: auto;
+      flex-basis: auto;
+}
+
+.navbar-expand .navbar-toggler {
+  display: none;
+}
+
+.navbar-light .navbar-brand {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-nav .nav-link {
+  color: rgba(0, 0, 0, 0.5);
+}
+
+.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus {
+  color: rgba(0, 0, 0, 0.7);
+}
+
+.navbar-light .navbar-nav .nav-link.disabled {
+  color: rgba(0, 0, 0, 0.3);
+}
+
+.navbar-light .navbar-nav .show > .nav-link,
+.navbar-light .navbar-nav .active > .nav-link,
+.navbar-light .navbar-nav .nav-link.show,
+.navbar-light .navbar-nav .nav-link.active {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-toggler {
+  color: rgba(0, 0, 0, 0.5);
+  border-color: rgba(0, 0, 0, 0.1);
+}
+
+.navbar-light .navbar-toggler-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
+}
+
+.navbar-light .navbar-text {
+  color: rgba(0, 0, 0, 0.5);
+}
+
+.navbar-light .navbar-text a {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus {
+  color: rgba(0, 0, 0, 0.9);
+}
+
+.navbar-dark .navbar-brand {
+  color: #FFF;
+}
+
+.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus {
+  color: #FFF;
+}
+
+.navbar-dark .navbar-nav .nav-link {
+  color: rgba(255, 255, 255, 0.5);
+}
+
+.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus {
+  color: rgba(255, 255, 255, 0.75);
+}
+
+.navbar-dark .navbar-nav .nav-link.disabled {
+  color: rgba(255, 255, 255, 0.25);
+}
+
+.navbar-dark .navbar-nav .show > .nav-link,
+.navbar-dark .navbar-nav .active > .nav-link,
+.navbar-dark .navbar-nav .nav-link.show,
+.navbar-dark .navbar-nav .nav-link.active {
+  color: #FFF;
+}
+
+.navbar-dark .navbar-toggler {
+  color: rgba(255, 255, 255, 0.5);
+  border-color: rgba(255, 255, 255, 0.1);
+}
+
+.navbar-dark .navbar-toggler-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E");
+}
+
+.navbar-dark .navbar-text {
+  color: rgba(255, 255, 255, 0.5);
+}
+
+.navbar-dark .navbar-text a {
+  color: #FFF;
+}
+
+.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus {
+  color: #FFF;
+}
+
+.card {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  min-width: 0;
+  word-wrap: break-word;
+  background-color: #FFF;
+  background-clip: border-box;
+  border: 1px solid rgba(0, 0, 0, 0.125);
+  border-radius: 0.25rem;
+}
+
+.card > hr {
+  margin-right: 0;
+  margin-left: 0;
+}
+
+.card > .list-group:first-child .list-group-item:first-child {
+  border-top-left-radius: 0.25rem;
+  border-top-right-radius: 0.25rem;
+}
+
+.card > .list-group:last-child .list-group-item:last-child {
+  border-bottom-right-radius: 0.25rem;
+  border-bottom-left-radius: 0.25rem;
+}
+
+.card-body {
+  -webkit-box-flex: 1;
+      -ms-flex: 1 1 auto;
+          flex: 1 1 auto;
+  padding: 1.25rem;
+}
+
+.card-title {
+  margin-bottom: 0.75rem;
+}
+
+.card-subtitle {
+  margin-top: -0.375rem;
+  margin-bottom: 0;
+}
+
+.card-text:last-child {
+  margin-bottom: 0;
+}
+
+.card-link:hover {
+  text-decoration: none;
+}
+
+.card-link + .card-link {
+  margin-left: 1.25rem;
+}
+
+.card-header {
+  padding: 0.75rem 1.25rem;
+  margin-bottom: 0;
+  background-color: rgba(0, 0, 0, 0.03);
+  border-bottom: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.card-header:first-child {
+  border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0;
+}
+
+.card-header + .list-group .list-group-item:first-child {
+  border-top: 0;
+}
+
+.card-footer {
+  padding: 0.75rem 1.25rem;
+  background-color: rgba(0, 0, 0, 0.03);
+  border-top: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.card-footer:last-child {
+  border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px);
+}
+
+.card-header-tabs {
+  margin-right: -0.625rem;
+  margin-bottom: -0.75rem;
+  margin-left: -0.625rem;
+  border-bottom: 0;
+}
+
+.card-header-pills {
+  margin-right: -0.625rem;
+  margin-left: -0.625rem;
+}
+
+.card-img-overlay {
+  position: absolute;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  padding: 1.25rem;
+}
+
+.card-img {
+  width: 100%;
+  border-radius: calc(0.25rem - 1px);
+}
+
+.card-img-top {
+  width: 100%;
+  border-top-left-radius: calc(0.25rem - 1px);
+  border-top-right-radius: calc(0.25rem - 1px);
+}
+
+.card-img-bottom {
+  width: 100%;
+  border-bottom-right-radius: calc(0.25rem - 1px);
+  border-bottom-left-radius: calc(0.25rem - 1px);
+}
+
+.card-deck {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+}
+
+.card-deck .card {
+  margin-bottom: 15px;
+}
+
+@media (min-width: 576px) {
+  .card-deck {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-flow: row wrap;
+            flex-flow: row wrap;
+    margin-right: -15px;
+    margin-left: -15px;
+  }
+  .card-deck .card {
+    display: -webkit-box;
+    display: -ms-flexbox;
+    display: flex;
+    -webkit-box-flex: 1;
+        -ms-flex: 1 0 0%;
+            flex: 1 0 0%;
+    -webkit-box-orient: vertical;
+    -webkit-box-direction: normal;
+        -ms-flex-direction: column;
+            flex-direction: column;
+    margin-right: 15px;
+    margin-bottom: 0;
+    margin-left: 15px;
+  }
+}
+
+.card-group {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+}
+
+.card-group > .card {
+  margin-bottom: 15px;
+}
+
+@media (min-width: 576px) {
+  .card-group {
+    -webkit-box-orient: horizontal;
+    -webkit-box-direction: normal;
+        -ms-flex-flow: row wrap;
+            flex-flow: row wrap;
+  }
+  .card-group > .card {
+    -webkit-box-flex: 1;
+        -ms-flex: 1 0 0%;
+            flex: 1 0 0%;
+    margin-bottom: 0;
+  }
+  .card-group > .card + .card {
+    margin-left: 0;
+    border-left: 0;
+  }
+  .card-group > .card:first-child {
+    border-top-right-radius: 0;
+    border-bottom-right-radius: 0;
+  }
+  .card-group > .card:first-child .card-img-top,
+  .card-group > .card:first-child .card-header {
+    border-top-right-radius: 0;
+  }
+  .card-group > .card:first-child .card-img-bottom,
+  .card-group > .card:first-child .card-footer {
+    border-bottom-right-radius: 0;
+  }
+  .card-group > .card:last-child {
+    border-top-left-radius: 0;
+    border-bottom-left-radius: 0;
+  }
+  .card-group > .card:last-child .card-img-top,
+  .card-group > .card:last-child .card-header {
+    border-top-left-radius: 0;
+  }
+  .card-group > .card:last-child .card-img-bottom,
+  .card-group > .card:last-child .card-footer {
+    border-bottom-left-radius: 0;
+  }
+  .card-group > .card:only-child {
+    border-radius: 0.25rem;
+  }
+  .card-group > .card:only-child .card-img-top,
+  .card-group > .card:only-child .card-header {
+    border-top-left-radius: 0.25rem;
+    border-top-right-radius: 0.25rem;
+  }
+  .card-group > .card:only-child .card-img-bottom,
+  .card-group > .card:only-child .card-footer {
+    border-bottom-right-radius: 0.25rem;
+    border-bottom-left-radius: 0.25rem;
+  }
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) {
+    border-radius: 0;
+  }
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top,
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom,
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header,
+  .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer {
+    border-radius: 0;
+  }
+}
+
+.card-columns .card {
+  margin-bottom: 0.75rem;
+}
+
+@media (min-width: 576px) {
+  .card-columns {
+    -webkit-column-count: 3;
+            column-count: 3;
+    -webkit-column-gap: 1.25rem;
+            column-gap: 1.25rem;
+    orphans: 1;
+    widows: 1;
+  }
+  .card-columns .card {
+    display: inline-block;
+    width: 100%;
+  }
+}
+
+.accordion .card:not(:first-of-type):not(:last-of-type) {
+  border-bottom: 0;
+  border-radius: 0;
+}
+
+.accordion .card:not(:first-of-type) .card-header:first-child {
+  border-radius: 0;
+}
+
+.accordion .card:first-of-type {
+  border-bottom: 0;
+  border-bottom-right-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.accordion .card:last-of-type {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.breadcrumb {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-wrap: wrap;
+      flex-wrap: wrap;
+  padding: 0.75rem 1rem;
+  margin-bottom: 1rem;
+  list-style: none;
+  background-color: #e9ecef;
+  border-radius: 0.25rem;
+}
+
+.breadcrumb-item + .breadcrumb-item {
+  padding-left: 0.5rem;
+}
+
+.breadcrumb-item + .breadcrumb-item::before {
+  display: inline-block;
+  padding-right: 0.5rem;
+  color: #6c757d;
+  content: "/";
+}
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+  text-decoration: underline;
+}
+
+.breadcrumb-item + .breadcrumb-item:hover::before {
+  text-decoration: none;
+}
+
+.breadcrumb-item.active {
+  color: #6c757d;
+}
+
+.pagination {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  padding-left: 0;
+  list-style: none;
+  border-radius: 0.25rem;
+}
+
+.page-link {
+  position: relative;
+  display: block;
+  padding: 0.5rem 0.75rem;
+  margin-left: -1px;
+  line-height: 1.25;
+  color: #009688;
+  background-color: #FFF;
+  border: 1px solid #dee2e6;
+}
+
+.page-link:hover {
+  z-index: 2;
+  color: #004a43;
+  text-decoration: none;
+  background-color: #e9ecef;
+  border-color: #dee2e6;
+}
+
+.page-link:focus {
+  z-index: 2;
+  outline: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.page-link:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+.page-item:first-child .page-link {
+  margin-left: 0;
+  border-top-left-radius: 0.25rem;
+  border-bottom-left-radius: 0.25rem;
+}
+
+.page-item:last-child .page-link {
+  border-top-right-radius: 0.25rem;
+  border-bottom-right-radius: 0.25rem;
+}
+
+.page-item.active .page-link {
+  z-index: 1;
+  color: #FFF;
+  background-color: #009688;
+  border-color: #009688;
+}
+
+.page-item.disabled .page-link {
+  color: #6c757d;
+  pointer-events: none;
+  cursor: auto;
+  background-color: #FFF;
+  border-color: #dee2e6;
+}
+
+.pagination-lg .page-link {
+  padding: 0.75rem 1.5rem;
+  font-size: 1.09375rem;
+  line-height: 1.5;
+}
+
+.pagination-lg .page-item:first-child .page-link {
+  border-top-left-radius: 0.3rem;
+  border-bottom-left-radius: 0.3rem;
+}
+
+.pagination-lg .page-item:last-child .page-link {
+  border-top-right-radius: 0.3rem;
+  border-bottom-right-radius: 0.3rem;
+}
+
+.pagination-sm .page-link {
+  padding: 0.25rem 0.5rem;
+  font-size: 0.765625rem;
+  line-height: 1.5;
+}
+
+.pagination-sm .page-item:first-child .page-link {
+  border-top-left-radius: 0.2rem;
+  border-bottom-left-radius: 0.2rem;
+}
+
+.pagination-sm .page-item:last-child .page-link {
+  border-top-right-radius: 0.2rem;
+  border-bottom-right-radius: 0.2rem;
+}
+
+.badge {
+  display: inline-block;
+  padding: 0.25em 0.4em;
+  font-size: 75%;
+  font-weight: 700;
+  line-height: 1;
+  text-align: center;
+  white-space: nowrap;
+  vertical-align: baseline;
+  border-radius: 0.25rem;
+}
+
+.badge:empty {
+  display: none;
+}
+
+.btn .badge {
+  position: relative;
+  top: -1px;
+}
+
+.badge-pill {
+  padding-right: 0.6em;
+  padding-left: 0.6em;
+  border-radius: 10rem;
+}
+
+.badge-primary {
+  color: #FFF;
+  background-color: #009688;
+}
+
+.badge-primary[href]:hover, .badge-primary[href]:focus {
+  color: #FFF;
+  text-decoration: none;
+  background-color: #00635a;
+}
+
+.badge-secondary {
+  color: #FFF;
+  background-color: #6c757d;
+}
+
+.badge-secondary[href]:hover, .badge-secondary[href]:focus {
+  color: #FFF;
+  text-decoration: none;
+  background-color: #545b62;
+}
+
+.badge-success {
+  color: #FFF;
+  background-color: #28a745;
+}
+
+.badge-success[href]:hover, .badge-success[href]:focus {
+  color: #FFF;
+  text-decoration: none;
+  background-color: #1e7e34;
+}
+
+.badge-info {
+  color: #FFF;
+  background-color: #17a2b8;
+}
+
+.badge-info[href]:hover, .badge-info[href]:focus {
+  color: #FFF;
+  text-decoration: none;
+  background-color: #117a8b;
+}
+
+.badge-warning {
+  color: #212529;
+  background-color: #ffc107;
+}
+
+.badge-warning[href]:hover, .badge-warning[href]:focus {
+  color: #212529;
+  text-decoration: none;
+  background-color: #d39e00;
+}
+
+.badge-danger {
+  color: #FFF;
+  background-color: #dc3545;
+}
+
+.badge-danger[href]:hover, .badge-danger[href]:focus {
+  color: #FFF;
+  text-decoration: none;
+  background-color: #bd2130;
+}
+
+.badge-light {
+  color: #212529;
+  background-color: #f8f9fa;
+}
+
+.badge-light[href]:hover, .badge-light[href]:focus {
+  color: #212529;
+  text-decoration: none;
+  background-color: #dae0e5;
+}
+
+.badge-dark {
+  color: #FFF;
+  background-color: #343a40;
+}
+
+.badge-dark[href]:hover, .badge-dark[href]:focus {
+  color: #FFF;
+  text-decoration: none;
+  background-color: #1d2124;
+}
+
+.jumbotron {
+  padding: 2rem 1rem;
+  margin-bottom: 2rem;
+  background-color: #e9ecef;
+  border-radius: 0.3rem;
+}
+
+@media (min-width: 576px) {
+  .jumbotron {
+    padding: 4rem 2rem;
+  }
+}
+
+.jumbotron-fluid {
+  padding-right: 0;
+  padding-left: 0;
+  border-radius: 0;
+}
+
+.alert {
+  position: relative;
+  padding: 0.75rem 1.25rem;
+  margin-bottom: 1rem;
+  border: 1px solid transparent;
+  border-radius: 0.25rem;
+}
+
+.alert-heading {
+  color: inherit;
+}
+
+.alert-link {
+  font-weight: 700;
+}
+
+.alert-dismissible {
+  padding-right: 3.8125rem;
+}
+
+.alert-dismissible .close {
+  position: absolute;
+  top: 0;
+  right: 0;
+  padding: 0.75rem 1.25rem;
+  color: inherit;
+}
+
+.alert-primary {
+  color: #004e47;
+  background-color: #cceae7;
+  border-color: #b8e2de;
+}
+
+.alert-primary hr {
+  border-top-color: #a6dbd6;
+}
+
+.alert-primary .alert-link {
+  color: #001b19;
+}
+
+.alert-secondary {
+  color: #383d41;
+  background-color: #e2e3e5;
+  border-color: #d6d8db;
+}
+
+.alert-secondary hr {
+  border-top-color: #c8cbcf;
+}
+
+.alert-secondary .alert-link {
+  color: #202326;
+}
+
+.alert-success {
+  color: #155724;
+  background-color: #d4edda;
+  border-color: #c3e6cb;
+}
+
+.alert-success hr {
+  border-top-color: #b1dfbb;
+}
+
+.alert-success .alert-link {
+  color: #0b2e13;
+}
+
+.alert-info {
+  color: #0c5460;
+  background-color: #d1ecf1;
+  border-color: #bee5eb;
+}
+
+.alert-info hr {
+  border-top-color: #abdde5;
+}
+
+.alert-info .alert-link {
+  color: #062c33;
+}
+
+.alert-warning {
+  color: #856404;
+  background-color: #fff3cd;
+  border-color: #ffeeba;
+}
+
+.alert-warning hr {
+  border-top-color: #ffe8a1;
+}
+
+.alert-warning .alert-link {
+  color: #533f03;
+}
+
+.alert-danger {
+  color: #721c24;
+  background-color: #f8d7da;
+  border-color: #f5c6cb;
+}
+
+.alert-danger hr {
+  border-top-color: #f1b0b7;
+}
+
+.alert-danger .alert-link {
+  color: #491217;
+}
+
+.alert-light {
+  color: #818182;
+  background-color: #fefefe;
+  border-color: #fdfdfe;
+}
+
+.alert-light hr {
+  border-top-color: #ececf6;
+}
+
+.alert-light .alert-link {
+  color: #686868;
+}
+
+.alert-dark {
+  color: #1b1e21;
+  background-color: #d6d8d9;
+  border-color: #c6c8ca;
+}
+
+.alert-dark hr {
+  border-top-color: #b9bbbe;
+}
+
+.alert-dark .alert-link {
+  color: #040505;
+}
+
+@-webkit-keyframes progress-bar-stripes {
+  from {
+    background-position: 1rem 0;
+  }
+  to {
+    background-position: 0 0;
+  }
+}
+
+@keyframes progress-bar-stripes {
+  from {
+    background-position: 1rem 0;
+  }
+  to {
+    background-position: 0 0;
+  }
+}
+
+.progress {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  height: 1rem;
+  overflow: hidden;
+  font-size: 0.65625rem;
+  background-color: #e9ecef;
+  border-radius: 0.25rem;
+}
+
+.progress-bar {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  color: #FFF;
+  text-align: center;
+  white-space: nowrap;
+  background-color: #009688;
+  -webkit-transition: width 0.6s ease;
+  -o-transition: width 0.6s ease;
+  transition: width 0.6s ease;
+}
+
+@media screen and (prefers-reduced-motion: reduce) {
+  .progress-bar {
+    -webkit-transition: none;
+    -o-transition: none;
+    transition: none;
+  }
+}
+
+.progress-bar-striped {
+  background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+  background-size: 1rem 1rem;
+}
+
+.progress-bar-animated {
+  -webkit-animation: progress-bar-stripes 1s linear infinite;
+          animation: progress-bar-stripes 1s linear infinite;
+}
+
+.media {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: start;
+      -ms-flex-align: start;
+          align-items: flex-start;
+}
+
+.media-body {
+  -webkit-box-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+}
+
+.list-group {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  padding-left: 0;
+  margin-bottom: 0;
+}
+
+.list-group-item-action {
+  width: 100%;
+  color: #495057;
+  text-align: inherit;
+}
+
+.list-group-item-action:hover, .list-group-item-action:focus {
+  color: #495057;
+  text-decoration: none;
+  background-color: #f8f9fa;
+}
+
+.list-group-item-action:active {
+  color: #212529;
+  background-color: #e9ecef;
+}
+
+.list-group-item {
+  position: relative;
+  display: block;
+  padding: 0.75rem 1.25rem;
+  margin-bottom: -1px;
+  background-color: #FFF;
+  border: 1px solid rgba(0, 0, 0, 0.125);
+}
+
+.list-group-item:first-child {
+  border-top-left-radius: 0.25rem;
+  border-top-right-radius: 0.25rem;
+}
+
+.list-group-item:last-child {
+  margin-bottom: 0;
+  border-bottom-right-radius: 0.25rem;
+  border-bottom-left-radius: 0.25rem;
+}
+
+.list-group-item:hover, .list-group-item:focus {
+  z-index: 1;
+  text-decoration: none;
+}
+
+.list-group-item.disabled, .list-group-item:disabled {
+  color: #6c757d;
+  background-color: #FFF;
+}
+
+.list-group-item.active {
+  z-index: 2;
+  color: #FFF;
+  background-color: #009688;
+  border-color: #009688;
+}
+
+.list-group-flush .list-group-item {
+  border-right: 0;
+  border-left: 0;
+  border-radius: 0;
+}
+
+.list-group-flush:first-child .list-group-item:first-child {
+  border-top: 0;
+}
+
+.list-group-flush:last-child .list-group-item:last-child {
+  border-bottom: 0;
+}
+
+.list-group-item-primary {
+  color: #004e47;
+  background-color: #b8e2de;
+}
+
+.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus {
+  color: #004e47;
+  background-color: #a6dbd6;
+}
+
+.list-group-item-primary.list-group-item-action.active {
+  color: #FFF;
+  background-color: #004e47;
+  border-color: #004e47;
+}
+
+.list-group-item-secondary {
+  color: #383d41;
+  background-color: #d6d8db;
+}
+
+.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus {
+  color: #383d41;
+  background-color: #c8cbcf;
+}
+
+.list-group-item-secondary.list-group-item-action.active {
+  color: #FFF;
+  background-color: #383d41;
+  border-color: #383d41;
+}
+
+.list-group-item-success {
+  color: #155724;
+  background-color: #c3e6cb;
+}
+
+.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus {
+  color: #155724;
+  background-color: #b1dfbb;
+}
+
+.list-group-item-success.list-group-item-action.active {
+  color: #FFF;
+  background-color: #155724;
+  border-color: #155724;
+}
+
+.list-group-item-info {
+  color: #0c5460;
+  background-color: #bee5eb;
+}
+
+.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus {
+  color: #0c5460;
+  background-color: #abdde5;
+}
+
+.list-group-item-info.list-group-item-action.active {
+  color: #FFF;
+  background-color: #0c5460;
+  border-color: #0c5460;
+}
+
+.list-group-item-warning {
+  color: #856404;
+  background-color: #ffeeba;
+}
+
+.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus {
+  color: #856404;
+  background-color: #ffe8a1;
+}
+
+.list-group-item-warning.list-group-item-action.active {
+  color: #FFF;
+  background-color: #856404;
+  border-color: #856404;
+}
+
+.list-group-item-danger {
+  color: #721c24;
+  background-color: #f5c6cb;
+}
+
+.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus {
+  color: #721c24;
+  background-color: #f1b0b7;
+}
+
+.list-group-item-danger.list-group-item-action.active {
+  color: #FFF;
+  background-color: #721c24;
+  border-color: #721c24;
+}
+
+.list-group-item-light {
+  color: #818182;
+  background-color: #fdfdfe;
+}
+
+.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus {
+  color: #818182;
+  background-color: #ececf6;
+}
+
+.list-group-item-light.list-group-item-action.active {
+  color: #FFF;
+  background-color: #818182;
+  border-color: #818182;
+}
+
+.list-group-item-dark {
+  color: #1b1e21;
+  background-color: #c6c8ca;
+}
+
+.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus {
+  color: #1b1e21;
+  background-color: #b9bbbe;
+}
+
+.list-group-item-dark.list-group-item-action.active {
+  color: #FFF;
+  background-color: #1b1e21;
+  border-color: #1b1e21;
+}
+
+.close {
+  float: right;
+  font-size: 1.3125rem;
+  font-weight: 700;
+  line-height: 1;
+  color: #000;
+  text-shadow: 0 1px 0 #FFF;
+  opacity: .5;
+}
+
+.close:hover, .close:focus {
+  color: #000;
+  text-decoration: none;
+  opacity: .75;
+}
+
+.close:not(:disabled):not(.disabled) {
+  cursor: pointer;
+}
+
+button.close {
+  padding: 0;
+  background-color: transparent;
+  border: 0;
+  -webkit-appearance: none;
+}
+
+.modal-open {
+  overflow: hidden;
+}
+
+.modal {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1050;
+  display: none;
+  overflow: hidden;
+  outline: 0;
+}
+
+.modal-open .modal {
+  overflow-x: hidden;
+  overflow-y: auto;
+}
+
+.modal-dialog {
+  position: relative;
+  width: auto;
+  margin: 0.5rem;
+  pointer-events: none;
+}
+
+.modal.fade .modal-dialog {
+  -webkit-transition: -webkit-transform 0.3s ease-out;
+  transition: -webkit-transform 0.3s ease-out;
+  -o-transition: transform 0.3s ease-out;
+  transition: transform 0.3s ease-out;
+  transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out;
+  -webkit-transform: translate(0, -25%);
+      -ms-transform: translate(0, -25%);
+          transform: translate(0, -25%);
+}
+
+@media screen and (prefers-reduced-motion: reduce) {
+  .modal.fade .modal-dialog {
+    -webkit-transition: none;
+    -o-transition: none;
+    transition: none;
+  }
+}
+
+.modal.show .modal-dialog {
+  -webkit-transform: translate(0, 0);
+      -ms-transform: translate(0, 0);
+          transform: translate(0, 0);
+}
+
+.modal-dialog-centered {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  min-height: calc(100% - (0.5rem * 2));
+}
+
+.modal-content {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  width: 100%;
+  pointer-events: auto;
+  background-color: #FFF;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.2);
+  border-radius: 0.3rem;
+  outline: 0;
+}
+
+.modal-backdrop {
+  position: fixed;
+  top: 0;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1040;
+  background-color: #000;
+}
+
+.modal-backdrop.fade {
+  opacity: 0;
+}
+
+.modal-backdrop.show {
+  opacity: 0.5;
+}
+
+.modal-header {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: start;
+      -ms-flex-align: start;
+          align-items: flex-start;
+  -webkit-box-pack: justify;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+  padding: 1rem;
+  border-bottom: 1px solid #e9ecef;
+  border-top-left-radius: 0.3rem;
+  border-top-right-radius: 0.3rem;
+}
+
+.modal-header .close {
+  padding: 1rem;
+  margin: -1rem -1rem -1rem auto;
+}
+
+.modal-title {
+  margin-bottom: 0;
+  line-height: 1.5;
+}
+
+.modal-body {
+  position: relative;
+  -webkit-box-flex: 1;
+      -ms-flex: 1 1 auto;
+          flex: 1 1 auto;
+  padding: 1rem;
+}
+
+.modal-footer {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: end;
+      -ms-flex-pack: end;
+          justify-content: flex-end;
+  padding: 1rem;
+  border-top: 1px solid #e9ecef;
+}
+
+.modal-footer > :not(:first-child) {
+  margin-left: .25rem;
+}
+
+.modal-footer > :not(:last-child) {
+  margin-right: .25rem;
+}
+
+.modal-scrollbar-measure {
+  position: absolute;
+  top: -9999px;
+  width: 50px;
+  height: 50px;
+  overflow: scroll;
+}
+
+@media (min-width: 576px) {
+  .modal-dialog {
+    max-width: 500px;
+    margin: 1.75rem auto;
+  }
+  .modal-dialog-centered {
+    min-height: calc(100% - (1.75rem * 2));
+  }
+  .modal-sm {
+    max-width: 300px;
+  }
+}
+
+@media (min-width: 992px) {
+  .modal-lg {
+    max-width: 800px;
+  }
+}
+
+.tooltip {
+  position: absolute;
+  z-index: 1070;
+  display: block;
+  margin: 0;
+  font-family: "Lato", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif;
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  white-space: normal;
+  line-break: auto;
+  font-size: 0.765625rem;
+  word-wrap: break-word;
+  opacity: 0;
+}
+
+.tooltip.show {
+  opacity: 0.9;
+}
+
+.tooltip .arrow {
+  position: absolute;
+  display: block;
+  width: 0.8rem;
+  height: 0.4rem;
+}
+
+.tooltip .arrow::before {
+  position: absolute;
+  content: "";
+  border-color: transparent;
+  border-style: solid;
+}
+
+.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] {
+  padding: 0.4rem 0;
+}
+
+.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow {
+  bottom: 0;
+}
+
+.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before {
+  top: 0;
+  border-width: 0.4rem 0.4rem 0;
+  border-top-color: #000;
+}
+
+.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] {
+  padding: 0 0.4rem;
+}
+
+.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow {
+  left: 0;
+  width: 0.4rem;
+  height: 0.8rem;
+}
+
+.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before {
+  right: 0;
+  border-width: 0.4rem 0.4rem 0.4rem 0;
+  border-right-color: #000;
+}
+
+.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] {
+  padding: 0.4rem 0;
+}
+
+.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow {
+  top: 0;
+}
+
+.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before {
+  bottom: 0;
+  border-width: 0 0.4rem 0.4rem;
+  border-bottom-color: #000;
+}
+
+.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] {
+  padding: 0 0.4rem;
+}
+
+.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow {
+  right: 0;
+  width: 0.4rem;
+  height: 0.8rem;
+}
+
+.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before {
+  left: 0;
+  border-width: 0.4rem 0 0.4rem 0.4rem;
+  border-left-color: #000;
+}
+
+.tooltip-inner {
+  max-width: 200px;
+  padding: 0.25rem 0.5rem;
+  color: #FFF;
+  text-align: center;
+  background-color: #000;
+  border-radius: 0.25rem;
+}
+
+.popover {
+  position: absolute;
+  top: 0;
+  left: 0;
+  z-index: 1060;
+  display: block;
+  max-width: 276px;
+  font-family: "Lato", -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif;
+  font-style: normal;
+  font-weight: 400;
+  line-height: 1.5;
+  text-align: left;
+  text-align: start;
+  text-decoration: none;
+  text-shadow: none;
+  text-transform: none;
+  letter-spacing: normal;
+  word-break: normal;
+  word-spacing: normal;
+  white-space: normal;
+  line-break: auto;
+  font-size: 0.765625rem;
+  word-wrap: break-word;
+  background-color: #FFF;
+  background-clip: padding-box;
+  border: 1px solid rgba(0, 0, 0, 0.2);
+  border-radius: 0.3rem;
+}
+
+.popover .arrow {
+  position: absolute;
+  display: block;
+  width: 1rem;
+  height: 0.5rem;
+  margin: 0 0.3rem;
+}
+
+.popover .arrow::before, .popover .arrow::after {
+  position: absolute;
+  display: block;
+  content: "";
+  border-color: transparent;
+  border-style: solid;
+}
+
+.bs-popover-top, .bs-popover-auto[x-placement^="top"] {
+  margin-bottom: 0.5rem;
+}
+
+.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow {
+  bottom: calc((0.5rem + 1px) * -1);
+}
+
+.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before,
+.bs-popover-top .arrow::after,
+.bs-popover-auto[x-placement^="top"] .arrow::after {
+  border-width: 0.5rem 0.5rem 0;
+}
+
+.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before {
+  bottom: 0;
+  border-top-color: rgba(0, 0, 0, 0.25);
+}
+
+
+.bs-popover-top .arrow::after,
+.bs-popover-auto[x-placement^="top"] .arrow::after {
+  bottom: 1px;
+  border-top-color: #FFF;
+}
+
+.bs-popover-right, .bs-popover-auto[x-placement^="right"] {
+  margin-left: 0.5rem;
+}
+
+.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow {
+  left: calc((0.5rem + 1px) * -1);
+  width: 0.5rem;
+  height: 1rem;
+  margin: 0.3rem 0;
+}
+
+.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before,
+.bs-popover-right .arrow::after,
+.bs-popover-auto[x-placement^="right"] .arrow::after {
+  border-width: 0.5rem 0.5rem 0.5rem 0;
+}
+
+.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before {
+  left: 0;
+  border-right-color: rgba(0, 0, 0, 0.25);
+}
+
+
+.bs-popover-right .arrow::after,
+.bs-popover-auto[x-placement^="right"] .arrow::after {
+  left: 1px;
+  border-right-color: #FFF;
+}
+
+.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] {
+  margin-top: 0.5rem;
+}
+
+.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow {
+  top: calc((0.5rem + 1px) * -1);
+}
+
+.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before,
+.bs-popover-bottom .arrow::after,
+.bs-popover-auto[x-placement^="bottom"] .arrow::after {
+  border-width: 0 0.5rem 0.5rem 0.5rem;
+}
+
+.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before {
+  top: 0;
+  border-bottom-color: rgba(0, 0, 0, 0.25);
+}
+
+
+.bs-popover-bottom .arrow::after,
+.bs-popover-auto[x-placement^="bottom"] .arrow::after {
+  top: 1px;
+  border-bottom-color: #FFF;
+}
+
+.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before {
+  position: absolute;
+  top: 0;
+  left: 50%;
+  display: block;
+  width: 1rem;
+  margin-left: -0.5rem;
+  content: "";
+  border-bottom: 1px solid #f7f7f7;
+}
+
+.bs-popover-left, .bs-popover-auto[x-placement^="left"] {
+  margin-right: 0.5rem;
+}
+
+.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow {
+  right: calc((0.5rem + 1px) * -1);
+  width: 0.5rem;
+  height: 1rem;
+  margin: 0.3rem 0;
+}
+
+.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before,
+.bs-popover-left .arrow::after,
+.bs-popover-auto[x-placement^="left"] .arrow::after {
+  border-width: 0.5rem 0 0.5rem 0.5rem;
+}
+
+.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before {
+  right: 0;
+  border-left-color: rgba(0, 0, 0, 0.25);
+}
+
+
+.bs-popover-left .arrow::after,
+.bs-popover-auto[x-placement^="left"] .arrow::after {
+  right: 1px;
+  border-left-color: #FFF;
+}
+
+.popover-header {
+  padding: 0.5rem 0.75rem;
+  margin-bottom: 0;
+  font-size: 0.875rem;
+  color: inherit;
+  background-color: #f7f7f7;
+  border-bottom: 1px solid #ebebeb;
+  border-top-left-radius: calc(0.3rem - 1px);
+  border-top-right-radius: calc(0.3rem - 1px);
+}
+
+.popover-header:empty {
+  display: none;
+}
+
+.popover-body {
+  padding: 0.5rem 0.75rem;
+  color: #212529;
+}
+
+.carousel {
+  position: relative;
+}
+
+.carousel-inner {
+  position: relative;
+  width: 100%;
+  overflow: hidden;
+}
+
+.carousel-item {
+  position: relative;
+  display: none;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  width: 100%;
+  -webkit-transition: -webkit-transform 0.6s ease;
+  transition: -webkit-transform 0.6s ease;
+  -o-transition: transform 0.6s ease;
+  transition: transform 0.6s ease;
+  transition: transform 0.6s ease, -webkit-transform 0.6s ease;
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  -webkit-perspective: 1000px;
+          perspective: 1000px;
+}
+
+@media screen and (prefers-reduced-motion: reduce) {
+  .carousel-item {
+    -webkit-transition: none;
+    -o-transition: none;
+    transition: none;
+  }
+}
+
+.carousel-item.active,
+.carousel-item-next,
+.carousel-item-prev {
+  display: block;
+}
+
+.carousel-item-next,
+.carousel-item-prev {
+  position: absolute;
+  top: 0;
+}
+
+.carousel-item-next.carousel-item-left,
+.carousel-item-prev.carousel-item-right {
+  -webkit-transform: translateX(0);
+      -ms-transform: translateX(0);
+          transform: translateX(0);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+  .carousel-item-next.carousel-item-left,
+  .carousel-item-prev.carousel-item-right {
+    -webkit-transform: translate3d(0, 0, 0);
+            transform: translate3d(0, 0, 0);
+  }
+}
+
+.carousel-item-next,
+.active.carousel-item-right {
+  -webkit-transform: translateX(100%);
+      -ms-transform: translateX(100%);
+          transform: translateX(100%);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+  .carousel-item-next,
+  .active.carousel-item-right {
+    -webkit-transform: translate3d(100%, 0, 0);
+            transform: translate3d(100%, 0, 0);
+  }
+}
+
+.carousel-item-prev,
+.active.carousel-item-left {
+  -webkit-transform: translateX(-100%);
+      -ms-transform: translateX(-100%);
+          transform: translateX(-100%);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+  .carousel-item-prev,
+  .active.carousel-item-left {
+    -webkit-transform: translate3d(-100%, 0, 0);
+            transform: translate3d(-100%, 0, 0);
+  }
+}
+
+.carousel-fade .carousel-item {
+  opacity: 0;
+  -webkit-transition-duration: .6s;
+       -o-transition-duration: .6s;
+          transition-duration: .6s;
+  -webkit-transition-property: opacity;
+  -o-transition-property: opacity;
+  transition-property: opacity;
+}
+
+.carousel-fade .carousel-item.active,
+.carousel-fade .carousel-item-next.carousel-item-left,
+.carousel-fade .carousel-item-prev.carousel-item-right {
+  opacity: 1;
+}
+
+.carousel-fade .active.carousel-item-left,
+.carousel-fade .active.carousel-item-right {
+  opacity: 0;
+}
+
+.carousel-fade .carousel-item-next,
+.carousel-fade .carousel-item-prev,
+.carousel-fade .carousel-item.active,
+.carousel-fade .active.carousel-item-left,
+.carousel-fade .active.carousel-item-prev {
+  -webkit-transform: translateX(0);
+      -ms-transform: translateX(0);
+          transform: translateX(0);
+}
+
+@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) {
+  .carousel-fade .carousel-item-next,
+  .carousel-fade .carousel-item-prev,
+  .carousel-fade .carousel-item.active,
+  .carousel-fade .active.carousel-item-left,
+  .carousel-fade .active.carousel-item-prev {
+    -webkit-transform: translate3d(0, 0, 0);
+            transform: translate3d(0, 0, 0);
+  }
+}
+
+.carousel-control-prev,
+.carousel-control-next {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  width: 15%;
+  color: #FFF;
+  text-align: center;
+  opacity: 0.5;
+}
+
+.carousel-control-prev:hover, .carousel-control-prev:focus,
+.carousel-control-next:hover,
+.carousel-control-next:focus {
+  color: #FFF;
+  text-decoration: none;
+  outline: 0;
+  opacity: .9;
+}
+
+.carousel-control-prev {
+  left: 0;
+}
+
+.carousel-control-next {
+  right: 0;
+}
+
+.carousel-control-prev-icon,
+.carousel-control-next-icon {
+  display: inline-block;
+  width: 20px;
+  height: 20px;
+  background: transparent no-repeat center center;
+  background-size: 100% 100%;
+}
+
+.carousel-control-prev-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23FFF' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E");
+}
+
+.carousel-control-next-icon {
+  background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23FFF' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E");
+}
+
+.carousel-indicators {
+  position: absolute;
+  right: 0;
+  bottom: 10px;
+  left: 0;
+  z-index: 15;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  padding-left: 0;
+  margin-right: 15%;
+  margin-left: 15%;
+  list-style: none;
+}
+
+.carousel-indicators li {
+  position: relative;
+  -webkit-box-flex: 0;
+      -ms-flex: 0 1 auto;
+          flex: 0 1 auto;
+  width: 30px;
+  height: 3px;
+  margin-right: 3px;
+  margin-left: 3px;
+  text-indent: -999px;
+  cursor: pointer;
+  background-color: rgba(255, 255, 255, 0.5);
+}
+
+.carousel-indicators li::before {
+  position: absolute;
+  top: -10px;
+  left: 0;
+  display: inline-block;
+  width: 100%;
+  height: 10px;
+  content: "";
+}
+
+.carousel-indicators li::after {
+  position: absolute;
+  bottom: -10px;
+  left: 0;
+  display: inline-block;
+  width: 100%;
+  height: 10px;
+  content: "";
+}
+
+.carousel-indicators .active {
+  background-color: #FFF;
+}
+
+.carousel-caption {
+  position: absolute;
+  right: 15%;
+  bottom: 20px;
+  left: 15%;
+  z-index: 10;
+  padding-top: 20px;
+  padding-bottom: 20px;
+  color: #FFF;
+  text-align: center;
+}
+
+.align-baseline {
+  vertical-align: baseline !important;
+}
+
+.align-top {
+  vertical-align: top !important;
+}
+
+.align-middle {
+  vertical-align: middle !important;
+}
+
+.align-bottom {
+  vertical-align: bottom !important;
+}
+
+.align-text-bottom {
+  vertical-align: text-bottom !important;
+}
+
+.align-text-top {
+  vertical-align: text-top !important;
+}
+
+.bg-primary {
+  background-color: #009688 !important;
+}
+
+a.bg-primary:hover, a.bg-primary:focus,
+button.bg-primary:hover,
+button.bg-primary:focus {
+  background-color: #00635a !important;
+}
+
+.bg-secondary {
+  background-color: #6c757d !important;
+}
+
+a.bg-secondary:hover, a.bg-secondary:focus,
+button.bg-secondary:hover,
+button.bg-secondary:focus {
+  background-color: #545b62 !important;
+}
+
+.bg-success {
+  background-color: #28a745 !important;
+}
+
+a.bg-success:hover, a.bg-success:focus,
+button.bg-success:hover,
+button.bg-success:focus {
+  background-color: #1e7e34 !important;
+}
+
+.bg-info {
+  background-color: #17a2b8 !important;
+}
+
+a.bg-info:hover, a.bg-info:focus,
+button.bg-info:hover,
+button.bg-info:focus {
+  background-color: #117a8b !important;
+}
+
+.bg-warning {
+  background-color: #ffc107 !important;
+}
+
+a.bg-warning:hover, a.bg-warning:focus,
+button.bg-warning:hover,
+button.bg-warning:focus {
+  background-color: #d39e00 !important;
+}
+
+.bg-danger {
+  background-color: #dc3545 !important;
+}
+
+a.bg-danger:hover, a.bg-danger:focus,
+button.bg-danger:hover,
+button.bg-danger:focus {
+  background-color: #bd2130 !important;
+}
+
+.bg-light {
+  background-color: #f8f9fa !important;
+}
+
+a.bg-light:hover, a.bg-light:focus,
+button.bg-light:hover,
+button.bg-light:focus {
+  background-color: #dae0e5 !important;
+}
+
+.bg-dark {
+  background-color: #343a40 !important;
+}
+
+a.bg-dark:hover, a.bg-dark:focus,
+button.bg-dark:hover,
+button.bg-dark:focus {
+  background-color: #1d2124 !important;
+}
+
+.bg-white {
+  background-color: #FFF !important;
+}
+
+.bg-transparent {
+  background-color: transparent !important;
+}
+
+.border {
+  border: 1px solid #dee2e6 !important;
+}
+
+.border-top {
+  border-top: 1px solid #dee2e6 !important;
+}
+
+.border-right {
+  border-right: 1px solid #dee2e6 !important;
+}
+
+.border-bottom {
+  border-bottom: 1px solid #dee2e6 !important;
+}
+
+.border-left {
+  border-left: 1px solid #dee2e6 !important;
+}
+
+.border-0 {
+  border: 0 !important;
+}
+
+.border-top-0 {
+  border-top: 0 !important;
+}
+
+.border-right-0 {
+  border-right: 0 !important;
+}
+
+.border-bottom-0 {
+  border-bottom: 0 !important;
+}
+
+.border-left-0 {
+  border-left: 0 !important;
+}
+
+.border-primary {
+  border-color: #009688 !important;
+}
+
+.border-secondary {
+  border-color: #6c757d !important;
+}
+
+.border-success {
+  border-color: #28a745 !important;
+}
+
+.border-info {
+  border-color: #17a2b8 !important;
+}
+
+.border-warning {
+  border-color: #ffc107 !important;
+}
+
+.border-danger {
+  border-color: #dc3545 !important;
+}
+
+.border-light {
+  border-color: #f8f9fa !important;
+}
+
+.border-dark {
+  border-color: #343a40 !important;
+}
+
+.border-white {
+  border-color: #FFF !important;
+}
+
+.rounded {
+  border-radius: 0.25rem !important;
+}
+
+.rounded-top {
+  border-top-left-radius: 0.25rem !important;
+  border-top-right-radius: 0.25rem !important;
+}
+
+.rounded-right {
+  border-top-right-radius: 0.25rem !important;
+  border-bottom-right-radius: 0.25rem !important;
+}
+
+.rounded-bottom {
+  border-bottom-right-radius: 0.25rem !important;
+  border-bottom-left-radius: 0.25rem !important;
+}
+
+.rounded-left {
+  border-top-left-radius: 0.25rem !important;
+  border-bottom-left-radius: 0.25rem !important;
+}
+
+.rounded-circle, .app-sidebar__user-avatar {
+  border-radius: 50% !important;
+}
+
+.rounded-0 {
+  border-radius: 0 !important;
+}
+
+.clearfix::after {
+  display: block;
+  clear: both;
+  content: "";
+}
+
+.d-none {
+  display: none !important;
+}
+
+.d-inline {
+  display: inline !important;
+}
+
+.d-inline-block {
+  display: inline-block !important;
+}
+
+.d-block {
+  display: block !important;
+}
+
+.d-table {
+  display: table !important;
+}
+
+.d-table-row {
+  display: table-row !important;
+}
+
+.d-table-cell {
+  display: table-cell !important;
+}
+
+.d-flex {
+  display: -webkit-box !important;
+  display: -ms-flexbox !important;
+  display: flex !important;
+}
+
+.d-inline-flex {
+  display: -webkit-inline-box !important;
+  display: -ms-inline-flexbox !important;
+  display: inline-flex !important;
+}
+
+@media (min-width: 576px) {
+  .d-sm-none {
+    display: none !important;
+  }
+  .d-sm-inline {
+    display: inline !important;
+  }
+  .d-sm-inline-block {
+    display: inline-block !important;
+  }
+  .d-sm-block {
+    display: block !important;
+  }
+  .d-sm-table {
+    display: table !important;
+  }
+  .d-sm-table-row {
+    display: table-row !important;
+  }
+  .d-sm-table-cell {
+    display: table-cell !important;
+  }
+  .d-sm-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-sm-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .d-md-none {
+    display: none !important;
+  }
+  .d-md-inline {
+    display: inline !important;
+  }
+  .d-md-inline-block {
+    display: inline-block !important;
+  }
+  .d-md-block {
+    display: block !important;
+  }
+  .d-md-table {
+    display: table !important;
+  }
+  .d-md-table-row {
+    display: table-row !important;
+  }
+  .d-md-table-cell {
+    display: table-cell !important;
+  }
+  .d-md-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-md-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .d-lg-none {
+    display: none !important;
+  }
+  .d-lg-inline {
+    display: inline !important;
+  }
+  .d-lg-inline-block {
+    display: inline-block !important;
+  }
+  .d-lg-block {
+    display: block !important;
+  }
+  .d-lg-table {
+    display: table !important;
+  }
+  .d-lg-table-row {
+    display: table-row !important;
+  }
+  .d-lg-table-cell {
+    display: table-cell !important;
+  }
+  .d-lg-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-lg-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .d-xl-none {
+    display: none !important;
+  }
+  .d-xl-inline {
+    display: inline !important;
+  }
+  .d-xl-inline-block {
+    display: inline-block !important;
+  }
+  .d-xl-block {
+    display: block !important;
+  }
+  .d-xl-table {
+    display: table !important;
+  }
+  .d-xl-table-row {
+    display: table-row !important;
+  }
+  .d-xl-table-cell {
+    display: table-cell !important;
+  }
+  .d-xl-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-xl-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+@media print {
+  .d-print-none {
+    display: none !important;
+  }
+  .d-print-inline {
+    display: inline !important;
+  }
+  .d-print-inline-block {
+    display: inline-block !important;
+  }
+  .d-print-block {
+    display: block !important;
+  }
+  .d-print-table {
+    display: table !important;
+  }
+  .d-print-table-row {
+    display: table-row !important;
+  }
+  .d-print-table-cell {
+    display: table-cell !important;
+  }
+  .d-print-flex {
+    display: -webkit-box !important;
+    display: -ms-flexbox !important;
+    display: flex !important;
+  }
+  .d-print-inline-flex {
+    display: -webkit-inline-box !important;
+    display: -ms-inline-flexbox !important;
+    display: inline-flex !important;
+  }
+}
+
+.embed-responsive {
+  position: relative;
+  display: block;
+  width: 100%;
+  padding: 0;
+  overflow: hidden;
+}
+
+.embed-responsive::before {
+  display: block;
+  content: "";
+}
+
+.embed-responsive .embed-responsive-item,
+.embed-responsive iframe,
+.embed-responsive embed,
+.embed-responsive object,
+.embed-responsive video {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  width: 100%;
+  height: 100%;
+  border: 0;
+}
+
+.embed-responsive-21by9::before {
+  padding-top: 42.8571428571%;
+}
+
+.embed-responsive-16by9::before {
+  padding-top: 56.25%;
+}
+
+.embed-responsive-4by3::before {
+  padding-top: 75%;
+}
+
+.embed-responsive-1by1::before {
+  padding-top: 100%;
+}
+
+.flex-row {
+  -webkit-box-orient: horizontal !important;
+  -webkit-box-direction: normal !important;
+      -ms-flex-direction: row !important;
+          flex-direction: row !important;
+}
+
+.flex-column {
+  -webkit-box-orient: vertical !important;
+  -webkit-box-direction: normal !important;
+      -ms-flex-direction: column !important;
+          flex-direction: column !important;
+}
+
+.flex-row-reverse {
+  -webkit-box-orient: horizontal !important;
+  -webkit-box-direction: reverse !important;
+      -ms-flex-direction: row-reverse !important;
+          flex-direction: row-reverse !important;
+}
+
+.flex-column-reverse {
+  -webkit-box-orient: vertical !important;
+  -webkit-box-direction: reverse !important;
+      -ms-flex-direction: column-reverse !important;
+          flex-direction: column-reverse !important;
+}
+
+.flex-wrap {
+  -ms-flex-wrap: wrap !important;
+      flex-wrap: wrap !important;
+}
+
+.flex-nowrap {
+  -ms-flex-wrap: nowrap !important;
+      flex-wrap: nowrap !important;
+}
+
+.flex-wrap-reverse {
+  -ms-flex-wrap: wrap-reverse !important;
+      flex-wrap: wrap-reverse !important;
+}
+
+.flex-fill {
+  -webkit-box-flex: 1 !important;
+      -ms-flex: 1 1 auto !important;
+          flex: 1 1 auto !important;
+}
+
+.flex-grow-0 {
+  -webkit-box-flex: 0 !important;
+      -ms-flex-positive: 0 !important;
+          flex-grow: 0 !important;
+}
+
+.flex-grow-1 {
+  -webkit-box-flex: 1 !important;
+      -ms-flex-positive: 1 !important;
+          flex-grow: 1 !important;
+}
+
+.flex-shrink-0 {
+  -ms-flex-negative: 0 !important;
+      flex-shrink: 0 !important;
+}
+
+.flex-shrink-1 {
+  -ms-flex-negative: 1 !important;
+      flex-shrink: 1 !important;
+}
+
+.justify-content-start {
+  -webkit-box-pack: start !important;
+      -ms-flex-pack: start !important;
+          justify-content: flex-start !important;
+}
+
+.justify-content-end {
+  -webkit-box-pack: end !important;
+      -ms-flex-pack: end !important;
+          justify-content: flex-end !important;
+}
+
+.justify-content-center {
+  -webkit-box-pack: center !important;
+      -ms-flex-pack: center !important;
+          justify-content: center !important;
+}
+
+.justify-content-between {
+  -webkit-box-pack: justify !important;
+      -ms-flex-pack: justify !important;
+          justify-content: space-between !important;
+}
+
+.justify-content-around {
+  -ms-flex-pack: distribute !important;
+      justify-content: space-around !important;
+}
+
+.align-items-start {
+  -webkit-box-align: start !important;
+      -ms-flex-align: start !important;
+          align-items: flex-start !important;
+}
+
+.align-items-end {
+  -webkit-box-align: end !important;
+      -ms-flex-align: end !important;
+          align-items: flex-end !important;
+}
+
+.align-items-center {
+  -webkit-box-align: center !important;
+      -ms-flex-align: center !important;
+          align-items: center !important;
+}
+
+.align-items-baseline {
+  -webkit-box-align: baseline !important;
+      -ms-flex-align: baseline !important;
+          align-items: baseline !important;
+}
+
+.align-items-stretch {
+  -webkit-box-align: stretch !important;
+      -ms-flex-align: stretch !important;
+          align-items: stretch !important;
+}
+
+.align-content-start {
+  -ms-flex-line-pack: start !important;
+      align-content: flex-start !important;
+}
+
+.align-content-end {
+  -ms-flex-line-pack: end !important;
+      align-content: flex-end !important;
+}
+
+.align-content-center {
+  -ms-flex-line-pack: center !important;
+      align-content: center !important;
+}
+
+.align-content-between {
+  -ms-flex-line-pack: justify !important;
+      align-content: space-between !important;
+}
+
+.align-content-around {
+  -ms-flex-line-pack: distribute !important;
+      align-content: space-around !important;
+}
+
+.align-content-stretch {
+  -ms-flex-line-pack: stretch !important;
+      align-content: stretch !important;
+}
+
+.align-self-auto {
+  -ms-flex-item-align: auto !important;
+      align-self: auto !important;
+}
+
+.align-self-start {
+  -ms-flex-item-align: start !important;
+      align-self: flex-start !important;
+}
+
+.align-self-end {
+  -ms-flex-item-align: end !important;
+      align-self: flex-end !important;
+}
+
+.align-self-center {
+  -ms-flex-item-align: center !important;
+      align-self: center !important;
+}
+
+.align-self-baseline {
+  -ms-flex-item-align: baseline !important;
+      align-self: baseline !important;
+}
+
+.align-self-stretch {
+  -ms-flex-item-align: stretch !important;
+      align-self: stretch !important;
+}
+
+@media (min-width: 576px) {
+  .flex-sm-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: row !important;
+            flex-direction: row !important;
+  }
+  .flex-sm-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: column !important;
+            flex-direction: column !important;
+  }
+  .flex-sm-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: row-reverse !important;
+            flex-direction: row-reverse !important;
+  }
+  .flex-sm-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: column-reverse !important;
+            flex-direction: column-reverse !important;
+  }
+  .flex-sm-wrap {
+    -ms-flex-wrap: wrap !important;
+        flex-wrap: wrap !important;
+  }
+  .flex-sm-nowrap {
+    -ms-flex-wrap: nowrap !important;
+        flex-wrap: nowrap !important;
+  }
+  .flex-sm-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+        flex-wrap: wrap-reverse !important;
+  }
+  .flex-sm-fill {
+    -webkit-box-flex: 1 !important;
+        -ms-flex: 1 1 auto !important;
+            flex: 1 1 auto !important;
+  }
+  .flex-sm-grow-0 {
+    -webkit-box-flex: 0 !important;
+        -ms-flex-positive: 0 !important;
+            flex-grow: 0 !important;
+  }
+  .flex-sm-grow-1 {
+    -webkit-box-flex: 1 !important;
+        -ms-flex-positive: 1 !important;
+            flex-grow: 1 !important;
+  }
+  .flex-sm-shrink-0 {
+    -ms-flex-negative: 0 !important;
+        flex-shrink: 0 !important;
+  }
+  .flex-sm-shrink-1 {
+    -ms-flex-negative: 1 !important;
+        flex-shrink: 1 !important;
+  }
+  .justify-content-sm-start {
+    -webkit-box-pack: start !important;
+        -ms-flex-pack: start !important;
+            justify-content: flex-start !important;
+  }
+  .justify-content-sm-end {
+    -webkit-box-pack: end !important;
+        -ms-flex-pack: end !important;
+            justify-content: flex-end !important;
+  }
+  .justify-content-sm-center {
+    -webkit-box-pack: center !important;
+        -ms-flex-pack: center !important;
+            justify-content: center !important;
+  }
+  .justify-content-sm-between {
+    -webkit-box-pack: justify !important;
+        -ms-flex-pack: justify !important;
+            justify-content: space-between !important;
+  }
+  .justify-content-sm-around {
+    -ms-flex-pack: distribute !important;
+        justify-content: space-around !important;
+  }
+  .align-items-sm-start {
+    -webkit-box-align: start !important;
+        -ms-flex-align: start !important;
+            align-items: flex-start !important;
+  }
+  .align-items-sm-end {
+    -webkit-box-align: end !important;
+        -ms-flex-align: end !important;
+            align-items: flex-end !important;
+  }
+  .align-items-sm-center {
+    -webkit-box-align: center !important;
+        -ms-flex-align: center !important;
+            align-items: center !important;
+  }
+  .align-items-sm-baseline {
+    -webkit-box-align: baseline !important;
+        -ms-flex-align: baseline !important;
+            align-items: baseline !important;
+  }
+  .align-items-sm-stretch {
+    -webkit-box-align: stretch !important;
+        -ms-flex-align: stretch !important;
+            align-items: stretch !important;
+  }
+  .align-content-sm-start {
+    -ms-flex-line-pack: start !important;
+        align-content: flex-start !important;
+  }
+  .align-content-sm-end {
+    -ms-flex-line-pack: end !important;
+        align-content: flex-end !important;
+  }
+  .align-content-sm-center {
+    -ms-flex-line-pack: center !important;
+        align-content: center !important;
+  }
+  .align-content-sm-between {
+    -ms-flex-line-pack: justify !important;
+        align-content: space-between !important;
+  }
+  .align-content-sm-around {
+    -ms-flex-line-pack: distribute !important;
+        align-content: space-around !important;
+  }
+  .align-content-sm-stretch {
+    -ms-flex-line-pack: stretch !important;
+        align-content: stretch !important;
+  }
+  .align-self-sm-auto {
+    -ms-flex-item-align: auto !important;
+        align-self: auto !important;
+  }
+  .align-self-sm-start {
+    -ms-flex-item-align: start !important;
+        align-self: flex-start !important;
+  }
+  .align-self-sm-end {
+    -ms-flex-item-align: end !important;
+        align-self: flex-end !important;
+  }
+  .align-self-sm-center {
+    -ms-flex-item-align: center !important;
+        align-self: center !important;
+  }
+  .align-self-sm-baseline {
+    -ms-flex-item-align: baseline !important;
+        align-self: baseline !important;
+  }
+  .align-self-sm-stretch {
+    -ms-flex-item-align: stretch !important;
+        align-self: stretch !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .flex-md-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: row !important;
+            flex-direction: row !important;
+  }
+  .flex-md-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: column !important;
+            flex-direction: column !important;
+  }
+  .flex-md-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: row-reverse !important;
+            flex-direction: row-reverse !important;
+  }
+  .flex-md-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: column-reverse !important;
+            flex-direction: column-reverse !important;
+  }
+  .flex-md-wrap {
+    -ms-flex-wrap: wrap !important;
+        flex-wrap: wrap !important;
+  }
+  .flex-md-nowrap {
+    -ms-flex-wrap: nowrap !important;
+        flex-wrap: nowrap !important;
+  }
+  .flex-md-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+        flex-wrap: wrap-reverse !important;
+  }
+  .flex-md-fill {
+    -webkit-box-flex: 1 !important;
+        -ms-flex: 1 1 auto !important;
+            flex: 1 1 auto !important;
+  }
+  .flex-md-grow-0 {
+    -webkit-box-flex: 0 !important;
+        -ms-flex-positive: 0 !important;
+            flex-grow: 0 !important;
+  }
+  .flex-md-grow-1 {
+    -webkit-box-flex: 1 !important;
+        -ms-flex-positive: 1 !important;
+            flex-grow: 1 !important;
+  }
+  .flex-md-shrink-0 {
+    -ms-flex-negative: 0 !important;
+        flex-shrink: 0 !important;
+  }
+  .flex-md-shrink-1 {
+    -ms-flex-negative: 1 !important;
+        flex-shrink: 1 !important;
+  }
+  .justify-content-md-start {
+    -webkit-box-pack: start !important;
+        -ms-flex-pack: start !important;
+            justify-content: flex-start !important;
+  }
+  .justify-content-md-end {
+    -webkit-box-pack: end !important;
+        -ms-flex-pack: end !important;
+            justify-content: flex-end !important;
+  }
+  .justify-content-md-center {
+    -webkit-box-pack: center !important;
+        -ms-flex-pack: center !important;
+            justify-content: center !important;
+  }
+  .justify-content-md-between {
+    -webkit-box-pack: justify !important;
+        -ms-flex-pack: justify !important;
+            justify-content: space-between !important;
+  }
+  .justify-content-md-around {
+    -ms-flex-pack: distribute !important;
+        justify-content: space-around !important;
+  }
+  .align-items-md-start {
+    -webkit-box-align: start !important;
+        -ms-flex-align: start !important;
+            align-items: flex-start !important;
+  }
+  .align-items-md-end {
+    -webkit-box-align: end !important;
+        -ms-flex-align: end !important;
+            align-items: flex-end !important;
+  }
+  .align-items-md-center {
+    -webkit-box-align: center !important;
+        -ms-flex-align: center !important;
+            align-items: center !important;
+  }
+  .align-items-md-baseline {
+    -webkit-box-align: baseline !important;
+        -ms-flex-align: baseline !important;
+            align-items: baseline !important;
+  }
+  .align-items-md-stretch {
+    -webkit-box-align: stretch !important;
+        -ms-flex-align: stretch !important;
+            align-items: stretch !important;
+  }
+  .align-content-md-start {
+    -ms-flex-line-pack: start !important;
+        align-content: flex-start !important;
+  }
+  .align-content-md-end {
+    -ms-flex-line-pack: end !important;
+        align-content: flex-end !important;
+  }
+  .align-content-md-center {
+    -ms-flex-line-pack: center !important;
+        align-content: center !important;
+  }
+  .align-content-md-between {
+    -ms-flex-line-pack: justify !important;
+        align-content: space-between !important;
+  }
+  .align-content-md-around {
+    -ms-flex-line-pack: distribute !important;
+        align-content: space-around !important;
+  }
+  .align-content-md-stretch {
+    -ms-flex-line-pack: stretch !important;
+        align-content: stretch !important;
+  }
+  .align-self-md-auto {
+    -ms-flex-item-align: auto !important;
+        align-self: auto !important;
+  }
+  .align-self-md-start {
+    -ms-flex-item-align: start !important;
+        align-self: flex-start !important;
+  }
+  .align-self-md-end {
+    -ms-flex-item-align: end !important;
+        align-self: flex-end !important;
+  }
+  .align-self-md-center {
+    -ms-flex-item-align: center !important;
+        align-self: center !important;
+  }
+  .align-self-md-baseline {
+    -ms-flex-item-align: baseline !important;
+        align-self: baseline !important;
+  }
+  .align-self-md-stretch {
+    -ms-flex-item-align: stretch !important;
+        align-self: stretch !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .flex-lg-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: row !important;
+            flex-direction: row !important;
+  }
+  .flex-lg-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: column !important;
+            flex-direction: column !important;
+  }
+  .flex-lg-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: row-reverse !important;
+            flex-direction: row-reverse !important;
+  }
+  .flex-lg-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: column-reverse !important;
+            flex-direction: column-reverse !important;
+  }
+  .flex-lg-wrap {
+    -ms-flex-wrap: wrap !important;
+        flex-wrap: wrap !important;
+  }
+  .flex-lg-nowrap {
+    -ms-flex-wrap: nowrap !important;
+        flex-wrap: nowrap !important;
+  }
+  .flex-lg-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+        flex-wrap: wrap-reverse !important;
+  }
+  .flex-lg-fill {
+    -webkit-box-flex: 1 !important;
+        -ms-flex: 1 1 auto !important;
+            flex: 1 1 auto !important;
+  }
+  .flex-lg-grow-0 {
+    -webkit-box-flex: 0 !important;
+        -ms-flex-positive: 0 !important;
+            flex-grow: 0 !important;
+  }
+  .flex-lg-grow-1 {
+    -webkit-box-flex: 1 !important;
+        -ms-flex-positive: 1 !important;
+            flex-grow: 1 !important;
+  }
+  .flex-lg-shrink-0 {
+    -ms-flex-negative: 0 !important;
+        flex-shrink: 0 !important;
+  }
+  .flex-lg-shrink-1 {
+    -ms-flex-negative: 1 !important;
+        flex-shrink: 1 !important;
+  }
+  .justify-content-lg-start {
+    -webkit-box-pack: start !important;
+        -ms-flex-pack: start !important;
+            justify-content: flex-start !important;
+  }
+  .justify-content-lg-end {
+    -webkit-box-pack: end !important;
+        -ms-flex-pack: end !important;
+            justify-content: flex-end !important;
+  }
+  .justify-content-lg-center {
+    -webkit-box-pack: center !important;
+        -ms-flex-pack: center !important;
+            justify-content: center !important;
+  }
+  .justify-content-lg-between {
+    -webkit-box-pack: justify !important;
+        -ms-flex-pack: justify !important;
+            justify-content: space-between !important;
+  }
+  .justify-content-lg-around {
+    -ms-flex-pack: distribute !important;
+        justify-content: space-around !important;
+  }
+  .align-items-lg-start {
+    -webkit-box-align: start !important;
+        -ms-flex-align: start !important;
+            align-items: flex-start !important;
+  }
+  .align-items-lg-end {
+    -webkit-box-align: end !important;
+        -ms-flex-align: end !important;
+            align-items: flex-end !important;
+  }
+  .align-items-lg-center {
+    -webkit-box-align: center !important;
+        -ms-flex-align: center !important;
+            align-items: center !important;
+  }
+  .align-items-lg-baseline {
+    -webkit-box-align: baseline !important;
+        -ms-flex-align: baseline !important;
+            align-items: baseline !important;
+  }
+  .align-items-lg-stretch {
+    -webkit-box-align: stretch !important;
+        -ms-flex-align: stretch !important;
+            align-items: stretch !important;
+  }
+  .align-content-lg-start {
+    -ms-flex-line-pack: start !important;
+        align-content: flex-start !important;
+  }
+  .align-content-lg-end {
+    -ms-flex-line-pack: end !important;
+        align-content: flex-end !important;
+  }
+  .align-content-lg-center {
+    -ms-flex-line-pack: center !important;
+        align-content: center !important;
+  }
+  .align-content-lg-between {
+    -ms-flex-line-pack: justify !important;
+        align-content: space-between !important;
+  }
+  .align-content-lg-around {
+    -ms-flex-line-pack: distribute !important;
+        align-content: space-around !important;
+  }
+  .align-content-lg-stretch {
+    -ms-flex-line-pack: stretch !important;
+        align-content: stretch !important;
+  }
+  .align-self-lg-auto {
+    -ms-flex-item-align: auto !important;
+        align-self: auto !important;
+  }
+  .align-self-lg-start {
+    -ms-flex-item-align: start !important;
+        align-self: flex-start !important;
+  }
+  .align-self-lg-end {
+    -ms-flex-item-align: end !important;
+        align-self: flex-end !important;
+  }
+  .align-self-lg-center {
+    -ms-flex-item-align: center !important;
+        align-self: center !important;
+  }
+  .align-self-lg-baseline {
+    -ms-flex-item-align: baseline !important;
+        align-self: baseline !important;
+  }
+  .align-self-lg-stretch {
+    -ms-flex-item-align: stretch !important;
+        align-self: stretch !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .flex-xl-row {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: row !important;
+            flex-direction: row !important;
+  }
+  .flex-xl-column {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: normal !important;
+        -ms-flex-direction: column !important;
+            flex-direction: column !important;
+  }
+  .flex-xl-row-reverse {
+    -webkit-box-orient: horizontal !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: row-reverse !important;
+            flex-direction: row-reverse !important;
+  }
+  .flex-xl-column-reverse {
+    -webkit-box-orient: vertical !important;
+    -webkit-box-direction: reverse !important;
+        -ms-flex-direction: column-reverse !important;
+            flex-direction: column-reverse !important;
+  }
+  .flex-xl-wrap {
+    -ms-flex-wrap: wrap !important;
+        flex-wrap: wrap !important;
+  }
+  .flex-xl-nowrap {
+    -ms-flex-wrap: nowrap !important;
+        flex-wrap: nowrap !important;
+  }
+  .flex-xl-wrap-reverse {
+    -ms-flex-wrap: wrap-reverse !important;
+        flex-wrap: wrap-reverse !important;
+  }
+  .flex-xl-fill {
+    -webkit-box-flex: 1 !important;
+        -ms-flex: 1 1 auto !important;
+            flex: 1 1 auto !important;
+  }
+  .flex-xl-grow-0 {
+    -webkit-box-flex: 0 !important;
+        -ms-flex-positive: 0 !important;
+            flex-grow: 0 !important;
+  }
+  .flex-xl-grow-1 {
+    -webkit-box-flex: 1 !important;
+        -ms-flex-positive: 1 !important;
+            flex-grow: 1 !important;
+  }
+  .flex-xl-shrink-0 {
+    -ms-flex-negative: 0 !important;
+        flex-shrink: 0 !important;
+  }
+  .flex-xl-shrink-1 {
+    -ms-flex-negative: 1 !important;
+        flex-shrink: 1 !important;
+  }
+  .justify-content-xl-start {
+    -webkit-box-pack: start !important;
+        -ms-flex-pack: start !important;
+            justify-content: flex-start !important;
+  }
+  .justify-content-xl-end {
+    -webkit-box-pack: end !important;
+        -ms-flex-pack: end !important;
+            justify-content: flex-end !important;
+  }
+  .justify-content-xl-center {
+    -webkit-box-pack: center !important;
+        -ms-flex-pack: center !important;
+            justify-content: center !important;
+  }
+  .justify-content-xl-between {
+    -webkit-box-pack: justify !important;
+        -ms-flex-pack: justify !important;
+            justify-content: space-between !important;
+  }
+  .justify-content-xl-around {
+    -ms-flex-pack: distribute !important;
+        justify-content: space-around !important;
+  }
+  .align-items-xl-start {
+    -webkit-box-align: start !important;
+        -ms-flex-align: start !important;
+            align-items: flex-start !important;
+  }
+  .align-items-xl-end {
+    -webkit-box-align: end !important;
+        -ms-flex-align: end !important;
+            align-items: flex-end !important;
+  }
+  .align-items-xl-center {
+    -webkit-box-align: center !important;
+        -ms-flex-align: center !important;
+            align-items: center !important;
+  }
+  .align-items-xl-baseline {
+    -webkit-box-align: baseline !important;
+        -ms-flex-align: baseline !important;
+            align-items: baseline !important;
+  }
+  .align-items-xl-stretch {
+    -webkit-box-align: stretch !important;
+        -ms-flex-align: stretch !important;
+            align-items: stretch !important;
+  }
+  .align-content-xl-start {
+    -ms-flex-line-pack: start !important;
+        align-content: flex-start !important;
+  }
+  .align-content-xl-end {
+    -ms-flex-line-pack: end !important;
+        align-content: flex-end !important;
+  }
+  .align-content-xl-center {
+    -ms-flex-line-pack: center !important;
+        align-content: center !important;
+  }
+  .align-content-xl-between {
+    -ms-flex-line-pack: justify !important;
+        align-content: space-between !important;
+  }
+  .align-content-xl-around {
+    -ms-flex-line-pack: distribute !important;
+        align-content: space-around !important;
+  }
+  .align-content-xl-stretch {
+    -ms-flex-line-pack: stretch !important;
+        align-content: stretch !important;
+  }
+  .align-self-xl-auto {
+    -ms-flex-item-align: auto !important;
+        align-self: auto !important;
+  }
+  .align-self-xl-start {
+    -ms-flex-item-align: start !important;
+        align-self: flex-start !important;
+  }
+  .align-self-xl-end {
+    -ms-flex-item-align: end !important;
+        align-self: flex-end !important;
+  }
+  .align-self-xl-center {
+    -ms-flex-item-align: center !important;
+        align-self: center !important;
+  }
+  .align-self-xl-baseline {
+    -ms-flex-item-align: baseline !important;
+        align-self: baseline !important;
+  }
+  .align-self-xl-stretch {
+    -ms-flex-item-align: stretch !important;
+        align-self: stretch !important;
+  }
+}
+
+.float-left {
+  float: left !important;
+}
+
+.float-right {
+  float: right !important;
+}
+
+.float-none {
+  float: none !important;
+}
+
+@media (min-width: 576px) {
+  .float-sm-left {
+    float: left !important;
+  }
+  .float-sm-right {
+    float: right !important;
+  }
+  .float-sm-none {
+    float: none !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .float-md-left {
+    float: left !important;
+  }
+  .float-md-right {
+    float: right !important;
+  }
+  .float-md-none {
+    float: none !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .float-lg-left {
+    float: left !important;
+  }
+  .float-lg-right {
+    float: right !important;
+  }
+  .float-lg-none {
+    float: none !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .float-xl-left {
+    float: left !important;
+  }
+  .float-xl-right {
+    float: right !important;
+  }
+  .float-xl-none {
+    float: none !important;
+  }
+}
+
+.position-static {
+  position: static !important;
+}
+
+.position-relative {
+  position: relative !important;
+}
+
+.position-absolute {
+  position: absolute !important;
+}
+
+.position-fixed {
+  position: fixed !important;
+}
+
+.position-sticky {
+  position: -webkit-sticky !important;
+  position: sticky !important;
+}
+
+.fixed-top {
+  position: fixed;
+  top: 0;
+  right: 0;
+  left: 0;
+  z-index: 1030;
+}
+
+.fixed-bottom {
+  position: fixed;
+  right: 0;
+  bottom: 0;
+  left: 0;
+  z-index: 1030;
+}
+
+@supports ((position: -webkit-sticky) or (position: sticky)) {
+  .sticky-top {
+    position: -webkit-sticky;
+    position: sticky;
+    top: 0;
+    z-index: 1020;
+  }
+}
+
+.sr-only {
+  position: absolute;
+  width: 1px;
+  height: 1px;
+  padding: 0;
+  overflow: hidden;
+  clip: rect(0, 0, 0, 0);
+  white-space: nowrap;
+  border: 0;
+}
+
+.sr-only-focusable:active, .sr-only-focusable:focus {
+  position: static;
+  width: auto;
+  height: auto;
+  overflow: visible;
+  clip: auto;
+  white-space: normal;
+}
+
+.shadow-sm {
+  -webkit-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important;
+          box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important;
+}
+
+.shadow {
+  -webkit-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important;
+          box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important;
+}
+
+.shadow-lg {
+  -webkit-box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important;
+          box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important;
+}
+
+.shadow-none {
+  -webkit-box-shadow: none !important;
+          box-shadow: none !important;
+}
+
+.w-25 {
+  width: 25% !important;
+}
+
+.w-50 {
+  width: 50% !important;
+}
+
+.w-75 {
+  width: 75% !important;
+}
+
+.w-100 {
+  width: 100% !important;
+}
+
+.w-auto {
+  width: auto !important;
+}
+
+.h-25 {
+  height: 25% !important;
+}
+
+.h-50 {
+  height: 50% !important;
+}
+
+.h-75 {
+  height: 75% !important;
+}
+
+.h-100 {
+  height: 100% !important;
+}
+
+.h-auto {
+  height: auto !important;
+}
+
+.mw-100 {
+  max-width: 100% !important;
+}
+
+.mh-100 {
+  max-height: 100% !important;
+}
+
+.m-0 {
+  margin: 0 !important;
+}
+
+.mt-0,
+.my-0 {
+  margin-top: 0 !important;
+}
+
+.mr-0,
+.mx-0 {
+  margin-right: 0 !important;
+}
+
+.mb-0,
+.my-0 {
+  margin-bottom: 0 !important;
+}
+
+.ml-0,
+.mx-0 {
+  margin-left: 0 !important;
+}
+
+.m-1 {
+  margin: 0.25rem !important;
+}
+
+.mt-1,
+.my-1 {
+  margin-top: 0.25rem !important;
+}
+
+.mr-1,
+.mx-1 {
+  margin-right: 0.25rem !important;
+}
+
+.mb-1,
+.my-1 {
+  margin-bottom: 0.25rem !important;
+}
+
+.ml-1,
+.mx-1 {
+  margin-left: 0.25rem !important;
+}
+
+.m-2 {
+  margin: 0.5rem !important;
+}
+
+.mt-2,
+.my-2 {
+  margin-top: 0.5rem !important;
+}
+
+.mr-2,
+.mx-2 {
+  margin-right: 0.5rem !important;
+}
+
+.mb-2,
+.my-2 {
+  margin-bottom: 0.5rem !important;
+}
+
+.ml-2,
+.mx-2 {
+  margin-left: 0.5rem !important;
+}
+
+.m-3 {
+  margin: 1rem !important;
+}
+
+.mt-3,
+.my-3 {
+  margin-top: 1rem !important;
+}
+
+.mr-3,
+.mx-3 {
+  margin-right: 1rem !important;
+}
+
+.mb-3,
+.my-3 {
+  margin-bottom: 1rem !important;
+}
+
+.ml-3,
+.mx-3 {
+  margin-left: 1rem !important;
+}
+
+.m-4 {
+  margin: 1.5rem !important;
+}
+
+.mt-4,
+.my-4 {
+  margin-top: 1.5rem !important;
+}
+
+.mr-4,
+.mx-4 {
+  margin-right: 1.5rem !important;
+}
+
+.mb-4,
+.my-4 {
+  margin-bottom: 1.5rem !important;
+}
+
+.ml-4,
+.mx-4 {
+  margin-left: 1.5rem !important;
+}
+
+.m-5 {
+  margin: 3rem !important;
+}
+
+.mt-5,
+.my-5 {
+  margin-top: 3rem !important;
+}
+
+.mr-5,
+.mx-5 {
+  margin-right: 3rem !important;
+}
+
+.mb-5,
+.my-5 {
+  margin-bottom: 3rem !important;
+}
+
+.ml-5,
+.mx-5 {
+  margin-left: 3rem !important;
+}
+
+.p-0 {
+  padding: 0 !important;
+}
+
+.pt-0,
+.py-0 {
+  padding-top: 0 !important;
+}
+
+.pr-0,
+.px-0 {
+  padding-right: 0 !important;
+}
+
+.pb-0,
+.py-0 {
+  padding-bottom: 0 !important;
+}
+
+.pl-0,
+.px-0 {
+  padding-left: 0 !important;
+}
+
+.p-1 {
+  padding: 0.25rem !important;
+}
+
+.pt-1,
+.py-1 {
+  padding-top: 0.25rem !important;
+}
+
+.pr-1,
+.px-1 {
+  padding-right: 0.25rem !important;
+}
+
+.pb-1,
+.py-1 {
+  padding-bottom: 0.25rem !important;
+}
+
+.pl-1,
+.px-1 {
+  padding-left: 0.25rem !important;
+}
+
+.p-2 {
+  padding: 0.5rem !important;
+}
+
+.pt-2,
+.py-2 {
+  padding-top: 0.5rem !important;
+}
+
+.pr-2,
+.px-2 {
+  padding-right: 0.5rem !important;
+}
+
+.pb-2,
+.py-2 {
+  padding-bottom: 0.5rem !important;
+}
+
+.pl-2,
+.px-2 {
+  padding-left: 0.5rem !important;
+}
+
+.p-3 {
+  padding: 1rem !important;
+}
+
+.pt-3,
+.py-3 {
+  padding-top: 1rem !important;
+}
+
+.pr-3,
+.px-3 {
+  padding-right: 1rem !important;
+}
+
+.pb-3,
+.py-3 {
+  padding-bottom: 1rem !important;
+}
+
+.pl-3,
+.px-3 {
+  padding-left: 1rem !important;
+}
+
+.p-4 {
+  padding: 1.5rem !important;
+}
+
+.pt-4,
+.py-4 {
+  padding-top: 1.5rem !important;
+}
+
+.pr-4,
+.px-4 {
+  padding-right: 1.5rem !important;
+}
+
+.pb-4,
+.py-4 {
+  padding-bottom: 1.5rem !important;
+}
+
+.pl-4,
+.px-4 {
+  padding-left: 1.5rem !important;
+}
+
+.p-5 {
+  padding: 3rem !important;
+}
+
+.pt-5,
+.py-5 {
+  padding-top: 3rem !important;
+}
+
+.pr-5,
+.px-5 {
+  padding-right: 3rem !important;
+}
+
+.pb-5,
+.py-5 {
+  padding-bottom: 3rem !important;
+}
+
+.pl-5,
+.px-5 {
+  padding-left: 3rem !important;
+}
+
+.m-auto {
+  margin: auto !important;
+}
+
+.mt-auto,
+.my-auto {
+  margin-top: auto !important;
+}
+
+.mr-auto,
+.mx-auto {
+  margin-right: auto !important;
+}
+
+.mb-auto,
+.my-auto {
+  margin-bottom: auto !important;
+}
+
+.ml-auto,
+.mx-auto {
+  margin-left: auto !important;
+}
+
+@media (min-width: 576px) {
+  .m-sm-0 {
+    margin: 0 !important;
+  }
+  .mt-sm-0,
+  .my-sm-0 {
+    margin-top: 0 !important;
+  }
+  .mr-sm-0,
+  .mx-sm-0 {
+    margin-right: 0 !important;
+  }
+  .mb-sm-0,
+  .my-sm-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-sm-0,
+  .mx-sm-0 {
+    margin-left: 0 !important;
+  }
+  .m-sm-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-sm-1,
+  .my-sm-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-sm-1,
+  .mx-sm-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-sm-1,
+  .my-sm-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-sm-1,
+  .mx-sm-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-sm-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-sm-2,
+  .my-sm-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-sm-2,
+  .mx-sm-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-sm-2,
+  .my-sm-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-sm-2,
+  .mx-sm-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-sm-3 {
+    margin: 1rem !important;
+  }
+  .mt-sm-3,
+  .my-sm-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-sm-3,
+  .mx-sm-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-sm-3,
+  .my-sm-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-sm-3,
+  .mx-sm-3 {
+    margin-left: 1rem !important;
+  }
+  .m-sm-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-sm-4,
+  .my-sm-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-sm-4,
+  .mx-sm-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-sm-4,
+  .my-sm-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-sm-4,
+  .mx-sm-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-sm-5 {
+    margin: 3rem !important;
+  }
+  .mt-sm-5,
+  .my-sm-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-sm-5,
+  .mx-sm-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-sm-5,
+  .my-sm-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-sm-5,
+  .mx-sm-5 {
+    margin-left: 3rem !important;
+  }
+  .p-sm-0 {
+    padding: 0 !important;
+  }
+  .pt-sm-0,
+  .py-sm-0 {
+    padding-top: 0 !important;
+  }
+  .pr-sm-0,
+  .px-sm-0 {
+    padding-right: 0 !important;
+  }
+  .pb-sm-0,
+  .py-sm-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-sm-0,
+  .px-sm-0 {
+    padding-left: 0 !important;
+  }
+  .p-sm-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-sm-1,
+  .py-sm-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-sm-1,
+  .px-sm-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-sm-1,
+  .py-sm-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-sm-1,
+  .px-sm-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-sm-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-sm-2,
+  .py-sm-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-sm-2,
+  .px-sm-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-sm-2,
+  .py-sm-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-sm-2,
+  .px-sm-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-sm-3 {
+    padding: 1rem !important;
+  }
+  .pt-sm-3,
+  .py-sm-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-sm-3,
+  .px-sm-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-sm-3,
+  .py-sm-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-sm-3,
+  .px-sm-3 {
+    padding-left: 1rem !important;
+  }
+  .p-sm-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-sm-4,
+  .py-sm-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-sm-4,
+  .px-sm-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-sm-4,
+  .py-sm-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-sm-4,
+  .px-sm-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-sm-5 {
+    padding: 3rem !important;
+  }
+  .pt-sm-5,
+  .py-sm-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-sm-5,
+  .px-sm-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-sm-5,
+  .py-sm-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-sm-5,
+  .px-sm-5 {
+    padding-left: 3rem !important;
+  }
+  .m-sm-auto {
+    margin: auto !important;
+  }
+  .mt-sm-auto,
+  .my-sm-auto {
+    margin-top: auto !important;
+  }
+  .mr-sm-auto,
+  .mx-sm-auto {
+    margin-right: auto !important;
+  }
+  .mb-sm-auto,
+  .my-sm-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-sm-auto,
+  .mx-sm-auto {
+    margin-left: auto !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .m-md-0 {
+    margin: 0 !important;
+  }
+  .mt-md-0,
+  .my-md-0 {
+    margin-top: 0 !important;
+  }
+  .mr-md-0,
+  .mx-md-0 {
+    margin-right: 0 !important;
+  }
+  .mb-md-0,
+  .my-md-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-md-0,
+  .mx-md-0 {
+    margin-left: 0 !important;
+  }
+  .m-md-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-md-1,
+  .my-md-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-md-1,
+  .mx-md-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-md-1,
+  .my-md-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-md-1,
+  .mx-md-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-md-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-md-2,
+  .my-md-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-md-2,
+  .mx-md-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-md-2,
+  .my-md-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-md-2,
+  .mx-md-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-md-3 {
+    margin: 1rem !important;
+  }
+  .mt-md-3,
+  .my-md-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-md-3,
+  .mx-md-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-md-3,
+  .my-md-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-md-3,
+  .mx-md-3 {
+    margin-left: 1rem !important;
+  }
+  .m-md-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-md-4,
+  .my-md-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-md-4,
+  .mx-md-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-md-4,
+  .my-md-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-md-4,
+  .mx-md-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-md-5 {
+    margin: 3rem !important;
+  }
+  .mt-md-5,
+  .my-md-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-md-5,
+  .mx-md-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-md-5,
+  .my-md-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-md-5,
+  .mx-md-5 {
+    margin-left: 3rem !important;
+  }
+  .p-md-0 {
+    padding: 0 !important;
+  }
+  .pt-md-0,
+  .py-md-0 {
+    padding-top: 0 !important;
+  }
+  .pr-md-0,
+  .px-md-0 {
+    padding-right: 0 !important;
+  }
+  .pb-md-0,
+  .py-md-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-md-0,
+  .px-md-0 {
+    padding-left: 0 !important;
+  }
+  .p-md-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-md-1,
+  .py-md-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-md-1,
+  .px-md-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-md-1,
+  .py-md-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-md-1,
+  .px-md-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-md-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-md-2,
+  .py-md-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-md-2,
+  .px-md-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-md-2,
+  .py-md-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-md-2,
+  .px-md-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-md-3 {
+    padding: 1rem !important;
+  }
+  .pt-md-3,
+  .py-md-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-md-3,
+  .px-md-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-md-3,
+  .py-md-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-md-3,
+  .px-md-3 {
+    padding-left: 1rem !important;
+  }
+  .p-md-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-md-4,
+  .py-md-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-md-4,
+  .px-md-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-md-4,
+  .py-md-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-md-4,
+  .px-md-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-md-5 {
+    padding: 3rem !important;
+  }
+  .pt-md-5,
+  .py-md-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-md-5,
+  .px-md-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-md-5,
+  .py-md-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-md-5,
+  .px-md-5 {
+    padding-left: 3rem !important;
+  }
+  .m-md-auto {
+    margin: auto !important;
+  }
+  .mt-md-auto,
+  .my-md-auto {
+    margin-top: auto !important;
+  }
+  .mr-md-auto,
+  .mx-md-auto {
+    margin-right: auto !important;
+  }
+  .mb-md-auto,
+  .my-md-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-md-auto,
+  .mx-md-auto {
+    margin-left: auto !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .m-lg-0 {
+    margin: 0 !important;
+  }
+  .mt-lg-0,
+  .my-lg-0 {
+    margin-top: 0 !important;
+  }
+  .mr-lg-0,
+  .mx-lg-0 {
+    margin-right: 0 !important;
+  }
+  .mb-lg-0,
+  .my-lg-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-lg-0,
+  .mx-lg-0 {
+    margin-left: 0 !important;
+  }
+  .m-lg-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-lg-1,
+  .my-lg-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-lg-1,
+  .mx-lg-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-lg-1,
+  .my-lg-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-lg-1,
+  .mx-lg-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-lg-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-lg-2,
+  .my-lg-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-lg-2,
+  .mx-lg-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-lg-2,
+  .my-lg-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-lg-2,
+  .mx-lg-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-lg-3 {
+    margin: 1rem !important;
+  }
+  .mt-lg-3,
+  .my-lg-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-lg-3,
+  .mx-lg-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-lg-3,
+  .my-lg-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-lg-3,
+  .mx-lg-3 {
+    margin-left: 1rem !important;
+  }
+  .m-lg-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-lg-4,
+  .my-lg-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-lg-4,
+  .mx-lg-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-lg-4,
+  .my-lg-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-lg-4,
+  .mx-lg-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-lg-5 {
+    margin: 3rem !important;
+  }
+  .mt-lg-5,
+  .my-lg-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-lg-5,
+  .mx-lg-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-lg-5,
+  .my-lg-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-lg-5,
+  .mx-lg-5 {
+    margin-left: 3rem !important;
+  }
+  .p-lg-0 {
+    padding: 0 !important;
+  }
+  .pt-lg-0,
+  .py-lg-0 {
+    padding-top: 0 !important;
+  }
+  .pr-lg-0,
+  .px-lg-0 {
+    padding-right: 0 !important;
+  }
+  .pb-lg-0,
+  .py-lg-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-lg-0,
+  .px-lg-0 {
+    padding-left: 0 !important;
+  }
+  .p-lg-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-lg-1,
+  .py-lg-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-lg-1,
+  .px-lg-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-lg-1,
+  .py-lg-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-lg-1,
+  .px-lg-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-lg-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-lg-2,
+  .py-lg-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-lg-2,
+  .px-lg-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-lg-2,
+  .py-lg-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-lg-2,
+  .px-lg-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-lg-3 {
+    padding: 1rem !important;
+  }
+  .pt-lg-3,
+  .py-lg-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-lg-3,
+  .px-lg-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-lg-3,
+  .py-lg-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-lg-3,
+  .px-lg-3 {
+    padding-left: 1rem !important;
+  }
+  .p-lg-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-lg-4,
+  .py-lg-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-lg-4,
+  .px-lg-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-lg-4,
+  .py-lg-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-lg-4,
+  .px-lg-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-lg-5 {
+    padding: 3rem !important;
+  }
+  .pt-lg-5,
+  .py-lg-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-lg-5,
+  .px-lg-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-lg-5,
+  .py-lg-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-lg-5,
+  .px-lg-5 {
+    padding-left: 3rem !important;
+  }
+  .m-lg-auto {
+    margin: auto !important;
+  }
+  .mt-lg-auto,
+  .my-lg-auto {
+    margin-top: auto !important;
+  }
+  .mr-lg-auto,
+  .mx-lg-auto {
+    margin-right: auto !important;
+  }
+  .mb-lg-auto,
+  .my-lg-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-lg-auto,
+  .mx-lg-auto {
+    margin-left: auto !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .m-xl-0 {
+    margin: 0 !important;
+  }
+  .mt-xl-0,
+  .my-xl-0 {
+    margin-top: 0 !important;
+  }
+  .mr-xl-0,
+  .mx-xl-0 {
+    margin-right: 0 !important;
+  }
+  .mb-xl-0,
+  .my-xl-0 {
+    margin-bottom: 0 !important;
+  }
+  .ml-xl-0,
+  .mx-xl-0 {
+    margin-left: 0 !important;
+  }
+  .m-xl-1 {
+    margin: 0.25rem !important;
+  }
+  .mt-xl-1,
+  .my-xl-1 {
+    margin-top: 0.25rem !important;
+  }
+  .mr-xl-1,
+  .mx-xl-1 {
+    margin-right: 0.25rem !important;
+  }
+  .mb-xl-1,
+  .my-xl-1 {
+    margin-bottom: 0.25rem !important;
+  }
+  .ml-xl-1,
+  .mx-xl-1 {
+    margin-left: 0.25rem !important;
+  }
+  .m-xl-2 {
+    margin: 0.5rem !important;
+  }
+  .mt-xl-2,
+  .my-xl-2 {
+    margin-top: 0.5rem !important;
+  }
+  .mr-xl-2,
+  .mx-xl-2 {
+    margin-right: 0.5rem !important;
+  }
+  .mb-xl-2,
+  .my-xl-2 {
+    margin-bottom: 0.5rem !important;
+  }
+  .ml-xl-2,
+  .mx-xl-2 {
+    margin-left: 0.5rem !important;
+  }
+  .m-xl-3 {
+    margin: 1rem !important;
+  }
+  .mt-xl-3,
+  .my-xl-3 {
+    margin-top: 1rem !important;
+  }
+  .mr-xl-3,
+  .mx-xl-3 {
+    margin-right: 1rem !important;
+  }
+  .mb-xl-3,
+  .my-xl-3 {
+    margin-bottom: 1rem !important;
+  }
+  .ml-xl-3,
+  .mx-xl-3 {
+    margin-left: 1rem !important;
+  }
+  .m-xl-4 {
+    margin: 1.5rem !important;
+  }
+  .mt-xl-4,
+  .my-xl-4 {
+    margin-top: 1.5rem !important;
+  }
+  .mr-xl-4,
+  .mx-xl-4 {
+    margin-right: 1.5rem !important;
+  }
+  .mb-xl-4,
+  .my-xl-4 {
+    margin-bottom: 1.5rem !important;
+  }
+  .ml-xl-4,
+  .mx-xl-4 {
+    margin-left: 1.5rem !important;
+  }
+  .m-xl-5 {
+    margin: 3rem !important;
+  }
+  .mt-xl-5,
+  .my-xl-5 {
+    margin-top: 3rem !important;
+  }
+  .mr-xl-5,
+  .mx-xl-5 {
+    margin-right: 3rem !important;
+  }
+  .mb-xl-5,
+  .my-xl-5 {
+    margin-bottom: 3rem !important;
+  }
+  .ml-xl-5,
+  .mx-xl-5 {
+    margin-left: 3rem !important;
+  }
+  .p-xl-0 {
+    padding: 0 !important;
+  }
+  .pt-xl-0,
+  .py-xl-0 {
+    padding-top: 0 !important;
+  }
+  .pr-xl-0,
+  .px-xl-0 {
+    padding-right: 0 !important;
+  }
+  .pb-xl-0,
+  .py-xl-0 {
+    padding-bottom: 0 !important;
+  }
+  .pl-xl-0,
+  .px-xl-0 {
+    padding-left: 0 !important;
+  }
+  .p-xl-1 {
+    padding: 0.25rem !important;
+  }
+  .pt-xl-1,
+  .py-xl-1 {
+    padding-top: 0.25rem !important;
+  }
+  .pr-xl-1,
+  .px-xl-1 {
+    padding-right: 0.25rem !important;
+  }
+  .pb-xl-1,
+  .py-xl-1 {
+    padding-bottom: 0.25rem !important;
+  }
+  .pl-xl-1,
+  .px-xl-1 {
+    padding-left: 0.25rem !important;
+  }
+  .p-xl-2 {
+    padding: 0.5rem !important;
+  }
+  .pt-xl-2,
+  .py-xl-2 {
+    padding-top: 0.5rem !important;
+  }
+  .pr-xl-2,
+  .px-xl-2 {
+    padding-right: 0.5rem !important;
+  }
+  .pb-xl-2,
+  .py-xl-2 {
+    padding-bottom: 0.5rem !important;
+  }
+  .pl-xl-2,
+  .px-xl-2 {
+    padding-left: 0.5rem !important;
+  }
+  .p-xl-3 {
+    padding: 1rem !important;
+  }
+  .pt-xl-3,
+  .py-xl-3 {
+    padding-top: 1rem !important;
+  }
+  .pr-xl-3,
+  .px-xl-3 {
+    padding-right: 1rem !important;
+  }
+  .pb-xl-3,
+  .py-xl-3 {
+    padding-bottom: 1rem !important;
+  }
+  .pl-xl-3,
+  .px-xl-3 {
+    padding-left: 1rem !important;
+  }
+  .p-xl-4 {
+    padding: 1.5rem !important;
+  }
+  .pt-xl-4,
+  .py-xl-4 {
+    padding-top: 1.5rem !important;
+  }
+  .pr-xl-4,
+  .px-xl-4 {
+    padding-right: 1.5rem !important;
+  }
+  .pb-xl-4,
+  .py-xl-4 {
+    padding-bottom: 1.5rem !important;
+  }
+  .pl-xl-4,
+  .px-xl-4 {
+    padding-left: 1.5rem !important;
+  }
+  .p-xl-5 {
+    padding: 3rem !important;
+  }
+  .pt-xl-5,
+  .py-xl-5 {
+    padding-top: 3rem !important;
+  }
+  .pr-xl-5,
+  .px-xl-5 {
+    padding-right: 3rem !important;
+  }
+  .pb-xl-5,
+  .py-xl-5 {
+    padding-bottom: 3rem !important;
+  }
+  .pl-xl-5,
+  .px-xl-5 {
+    padding-left: 3rem !important;
+  }
+  .m-xl-auto {
+    margin: auto !important;
+  }
+  .mt-xl-auto,
+  .my-xl-auto {
+    margin-top: auto !important;
+  }
+  .mr-xl-auto,
+  .mx-xl-auto {
+    margin-right: auto !important;
+  }
+  .mb-xl-auto,
+  .my-xl-auto {
+    margin-bottom: auto !important;
+  }
+  .ml-xl-auto,
+  .mx-xl-auto {
+    margin-left: auto !important;
+  }
+}
+
+.text-monospace {
+  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
+}
+
+.text-justify {
+  text-align: justify !important;
+}
+
+.text-nowrap {
+  white-space: nowrap !important;
+}
+
+.text-truncate {
+  overflow: hidden;
+  -o-text-overflow: ellipsis;
+     text-overflow: ellipsis;
+  white-space: nowrap;
+}
+
+.text-left {
+  text-align: left !important;
+}
+
+.text-right {
+  text-align: right !important;
+}
+
+.text-center {
+  text-align: center !important;
+}
+
+@media (min-width: 576px) {
+  .text-sm-left {
+    text-align: left !important;
+  }
+  .text-sm-right {
+    text-align: right !important;
+  }
+  .text-sm-center {
+    text-align: center !important;
+  }
+}
+
+@media (min-width: 768px) {
+  .text-md-left {
+    text-align: left !important;
+  }
+  .text-md-right {
+    text-align: right !important;
+  }
+  .text-md-center {
+    text-align: center !important;
+  }
+}
+
+@media (min-width: 992px) {
+  .text-lg-left {
+    text-align: left !important;
+  }
+  .text-lg-right {
+    text-align: right !important;
+  }
+  .text-lg-center {
+    text-align: center !important;
+  }
+}
+
+@media (min-width: 1200px) {
+  .text-xl-left {
+    text-align: left !important;
+  }
+  .text-xl-right {
+    text-align: right !important;
+  }
+  .text-xl-center {
+    text-align: center !important;
+  }
+}
+
+.text-lowercase {
+  text-transform: lowercase !important;
+}
+
+.text-uppercase {
+  text-transform: uppercase !important;
+}
+
+.text-capitalize {
+  text-transform: capitalize !important;
+}
+
+.font-weight-light {
+  font-weight: 300 !important;
+}
+
+.font-weight-normal {
+  font-weight: 400 !important;
+}
+
+.font-weight-bold {
+  font-weight: 700 !important;
+}
+
+.font-italic {
+  font-style: italic !important;
+}
+
+.text-white {
+  color: #FFF !important;
+}
+
+.text-primary {
+  color: #009688 !important;
+}
+
+a.text-primary:hover, a.text-primary:focus {
+  color: #00635a !important;
+}
+
+.text-secondary {
+  color: #6c757d !important;
+}
+
+a.text-secondary:hover, a.text-secondary:focus {
+  color: #545b62 !important;
+}
+
+.text-success {
+  color: #28a745 !important;
+}
+
+a.text-success:hover, a.text-success:focus {
+  color: #1e7e34 !important;
+}
+
+.text-info {
+  color: #17a2b8 !important;
+}
+
+a.text-info:hover, a.text-info:focus {
+  color: #117a8b !important;
+}
+
+.text-warning {
+  color: #ffc107 !important;
+}
+
+a.text-warning:hover, a.text-warning:focus {
+  color: #d39e00 !important;
+}
+
+.text-danger {
+  color: #dc3545 !important;
+}
+
+a.text-danger:hover, a.text-danger:focus {
+  color: #bd2130 !important;
+}
+
+.text-light {
+  color: #f8f9fa !important;
+}
+
+a.text-light:hover, a.text-light:focus {
+  color: #dae0e5 !important;
+}
+
+.text-dark {
+  color: #343a40 !important;
+}
+
+a.text-dark:hover, a.text-dark:focus {
+  color: #1d2124 !important;
+}
+
+.text-body {
+  color: #212529 !important;
+}
+
+.text-muted, .app-notification__meta {
+  color: #6c757d !important;
+}
+
+.text-black-50 {
+  color: rgba(0, 0, 0, 0.5) !important;
+}
+
+.text-white-50 {
+  color: rgba(255, 255, 255, 0.5) !important;
+}
+
+.text-hide {
+  font: 0/0 a;
+  color: transparent;
+  text-shadow: none;
+  background-color: transparent;
+  border: 0;
+}
+
+.visible {
+  visibility: visible !important;
+}
+
+.invisible {
+  visibility: hidden !important;
+}
+
+@media print {
+  *,
+  *::before,
+  *::after {
+    text-shadow: none !important;
+    -webkit-box-shadow: none !important;
+            box-shadow: none !important;
+  }
+  a:not(.btn) {
+    text-decoration: underline;
+  }
+  abbr[title]::after {
+    content: " (" attr(title) ")";
+  }
+  pre {
+    white-space: pre-wrap !important;
+  }
+  pre,
+  blockquote {
+    border: 1px solid #adb5bd;
+    page-break-inside: avoid;
+  }
+  thead {
+    display: table-header-group;
+  }
+  tr,
+  img {
+    page-break-inside: avoid;
+  }
+  p,
+  h2,
+  h3 {
+    orphans: 3;
+    widows: 3;
+  }
+  h2,
+  h3 {
+    page-break-after: avoid;
+  }
+  @page {
+    size: a3;
+  }
+  body {
+    min-width: 992px !important;
+  }
+  .container {
+    min-width: 992px !important;
+  }
+  .navbar {
+    display: none;
+  }
+  .badge {
+    border: 1px solid #000;
+  }
+  .table {
+    border-collapse: collapse !important;
+  }
+  .table td,
+  .table th {
+    background-color: #FFF !important;
+  }
+  .table-bordered th,
+  .table-bordered td {
+    border: 1px solid #dee2e6 !important;
+  }
+  .table-dark {
+    color: inherit;
+  }
+  .table-dark th,
+  .table-dark td,
+  .table-dark thead th,
+  .table-dark tbody + tbody {
+    border-color: #dee2e6;
+  }
+  .table .thead-dark th {
+    color: inherit;
+    border-color: #dee2e6;
+  }
+}
+
+table.dataTable {
+  clear: both;
+  margin-top: 6px !important;
+  margin-bottom: 6px !important;
+  max-width: none !important;
+}
+
+table.dataTable td,
+table.dataTable th {
+  -webkit-box-sizing: content-box;
+  box-sizing: content-box;
+}
+
+table.dataTable td.dataTables_empty,
+table.dataTable th.dataTables_empty {
+  text-align: center;
+}
+
+table.dataTable.nowrap th,
+table.dataTable.nowrap td {
+  white-space: nowrap;
+}
+
+.tile div.dataTables_wrapper {
+  padding: 0;
+}
+
+div.dataTables_wrapper div.dataTables_length label {
+  font-weight: normal;
+  text-align: left;
+  white-space: nowrap;
+}
+
+div.dataTables_wrapper div.dataTables_length select {
+  width: 75px;
+  display: inline-block;
+}
+
+div.dataTables_wrapper div.dataTables_filter {
+  text-align: right;
+}
+
+div.dataTables_wrapper div.dataTables_filter label {
+  font-weight: normal;
+  white-space: nowrap;
+  text-align: left;
+}
+
+div.dataTables_wrapper div.dataTables_filter input {
+  margin-left: 0.5em;
+  display: inline-block;
+  width: auto;
+}
+
+div.dataTables_wrapper div.dataTables_info {
+  padding-top: 0.85em;
+  white-space: nowrap;
+}
+
+div.dataTables_wrapper div.dataTables_paginate {
+  margin: 0;
+  white-space: nowrap;
+  text-align: right;
+}
+
+div.dataTables_wrapper div.dataTables_paginate ul.pagination {
+  margin: 2px 0;
+  white-space: nowrap;
+  -webkit-box-pack: end;
+      -ms-flex-pack: end;
+          justify-content: flex-end;
+}
+
+div.dataTables_wrapper div.dataTables_processing {
+  position: absolute;
+  top: 50%;
+  left: 50%;
+  width: 200px;
+  margin-left: -100px;
+  margin-top: -26px;
+  text-align: center;
+  padding: 1em 0;
+}
+
+table.dataTable thead > tr > th.sorting_asc, table.dataTable thead > tr > th.sorting_desc, table.dataTable thead > tr > th.sorting,
+table.dataTable thead > tr > td.sorting_asc,
+table.dataTable thead > tr > td.sorting_desc,
+table.dataTable thead > tr > td.sorting {
+  padding-right: 30px;
+}
+
+table.dataTable thead > tr > th:active,
+table.dataTable thead > tr > td:active {
+  outline: none;
+}
+
+table.dataTable thead .sorting,
+table.dataTable thead .sorting_asc,
+table.dataTable thead .sorting_desc,
+table.dataTable thead .sorting_asc_disabled,
+table.dataTable thead .sorting_desc_disabled {
+  cursor: pointer;
+  position: relative;
+}
+
+table.dataTable thead .sorting:before, table.dataTable thead .sorting:after,
+table.dataTable thead .sorting_asc:before,
+table.dataTable thead .sorting_asc:after,
+table.dataTable thead .sorting_desc:before,
+table.dataTable thead .sorting_desc:after,
+table.dataTable thead .sorting_asc_disabled:before,
+table.dataTable thead .sorting_asc_disabled:after,
+table.dataTable thead .sorting_desc_disabled:before,
+table.dataTable thead .sorting_desc_disabled:after {
+  position: absolute;
+  bottom: 0.9em;
+  display: block;
+  opacity: 0.3;
+}
+
+table.dataTable thead .sorting:before,
+table.dataTable thead .sorting_asc:before,
+table.dataTable thead .sorting_desc:before,
+table.dataTable thead .sorting_asc_disabled:before,
+table.dataTable thead .sorting_desc_disabled:before {
+  right: 1em;
+  content: "\2191";
+}
+
+table.dataTable thead .sorting:after,
+table.dataTable thead .sorting_asc:after,
+table.dataTable thead .sorting_desc:after,
+table.dataTable thead .sorting_asc_disabled:after,
+table.dataTable thead .sorting_desc_disabled:after {
+  right: 0.5em;
+  content: "\2193";
+}
+
+table.dataTable thead .sorting_asc:before,
+table.dataTable thead .sorting_desc:after {
+  opacity: 1;
+}
+
+table.dataTable thead .sorting_asc_disabled:before,
+table.dataTable thead .sorting_desc_disabled:after {
+  opacity: 0;
+}
+
+div.dataTables_scrollHead table.dataTable {
+  margin-bottom: 0 !important;
+}
+
+div.dataTables_scrollBody table {
+  border-top: none;
+  margin-top: 0 !important;
+  margin-bottom: 0 !important;
+}
+
+div.dataTables_scrollBody table thead .sorting:after,
+div.dataTables_scrollBody table thead .sorting_asc:after,
+div.dataTables_scrollBody table thead .sorting_desc:after {
+  display: none;
+}
+
+div.dataTables_scrollBody table tbody tr:first-child th,
+div.dataTables_scrollBody table tbody tr:first-child td {
+  border-top: none;
+}
+
+div.dataTables_scrollFoot > .dataTables_scrollFootInner {
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+}
+
+div.dataTables_scrollFoot > .dataTables_scrollFootInner > table {
+  margin-top: 0 !important;
+  border-top: none;
+}
+
+@media screen and (max-width: 767px) {
+  div.dataTables_wrapper div.dataTables_length,
+  div.dataTables_wrapper div.dataTables_filter,
+  div.dataTables_wrapper div.dataTables_info,
+  div.dataTables_wrapper div.dataTables_paginate {
+    text-align: center;
+  }
+}
+
+table.dataTable.table-sm > thead > tr > th {
+  padding-right: 20px;
+}
+
+table.dataTable.table-sm .sorting:before,
+table.dataTable.table-sm .sorting_asc:before,
+table.dataTable.table-sm .sorting_desc:before {
+  top: 5px;
+  right: 0.85em;
+}
+
+table.dataTable.table-sm .sorting:after,
+table.dataTable.table-sm .sorting_asc:after,
+table.dataTable.table-sm .sorting_desc:after {
+  top: 5px;
+}
+
+table.table-bordered.dataTable th,
+table.table-bordered.dataTable td {
+  border-left-width: 0;
+}
+
+table.table-bordered.dataTable th:last-child, table.table-bordered.dataTable th:last-child,
+table.table-bordered.dataTable td:last-child,
+table.table-bordered.dataTable td:last-child {
+  border-right-width: 0;
+}
+
+table.table-bordered.dataTable tbody th,
+table.table-bordered.dataTable tbody td {
+  border-bottom-width: 0;
+}
+
+div.dataTables_scrollHead table.table-bordered {
+  border-bottom-width: 0;
+}
+
+div.table-responsive > div.dataTables_wrapper > div.row {
+  margin: 0;
+}
+
+div.table-responsive > div.dataTables_wrapper > div.row > div[class^="col-"]:first-child {
+  padding-left: 0;
+}
+
+div.table-responsive > div.dataTables_wrapper > div.row > div[class^="col-"]:last-child {
+  padding-right: 0;
+}
+
+/*!
+ * Datepicker for Bootstrap v1.5.0 (https://github.com/eternicode/bootstrap-datepicker)
+ *
+ * Copyright 2012 Stefan Petre
+ * Improvements by Andrew Rowls
+ * Licensed under the Apache License v2.0 (http://www.apache.org/licenses/LICENSE-2.0)
+ */
+.datepicker {
+  border-radius: 4px;
+  direction: ltr;
+}
+
+.datepicker-inline {
+  width: 220px;
+}
+
+.datepicker.datepicker-rtl {
+  direction: rtl;
+}
+
+.datepicker.datepicker-rtl table tr td span {
+  float: right;
+}
+
+.datepicker-dropdown {
+  top: 0;
+  left: 0;
+  padding: 4px;
+}
+
+.datepicker-dropdown:before {
+  content: '';
+  display: inline-block;
+  border-left: 7px solid transparent;
+  border-right: 7px solid transparent;
+  border-bottom: 7px solid rgba(0, 0, 0, 0.15);
+  border-top: 0;
+  border-bottom-color: rgba(0, 0, 0, 0.2);
+  position: absolute;
+}
+
+.datepicker-dropdown:after {
+  content: '';
+  display: inline-block;
+  border-left: 6px solid transparent;
+  border-right: 6px solid transparent;
+  border-bottom: 6px solid #ffffff;
+  border-top: 0;
+  position: absolute;
+}
+
+.datepicker-dropdown.datepicker-orient-left:before {
+  left: 6px;
+}
+
+.datepicker-dropdown.datepicker-orient-left:after {
+  left: 7px;
+}
+
+.datepicker-dropdown.datepicker-orient-right:before {
+  right: 6px;
+}
+
+.datepicker-dropdown.datepicker-orient-right:after {
+  right: 7px;
+}
+
+.datepicker-dropdown.datepicker-orient-bottom:before {
+  top: -7px;
+}
+
+.datepicker-dropdown.datepicker-orient-bottom:after {
+  top: -6px;
+}
+
+.datepicker-dropdown.datepicker-orient-top:before {
+  bottom: -7px;
+  border-bottom: 0;
+  border-top: 7px solid rgba(0, 0, 0, 0.15);
+}
+
+.datepicker-dropdown.datepicker-orient-top:after {
+  bottom: -6px;
+  border-bottom: 0;
+  border-top: 6px solid #ffffff;
+}
+
+.datepicker table {
+  margin: 0;
+  -webkit-touch-callout: none;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+
+.datepicker table tr td,
+.datepicker table tr th {
+  text-align: center;
+  width: 30px;
+  height: 30px;
+  border-radius: 4px;
+  border: none;
+}
+
+.table-striped .datepicker table tr td,
+.table-striped .datepicker table tr th {
+  background-color: transparent;
+}
+
+.datepicker-days tbody tr td {
+  border-radius: 50%;
+  font-weight: 500;
+}
+
+.datepicker table tr td.old,
+.datepicker table tr td.new {
+  color: #999999;
+}
+
+.datepicker table tr td.day:hover,
+.datepicker table tr td.focused {
+  background: #eeeeee;
+  cursor: pointer;
+}
+
+.datepicker table tr td.disabled,
+.datepicker table tr td.disabled:hover {
+  background: none;
+  color: #999999;
+  cursor: default;
+}
+
+.datepicker table tr td.highlighted {
+  color: #000000;
+  background-color: #d9edf7;
+  border-color: #85c5e5;
+  border-radius: 0;
+}
+
+.datepicker table tr td.highlighted:focus,
+.datepicker table tr td.highlighted.focus {
+  color: #000000;
+  background-color: #afd9ee;
+  border-color: #298fc2;
+}
+
+.datepicker table tr td.highlighted:hover {
+  color: #000000;
+  background-color: #afd9ee;
+  border-color: #52addb;
+}
+
+.datepicker table tr td.highlighted:active,
+.datepicker table tr td.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.highlighted {
+  color: #000000;
+  background-color: #afd9ee;
+  border-color: #52addb;
+}
+
+.datepicker table tr td.highlighted:active:hover,
+.datepicker table tr td.highlighted.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.highlighted:hover,
+.datepicker table tr td.highlighted:active:focus,
+.datepicker table tr td.highlighted.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.highlighted:focus,
+.datepicker table tr td.highlighted:active.focus,
+.datepicker table tr td.highlighted.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.highlighted.focus {
+  color: #000000;
+  background-color: #91cbe8;
+  border-color: #298fc2;
+}
+
+.datepicker table tr td.highlighted:active,
+.datepicker table tr td.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.highlighted {
+  background-image: none;
+}
+
+.datepicker table tr td.highlighted.disabled:hover,
+.datepicker table tr td.highlighted[disabled]:hover,
+fieldset[disabled] .datepicker table tr td.highlighted:hover,
+.datepicker table tr td.highlighted.disabled:focus,
+.datepicker table tr td.highlighted[disabled]:focus,
+fieldset[disabled] .datepicker table tr td.highlighted:focus,
+.datepicker table tr td.highlighted.disabled.focus,
+.datepicker table tr td.highlighted[disabled].focus,
+fieldset[disabled] .datepicker table tr td.highlighted.focus {
+  background-color: #d9edf7;
+  border-color: #85c5e5;
+}
+
+.datepicker table tr td.highlighted.focused {
+  background: #afd9ee;
+}
+
+.datepicker table tr td.highlighted.disabled,
+.datepicker table tr td.highlighted.disabled:active {
+  background: #d9edf7;
+  color: #999999;
+}
+
+.datepicker table tr td.today {
+  color: #000000;
+  background-color: #ffdb99;
+  border-color: #ffb733;
+}
+
+.datepicker table tr td.today:focus,
+.datepicker table tr td.today.focus {
+  color: #000000;
+  background-color: #ffc966;
+  border-color: #b37400;
+}
+
+.datepicker table tr td.today:hover {
+  color: #000000;
+  background-color: #ffc966;
+  border-color: #f59e00;
+}
+
+.datepicker table tr td.today:active,
+.datepicker table tr td.today.active,
+.open > .dropdown-toggle.datepicker table tr td.today {
+  color: #000000;
+  background-color: #ffc966;
+  border-color: #f59e00;
+}
+
+.datepicker table tr td.today:active:hover,
+.datepicker table tr td.today.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.today:hover,
+.datepicker table tr td.today:active:focus,
+.datepicker table tr td.today.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.today:focus,
+.datepicker table tr td.today:active.focus,
+.datepicker table tr td.today.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.today.focus {
+  color: #000000;
+  background-color: #ffbc42;
+  border-color: #b37400;
+}
+
+.datepicker table tr td.today:active,
+.datepicker table tr td.today.active,
+.open > .dropdown-toggle.datepicker table tr td.today {
+  background-image: none;
+}
+
+.datepicker table tr td.today.disabled:hover,
+.datepicker table tr td.today[disabled]:hover,
+fieldset[disabled] .datepicker table tr td.today:hover,
+.datepicker table tr td.today.disabled:focus,
+.datepicker table tr td.today[disabled]:focus,
+fieldset[disabled] .datepicker table tr td.today:focus,
+.datepicker table tr td.today.disabled.focus,
+.datepicker table tr td.today[disabled].focus,
+fieldset[disabled] .datepicker table tr td.today.focus {
+  background-color: #ffdb99;
+  border-color: #ffb733;
+}
+
+.datepicker table tr td.today.focused {
+  background: #ffc966;
+}
+
+.datepicker table tr td.today.disabled,
+.datepicker table tr td.today.disabled:active {
+  background: #ffdb99;
+  color: #999999;
+}
+
+.datepicker table tr td.range {
+  color: #000000;
+  background-color: #eeeeee;
+  border-color: #bbbbbb;
+  border-radius: 0;
+}
+
+.datepicker table tr td.range:focus,
+.datepicker table tr td.range.focus {
+  color: #000000;
+  background-color: #d5d5d5;
+  border-color: #7c7c7c;
+}
+
+.datepicker table tr td.range:hover {
+  color: #000000;
+  background-color: #d5d5d5;
+  border-color: #9d9d9d;
+}
+
+.datepicker table tr td.range:active,
+.datepicker table tr td.range.active,
+.open > .dropdown-toggle.datepicker table tr td.range {
+  color: #000000;
+  background-color: #d5d5d5;
+  border-color: #9d9d9d;
+}
+
+.datepicker table tr td.range:active:hover,
+.datepicker table tr td.range.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.range:hover,
+.datepicker table tr td.range:active:focus,
+.datepicker table tr td.range.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.range:focus,
+.datepicker table tr td.range:active.focus,
+.datepicker table tr td.range.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.range.focus {
+  color: #000000;
+  background-color: #c3c3c3;
+  border-color: #7c7c7c;
+}
+
+.datepicker table tr td.range:active,
+.datepicker table tr td.range.active,
+.open > .dropdown-toggle.datepicker table tr td.range {
+  background-image: none;
+}
+
+.datepicker table tr td.range.disabled:hover,
+.datepicker table tr td.range[disabled]:hover,
+fieldset[disabled] .datepicker table tr td.range:hover,
+.datepicker table tr td.range.disabled:focus,
+.datepicker table tr td.range[disabled]:focus,
+fieldset[disabled] .datepicker table tr td.range:focus,
+.datepicker table tr td.range.disabled.focus,
+.datepicker table tr td.range[disabled].focus,
+fieldset[disabled] .datepicker table tr td.range.focus {
+  background-color: #eeeeee;
+  border-color: #bbbbbb;
+}
+
+.datepicker table tr td.range.focused {
+  background: #d5d5d5;
+}
+
+.datepicker table tr td.range.disabled,
+.datepicker table tr td.range.disabled:active {
+  background: #eeeeee;
+  color: #999999;
+}
+
+.datepicker table tr td.range.highlighted {
+  color: #000000;
+  background-color: #e4eef3;
+  border-color: #9dc1d3;
+}
+
+.datepicker table tr td.range.highlighted:focus,
+.datepicker table tr td.range.highlighted.focus {
+  color: #000000;
+  background-color: #c1d7e3;
+  border-color: #4b88a6;
+}
+
+.datepicker table tr td.range.highlighted:hover {
+  color: #000000;
+  background-color: #c1d7e3;
+  border-color: #73a6c0;
+}
+
+.datepicker table tr td.range.highlighted:active,
+.datepicker table tr td.range.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.range.highlighted {
+  color: #000000;
+  background-color: #c1d7e3;
+  border-color: #73a6c0;
+}
+
+.datepicker table tr td.range.highlighted:active:hover,
+.datepicker table tr td.range.highlighted.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.range.highlighted:hover,
+.datepicker table tr td.range.highlighted:active:focus,
+.datepicker table tr td.range.highlighted.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.range.highlighted:focus,
+.datepicker table tr td.range.highlighted:active.focus,
+.datepicker table tr td.range.highlighted.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.range.highlighted.focus {
+  color: #000000;
+  background-color: #a8c8d8;
+  border-color: #4b88a6;
+}
+
+.datepicker table tr td.range.highlighted:active,
+.datepicker table tr td.range.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.range.highlighted {
+  background-image: none;
+}
+
+.datepicker table tr td.range.highlighted.disabled:hover,
+.datepicker table tr td.range.highlighted[disabled]:hover,
+fieldset[disabled] .datepicker table tr td.range.highlighted:hover,
+.datepicker table tr td.range.highlighted.disabled:focus,
+.datepicker table tr td.range.highlighted[disabled]:focus,
+fieldset[disabled] .datepicker table tr td.range.highlighted:focus,
+.datepicker table tr td.range.highlighted.disabled.focus,
+.datepicker table tr td.range.highlighted[disabled].focus,
+fieldset[disabled] .datepicker table tr td.range.highlighted.focus {
+  background-color: #e4eef3;
+  border-color: #9dc1d3;
+}
+
+.datepicker table tr td.range.highlighted.focused {
+  background: #c1d7e3;
+}
+
+.datepicker table tr td.range.highlighted.disabled,
+.datepicker table tr td.range.highlighted.disabled:active {
+  background: #e4eef3;
+  color: #999999;
+}
+
+.datepicker table tr td.range.today {
+  color: #000000;
+  background-color: #f7ca77;
+  border-color: #f1a417;
+}
+
+.datepicker table tr td.range.today:focus,
+.datepicker table tr td.range.today.focus {
+  color: #000000;
+  background-color: #f4b747;
+  border-color: #815608;
+}
+
+.datepicker table tr td.range.today:hover {
+  color: #000000;
+  background-color: #f4b747;
+  border-color: #bf800c;
+}
+
+.datepicker table tr td.range.today:active,
+.datepicker table tr td.range.today.active,
+.open > .dropdown-toggle.datepicker table tr td.range.today {
+  color: #000000;
+  background-color: #f4b747;
+  border-color: #bf800c;
+}
+
+.datepicker table tr td.range.today:active:hover,
+.datepicker table tr td.range.today.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.range.today:hover,
+.datepicker table tr td.range.today:active:focus,
+.datepicker table tr td.range.today.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.range.today:focus,
+.datepicker table tr td.range.today:active.focus,
+.datepicker table tr td.range.today.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.range.today.focus {
+  color: #000000;
+  background-color: #f2aa25;
+  border-color: #815608;
+}
+
+.datepicker table tr td.range.today:active,
+.datepicker table tr td.range.today.active,
+.open > .dropdown-toggle.datepicker table tr td.range.today {
+  background-image: none;
+}
+
+.datepicker table tr td.range.today.disabled:hover,
+.datepicker table tr td.range.today[disabled]:hover,
+fieldset[disabled] .datepicker table tr td.range.today:hover,
+.datepicker table tr td.range.today.disabled:focus,
+.datepicker table tr td.range.today[disabled]:focus,
+fieldset[disabled] .datepicker table tr td.range.today:focus,
+.datepicker table tr td.range.today.disabled.focus,
+.datepicker table tr td.range.today[disabled].focus,
+fieldset[disabled] .datepicker table tr td.range.today.focus {
+  background-color: #f7ca77;
+  border-color: #f1a417;
+}
+
+.datepicker table tr td.range.today.disabled,
+.datepicker table tr td.range.today.disabled:active {
+  background: #f7ca77;
+  color: #999999;
+}
+
+.datepicker table tr td.selected,
+.datepicker table tr td.selected.highlighted {
+  color: #ffffff;
+  background-color: #999999;
+  border-color: #555555;
+  text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.datepicker table tr td.selected:focus,
+.datepicker table tr td.selected.highlighted:focus,
+.datepicker table tr td.selected.focus,
+.datepicker table tr td.selected.highlighted.focus {
+  color: #ffffff;
+  background-color: #808080;
+  border-color: #161616;
+}
+
+.datepicker table tr td.selected:hover,
+.datepicker table tr td.selected.highlighted:hover {
+  color: #ffffff;
+  background-color: #808080;
+  border-color: #373737;
+}
+
+.datepicker table tr td.selected:active,
+.datepicker table tr td.selected.highlighted:active,
+.datepicker table tr td.selected.active,
+.datepicker table tr td.selected.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.selected,
+.open > .dropdown-toggle.datepicker table tr td.selected.highlighted {
+  color: #ffffff;
+  background-color: #808080;
+  border-color: #373737;
+}
+
+.datepicker table tr td.selected:active:hover,
+.datepicker table tr td.selected.highlighted:active:hover,
+.datepicker table tr td.selected.active:hover,
+.datepicker table tr td.selected.highlighted.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.selected:hover,
+.open > .dropdown-toggle.datepicker table tr td.selected.highlighted:hover,
+.datepicker table tr td.selected:active:focus,
+.datepicker table tr td.selected.highlighted:active:focus,
+.datepicker table tr td.selected.active:focus,
+.datepicker table tr td.selected.highlighted.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.selected:focus,
+.open > .dropdown-toggle.datepicker table tr td.selected.highlighted:focus,
+.datepicker table tr td.selected:active.focus,
+.datepicker table tr td.selected.highlighted:active.focus,
+.datepicker table tr td.selected.active.focus,
+.datepicker table tr td.selected.highlighted.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.selected.focus,
+.open > .dropdown-toggle.datepicker table tr td.selected.highlighted.focus {
+  color: #ffffff;
+  background-color: #6e6e6e;
+  border-color: #161616;
+}
+
+.datepicker table tr td.selected:active,
+.datepicker table tr td.selected.highlighted:active,
+.datepicker table tr td.selected.active,
+.datepicker table tr td.selected.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.selected,
+.open > .dropdown-toggle.datepicker table tr td.selected.highlighted {
+  background-image: none;
+}
+
+.datepicker table tr td.selected.disabled:hover,
+.datepicker table tr td.selected.highlighted.disabled:hover,
+.datepicker table tr td.selected[disabled]:hover,
+.datepicker table tr td.selected.highlighted[disabled]:hover,
+fieldset[disabled] .datepicker table tr td.selected:hover,
+fieldset[disabled] .datepicker table tr td.selected.highlighted:hover,
+.datepicker table tr td.selected.disabled:focus,
+.datepicker table tr td.selected.highlighted.disabled:focus,
+.datepicker table tr td.selected[disabled]:focus,
+.datepicker table tr td.selected.highlighted[disabled]:focus,
+fieldset[disabled] .datepicker table tr td.selected:focus,
+fieldset[disabled] .datepicker table tr td.selected.highlighted:focus,
+.datepicker table tr td.selected.disabled.focus,
+.datepicker table tr td.selected.highlighted.disabled.focus,
+.datepicker table tr td.selected[disabled].focus,
+.datepicker table tr td.selected.highlighted[disabled].focus,
+fieldset[disabled] .datepicker table tr td.selected.focus,
+fieldset[disabled] .datepicker table tr td.selected.highlighted.focus {
+  background-color: #999999;
+  border-color: #555555;
+}
+
+.datepicker table tr td.active,
+.datepicker table tr td.active.highlighted {
+  color: #ffffff;
+  background-color: #428bca;
+  border-color: #357ebd;
+  text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.datepicker table tr td.active:focus,
+.datepicker table tr td.active.highlighted:focus,
+.datepicker table tr td.active.focus,
+.datepicker table tr td.active.highlighted.focus {
+  color: #ffffff;
+  background-color: #009688;
+  border-color: #193c5a;
+}
+
+.datepicker table tr td.active:hover,
+.datepicker table tr td.active.highlighted:hover {
+  color: #ffffff;
+  background-color: #009688;
+  border-color: #007d71;
+}
+
+.datepicker table tr td.active:active,
+.datepicker table tr td.active.highlighted:active,
+.datepicker table tr td.active.active,
+.datepicker table tr td.active.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.active,
+.open > .dropdown-toggle.datepicker table tr td.active.highlighted {
+  color: #ffffff;
+  background-color: #009688;
+  border-color: #007d71;
+}
+
+.datepicker table tr td.active:active:hover,
+.datepicker table tr td.active.highlighted:active:hover,
+.datepicker table tr td.active.active:hover,
+.datepicker table tr td.active.highlighted.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.active:hover,
+.open > .dropdown-toggle.datepicker table tr td.active.highlighted:hover,
+.datepicker table tr td.active:active:focus,
+.datepicker table tr td.active.highlighted:active:focus,
+.datepicker table tr td.active.active:focus,
+.datepicker table tr td.active.highlighted.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.active:focus,
+.open > .dropdown-toggle.datepicker table tr td.active.highlighted:focus,
+.datepicker table tr td.active:active.focus,
+.datepicker table tr td.active.highlighted:active.focus,
+.datepicker table tr td.active.active.focus,
+.datepicker table tr td.active.highlighted.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.active.focus,
+.open > .dropdown-toggle.datepicker table tr td.active.highlighted.focus {
+  color: #ffffff;
+  background-color: #007d71;
+  border-color: #193c5a;
+}
+
+.datepicker table tr td.active:active,
+.datepicker table tr td.active.highlighted:active,
+.datepicker table tr td.active.active,
+.datepicker table tr td.active.highlighted.active,
+.open > .dropdown-toggle.datepicker table tr td.active,
+.open > .dropdown-toggle.datepicker table tr td.active.highlighted {
+  background-image: none;
+}
+
+.datepicker table tr td.active.disabled:hover,
+.datepicker table tr td.active.highlighted.disabled:hover,
+.datepicker table tr td.active[disabled]:hover,
+.datepicker table tr td.active.highlighted[disabled]:hover,
+fieldset[disabled] .datepicker table tr td.active:hover,
+fieldset[disabled] .datepicker table tr td.active.highlighted:hover,
+.datepicker table tr td.active.disabled:focus,
+.datepicker table tr td.active.highlighted.disabled:focus,
+.datepicker table tr td.active[disabled]:focus,
+.datepicker table tr td.active.highlighted[disabled]:focus,
+fieldset[disabled] .datepicker table tr td.active:focus,
+fieldset[disabled] .datepicker table tr td.active.highlighted:focus,
+.datepicker table tr td.active.disabled.focus,
+.datepicker table tr td.active.highlighted.disabled.focus,
+.datepicker table tr td.active[disabled].focus,
+.datepicker table tr td.active.highlighted[disabled].focus,
+fieldset[disabled] .datepicker table tr td.active.focus,
+fieldset[disabled] .datepicker table tr td.active.highlighted.focus {
+  background-color: #428bca;
+  border-color: #357ebd;
+}
+
+.datepicker table tr td span {
+  display: block;
+  width: 23%;
+  height: 54px;
+  line-height: 54px;
+  float: left;
+  margin: 1%;
+  cursor: pointer;
+  border-radius: 4px;
+}
+
+.datepicker table tr td span:hover {
+  background: #eeeeee;
+}
+
+.datepicker table tr td span.disabled,
+.datepicker table tr td span.disabled:hover {
+  background: none;
+  color: #999999;
+  cursor: default;
+}
+
+.datepicker table tr td span.active,
+.datepicker table tr td span.active:hover,
+.datepicker table tr td span.active.disabled,
+.datepicker table tr td span.active.disabled:hover {
+  color: #ffffff;
+  background-color: #428bca;
+  border-color: #357ebd;
+  text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
+}
+
+.datepicker table tr td span.active:focus,
+.datepicker table tr td span.active:hover:focus,
+.datepicker table tr td span.active.disabled:focus,
+.datepicker table tr td span.active.disabled:hover:focus,
+.datepicker table tr td span.active.focus,
+.datepicker table tr td span.active:hover.focus,
+.datepicker table tr td span.active.disabled.focus,
+.datepicker table tr td span.active.disabled:hover.focus {
+  color: #ffffff;
+  background-color: #009688;
+  border-color: #193c5a;
+}
+
+.datepicker table tr td span.active:hover,
+.datepicker table tr td span.active:hover:hover,
+.datepicker table tr td span.active.disabled:hover,
+.datepicker table tr td span.active.disabled:hover:hover {
+  color: #ffffff;
+  background-color: #009688;
+  border-color: #007d71;
+}
+
+.datepicker table tr td span.active:active,
+.datepicker table tr td span.active:hover:active,
+.datepicker table tr td span.active.disabled:active,
+.datepicker table tr td span.active.disabled:hover:active,
+.datepicker table tr td span.active.active,
+.datepicker table tr td span.active:hover.active,
+.datepicker table tr td span.active.disabled.active,
+.datepicker table tr td span.active.disabled:hover.active,
+.open > .dropdown-toggle.datepicker table tr td span.active,
+.open > .dropdown-toggle.datepicker table tr td span.active:hover,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled:hover {
+  color: #ffffff;
+  background-color: #009688;
+  border-color: #007d71;
+}
+
+.datepicker table tr td span.active:active:hover,
+.datepicker table tr td span.active:hover:active:hover,
+.datepicker table tr td span.active.disabled:active:hover,
+.datepicker table tr td span.active.disabled:hover:active:hover,
+.datepicker table tr td span.active.active:hover,
+.datepicker table tr td span.active:hover.active:hover,
+.datepicker table tr td span.active.disabled.active:hover,
+.datepicker table tr td span.active.disabled:hover.active:hover,
+.open > .dropdown-toggle.datepicker table tr td span.active:hover,
+.open > .dropdown-toggle.datepicker table tr td span.active:hover:hover,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled:hover,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled:hover:hover,
+.datepicker table tr td span.active:active:focus,
+.datepicker table tr td span.active:hover:active:focus,
+.datepicker table tr td span.active.disabled:active:focus,
+.datepicker table tr td span.active.disabled:hover:active:focus,
+.datepicker table tr td span.active.active:focus,
+.datepicker table tr td span.active:hover.active:focus,
+.datepicker table tr td span.active.disabled.active:focus,
+.datepicker table tr td span.active.disabled:hover.active:focus,
+.open > .dropdown-toggle.datepicker table tr td span.active:focus,
+.open > .dropdown-toggle.datepicker table tr td span.active:hover:focus,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled:focus,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled:hover:focus,
+.datepicker table tr td span.active:active.focus,
+.datepicker table tr td span.active:hover:active.focus,
+.datepicker table tr td span.active.disabled:active.focus,
+.datepicker table tr td span.active.disabled:hover:active.focus,
+.datepicker table tr td span.active.active.focus,
+.datepicker table tr td span.active:hover.active.focus,
+.datepicker table tr td span.active.disabled.active.focus,
+.datepicker table tr td span.active.disabled:hover.active.focus,
+.open > .dropdown-toggle.datepicker table tr td span.active.focus,
+.open > .dropdown-toggle.datepicker table tr td span.active:hover.focus,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled.focus,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled:hover.focus {
+  color: #ffffff;
+  background-color: #007d71;
+  border-color: #193c5a;
+}
+
+.datepicker table tr td span.active:active,
+.datepicker table tr td span.active:hover:active,
+.datepicker table tr td span.active.disabled:active,
+.datepicker table tr td span.active.disabled:hover:active,
+.datepicker table tr td span.active.active,
+.datepicker table tr td span.active:hover.active,
+.datepicker table tr td span.active.disabled.active,
+.datepicker table tr td span.active.disabled:hover.active,
+.open > .dropdown-toggle.datepicker table tr td span.active,
+.open > .dropdown-toggle.datepicker table tr td span.active:hover,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled,
+.open > .dropdown-toggle.datepicker table tr td span.active.disabled:hover {
+  background-image: none;
+}
+
+.datepicker table tr td span.active.disabled:hover,
+.datepicker table tr td span.active:hover.disabled:hover,
+.datepicker table tr td span.active.disabled.disabled:hover,
+.datepicker table tr td span.active.disabled:hover.disabled:hover,
+.datepicker table tr td span.active[disabled]:hover,
+.datepicker table tr td span.active:hover[disabled]:hover,
+.datepicker table tr td span.active.disabled[disabled]:hover,
+.datepicker table tr td span.active.disabled:hover[disabled]:hover,
+fieldset[disabled] .datepicker table tr td span.active:hover,
+fieldset[disabled] .datepicker table tr td span.active:hover:hover,
+fieldset[disabled] .datepicker table tr td span.active.disabled:hover,
+fieldset[disabled] .datepicker table tr td span.active.disabled:hover:hover,
+.datepicker table tr td span.active.disabled:focus,
+.datepicker table tr td span.active:hover.disabled:focus,
+.datepicker table tr td span.active.disabled.disabled:focus,
+.datepicker table tr td span.active.disabled:hover.disabled:focus,
+.datepicker table tr td span.active[disabled]:focus,
+.datepicker table tr td span.active:hover[disabled]:focus,
+.datepicker table tr td span.active.disabled[disabled]:focus,
+.datepicker table tr td span.active.disabled:hover[disabled]:focus,
+fieldset[disabled] .datepicker table tr td span.active:focus,
+fieldset[disabled] .datepicker table tr td span.active:hover:focus,
+fieldset[disabled] .datepicker table tr td span.active.disabled:focus,
+fieldset[disabled] .datepicker table tr td span.active.disabled:hover:focus,
+.datepicker table tr td span.active.disabled.focus,
+.datepicker table tr td span.active:hover.disabled.focus,
+.datepicker table tr td span.active.disabled.disabled.focus,
+.datepicker table tr td span.active.disabled:hover.disabled.focus,
+.datepicker table tr td span.active[disabled].focus,
+.datepicker table tr td span.active:hover[disabled].focus,
+.datepicker table tr td span.active.disabled[disabled].focus,
+.datepicker table tr td span.active.disabled:hover[disabled].focus,
+fieldset[disabled] .datepicker table tr td span.active.focus,
+fieldset[disabled] .datepicker table tr td span.active:hover.focus,
+fieldset[disabled] .datepicker table tr td span.active.disabled.focus,
+fieldset[disabled] .datepicker table tr td span.active.disabled:hover.focus {
+  background-color: #428bca;
+  border-color: #357ebd;
+}
+
+.datepicker table tr td span.old,
+.datepicker table tr td span.new {
+  color: #999999;
+}
+
+.datepicker .datepicker-switch {
+  width: 145px;
+}
+
+.datepicker .datepicker-switch,
+.datepicker .prev,
+.datepicker .next,
+.datepicker tfoot tr th {
+  cursor: pointer;
+}
+
+.datepicker .datepicker-switch:hover,
+.datepicker .prev:hover,
+.datepicker .next:hover,
+.datepicker tfoot tr th:hover {
+  background: #eeeeee;
+}
+
+.datepicker .cw {
+  font-size: 10px;
+  width: 12px;
+  padding: 0 2px 0 5px;
+  vertical-align: middle;
+}
+
+.input-group.date .input-group-addon {
+  cursor: pointer;
+}
+
+.input-daterange {
+  width: 100%;
+}
+
+.input-daterange input {
+  text-align: center;
+}
+
+.input-daterange input:first-child {
+  border-radius: 3px 0 0 3px;
+}
+
+.input-daterange input:last-child {
+  border-radius: 0 3px 3px 0;
+}
+
+.input-daterange .input-group-addon {
+  width: auto;
+  min-width: 16px;
+  padding: 4px 5px;
+  font-weight: normal;
+  line-height: 1.42857143;
+  text-align: center;
+  text-shadow: 0 1px 0 #fff;
+  vertical-align: middle;
+  background-color: #eeeeee;
+  border: solid #cccccc;
+  border-width: 1px 0;
+  margin-left: -5px;
+  margin-right: -5px;
+}
+
+.datepicker.dropdown-menu {
+  position: absolute;
+  top: 100%;
+  left: 0;
+  right: auto;
+  z-index: 1000;
+  float: left;
+  display: none;
+  min-width: 160px;
+  list-style: none;
+  background-color: #ffffff;
+  border: 1px solid #ccc;
+  border: 1px solid rgba(0, 0, 0, 0.1);
+  border-radius: 5px;
+  -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+  box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+  background-clip: padding-box;
+  *border-right-width: 2px;
+  *border-bottom-width: 2px;
+  color: #333333;
+  font-size: 13px;
+  line-height: 1.42857143;
+}
+
+.datepicker.dropdown-menu th,
+.datepicker.datepicker-inline th,
+.datepicker.dropdown-menu td,
+.datepicker.datepicker-inline td {
+  padding: 0px 5px;
+}
+
+body.stop-scrolling {
+  height: 100%;
+  overflow: hidden;
+}
+
+.sweet-overlay {
+  background-color: rgba(255, 255, 255, 0.9);
+  position: fixed;
+  left: 0;
+  right: 0;
+  top: 0;
+  bottom: 0;
+  display: none;
+  outline: none !important;
+  z-index: 10000;
+}
+
+.sweet-alert {
+  background-color: white;
+  width: 478px;
+  padding: 20px;
+  border-radius: 3px;
+  text-align: center;
+  position: fixed;
+  left: 50%;
+  top: 50%;
+  margin-left: -259px;
+  margin-top: -200px;
+  -webkit-box-shadow: 0 4px 23px 5px rgba(0, 0, 0, 0.2), 0 2px 6px rgba(0, 0, 0, 0.15);
+          box-shadow: 0 4px 23px 5px rgba(0, 0, 0, 0.2), 0 2px 6px rgba(0, 0, 0, 0.15);
+  overflow: hidden;
+  display: none;
+  z-index: 99999;
+}
+
+@media all and (max-width: 540px) {
+  .sweet-alert {
+    width: auto;
+    margin-left: 0;
+    margin-right: 0;
+    left: 15px;
+    right: 15px;
+  }
+}
+
+.sweet-alert h2 {
+  color: #575757;
+  font-size: 30px;
+  text-align: center;
+  font-weight: 500;
+  text-transform: none;
+  position: relative;
+  margin: 15px 0 0 0;
+  padding: 0;
+  line-height: 40px;
+  display: block;
+}
+
+.sweet-alert p {
+  color: #797979;
+  font-size: 16px;
+  text-align: center;
+  font-weight: 400;
+  position: relative;
+  text-align: inherit;
+  float: none;
+  margin: 0;
+  padding: 0;
+  line-height: normal;
+}
+
+.sweet-alert fieldset {
+  border: none;
+  position: relative;
+}
+
+.sweet-alert .sa-error-container {
+  background-color: #f1f1f1;
+  margin-left: -17px;
+  margin-right: -17px;
+  overflow: hidden;
+  padding: 0 10px;
+  max-height: 0;
+  webkit-transition: padding 0.15s, max-height 0.15s;
+  -webkit-transition: padding 0.15s, max-height 0.15s;
+  -o-transition: padding 0.15s, max-height 0.15s;
+  transition: padding 0.15s, max-height 0.15s;
+}
+
+.sweet-alert .sa-error-container.show {
+  padding: 10px 0;
+  max-height: 100px;
+  webkit-transition: padding 0.2s, max-height 0.2s;
+  -webkit-transition: padding 0.25s, max-height 0.25s;
+  -o-transition: padding 0.25s, max-height 0.25s;
+  transition: padding 0.25s, max-height 0.25s;
+}
+
+.sweet-alert .sa-error-container .icon {
+  display: inline-block;
+  width: 24px;
+  height: 24px;
+  border-radius: 50%;
+  background-color: #ea7d7d;
+  color: white;
+  line-height: 24px;
+  text-align: center;
+  margin-right: 3px;
+}
+
+.sweet-alert .sa-error-container p {
+  display: inline-block;
+}
+
+.sweet-alert .sa-input-error {
+  position: absolute;
+  top: 22px;
+  right: 10px;
+  width: 20px;
+  height: 20px;
+  opacity: 0;
+  -webkit-transform: scale(0.5);
+  -ms-transform: scale(0.5);
+      transform: scale(0.5);
+  -webkit-transform-origin: 50% 50%;
+  -ms-transform-origin: 50% 50%;
+      transform-origin: 50% 50%;
+  -webkit-transition: all 0.1s;
+  -o-transition: all 0.1s;
+  transition: all 0.1s;
+}
+
+.sweet-alert .sa-input-error::before, .sweet-alert .sa-input-error::after {
+  content: "";
+  width: 20px;
+  height: 6px;
+  background-color: #f06e57;
+  border-radius: 3px;
+  position: absolute;
+  top: 50%;
+  margin-top: -4px;
+  left: 50%;
+  margin-left: -9px;
+}
+
+.sweet-alert .sa-input-error::before {
+  -webkit-transform: rotate(-45deg);
+  -ms-transform: rotate(-45deg);
+      transform: rotate(-45deg);
+}
+
+.sweet-alert .sa-input-error::after {
+  -webkit-transform: rotate(45deg);
+  -ms-transform: rotate(45deg);
+      transform: rotate(45deg);
+}
+
+.sweet-alert .sa-input-error.show {
+  opacity: 1;
+  -webkit-transform: scale(1);
+  -ms-transform: scale(1);
+      transform: scale(1);
+}
+
+.sweet-alert input {
+  display: none;
+  width: 100%;
+  height: 40px;
+  padding: 8px 12px 4px;
+  font-size: 14px;
+  font-weight: 500;
+  line-height: 1.44;
+  color: #555;
+  margin-top: 10px;
+  margin-bottom: 17px;
+  background-color: #fff;
+  background-image: none;
+  border: 2px solid #ccc;
+  border-radius: 3px;
+  -webkit-transition: border-color ease-in-out 0.15s;
+  -o-transition: border-color ease-in-out 0.15s;
+  transition: border-color ease-in-out 0.15s;
+}
+
+.sweet-alert input:focus {
+  border-color: #009688;
+  outline: none;
+}
+
+.sweet-alert.show-input input {
+  display: block;
+}
+
+.sweet-alert .sa-confirm-button-container {
+  display: inline-block;
+  position: relative;
+}
+
+.sweet-alert .la-ball-fall {
+  position: absolute;
+  left: 50%;
+  top: 50%;
+  margin-left: -27px;
+  margin-top: 4px;
+  opacity: 0;
+  visibility: hidden;
+}
+
+.sweet-alert button {
+  background-color: #009688 !important;
+  color: white;
+  border: none;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  font-size: 17px;
+  font-weight: 500;
+  border-radius: 3px;
+  padding: 8px 20px;
+  margin: 26px 5px 0 5px;
+  cursor: pointer;
+}
+
+.sweet-alert button:focus {
+  outline: none;
+  -webkit-box-shadow: 0 0 2px rgba(128, 179, 235, 0.5), inset 0 0 0 1px rgba(0, 0, 0, 0.05);
+          box-shadow: 0 0 2px rgba(128, 179, 235, 0.5), inset 0 0 0 1px rgba(0, 0, 0, 0.05);
+}
+
+.sweet-alert button:hover {
+  background-color: #00877a;
+}
+
+.sweet-alert button:active {
+  background-color: #00635a;
+}
+
+.sweet-alert button.cancel {
+  background-color: #C1C1C1 !important;
+}
+
+.sweet-alert button.cancel:hover {
+  background-color: #b9b9b9;
+}
+
+.sweet-alert button.cancel:active {
+  background-color: #a8a7a7;
+}
+
+.sweet-alert button.cancel:focus {
+  -webkit-box-shadow: rgba(197, 205, 211, 0.8) 0px 0px 2px, rgba(0, 0, 0, 0.0470588) 0px 0px 0px 1px inset !important;
+          box-shadow: rgba(197, 205, 211, 0.8) 0px 0px 2px, rgba(0, 0, 0, 0.0470588) 0px 0px 0px 1px inset !important;
+}
+
+.sweet-alert button[disabled] {
+  opacity: .6;
+  cursor: default;
+}
+
+.sweet-alert button.confirm[disabled] {
+  color: transparent;
+}
+
+.sweet-alert button.confirm[disabled] ~ .la-ball-fall {
+  opacity: 1;
+  visibility: visible;
+  -webkit-transition-delay: 0s;
+       -o-transition-delay: 0s;
+          transition-delay: 0s;
+}
+
+.sweet-alert button::-moz-focus-inner {
+  border: 0;
+}
+
+.sweet-alert[data-has-cancel-button=false] button {
+  -webkit-box-shadow: none !important;
+          box-shadow: none !important;
+}
+
+.sweet-alert[data-has-confirm-button=false][data-has-cancel-button=false] {
+  padding-bottom: 40px;
+}
+
+.sweet-alert .sa-icon {
+  width: 80px;
+  height: 80px;
+  border: 4px solid gray;
+  border-radius: 40px;
+  border-radius: 50%;
+  margin: 20px auto;
+  padding: 0;
+  position: relative;
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+}
+
+.sweet-alert .sa-icon.sa-error {
+  border-color: #F27474;
+}
+
+.sweet-alert .sa-icon.sa-error .sa-x-mark {
+  position: relative;
+  display: block;
+}
+
+.sweet-alert .sa-icon.sa-error .sa-line {
+  position: absolute;
+  height: 5px;
+  width: 47px;
+  background-color: #F27474;
+  display: block;
+  top: 37px;
+  border-radius: 2px;
+}
+
+.sweet-alert .sa-icon.sa-error .sa-line.sa-left {
+  -webkit-transform: rotate(45deg);
+  -ms-transform: rotate(45deg);
+      transform: rotate(45deg);
+  left: 17px;
+}
+
+.sweet-alert .sa-icon.sa-error .sa-line.sa-right {
+  -webkit-transform: rotate(-45deg);
+  -ms-transform: rotate(-45deg);
+      transform: rotate(-45deg);
+  right: 16px;
+}
+
+.sweet-alert .sa-icon.sa-warning {
+  border-color: #F8BB86;
+}
+
+.sweet-alert .sa-icon.sa-warning .sa-body {
+  position: absolute;
+  width: 5px;
+  height: 47px;
+  left: 50%;
+  top: 10px;
+  border-radius: 2px;
+  margin-left: -2px;
+  background-color: #F8BB86;
+}
+
+.sweet-alert .sa-icon.sa-warning .sa-dot {
+  position: absolute;
+  width: 7px;
+  height: 7px;
+  border-radius: 50%;
+  margin-left: -3px;
+  left: 50%;
+  bottom: 10px;
+  background-color: #F8BB86;
+}
+
+.sweet-alert .sa-icon.sa-info {
+  border-color: #C9DAE1;
+}
+
+.sweet-alert .sa-icon.sa-info::before {
+  content: "";
+  position: absolute;
+  width: 5px;
+  height: 29px;
+  left: 50%;
+  bottom: 17px;
+  border-radius: 2px;
+  margin-left: -2px;
+  background-color: #C9DAE1;
+}
+
+.sweet-alert .sa-icon.sa-info::after {
+  content: "";
+  position: absolute;
+  width: 7px;
+  height: 7px;
+  border-radius: 50%;
+  margin-left: -3px;
+  top: 19px;
+  background-color: #C9DAE1;
+}
+
+.sweet-alert .sa-icon.sa-success {
+  border-color: #A5DC86;
+}
+
+.sweet-alert .sa-icon.sa-success::before, .sweet-alert .sa-icon.sa-success::after {
+  content: '';
+  border-radius: 40px;
+  border-radius: 50%;
+  position: absolute;
+  width: 60px;
+  height: 120px;
+  background: white;
+  -webkit-transform: rotate(45deg);
+  -ms-transform: rotate(45deg);
+      transform: rotate(45deg);
+}
+
+.sweet-alert .sa-icon.sa-success::before {
+  border-radius: 120px 0 0 120px;
+  top: -7px;
+  left: -33px;
+  -webkit-transform: rotate(-45deg);
+  -ms-transform: rotate(-45deg);
+      transform: rotate(-45deg);
+  -webkit-transform-origin: 60px 60px;
+  -ms-transform-origin: 60px 60px;
+      transform-origin: 60px 60px;
+}
+
+.sweet-alert .sa-icon.sa-success::after {
+  border-radius: 0 120px 120px 0;
+  top: -11px;
+  left: 30px;
+  -webkit-transform: rotate(-45deg);
+  -ms-transform: rotate(-45deg);
+      transform: rotate(-45deg);
+  -webkit-transform-origin: 0px 60px;
+  -ms-transform-origin: 0px 60px;
+      transform-origin: 0px 60px;
+}
+
+.sweet-alert .sa-icon.sa-success .sa-placeholder {
+  width: 80px;
+  height: 80px;
+  border: 4px solid rgba(165, 220, 134, 0.2);
+  border-radius: 40px;
+  border-radius: 50%;
+  -webkit-box-sizing: content-box;
+          box-sizing: content-box;
+  position: absolute;
+  left: -4px;
+  top: -4px;
+  z-index: 2;
+}
+
+.sweet-alert .sa-icon.sa-success .sa-fix {
+  width: 5px;
+  height: 90px;
+  background-color: white;
+  position: absolute;
+  left: 28px;
+  top: 8px;
+  z-index: 1;
+  -webkit-transform: rotate(-45deg);
+  -ms-transform: rotate(-45deg);
+      transform: rotate(-45deg);
+}
+
+.sweet-alert .sa-icon.sa-success .sa-line {
+  height: 5px;
+  background-color: #A5DC86;
+  display: block;
+  border-radius: 2px;
+  position: absolute;
+  z-index: 2;
+}
+
+.sweet-alert .sa-icon.sa-success .sa-line.sa-tip {
+  width: 25px;
+  left: 14px;
+  top: 46px;
+  -webkit-transform: rotate(45deg);
+  -ms-transform: rotate(45deg);
+      transform: rotate(45deg);
+}
+
+.sweet-alert .sa-icon.sa-success .sa-line.sa-long {
+  width: 47px;
+  right: 8px;
+  top: 38px;
+  -webkit-transform: rotate(-45deg);
+  -ms-transform: rotate(-45deg);
+      transform: rotate(-45deg);
+}
+
+.sweet-alert .sa-icon.sa-custom {
+  background-size: contain;
+  border-radius: 0;
+  border: none;
+  background-position: center center;
+  background-repeat: no-repeat;
+}
+
+/*
+ * Animations
+ */
+@-webkit-keyframes showSweetAlert {
+  0% {
+    transform: scale(0.7);
+    -webkit-transform: scale(0.7);
+  }
+  45% {
+    transform: scale(1.05);
+    -webkit-transform: scale(1.05);
+  }
+  80% {
+    transform: scale(0.95);
+    -webkit-transform: scale(0.95);
+  }
+  100% {
+    transform: scale(1);
+    -webkit-transform: scale(1);
+  }
+}
+
+@keyframes showSweetAlert {
+  0% {
+    transform: scale(0.7);
+    -webkit-transform: scale(0.7);
+  }
+  45% {
+    transform: scale(1.05);
+    -webkit-transform: scale(1.05);
+  }
+  80% {
+    transform: scale(0.95);
+    -webkit-transform: scale(0.95);
+  }
+  100% {
+    transform: scale(1);
+    -webkit-transform: scale(1);
+  }
+}
+
+@-webkit-keyframes hideSweetAlert {
+  0% {
+    transform: scale(1);
+    -webkit-transform: scale(1);
+  }
+  100% {
+    transform: scale(0.5);
+    -webkit-transform: scale(0.5);
+  }
+}
+
+@keyframes hideSweetAlert {
+  0% {
+    transform: scale(1);
+    -webkit-transform: scale(1);
+  }
+  100% {
+    transform: scale(0.5);
+    -webkit-transform: scale(0.5);
+  }
+}
+
+@-webkit-keyframes slideFromTop {
+  0% {
+    top: 0%;
+  }
+  100% {
+    top: 50%;
+  }
+}
+
+@keyframes slideFromTop {
+  0% {
+    top: 0%;
+  }
+  100% {
+    top: 50%;
+  }
+}
+
+@-webkit-keyframes slideToTop {
+  0% {
+    top: 50%;
+  }
+  100% {
+    top: 0%;
+  }
+}
+
+@keyframes slideToTop {
+  0% {
+    top: 50%;
+  }
+  100% {
+    top: 0%;
+  }
+}
+
+@-webkit-keyframes slideFromBottom {
+  0% {
+    top: 70%;
+  }
+  100% {
+    top: 50%;
+  }
+}
+
+@keyframes slideFromBottom {
+  0% {
+    top: 70%;
+  }
+  100% {
+    top: 50%;
+  }
+}
+
+@-webkit-keyframes slideToBottom {
+  0% {
+    top: 50%;
+  }
+  100% {
+    top: 70%;
+  }
+}
+
+@keyframes slideToBottom {
+  0% {
+    top: 50%;
+  }
+  100% {
+    top: 70%;
+  }
+}
+
+.showSweetAlert[data-animation=pop] {
+  -webkit-animation: showSweetAlert 0.3s;
+  animation: showSweetAlert 0.3s;
+}
+
+.showSweetAlert[data-animation=none] {
+  -webkit-animation: none;
+  animation: none;
+}
+
+.showSweetAlert[data-animation=slide-from-top] {
+  -webkit-animation: slideFromTop 0.3s;
+  animation: slideFromTop 0.3s;
+}
+
+.showSweetAlert[data-animation=slide-from-bottom] {
+  -webkit-animation: slideFromBottom 0.3s;
+  animation: slideFromBottom 0.3s;
+}
+
+.hideSweetAlert[data-animation=pop] {
+  -webkit-animation: hideSweetAlert 0.2s;
+  animation: hideSweetAlert 0.2s;
+}
+
+.hideSweetAlert[data-animation=none] {
+  -webkit-animation: none;
+  animation: none;
+}
+
+.hideSweetAlert[data-animation=slide-from-top] {
+  -webkit-animation: slideToTop 0.4s;
+  animation: slideToTop 0.4s;
+}
+
+.hideSweetAlert[data-animation=slide-from-bottom] {
+  -webkit-animation: slideToBottom 0.3s;
+  animation: slideToBottom 0.3s;
+}
+
+@-webkit-keyframes animateSuccessTip {
+  0% {
+    width: 0;
+    left: 1px;
+    top: 19px;
+  }
+  54% {
+    width: 0;
+    left: 1px;
+    top: 19px;
+  }
+  70% {
+    width: 50px;
+    left: -8px;
+    top: 37px;
+  }
+  84% {
+    width: 17px;
+    left: 21px;
+    top: 48px;
+  }
+  100% {
+    width: 25px;
+    left: 14px;
+    top: 45px;
+  }
+}
+
+@keyframes animateSuccessTip {
+  0% {
+    width: 0;
+    left: 1px;
+    top: 19px;
+  }
+  54% {
+    width: 0;
+    left: 1px;
+    top: 19px;
+  }
+  70% {
+    width: 50px;
+    left: -8px;
+    top: 37px;
+  }
+  84% {
+    width: 17px;
+    left: 21px;
+    top: 48px;
+  }
+  100% {
+    width: 25px;
+    left: 14px;
+    top: 45px;
+  }
+}
+
+@-webkit-keyframes animateSuccessLong {
+  0% {
+    width: 0;
+    right: 46px;
+    top: 54px;
+  }
+  65% {
+    width: 0;
+    right: 46px;
+    top: 54px;
+  }
+  84% {
+    width: 55px;
+    right: 0px;
+    top: 35px;
+  }
+  100% {
+    width: 47px;
+    right: 8px;
+    top: 38px;
+  }
+}
+
+@keyframes animateSuccessLong {
+  0% {
+    width: 0;
+    right: 46px;
+    top: 54px;
+  }
+  65% {
+    width: 0;
+    right: 46px;
+    top: 54px;
+  }
+  84% {
+    width: 55px;
+    right: 0px;
+    top: 35px;
+  }
+  100% {
+    width: 47px;
+    right: 8px;
+    top: 38px;
+  }
+}
+
+@-webkit-keyframes rotatePlaceholder {
+  0% {
+    transform: rotate(-45deg);
+    -webkit-transform: rotate(-45deg);
+  }
+  5% {
+    transform: rotate(-45deg);
+    -webkit-transform: rotate(-45deg);
+  }
+  12% {
+    transform: rotate(-405deg);
+    -webkit-transform: rotate(-405deg);
+  }
+  100% {
+    transform: rotate(-405deg);
+    -webkit-transform: rotate(-405deg);
+  }
+}
+
+@keyframes rotatePlaceholder {
+  0% {
+    transform: rotate(-45deg);
+    -webkit-transform: rotate(-45deg);
+  }
+  5% {
+    transform: rotate(-45deg);
+    -webkit-transform: rotate(-45deg);
+  }
+  12% {
+    transform: rotate(-405deg);
+    -webkit-transform: rotate(-405deg);
+  }
+  100% {
+    transform: rotate(-405deg);
+    -webkit-transform: rotate(-405deg);
+  }
+}
+
+.animateSuccessTip {
+  -webkit-animation: animateSuccessTip 0.75s;
+  animation: animateSuccessTip 0.75s;
+}
+
+.animateSuccessLong {
+  -webkit-animation: animateSuccessLong 0.75s;
+  animation: animateSuccessLong 0.75s;
+}
+
+.sa-icon.sa-success.animate::after {
+  -webkit-animation: rotatePlaceholder 4.25s ease-in;
+  animation: rotatePlaceholder 4.25s ease-in;
+}
+
+@-webkit-keyframes animateErrorIcon {
+  0% {
+    transform: rotateX(100deg);
+    -webkit-transform: rotateX(100deg);
+    opacity: 0;
+  }
+  100% {
+    transform: rotateX(0deg);
+    -webkit-transform: rotateX(0deg);
+    opacity: 1;
+  }
+}
+
+@keyframes animateErrorIcon {
+  0% {
+    transform: rotateX(100deg);
+    -webkit-transform: rotateX(100deg);
+    opacity: 0;
+  }
+  100% {
+    transform: rotateX(0deg);
+    -webkit-transform: rotateX(0deg);
+    opacity: 1;
+  }
+}
+
+.animateErrorIcon {
+  -webkit-animation: animateErrorIcon 0.5s;
+  animation: animateErrorIcon 0.5s;
+}
+
+@-webkit-keyframes animateXMark {
+  0% {
+    transform: scale(0.4);
+    -webkit-transform: scale(0.4);
+    margin-top: 26px;
+    opacity: 0;
+  }
+  50% {
+    transform: scale(0.4);
+    -webkit-transform: scale(0.4);
+    margin-top: 26px;
+    opacity: 0;
+  }
+  80% {
+    transform: scale(1.15);
+    -webkit-transform: scale(1.15);
+    margin-top: -6px;
+  }
+  100% {
+    transform: scale(1);
+    -webkit-transform: scale(1);
+    margin-top: 0;
+    opacity: 1;
+  }
+}
+
+@keyframes animateXMark {
+  0% {
+    transform: scale(0.4);
+    -webkit-transform: scale(0.4);
+    margin-top: 26px;
+    opacity: 0;
+  }
+  50% {
+    transform: scale(0.4);
+    -webkit-transform: scale(0.4);
+    margin-top: 26px;
+    opacity: 0;
+  }
+  80% {
+    transform: scale(1.15);
+    -webkit-transform: scale(1.15);
+    margin-top: -6px;
+  }
+  100% {
+    transform: scale(1);
+    -webkit-transform: scale(1);
+    margin-top: 0;
+    opacity: 1;
+  }
+}
+
+.animateXMark {
+  -webkit-animation: animateXMark 0.5s;
+  animation: animateXMark 0.5s;
+}
+
+@-webkit-keyframes pulseWarning {
+  0% {
+    border-color: #F8D486;
+  }
+  100% {
+    border-color: #F8BB86;
+  }
+}
+
+@keyframes pulseWarning {
+  0% {
+    border-color: #F8D486;
+  }
+  100% {
+    border-color: #F8BB86;
+  }
+}
+
+.pulseWarning {
+  -webkit-animation: pulseWarning 0.75s infinite alternate;
+  animation: pulseWarning 0.75s infinite alternate;
+}
+
+@-webkit-keyframes pulseWarningIns {
+  0% {
+    background-color: #F8D486;
+  }
+  100% {
+    background-color: #F8BB86;
+  }
+}
+
+@keyframes pulseWarningIns {
+  0% {
+    background-color: #F8D486;
+  }
+  100% {
+    background-color: #F8BB86;
+  }
+}
+
+.pulseWarningIns {
+  -webkit-animation: pulseWarningIns 0.75s infinite alternate;
+  animation: pulseWarningIns 0.75s infinite alternate;
+}
+
+@-webkit-keyframes rotate-loading {
+  0% {
+    -webkit-transform: rotate(0deg);
+            transform: rotate(0deg);
+  }
+  100% {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+@keyframes rotate-loading {
+  0% {
+    -webkit-transform: rotate(0deg);
+            transform: rotate(0deg);
+  }
+  100% {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+.notify-alert {
+  -webkit-box-shadow: 0 3px 10px rgba(0, 0, 0, 0.23), 0 3px 10px rgba(0, 0, 0, 0.16);
+          box-shadow: 0 3px 10px rgba(0, 0, 0, 0.23), 0 3px 10px rgba(0, 0, 0, 0.16);
+  border: 0 !important;
+  max-width: 400px;
+  color: #FFF;
+}
+
+.notify-alert.alert-success {
+  background-color: #28a745;
+}
+
+.notify-alert.alert-info {
+  background-color: #17a2b8;
+}
+
+.notify-alert.alert-warning {
+  background-color: #ffce3a;
+}
+
+.notify-alert.alert-danger {
+  background-color: #e04b59;
+}
+
+.notify-alert button[data-notify="dismiss"] {
+  margin-left: 5px;
+  outline: none !important;
+}
+
+.select2-container {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  display: inline-block;
+  margin: 0;
+  position: relative;
+  vertical-align: middle;
+}
+
+.select2-container .select2-selection--single {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  cursor: pointer;
+  display: block;
+  height: 40px;
+  -moz-user-select: none;
+   -ms-user-select: none;
+       user-select: none;
+  -webkit-user-select: none;
+  -webkit-transition: all 0.15s ease-in-out;
+  -o-transition: all 0.15s ease-in-out;
+  transition: all 0.15s ease-in-out;
+}
+
+.select2-container .select2-selection--single .select2-selection__rendered {
+  display: block;
+  padding-left: 8px;
+  padding-right: 20px;
+  overflow: hidden;
+  -o-text-overflow: ellipsis;
+     text-overflow: ellipsis;
+  white-space: nowrap;
+}
+
+.select2-container .select2-selection--single .select2-selection__clear {
+  position: relative;
+}
+
+.select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered {
+  padding-right: 8px;
+  padding-left: 20px;
+}
+
+.select2-container .select2-selection--multiple {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  cursor: pointer;
+  display: block;
+  min-height: 32px;
+  -moz-user-select: none;
+   -ms-user-select: none;
+       user-select: none;
+  -webkit-user-select: none;
+}
+
+.select2-container .select2-selection--multiple .select2-selection__rendered {
+  display: inline-block;
+  overflow: hidden;
+  padding-left: 8px;
+  -o-text-overflow: ellipsis;
+     text-overflow: ellipsis;
+  white-space: nowrap;
+}
+
+.select2-container .select2-search--inline {
+  float: left;
+}
+
+.select2-container .select2-search--inline .select2-search__field {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  border: none;
+  font-size: 100%;
+  margin-top: 7px;
+  padding: 0;
+}
+
+.select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button {
+  -webkit-appearance: none;
+}
+
+.select2-dropdown {
+  background-color: white;
+  border: 2px solid #009688;
+  border-radius: 4px;
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  display: block;
+  position: absolute;
+  left: -100000px;
+  width: 100%;
+  z-index: 1051;
+}
+
+.select2-results {
+  display: block;
+}
+
+.select2-results__options {
+  list-style: none;
+  margin: 0;
+  padding: 0;
+}
+
+.select2-results__option {
+  padding: 6px;
+  -moz-user-select: none;
+   -ms-user-select: none;
+       user-select: none;
+  -webkit-user-select: none;
+}
+
+.select2-results__option[aria-selected] {
+  cursor: pointer;
+}
+
+.select2-container--open .select2-dropdown {
+  left: 0;
+}
+
+.select2-container--open .select2-dropdown--above {
+  border-bottom: none;
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.select2-container--open .select2-dropdown--below {
+  border-top: none;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.select2-search--dropdown {
+  display: block;
+  padding: 4px;
+}
+
+.select2-search--dropdown .select2-search__field {
+  padding: 4px;
+  width: 100%;
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  outline: none;
+}
+
+.select2-search--dropdown .select2-search__field::-webkit-search-cancel-button {
+  -webkit-appearance: none;
+}
+
+.select2-search--dropdown.select2-search--hide {
+  display: none;
+}
+
+.select2-close-mask {
+  border: 0;
+  margin: 0;
+  padding: 0;
+  display: block;
+  position: fixed;
+  left: 0;
+  top: 0;
+  min-height: 100%;
+  min-width: 100%;
+  height: auto;
+  width: auto;
+  opacity: 0;
+  z-index: 99;
+  background-color: #fff;
+  filter: alpha(opacity=0);
+}
+
+.select2-hidden-accessible {
+  border: 0 !important;
+  clip: rect(0 0 0 0) !important;
+  height: 1px !important;
+  margin: -1px !important;
+  overflow: hidden !important;
+  padding: 0 !important;
+  position: absolute !important;
+  width: 1px !important;
+}
+
+.select2-container--default .select2-selection--single {
+  background-color: #fff;
+  border: 2px solid #ccc;
+  border-radius: 3px;
+  outline: none;
+}
+
+.select2-container--default .select2-selection--single .select2-selection__rendered {
+  color: #444;
+  line-height: 37px;
+}
+
+.select2-container--default .select2-selection--single .select2-selection__clear {
+  cursor: pointer;
+  float: right;
+  font-weight: bold;
+}
+
+.select2-container--default .select2-selection--single .select2-selection__placeholder {
+  color: #999;
+}
+
+.select2-container--default .select2-selection--single .select2-selection__arrow {
+  height: 40px;
+  position: absolute;
+  top: 1px;
+  right: 5px;
+  width: 20px;
+}
+
+.select2-container--default .select2-selection--single .select2-selection__arrow b {
+  border-color: #888 transparent transparent transparent;
+  border-style: solid;
+  border-width: 5px 4px 0 4px;
+  height: 0;
+  left: 50%;
+  margin-left: -4px;
+  margin-top: -2px;
+  position: absolute;
+  top: 50%;
+  width: 0;
+}
+
+.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear {
+  float: left;
+}
+
+.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow {
+  left: 1px;
+  right: auto;
+}
+
+.select2-container--default.select2-container--disabled .select2-selection--single {
+  background-color: #eee;
+  cursor: default;
+}
+
+.select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear {
+  display: none;
+}
+
+.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b {
+  border-color: transparent transparent #888 transparent;
+  border-width: 0 4px 5px 4px;
+}
+
+.select2-container--default .select2-selection--multiple {
+  background-color: white;
+  border: 2px solid #ccc;
+  border-radius: 4px;
+  cursor: text;
+}
+
+.select2-container--default .select2-selection--multiple .select2-selection__rendered {
+  -webkit-box-sizing: border-box;
+          box-sizing: border-box;
+  list-style: none;
+  margin: 0;
+  padding: 0 8px;
+  width: 100%;
+}
+
+.select2-container--default .select2-selection--multiple .select2-selection__placeholder {
+  color: #999;
+  margin-top: 5px;
+  float: left;
+}
+
+.select2-container--default .select2-selection--multiple .select2-selection__clear {
+  cursor: pointer;
+  float: right;
+  font-weight: bold;
+  margin-top: 5px;
+  margin-right: 10px;
+}
+
+.select2-container--default .select2-selection--multiple .select2-selection__choice {
+  background-color: #009688;
+  color: #FFF;
+  border-radius: 3px;
+  cursor: default;
+  float: left;
+  margin-right: 6px;
+  margin-top: 6px;
+  padding: 1px 6px;
+}
+
+.select2-container--default .select2-selection--multiple .select2-selection__choice__remove {
+  color: #FFF;
+  cursor: pointer;
+  display: inline-block;
+  font-weight: bold;
+  margin-right: 4px;
+}
+
+.select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover {
+  color: #eee;
+}
+
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice,
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder,
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline {
+  float: right;
+}
+
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice {
+  margin-left: 5px;
+  margin-right: auto;
+}
+
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove {
+  margin-left: 2px;
+  margin-right: auto;
+}
+
+.select2-container--default.select2-container--focus .select2-selection--multiple {
+  border-color: #009688;
+  outline: 0;
+}
+
+.select2-container--default.select2-container--disabled .select2-selection--multiple {
+  background-color: #eee;
+  cursor: default;
+}
+
+.select2-container--default.select2-container--disabled .select2-selection__choice__remove {
+  display: none;
+}
+
+.select2-container--default.select2-container--open.select2-container--above .select2-selection--single,
+.select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+  border-color: #009688;
+}
+
+.select2-container--default.select2-container--open.select2-container--below .select2-selection--single,
+.select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple {
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0;
+  border-color: #009688;
+}
+
+.select2-container--default .select2-search--dropdown .select2-search__field {
+  border: 1px solid #009688;
+  border-radius: 3px;
+}
+
+.select2-container--default .select2-search--inline .select2-search__field {
+  background: transparent;
+  border: none;
+  outline: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+  -webkit-appearance: textfield;
+}
+
+.select2-container--default .select2-results > .select2-results__options {
+  max-height: 200px;
+  overflow-y: auto;
+}
+
+.select2-container--default .select2-results__option[role=group] {
+  padding: 0;
+}
+
+.select2-container--default .select2-results__option[aria-disabled=true] {
+  color: #999;
+}
+
+.select2-container--default .select2-results__option[aria-selected=true] {
+  background-color: #ddd;
+}
+
+.select2-container--default .select2-results__option .select2-results__option {
+  padding-left: 1em;
+}
+
+.select2-container--default .select2-results__option .select2-results__option .select2-results__group {
+  padding-left: 0;
+}
+
+.select2-container--default .select2-results__option .select2-results__option .select2-results__option {
+  margin-left: -1em;
+  padding-left: 2em;
+}
+
+.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+  margin-left: -2em;
+  padding-left: 3em;
+}
+
+.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+  margin-left: -3em;
+  padding-left: 4em;
+}
+
+.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+  margin-left: -4em;
+  padding-left: 5em;
+}
+
+.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+  margin-left: -5em;
+  padding-left: 6em;
+}
+
+.select2-container--default .select2-results__option--highlighted[aria-selected] {
+  background-color: #009688;
+  color: white;
+}
+
+.select2-container--default .select2-results__group {
+  cursor: default;
+  display: block;
+  padding: 6px;
+}
+
+.select2-container--classic .select2-selection--single {
+  background-color: #f7f7f7;
+  border: 2px solid #009688;
+  border-radius: 3px;
+  outline: 0;
+  background-image: -o-linear-gradient(top, white 50%, #eeeeee 100%);
+  background-image: -webkit-gradient(linear, left top, left bottom, color-stop(50%, white), to(#eeeeee));
+  background-image: linear-gradient(to bottom, white 50%, #eeeeee 100%);
+  background-repeat: repeat-x;
+}
+
+.select2-container--classic .select2-selection--single:focus {
+  border: 1px solid #009688;
+}
+
+.select2-container--classic .select2-selection--single .select2-selection__rendered {
+  color: #444;
+  line-height: 28px;
+}
+
+.select2-container--classic .select2-selection--single .select2-selection__clear {
+  cursor: pointer;
+  float: right;
+  font-weight: bold;
+  margin-right: 10px;
+}
+
+.select2-container--classic .select2-selection--single .select2-selection__placeholder {
+  color: #999;
+}
+
+.select2-container--classic .select2-selection--single .select2-selection__arrow {
+  background-color: #ddd;
+  border: none;
+  border-left: 1px solid #aaa;
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 4px;
+  height: 26px;
+  position: absolute;
+  top: 1px;
+  right: 1px;
+  width: 20px;
+  background-image: -o-linear-gradient(top, #eeeeee 50%, #cccccc 100%);
+  background-image: -webkit-gradient(linear, left top, left bottom, color-stop(50%, #eeeeee), to(#cccccc));
+  background-image: linear-gradient(to bottom, #eeeeee 50%, #cccccc 100%);
+  background-repeat: repeat-x;
+}
+
+.select2-container--classic .select2-selection--single .select2-selection__arrow b {
+  border-color: #888 transparent transparent transparent;
+  border-style: solid;
+  border-width: 5px 4px 0 4px;
+  height: 0;
+  left: 50%;
+  margin-left: -4px;
+  margin-top: -2px;
+  position: absolute;
+  top: 50%;
+  width: 0;
+}
+
+.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear {
+  float: left;
+}
+
+.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow {
+  border: none;
+  border-right: 1px solid #aaa;
+  border-radius: 0;
+  border-top-left-radius: 4px;
+  border-bottom-left-radius: 4px;
+  left: 1px;
+  right: auto;
+}
+
+.select2-container--classic.select2-container--open .select2-selection--single {
+  border: 1px solid #009688;
+}
+
+.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow {
+  background: transparent;
+  border: none;
+}
+
+.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b {
+  border-color: transparent transparent #888 transparent;
+  border-width: 0 4px 5px 4px;
+}
+
+.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single {
+  border-top: none;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+  background-image: -o-linear-gradient(top, white 0%, #eeeeee 50%);
+  background-image: -webkit-gradient(linear, left top, left bottom, from(white), color-stop(50%, #eeeeee));
+  background-image: linear-gradient(to bottom, white 0%, #eeeeee 50%);
+  background-repeat: repeat-x;
+}
+
+.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single {
+  border-bottom: none;
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0;
+  background-image: -o-linear-gradient(top, #eeeeee 50%, white 100%);
+  background-image: -webkit-gradient(linear, left top, left bottom, color-stop(50%, #eeeeee), to(white));
+  background-image: linear-gradient(to bottom, #eeeeee 50%, white 100%);
+  background-repeat: repeat-x;
+}
+
+.select2-container--classic .select2-selection--multiple {
+  background-color: white;
+  border: 1px solid #aaa;
+  border-radius: 4px;
+  cursor: text;
+  outline: 0;
+}
+
+.select2-container--classic .select2-selection--multiple:focus {
+  border: 1px solid #009688;
+}
+
+.select2-container--classic .select2-selection--multiple .select2-selection__rendered {
+  list-style: none;
+  margin: 0;
+  padding: 0 5px;
+}
+
+.select2-container--classic .select2-selection--multiple .select2-selection__clear {
+  display: none;
+}
+
+.select2-container--classic .select2-selection--multiple .select2-selection__choice {
+  background-color: #e4e4e4;
+  border: 1px solid #aaa;
+  border-radius: 4px;
+  cursor: default;
+  float: left;
+  margin-right: 5px;
+  margin-top: 5px;
+  padding: 0 5px;
+}
+
+.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove {
+  color: #888;
+  cursor: pointer;
+  display: inline-block;
+  font-weight: bold;
+  margin-right: 2px;
+}
+
+.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover {
+  color: #555;
+}
+
+.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice {
+  float: right;
+}
+
+.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice {
+  margin-left: 5px;
+  margin-right: auto;
+}
+
+.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove {
+  margin-left: 2px;
+  margin-right: auto;
+}
+
+.select2-container--classic.select2-container--open .select2-selection--multiple {
+  border: 1px solid #009688;
+}
+
+.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple {
+  border-top: none;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple {
+  border-bottom: none;
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+.select2-container--classic .select2-search--dropdown .select2-search__field {
+  border: 1px solid #aaa;
+  outline: 0;
+}
+
+.select2-container--classic .select2-search--inline .select2-search__field {
+  outline: 0;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.select2-container--classic .select2-dropdown {
+  background-color: white;
+  border: 1px solid transparent;
+}
+
+.select2-container--classic .select2-dropdown--above {
+  border-bottom: none;
+}
+
+.select2-container--classic .select2-dropdown--below {
+  border-top: none;
+}
+
+.select2-container--classic .select2-results > .select2-results__options {
+  max-height: 200px;
+  overflow-y: auto;
+}
+
+.select2-container--classic .select2-results__option[role=group] {
+  padding: 0;
+}
+
+.select2-container--classic .select2-results__option[aria-disabled=true] {
+  color: grey;
+}
+
+.select2-container--classic .select2-results__option--highlighted[aria-selected] {
+  background-color: #3875d7;
+  color: white;
+}
+
+.select2-container--classic .select2-results__group {
+  cursor: default;
+  display: block;
+  padding: 6px;
+}
+
+.select2-container--classic.select2-container--open .select2-dropdown {
+  border-color: #009688;
+}
+
+.pace {
+  pointer-events: none;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.pace .pace-progress {
+  background: #96000e;
+  position: fixed;
+  z-index: 2000;
+  top: 0;
+  right: 100%;
+  width: 100%;
+  height: 2px;
+}
+
+.pace .pace-progress-inner {
+  display: block;
+  position: absolute;
+  right: 0;
+  width: 100px;
+  height: 100%;
+  -webkit-box-shadow: 0 0 10px #96000e, 0 0 5px #96000e;
+          box-shadow: 0 0 10px #96000e, 0 0 5px #96000e;
+  opacity: 1;
+  -webkit-transform: rotate(3deg) translate(0px, -4px);
+      -ms-transform: rotate(3deg) translate(0px, -4px);
+          transform: rotate(3deg) translate(0px, -4px);
+}
+
+.pace-inactive {
+  display: none;
+}
+
+.jqvmap-label {
+  position: absolute;
+  display: none;
+  border-radius: 3px;
+  background: #292929;
+  color: white;
+  font-family: sans-serif, Verdana;
+  font-size: smaller;
+  padding: 3px;
+}
+
+.jqvmap-zoomin, .jqvmap-zoomout {
+  position: absolute;
+  left: 10px;
+  border-radius: 3px;
+  background: #000000;
+  padding: 3px;
+  color: white;
+  width: 18px;
+  height: 18px;
+  cursor: pointer;
+  line-height: 13px;
+  text-align: center;
+  font-size: 20px;
+}
+
+.jqvmap-zoomin {
+  top: 10px;
+}
+
+.jqvmap-zoomout {
+  top: 30px;
+}
+
+.jqvmap-region {
+  cursor: pointer;
+}
+
+.jqvmap-ajax_response {
+  width: 100%;
+  height: 500px;
+}
+
+/*!
+ * FullCalendar v2.5.0 Stylesheet
+ * Docs & License: http://fullcalendar.io/
+ * (c) 2015 Adam Shaw
+ */
+.fc {
+  direction: ltr;
+  text-align: left;
+}
+
+.fc-rtl {
+  text-align: right;
+}
+
+body .fc {
+  /* extra precedence to overcome jqui */
+  font-size: 1em;
+}
+
+/* Colors
+--------------------------------------------------------------------------------------------------*/
+.fc-unthemed th,
+.fc-unthemed td,
+.fc-unthemed thead,
+.fc-unthemed tbody,
+.fc-unthemed .fc-divider,
+.fc-unthemed .fc-row,
+.fc-unthemed .fc-popover {
+  border-color: #ddd;
+}
+
+.fc-unthemed .fc-popover {
+  background-color: #fff;
+}
+
+.fc-unthemed .fc-divider,
+.fc-unthemed .fc-popover .fc-header {
+  background: #eee;
+}
+
+.fc-unthemed .fc-popover .fc-header .fc-close {
+  color: #666;
+}
+
+.fc-unthemed .fc-today {
+  background: rgba(0, 150, 136, 0.2);
+}
+
+.fc-highlight {
+  /* when user is selecting cells */
+  background: #bce8f1;
+  opacity: .3;
+  filter: alpha(opacity=30);
+  /* for IE */
+}
+
+.fc-bgevent {
+  /* default look for background events */
+  background: #8fdf82;
+  opacity: .3;
+  filter: alpha(opacity=30);
+  /* for IE */
+}
+
+.fc-nonbusiness {
+  /* default look for non-business-hours areas */
+  /* will inherit .fc-bgevent's styles */
+  background: #d7d7d7;
+}
+
+/* Icons (inline elements with styled text that mock arrow icons)
+--------------------------------------------------------------------------------------------------*/
+.fc-icon {
+  display: inline-block;
+  width: 1em;
+  height: 1em;
+  line-height: 1em;
+  font-size: 1em;
+  text-align: center;
+  overflow: hidden;
+  font-family: "Courier New", Courier, monospace;
+  /* don't allow browser text-selection */
+  -webkit-touch-callout: none;
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+
+/*
+Acceptable font-family overrides for individual icons:
+	"Arial", sans-serif
+	"Times New Roman", serif
+
+NOTE: use percentage font sizes or else old IE chokes
+*/
+.fc-icon:after {
+  position: relative;
+  margin: 0 -1em;
+  /* ensures character will be centered, regardless of width */
+}
+
+.fc-icon-left-single-arrow:after {
+  content: "\02039";
+  font-weight: bold;
+  font-size: 200%;
+  top: -7%;
+  left: 3%;
+}
+
+.fc-icon-right-single-arrow:after {
+  content: "\0203A";
+  font-weight: bold;
+  font-size: 200%;
+  top: -7%;
+  left: -3%;
+}
+
+.fc-icon-left-double-arrow:after {
+  content: "\000AB";
+  font-size: 160%;
+  top: -7%;
+}
+
+.fc-icon-right-double-arrow:after {
+  content: "\000BB";
+  font-size: 160%;
+  top: -7%;
+}
+
+.fc-icon-left-triangle:after {
+  content: "\25C4";
+  font-size: 125%;
+  top: 3%;
+  left: -2%;
+}
+
+.fc-icon-right-triangle:after {
+  content: "\25BA";
+  font-size: 125%;
+  top: 3%;
+  left: 2%;
+}
+
+.fc-icon-down-triangle:after {
+  content: "\25BC";
+  font-size: 125%;
+  top: 2%;
+}
+
+.fc-icon-x:after {
+  content: "\000D7";
+  font-size: 200%;
+  top: 6%;
+}
+
+/* Buttons (styled <button> tags, normalized to work cross-browser)
+--------------------------------------------------------------------------------------------------*/
+.fc button {
+  /* force height to include the border and padding */
+  -webkit-box-sizing: border-box;
+  box-sizing: border-box;
+  /* dimensions */
+  margin: 0;
+  height: 2.1em;
+  padding: 0 .6em;
+  /* text & cursor */
+  font-size: 13px;
+  /* normalize */
+  font-weight: 500;
+  white-space: nowrap;
+  cursor: pointer;
+  text-transform: uppercase;
+}
+
+/* Firefox has an annoying inner border */
+.fc button::-moz-focus-inner {
+  margin: 0;
+  padding: 0;
+}
+
+.fc-state-default {
+  /* non-theme */
+  border: 1px solid;
+}
+
+.fc-state-default.fc-corner-left {
+  /* non-theme */
+  border-top-left-radius: 4px;
+  border-bottom-left-radius: 4px;
+}
+
+.fc-state-default.fc-corner-right {
+  /* non-theme */
+  border-top-right-radius: 4px;
+  border-bottom-right-radius: 4px;
+}
+
+/* icons in buttons */
+.fc button .fc-icon {
+  /* non-theme */
+  position: relative;
+  top: -0.05em;
+  /* seems to be a good adjustment across browsers */
+  margin: 0 .2em;
+  vertical-align: middle;
+}
+
+/*
+  button states
+  borrowed from twitter bootstrap (http://twitter.github.com/bootstrap/)
+*/
+.fc-state-default {
+  background-color: #f5f5f5;
+  background-image: -webkit-gradient(linear, left top, left bottom, from(#ffffff), to(#e6e6e6));
+  background-image: -o-linear-gradient(top, #ffffff, #e6e6e6);
+  background-image: linear-gradient(to bottom, #ffffff, #e6e6e6);
+  background-repeat: repeat-x;
+  border-color: #e6e6e6 #e6e6e6 #bfbfbf;
+  border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25);
+  color: #333;
+  -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+          box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);
+  outline: none;
+}
+
+.fc-state-hover,
+.fc-state-down,
+.fc-state-active,
+.fc-state-disabled {
+  color: #333333;
+  background-color: #e6e6e6;
+}
+
+.fc-state-hover {
+  color: #333333;
+  text-decoration: none;
+  background-position: 0 -15px;
+  -webkit-transition: background-position 0.1s linear;
+  -o-transition: background-position 0.1s linear;
+  transition: background-position 0.1s linear;
+}
+
+.fc-state-down,
+.fc-state-active {
+  background-color: #009688;
+  color: #FFF;
+  background-image: none;
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+.fc-state-disabled {
+  cursor: default;
+  background-image: none;
+  opacity: 0.65;
+  filter: alpha(opacity=65);
+  -webkit-box-shadow: none;
+          box-shadow: none;
+}
+
+/* Buttons Groups
+--------------------------------------------------------------------------------------------------*/
+.fc-button-group {
+  display: inline-block;
+}
+
+/*
+every button that is not first in a button group should scootch over one pixel and cover the
+previous button's border...
+*/
+.fc .fc-button-group > * {
+  /* extra precedence b/c buttons have margin set to zero */
+  float: left;
+  margin: 0 0 0 -1px;
+}
+
+.fc .fc-button-group > :first-child {
+  /* same */
+  margin-left: 0;
+}
+
+/* Popover
+--------------------------------------------------------------------------------------------------*/
+.fc-popover {
+  position: absolute;
+  -webkit-box-shadow: 0 2px 6px rgba(0, 0, 0, 0.15);
+          box-shadow: 0 2px 6px rgba(0, 0, 0, 0.15);
+}
+
+.fc-popover .fc-header {
+  /* TODO: be more consistent with fc-head/fc-body */
+  padding: 2px 4px;
+}
+
+.fc-popover .fc-header .fc-title {
+  margin: 0 2px;
+}
+
+.fc-popover .fc-header .fc-close {
+  cursor: pointer;
+}
+
+.fc-ltr .fc-popover .fc-header .fc-title,
+.fc-rtl .fc-popover .fc-header .fc-close {
+  float: left;
+}
+
+.fc-rtl .fc-popover .fc-header .fc-title,
+.fc-ltr .fc-popover .fc-header .fc-close {
+  float: right;
+}
+
+/* unthemed */
+.fc-unthemed .fc-popover {
+  border-width: 1px;
+  border-style: solid;
+}
+
+.fc-unthemed .fc-popover .fc-header .fc-close {
+  font-size: .9em;
+  margin-top: 2px;
+}
+
+/* jqui themed */
+.fc-popover > .ui-widget-header + .ui-widget-content {
+  border-top: 0;
+  /* where they meet, let the header have the border */
+}
+
+/* Misc Reusable Components
+--------------------------------------------------------------------------------------------------*/
+.fc-divider {
+  border-style: solid;
+  border-width: 1px;
+}
+
+hr.fc-divider {
+  height: 0;
+  margin: 0;
+  padding: 0 0 2px;
+  /* height is unreliable across browsers, so use padding */
+  border-width: 1px 0;
+}
+
+.fc-clear {
+  clear: both;
+}
+
+.fc-bg,
+.fc-bgevent-skeleton,
+.fc-highlight-skeleton,
+.fc-helper-skeleton {
+  /* these element should always cling to top-left/right corners */
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+}
+
+.fc-bg {
+  bottom: 0;
+  /* strech bg to bottom edge */
+}
+
+.fc-bg table {
+  height: 100%;
+  /* strech bg to bottom edge */
+}
+
+/* Tables
+--------------------------------------------------------------------------------------------------*/
+.fc table {
+  width: 100%;
+  table-layout: fixed;
+  border-collapse: collapse;
+  border-spacing: 0;
+  font-size: 1em;
+  /* normalize cross-browser */
+  font-weight: 500;
+}
+
+.fc th {
+  text-align: center;
+}
+
+.fc th,
+.fc td {
+  border-style: solid;
+  border-width: 1px;
+  padding: 0;
+  vertical-align: top;
+}
+
+.fc td.fc-today {
+  border-style: double;
+  /* overcome neighboring borders */
+}
+
+/* Fake Table Rows
+--------------------------------------------------------------------------------------------------*/
+.fc .fc-row {
+  /* extra precedence to overcome themes w/ .ui-widget-content forcing a 1px border */
+  /* no visible border by default. but make available if need be (scrollbar width compensation) */
+  border-style: solid;
+  border-width: 0;
+}
+
+.fc-row table {
+  /* don't put left/right border on anything within a fake row.
+	   the outer tbody will worry about this */
+  border-left: 0 hidden transparent;
+  border-right: 0 hidden transparent;
+  /* no bottom borders on rows */
+  border-bottom: 0 hidden transparent;
+}
+
+.fc-row:first-child table {
+  border-top: 0 hidden transparent;
+  /* no top border on first row */
+}
+
+/* Day Row (used within the header and the DayGrid)
+--------------------------------------------------------------------------------------------------*/
+.fc-row {
+  position: relative;
+}
+
+.fc-row .fc-bg {
+  z-index: 1;
+}
+
+/* highlighting cells & background event skeleton */
+.fc-row .fc-bgevent-skeleton,
+.fc-row .fc-highlight-skeleton {
+  bottom: 0;
+  /* stretch skeleton to bottom of row */
+}
+
+.fc-row .fc-bgevent-skeleton table,
+.fc-row .fc-highlight-skeleton table {
+  height: 100%;
+  /* stretch skeleton to bottom of row */
+}
+
+.fc-row .fc-highlight-skeleton td,
+.fc-row .fc-bgevent-skeleton td {
+  border-color: transparent;
+}
+
+.fc-row .fc-bgevent-skeleton {
+  z-index: 2;
+}
+
+.fc-row .fc-highlight-skeleton {
+  z-index: 3;
+}
+
+/*
+row content (which contains day/week numbers and events) as well as "helper" (which contains
+temporary rendered events).
+*/
+.fc-row .fc-content-skeleton {
+  position: relative;
+  z-index: 4;
+  padding-bottom: 2px;
+  /* matches the space above the events */
+}
+
+.fc-row .fc-helper-skeleton {
+  z-index: 5;
+}
+
+.fc-row .fc-content-skeleton td,
+.fc-row .fc-helper-skeleton td {
+  /* see-through to the background below */
+  background: none;
+  /* in case <td>s are globally styled */
+  border-color: transparent;
+  /* don't put a border between events and/or the day number */
+  border-bottom: 0;
+}
+
+.fc-row .fc-content-skeleton tbody td,
+.fc-row .fc-helper-skeleton tbody td {
+  /* don't put a border between event cells */
+  border-top: 0;
+}
+
+/* Scrolling Container
+--------------------------------------------------------------------------------------------------*/
+.fc-scroller {
+  /* this class goes on elements for guaranteed vertical scrollbars */
+  overflow-y: scroll;
+  overflow-x: hidden;
+}
+
+.fc-scroller > * {
+  /* we expect an immediate inner element */
+  position: relative;
+  /* re-scope all positions */
+  width: 100%;
+  /* hack to force re-sizing this inner element when scrollbars appear/disappear */
+  overflow: hidden;
+  /* don't let negative margins or absolute positioning create further scroll */
+}
+
+/* Global Event Styles
+--------------------------------------------------------------------------------------------------*/
+.fc-event {
+  position: relative;
+  /* for resize handle and other inner positioning */
+  display: block;
+  /* make the <a> tag block */
+  font-size: 14px;
+  padding: 5px;
+  line-height: 1.3;
+  border-radius: 3px;
+  border: 1px solid #009688;
+  background-color: #009688;
+  font-weight: normal;
+  /* undo jqui's ui-widget-header bold */
+  margin-bottom: 5px;
+  cursor: all-scroll;
+}
+
+/* overpower some of bootstrap's and jqui's styles on <a> tags */
+.fc-event,
+.fc-event:hover,
+.ui-widget .fc-event {
+  color: #fff;
+  /* default TEXT color */
+  text-decoration: none;
+  /* if <a> has an href */
+}
+
+.fc-event[href],
+.fc-event.fc-draggable {
+  cursor: pointer;
+  /* give events with links and draggable events a hand mouse pointer */
+}
+
+.fc-not-allowed,
+.fc-not-allowed .fc-event {
+  /* to override an event's custom cursor */
+  cursor: not-allowed;
+}
+
+.fc-event .fc-bg {
+  /* the generic .fc-bg already does position */
+  z-index: 1;
+  background: #fff;
+  opacity: .25;
+  filter: alpha(opacity=25);
+  /* for IE */
+}
+
+.fc-event .fc-content {
+  position: relative;
+  z-index: 2;
+}
+
+.fc-event .fc-resizer {
+  position: absolute;
+  z-index: 3;
+}
+
+/* Horizontal Events
+--------------------------------------------------------------------------------------------------*/
+/* events that are continuing to/from another week. kill rounded corners and butt up against edge */
+.fc-ltr .fc-h-event.fc-not-start,
+.fc-rtl .fc-h-event.fc-not-end {
+  margin-left: 0;
+  border-left-width: 0;
+  padding-left: 1px;
+  /* replace the border with padding */
+  border-top-left-radius: 0;
+  border-bottom-left-radius: 0;
+}
+
+.fc-ltr .fc-h-event.fc-not-end,
+.fc-rtl .fc-h-event.fc-not-start {
+  margin-right: 0;
+  border-right-width: 0;
+  padding-right: 1px;
+  /* replace the border with padding */
+  border-top-right-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+/* resizer */
+.fc-h-event .fc-resizer {
+  /* positioned it to overcome the event's borders */
+  top: -1px;
+  bottom: -1px;
+  left: -1px;
+  right: -1px;
+  width: 5px;
+}
+
+/* left resizer  */
+.fc-ltr .fc-h-event .fc-start-resizer,
+.fc-ltr .fc-h-event .fc-start-resizer:before,
+.fc-ltr .fc-h-event .fc-start-resizer:after,
+.fc-rtl .fc-h-event .fc-end-resizer,
+.fc-rtl .fc-h-event .fc-end-resizer:before,
+.fc-rtl .fc-h-event .fc-end-resizer:after {
+  right: auto;
+  /* ignore the right and only use the left */
+  cursor: w-resize;
+}
+
+/* right resizer */
+.fc-ltr .fc-h-event .fc-end-resizer,
+.fc-ltr .fc-h-event .fc-end-resizer:before,
+.fc-ltr .fc-h-event .fc-end-resizer:after,
+.fc-rtl .fc-h-event .fc-start-resizer,
+.fc-rtl .fc-h-event .fc-start-resizer:before,
+.fc-rtl .fc-h-event .fc-start-resizer:after {
+  left: auto;
+  /* ignore the left and only use the right */
+  cursor: e-resize;
+}
+
+/* DayGrid events
+----------------------------------------------------------------------------------------------------
+We use the full "fc-day-grid-event" class instead of using descendants because the event won't
+be a descendant of the grid when it is being dragged.
+*/
+.fc-day-grid-event {
+  margin: 1px 2px 0;
+  /* spacing between events and edges */
+  padding: 0 1px;
+}
+
+.fc-day-grid-event .fc-content {
+  /* force events to be one-line tall */
+  white-space: nowrap;
+  overflow: hidden;
+}
+
+.fc-day-grid-event .fc-time {
+  font-weight: bold;
+}
+
+.fc-day-grid-event .fc-resizer {
+  /* enlarge the default hit area */
+  left: -3px;
+  right: -3px;
+  width: 7px;
+}
+
+/* Event Limiting
+--------------------------------------------------------------------------------------------------*/
+/* "more" link that represents hidden events */
+a.fc-more {
+  margin: 1px 3px;
+  font-size: .85em;
+  cursor: pointer;
+  text-decoration: none;
+}
+
+a.fc-more:hover {
+  text-decoration: underline;
+}
+
+.fc-limited {
+  /* rows and cells that are hidden because of a "more" link */
+  display: none;
+}
+
+/* popover that appears when "more" link is clicked */
+.fc-day-grid .fc-row {
+  z-index: 1;
+  /* make the "more" popover one higher than this */
+}
+
+.fc-more-popover {
+  z-index: 2;
+  width: 220px;
+}
+
+.fc-more-popover .fc-event-container {
+  padding: 10px;
+}
+
+/* Toolbar
+--------------------------------------------------------------------------------------------------*/
+.fc-toolbar {
+  text-align: center;
+  margin-bottom: 1em;
+}
+
+.fc-toolbar .fc-left {
+  float: left;
+}
+
+.fc-toolbar .fc-right {
+  float: right;
+}
+
+.fc-toolbar .fc-center {
+  display: inline-block;
+}
+
+/* the things within each left/right/center section */
+.fc .fc-toolbar > * > * {
+  /* extra precedence to override button border margins */
+  float: left;
+  margin-left: .75em;
+}
+
+/* the first thing within each left/center/right section */
+.fc .fc-toolbar > * > :first-child {
+  /* extra precedence to override button border margins */
+  margin-left: 0;
+}
+
+/* title text */
+.fc-toolbar h2 {
+  margin: 0;
+  text-transform: uppercase;
+  font-size: 26px;
+  color: #555;
+}
+
+/* button layering (for border precedence) */
+.fc-toolbar button {
+  position: relative;
+}
+
+.fc-toolbar .fc-state-hover,
+.fc-toolbar .ui-state-hover {
+  z-index: 2;
+}
+
+.fc-toolbar .fc-state-down {
+  z-index: 3;
+}
+
+.fc-toolbar .fc-state-active,
+.fc-toolbar .ui-state-active {
+  z-index: 4;
+}
+
+.fc-toolbar button:focus {
+  z-index: 5;
+}
+
+/* View Structure
+--------------------------------------------------------------------------------------------------*/
+/* undo twitter bootstrap's box-sizing rules. normalizes positioning techniques */
+/* don't do this for the toolbar because we'll want bootstrap to style those buttons as some pt */
+.fc-view-container *,
+.fc-view-container *:before,
+.fc-view-container *:after {
+  -webkit-box-sizing: content-box;
+  box-sizing: content-box;
+}
+
+.fc-view,
+.fc-view > table {
+  /* so dragged elements can be above the view's main element */
+  position: relative;
+  z-index: 1;
+}
+
+/* BasicView
+--------------------------------------------------------------------------------------------------*/
+/* day row structure */
+.fc-basicWeek-view .fc-content-skeleton,
+.fc-basicDay-view .fc-content-skeleton {
+  /* we are sure there are no day numbers in these views, so... */
+  padding-top: 1px;
+  /* add a pixel to make sure there are 2px padding above events */
+  padding-bottom: 1em;
+  /* ensure a space at bottom of cell for user selecting/clicking */
+}
+
+.fc-basic-view .fc-body .fc-row {
+  min-height: 4em;
+  /* ensure that all rows are at least this tall */
+}
+
+/* a "rigid" row will take up a constant amount of height because content-skeleton is absolute */
+.fc-row.fc-rigid {
+  overflow: hidden;
+}
+
+.fc-row.fc-rigid .fc-content-skeleton {
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+}
+
+/* week and day number styling */
+.fc-basic-view .fc-week-number,
+.fc-basic-view .fc-day-number {
+  padding: 0 2px;
+}
+
+.fc-basic-view td.fc-week-number span,
+.fc-basic-view td.fc-day-number {
+  padding-top: 2px;
+  padding-bottom: 2px;
+}
+
+.fc-basic-view .fc-week-number {
+  text-align: center;
+}
+
+.fc-basic-view .fc-week-number span {
+  /* work around the way we do column resizing and ensure a minimum width */
+  display: inline-block;
+  min-width: 1.25em;
+}
+
+.fc-ltr .fc-basic-view .fc-day-number {
+  text-align: right;
+}
+
+.fc-rtl .fc-basic-view .fc-day-number {
+  text-align: left;
+}
+
+.fc-day-number.fc-other-month {
+  opacity: 0.3;
+  filter: alpha(opacity=30);
+  /* for IE */
+  /* opacity with small font can sometimes look too faded
+	   might want to set the 'color' property instead
+	   making day-numbers bold also fixes the problem */
+}
+
+/* AgendaView all-day area
+--------------------------------------------------------------------------------------------------*/
+.fc-agenda-view .fc-day-grid {
+  position: relative;
+  z-index: 2;
+  /* so the "more.." popover will be over the time grid */
+}
+
+.fc-agenda-view .fc-day-grid .fc-row {
+  min-height: 3em;
+  /* all-day section will never get shorter than this */
+}
+
+.fc-agenda-view .fc-day-grid .fc-row .fc-content-skeleton {
+  padding-top: 1px;
+  /* add a pixel to make sure there are 2px padding above events */
+  padding-bottom: 1em;
+  /* give space underneath events for clicking/selecting days */
+}
+
+/* TimeGrid axis running down the side (for both the all-day area and the slot area)
+--------------------------------------------------------------------------------------------------*/
+.fc .fc-axis {
+  /* .fc to overcome default cell styles */
+  vertical-align: middle;
+  padding: 0 4px;
+  white-space: nowrap;
+}
+
+.fc-ltr .fc-axis {
+  text-align: right;
+}
+
+.fc-rtl .fc-axis {
+  text-align: left;
+}
+
+.ui-widget td.fc-axis {
+  font-weight: normal;
+  /* overcome jqui theme making it bold */
+}
+
+/* TimeGrid Structure
+--------------------------------------------------------------------------------------------------*/
+.fc-time-grid-container,
+.fc-time-grid {
+  /* so slats/bg/content/etc positions get scoped within here */
+  position: relative;
+  z-index: 1;
+}
+
+.fc-time-grid {
+  min-height: 100%;
+  /* so if height setting is 'auto', .fc-bg stretches to fill height */
+}
+
+.fc-time-grid table {
+  /* don't put outer borders on slats/bg/content/etc */
+  border: 0 hidden transparent;
+}
+
+.fc-time-grid > .fc-bg {
+  z-index: 1;
+}
+
+.fc-time-grid .fc-slats,
+.fc-time-grid > hr {
+  /* the <hr> AgendaView injects when grid is shorter than scroller */
+  position: relative;
+  z-index: 2;
+}
+
+.fc-time-grid .fc-bgevent-skeleton,
+.fc-time-grid .fc-content-skeleton {
+  position: absolute;
+  top: 0;
+  left: 0;
+  right: 0;
+}
+
+.fc-time-grid .fc-bgevent-skeleton {
+  z-index: 3;
+}
+
+.fc-time-grid .fc-highlight-skeleton {
+  z-index: 4;
+}
+
+.fc-time-grid .fc-content-skeleton {
+  z-index: 5;
+}
+
+.fc-time-grid .fc-helper-skeleton {
+  z-index: 6;
+}
+
+/* TimeGrid Slats (lines that run horizontally)
+--------------------------------------------------------------------------------------------------*/
+.fc-time-grid .fc-slats td {
+  height: 1.5em;
+  border-bottom: 0;
+  /* each cell is responsible for its top border */
+}
+
+.fc-time-grid .fc-slats .fc-minor td {
+  border-top-style: dotted;
+}
+
+.fc-time-grid .fc-slats .ui-widget-content {
+  /* for jqui theme */
+  background: none;
+  /* see through to fc-bg */
+}
+
+/* TimeGrid Highlighting Slots
+--------------------------------------------------------------------------------------------------*/
+.fc-time-grid .fc-highlight-container {
+  /* a div within a cell within the fc-highlight-skeleton */
+  position: relative;
+  /* scopes the left/right of the fc-highlight to be in the column */
+}
+
+.fc-time-grid .fc-highlight {
+  position: absolute;
+  left: 0;
+  right: 0;
+  /* top and bottom will be in by JS */
+}
+
+/* TimeGrid Event Containment
+--------------------------------------------------------------------------------------------------*/
+.fc-time-grid .fc-event-container,
+.fc-time-grid .fc-bgevent-container {
+  /* a div within a cell within the fc-bgevent-skeleton */
+  position: relative;
+}
+
+.fc-ltr .fc-time-grid .fc-event-container {
+  /* space on the sides of events for LTR (default) */
+  margin: 0 2.5% 0 2px;
+}
+
+.fc-rtl .fc-time-grid .fc-event-container {
+  /* space on the sides of events for RTL */
+  margin: 0 2px 0 2.5%;
+}
+
+.fc-time-grid .fc-event,
+.fc-time-grid .fc-bgevent {
+  position: absolute;
+  z-index: 1;
+  /* scope inner z-index's */
+}
+
+.fc-time-grid .fc-bgevent {
+  /* background events always span full width */
+  left: 0;
+  right: 0;
+}
+
+/* Generic Vertical Event
+--------------------------------------------------------------------------------------------------*/
+.fc-v-event.fc-not-start {
+  /* events that are continuing from another day */
+  /* replace space made by the top border with padding */
+  border-top-width: 0;
+  padding-top: 1px;
+  /* remove top rounded corners */
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+}
+
+.fc-v-event.fc-not-end {
+  /* replace space made by the top border with padding */
+  border-bottom-width: 0;
+  padding-bottom: 1px;
+  /* remove bottom rounded corners */
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0;
+}
+
+/* TimeGrid Event Styling
+----------------------------------------------------------------------------------------------------
+We use the full "fc-time-grid-event" class instead of using descendants because the event won't
+be a descendant of the grid when it is being dragged.
+*/
+.fc-time-grid-event {
+  overflow: hidden;
+  /* don't let the bg flow over rounded corners */
+}
+
+.fc-time-grid-event .fc-time,
+.fc-time-grid-event .fc-title {
+  padding: 0 1px;
+}
+
+.fc-time-grid-event .fc-time {
+  font-size: .85em;
+  white-space: nowrap;
+}
+
+/* short mode, where time and title are on the same line */
+.fc-time-grid-event.fc-short .fc-content {
+  /* don't wrap to second line (now that contents will be inline) */
+  white-space: nowrap;
+}
+
+.fc-time-grid-event.fc-short .fc-time,
+.fc-time-grid-event.fc-short .fc-title {
+  /* put the time and title on the same line */
+  display: inline-block;
+  vertical-align: top;
+}
+
+.fc-time-grid-event.fc-short .fc-time span {
+  display: none;
+  /* don't display the full time text... */
+}
+
+.fc-time-grid-event.fc-short .fc-time:before {
+  content: attr(data-start);
+  /* ...instead, display only the start time */
+}
+
+.fc-time-grid-event.fc-short .fc-time:after {
+  content: "\000A0-\000A0";
+  /* seperate with a dash, wrapped in nbsp's */
+}
+
+.fc-time-grid-event.fc-short .fc-title {
+  font-size: .85em;
+  /* make the title text the same size as the time */
+  padding: 0;
+  /* undo padding from above */
+}
+
+/* resizer */
+.fc-time-grid-event .fc-resizer {
+  left: 0;
+  right: 0;
+  bottom: 0;
+  height: 8px;
+  overflow: hidden;
+  line-height: 8px;
+  font-size: 11px;
+  font-family: monospace;
+  text-align: center;
+  cursor: s-resize;
+}
+
+.fc-time-grid-event .fc-resizer:after {
+  content: "=";
+}
+
+::-moz-selection {
+  color: #FFF;
+  background-color: #00635a;
+}
+
+::selection {
+  color: #FFF;
+  background-color: #00635a;
+}
+
+@media (min-width: 768px) {
+  .app.sidenav-toggled .app-content {
+    margin-left: 0;
+  }
+  .app.sidenav-toggled .app-sidebar {
+    left: -230px;
+  }
+  .app.sidenav-toggled .app-sidebar__overlay {
+    visibility: hidden;
+  }
+}
+
+@media (max-width: 767px) {
+  .app {
+    overflow-x: hidden;
+  }
+  .app .app-sidebar {
+    left: -230px;
+  }
+  .app .app-sidebar__overlay {
+    visibility: hidden;
+  }
+  .app.sidenav-toggled .app-content {
+    margin-left: 0;
+  }
+  .app.sidenav-toggled .app-sidebar {
+    left: 0;
+  }
+  .app.sidenav-toggled .app-sidebar__overlay {
+    visibility: visible;
+  }
+}
+
+.app-content {
+  min-height: calc(100vh - 50px);
+  margin-top: 50px;
+  padding: 30px;
+  background-color: #E5E5E5;
+  -webkit-transition: margin-left 0.3s ease;
+  -o-transition: margin-left 0.3s ease;
+  transition: margin-left 0.3s ease;
+}
+
+@media (min-width: 768px) {
+  .app-content {
+    margin-left: 230px;
+  }
+}
+
+@media (max-width: 767px) {
+  .app-content {
+    margin-top: 50px;
+    min-width: 100%;
+  }
+}
+
+@media (max-width: 480px) {
+  .app-content {
+    padding: 15px;
+  }
+}
+
+@media print {
+  .app-content {
+    margin: 0;
+    padding: 0;
+    background-color: #fff;
+  }
+}
+
+.light-text {
+  font-weight: 300 !important;
+}
+
+.semibold-text {
+  font-weight: 600 !important;
+}
+
+.line-head {
+  padding-bottom: 10px;
+  border-bottom: 1px solid #ddd;
+}
+
+/*----- Componant: Top Navigation Bar ----- */
+.app-header {
+  position: fixed;
+  left: 0;
+  right: 0;
+  top: 0;
+  width: 100%;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  background-color: #009688;
+  z-index: 1030;
+  padding-right: 15px;
+}
+
+@media (min-width: 768px) {
+  .app-header {
+    padding-right: 30px;
+  }
+}
+
+@media print {
+  .app-header {
+    display: none;
+  }
+}
+
+.app-header__logo {
+  -webkit-box-flex: 1;
+      -ms-flex: 1 0 auto;
+          flex: 1 0 auto;
+  color: #fff;
+  text-align: center;
+  font-family: 'Niconne';
+  padding: 0 15px;
+  font-size: 26px;
+  font-weight: 400;
+  line-height: 50px;
+}
+
+@media (min-width: 768px) {
+  .app-header__logo {
+    -webkit-box-flex: 0;
+        -ms-flex: 0 0 auto;
+            flex: 0 0 auto;
+    display: block;
+    width: 230px;
+    background-color: #007d71;
+  }
+}
+
+.app-header__logo:focus, .app-header__logo:hover {
+  text-decoration: none;
+  color: #fff;
+}
+
+.app-sidebar__toggle {
+  padding: 0 15px;
+  font-family: fontAwesome;
+  color: #fff;
+  line-height: 2.4;
+  -webkit-transition: background-color 0.3s ease;
+  -o-transition: background-color 0.3s ease;
+  transition: background-color 0.3s ease;
+}
+
+@media (max-width: 767px) {
+  .app-sidebar__toggle {
+    -webkit-box-ordinal-group: 0;
+        -ms-flex-order: -1;
+            order: -1;
+  }
+}
+
+.app-sidebar__toggle:before {
+  content: "\f0c9";
+  font-size: 21px;
+}
+
+.app-sidebar__toggle:focus, .app-sidebar__toggle:hover {
+  color: #fff;
+  background-color: #00635a;
+  text-decoration: none;
+}
+
+.app-nav {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  margin-bottom: 0;
+  -webkit-box-pack: end;
+      -ms-flex-pack: end;
+          justify-content: flex-end;
+}
+
+@media (min-width: 768px) {
+  .app-nav {
+    -webkit-box-flex: 1;
+        -ms-flex: 1 0 auto;
+            flex: 1 0 auto;
+  }
+}
+
+.app-nav__item {
+  display: block;
+  padding: 15px;
+  line-height: 20px;
+  color: #fff;
+  -webkit-transition: background-color 0.3s ease;
+  -o-transition: background-color 0.3s ease;
+  transition: background-color 0.3s ease;
+}
+
+.app-nav__item:hover, .app-nav__item:focus {
+  background: rgba(0, 0, 0, 0.1);
+  color: #f6f6f6;
+}
+
+.app-search {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -ms-flex-item-align: center;
+      align-self: center;
+  margin-right: 15px;
+  padding: 10px 0;
+}
+
+@media (max-width: 480px) {
+  .app-search {
+    display: none;
+  }
+}
+
+.app-search__input {
+  border: 0;
+  padding: 5px 10px;
+  padding-right: 30px;
+  border-radius: 2px;
+  background-color: rgba(255, 255, 255, 0.8);
+  -webkit-transition: background-color 0.3s ease;
+  -o-transition: background-color 0.3s ease;
+  transition: background-color 0.3s ease;
+}
+
+.app-search__input::-webkit-input-placeholder {
+  color: rgba(0, 0, 0, 0.4);
+}
+
+.app-search__input:-ms-input-placeholder {
+  color: rgba(0, 0, 0, 0.4);
+}
+
+.app-search__input::-ms-input-placeholder {
+  color: rgba(0, 0, 0, 0.4);
+}
+
+.app-search__input::placeholder {
+  color: rgba(0, 0, 0, 0.4);
+}
+
+.app-search__button {
+  position: absolute;
+  right: 0;
+  top: 10px;
+  bottom: 10px;
+  padding: 0 10px;
+  border: 0;
+  color: rgba(0, 0, 0, 0.8);
+  background: none;
+  cursor: pointer;
+}
+
+.app-notification {
+  min-width: 270px;
+}
+
+.app-notification__title {
+  padding: 8px 20px;
+  text-align: center;
+  background-color: rgba(0, 150, 136, 0.4);
+  color: #333;
+}
+
+.app-notification__footer {
+  padding: 8px 20px;
+  text-align: center;
+  background-color: #eee;
+}
+
+.app-notification__content {
+  max-height: 220px;
+  overflow-y: auto;
+}
+
+.app-notification__content::-webkit-scrollbar {
+  width: 6px;
+}
+
+.app-notification__content::-webkit-scrollbar-thumb {
+  background: rgba(0, 0, 0, 0.2);
+}
+
+.app-notification__item {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  padding: 8px 20px;
+  color: inherit;
+  border-bottom: 1px solid #ddd;
+  -webkit-transition: background-color 0.3s ease;
+  -o-transition: background-color 0.3s ease;
+  transition: background-color 0.3s ease;
+}
+
+.app-notification__item:focus, .app-notification__item:hover {
+  color: inherit;
+  text-decoration: none;
+  background-color: #e0e0e0;
+}
+
+.app-notification__message,
+.app-notification__meta {
+  margin-bottom: 0;
+}
+
+.app-notification__icon {
+  padding-right: 10px;
+}
+
+.app-notification__message {
+  line-height: 1.2;
+}
+
+.app-sidebar {
+  position: fixed;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  padding-top: 70px;
+  width: 230px;
+  overflow: auto;
+  z-index: 10;
+  background-color: #222d32;
+  -webkit-box-shadow: 0px 8px 17px rgba(0, 0, 0, 0.2);
+          box-shadow: 0px 8px 17px rgba(0, 0, 0, 0.2);
+  -webkit-transition: left 0.3s ease,
+ width 0.3s ease;
+  -o-transition: left 0.3s ease,
+ width 0.3s ease;
+  transition: left 0.3s ease,
+ width 0.3s ease;
+}
+
+.app-sidebar::-webkit-scrollbar {
+  width: 6px;
+}
+
+.app-sidebar::-webkit-scrollbar-thumb {
+  background: rgba(0, 0, 0, 0.2);
+}
+
+@media print {
+  .app-sidebar {
+    display: none;
+  }
+}
+
+@media (max-width: 767px) {
+  .app-sidebar__overlay {
+    position: fixed;
+    top: 0;
+    left: 0;
+    bottom: 0;
+    right: 0;
+    z-index: 9;
+  }
+}
+
+.app-sidebar__user {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding: 10px;
+  margin-bottom: 20px;
+  color: #fff;
+}
+
+.app-sidebar__user-avatar {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 auto;
+          flex: 0 0 auto;
+  margin-right: 15px;
+}
+
+.app-sidebar__user-name {
+  font-size: 17px;
+  line-height: 1.3;
+}
+
+.app-sidebar__user-name,
+.app-sidebar__user-designation {
+  white-space: nowrap;
+  overflow: hidden;
+  -o-text-overflow: ellipsis;
+     text-overflow: ellipsis;
+  margin-bottom: 0;
+}
+
+.app-menu {
+  margin-bottom: 0;
+  padding-bottom: 40px;
+}
+
+.app-menu__item {
+  position: relative;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding: 12px 15px;
+  font-size: 1.08em;
+  border-left: 3px solid transparent;
+  -webkit-transition: border-left-color 0.3s ease,
+ background-color 0.3s ease;
+  -o-transition: border-left-color 0.3s ease,
+ background-color 0.3s ease;
+  transition: border-left-color 0.3s ease,
+ background-color 0.3s ease;
+  color: #fff;
+}
+
+.app-menu__item.active, .app-menu__item:hover, .app-menu__item:focus {
+  background: #0d1214;
+  border-left-color: #009688;
+  text-decoration: none;
+  color: #fff;
+}
+
+.app-menu__icon {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 auto;
+          flex: 0 0 auto;
+  width: 25px;
+}
+
+.app-menu__label {
+  white-space: nowrap;
+  -webkit-box-flex: 1;
+      -ms-flex: 1 1 auto;
+          flex: 1 1 auto;
+}
+
+.treeview.is-expanded [data-toggle='treeview'] {
+  border-left-color: #009688;
+  background: #0d1214;
+}
+
+.treeview.is-expanded .treeview-menu {
+  max-height: 100vh;
+}
+
+.treeview.is-expanded .treeview-indicator {
+  -webkit-transform: rotate(90deg);
+      -ms-transform: rotate(90deg);
+          transform: rotate(90deg);
+}
+
+.treeview-menu {
+  max-height: 0;
+  overflow: hidden;
+  -webkit-transition: max-height 0.3s ease;
+  -o-transition: max-height 0.3s ease;
+  transition: max-height 0.3s ease;
+  background: #2a383e;
+}
+
+.treeview-item {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  padding: 5px 5px 5px 20px;
+  font-size: 1em;
+  color: #fff;
+}
+
+.treeview-item.active, .treeview-item:hover, .treeview-item:focus {
+  background: #0d1214;
+  text-decoration: none;
+  color: #fff;
+}
+
+.treeview-item .icon {
+  margin-right: 5px;
+}
+
+.treeview-indicator {
+  -webkit-transform-origin: center;
+      -ms-transform-origin: center;
+          transform-origin: center;
+  -webkit-transition: -webkit-transform 0.3s ease;
+  transition: -webkit-transform 0.3s ease;
+  -o-transition: transform 0.3s ease;
+  transition: transform 0.3s ease;
+  transition: transform 0.3s ease, -webkit-transform 0.3s ease;
+}
+
+@media (min-width: 768px) {
+  .sidebar-mini.sidenav-toggled .app-sidebar__user-name,
+  .sidebar-mini.sidenav-toggled .app-sidebar__user-designation,
+  .sidebar-mini.sidenav-toggled .treeview-indicator {
+    display: none;
+  }
+  .sidebar-mini.sidenav-toggled .app-sidebar__user-avatar {
+    width: 30px;
+    height: 30px;
+  }
+  .sidebar-mini.sidenav-toggled .app-content {
+    margin-left: 50px;
+  }
+  .sidebar-mini.sidenav-toggled .app-sidebar {
+    left: 0;
+    width: 50px;
+    overflow: hidden;
+  }
+  .sidebar-mini.sidenav-toggled .app-sidebar:hover {
+    overflow: visible;
+  }
+  .sidebar-mini.sidenav-toggled .app-menu__item {
+    overflow: hidden;
+  }
+  .sidebar-mini.sidenav-toggled .app-menu__item:hover {
+    overflow: visible;
+  }
+  .sidebar-mini.sidenav-toggled .app-menu__item:hover .app-menu__label {
+    opacity: 1;
+  }
+  .sidebar-mini.sidenav-toggled .app-menu__item:hover + .treeview-menu {
+    visibility: visible;
+  }
+  .sidebar-mini.sidenav-toggled .app-menu__label {
+    display: block;
+    position: absolute;
+    top: 0;
+    left: 50px;
+    min-width: 180px;
+    padding: 12px 5px 12px 20px;
+    margin-left: -3px;
+    line-height: 1;
+    opacity: 0;
+    background: #0d1214;
+    border-top-right-radius: 4px;
+    border-bottom-right-radius: 4px;
+  }
+  .sidebar-mini.sidenav-toggled .treeview:hover .app-menu__item {
+    overflow: visible;
+    background: #0d1214;
+    border-left-color: #009688;
+    color: #fff;
+  }
+  .sidebar-mini.sidenav-toggled .treeview:hover .app-menu__label {
+    opacity: 1;
+  }
+  .sidebar-mini.sidenav-toggled .treeview:hover .treeview-menu {
+    max-height: 100vh;
+    opacity: 1;
+    visibility: visible;
+    z-index: 10;
+  }
+  .sidebar-mini.sidenav-toggled .treeview .app-menu__label {
+    border-bottom-right-radius: 0;
+  }
+  .sidebar-mini.sidenav-toggled .treeview-menu {
+    position: absolute;
+    left: 50px;
+    min-width: 180px;
+    padding: 12px 0;
+    opacity: 0;
+    border-bottom-right-radius: 4px;
+    z-index: 9;
+    visibility: hidden;
+    -webkit-transition: visibility 0.3s ease;
+    -o-transition: visibility 0.3s ease;
+    transition: visibility 0.3s ease;
+  }
+}
+
+.dropdown-menu {
+  border-radius: 0;
+  -webkit-box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+          box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+}
+
+.dropdown-menu.dropdown-menu-right {
+  left: auto;
+  right: 0;
+}
+
+.dropdown-item .fa,
+.dropdown-item .icon {
+  margin-right: 5px;
+  vertical-align: middle;
+}
+
+.btn {
+  cursor: pointer;
+}
+
+.btn:not([disabled]):not(.disabled):not(.btn-link):hover, .btn:not([disabled]):not(.disabled):not(.btn-link):focus {
+  text-decoration: none;
+  -webkit-transform: translate3d(0, -1px, 0);
+          transform: translate3d(0, -1px, 0);
+  -webkit-box-shadow: 0 4px 8px 0 rgba(0, 0, 0, 0.4);
+          box-shadow: 0 4px 8px 0 rgba(0, 0, 0, 0.4);
+}
+
+.btn[disabled] {
+  cursor: not-allowed;
+}
+
+.btn .icon,
+.btn .fa {
+  font-size: 14px;
+  margin-right: 5px;
+  vertical-align: middle;
+}
+
+.app-title {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: justify;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: row;
+          flex-direction: row;
+  background-color: #FFF;
+  margin: -30px -30px 30px;
+  padding: 20px 30px;
+  -webkit-box-shadow: 0 1px 2px rgba(0, 0, 0, 0.1);
+          box-shadow: 0 1px 2px rgba(0, 0, 0, 0.1);
+}
+
+@media print {
+  .app-title {
+    display: none;
+  }
+}
+
+@media (max-width: 480px) {
+  .app-title {
+    margin: -15px -15px 15px;
+    padding: 20px;
+    -webkit-box-orient: vertical;
+    -webkit-box-direction: normal;
+        -ms-flex-direction: column;
+            flex-direction: column;
+    -webkit-box-align: start;
+        -ms-flex-align: start;
+            align-items: flex-start;
+  }
+}
+
+.app-title h1 {
+  margin: 0;
+  font-size: 24px;
+  font-weight: 400;
+}
+
+.app-title p {
+  margin-bottom: 0;
+  font-style: italic;
+}
+
+@media (max-width: 480px) {
+  .app-title p {
+    display: none;
+  }
+}
+
+.app-breadcrumb {
+  margin-bottom: 0;
+  text-align: right;
+  font-weight: 500;
+  font-size: 13px;
+  text-transform: capitalize;
+  padding: 0;
+  text-align: left;
+  padding: 0;
+  background-color: transparent;
+}
+
+@media (max-width: 480px) {
+  .app-breadcrumb {
+    margin-top: 10px;
+  }
+}
+
+.tile {
+  position: relative;
+  background: #ffffff;
+  border-radius: 3px;
+  padding: 20px;
+  -webkit-box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+          box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+  margin-bottom: 30px;
+  -webkit-transition: all 0.3s ease-in-out;
+  -o-transition: all 0.3s ease-in-out;
+  transition: all 0.3s ease-in-out;
+}
+
+@media print {
+  .tile {
+    border: 1px solid #ddd;
+  }
+}
+
+.tile.small {
+  padding: 0;
+}
+
+.tile .overlay {
+  position: absolute;
+  top: 0;
+  left: 0;
+  bottom: 0;
+  right: 0;
+  background-color: rgba(255, 255, 255, 0.9);
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: row;
+          flex-direction: row;
+  color: #555;
+  border-radius: 3px;
+}
+
+.tile .overlay .l-text {
+  font-size: 24px;
+  margin-top: 15px;
+}
+
+.tile .tile-title {
+  margin-top: 0;
+  margin-bottom: 20px;
+  font-size: 1.5rem;
+}
+
+.tile .tile-title-w-btn {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-pack: justify;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  margin-bottom: 20px;
+}
+
+.tile .tile-title-w-btn p {
+  margin: 0;
+}
+
+.tile .tile-title-w-btn .title {
+  margin: 0;
+}
+
+.tile .tile-title-w-btn .side {
+  margin-bottom: 0;
+  padding-left: 0;
+}
+
+.tile .tile-title-w-btn .btn-group {
+  -webkit-box-flex: 0;
+      -ms-flex: 0 0 auto;
+          flex: 0 0 auto;
+}
+
+.tile .tile-footer {
+  border-top: 1px solid #ddd;
+  padding: 20px 0 0 0;
+  margin-top: 10px;
+}
+
+/* Custom Checkbox and Radio Buttons */
+.animated-checkbox input[type="checkbox"] {
+  display: none;
+}
+
+.animated-checkbox input[type="checkbox"] + .label-text {
+  cursor: pointer !important;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.animated-checkbox input[type="checkbox"] + .label-text:before {
+  content: "";
+  font-family: "FontAwesome";
+  speak: none;
+  font-style: normal;
+  font-weight: normal;
+  font-variant: normal;
+  text-transform: none;
+  line-height: 1;
+  font-size: 18px;
+  -webkit-font-smoothing: antialiased;
+  width: 1em;
+  display: inline-block;
+  margin-right: 2px;
+  vertical-align: -2px;
+}
+
+.animated-checkbox input[type="checkbox"]:checked + .label-text:before {
+  content: "";
+  color: #009688;
+  -webkit-animation: tick 180ms ease-in;
+          animation: tick 180ms ease-in;
+}
+
+.animated-checkbox input[type="checkbox"]:disabled + .label-text {
+  cursor: not-allowed !important;
+}
+
+.animated-checkbox input[type="checkbox"]:disabled + .label-text:before {
+  content: "";
+  color: #ccc;
+}
+
+.animated-radio-button input[type="radio"] {
+  display: none;
+}
+
+.animated-radio-button input[type="radio"] + .label-text {
+  cursor: pointer !important;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.animated-radio-button input[type="radio"] + .label-text:before {
+  content: "";
+  font-family: "FontAwesome";
+  speak: none;
+  font-style: normal;
+  font-weight: normal;
+  font-variant: normal;
+  text-transform: none;
+  line-height: 1;
+  font-size: 18px;
+  -webkit-font-smoothing: antialiased;
+  width: 1em;
+  display: inline-block;
+  margin-right: 2px;
+  vertical-align: -2px;
+}
+
+.animated-radio-button input[type="radio"]:checked + .label-text:before {
+  content: "";
+  color: #009688;
+  -webkit-animation: tick 180ms ease-in;
+          animation: tick 180ms ease-in;
+}
+
+.animated-radio-button input[type="radio"]:disabled + .label-text {
+  cursor: not-allowed !important;
+}
+
+.animated-radio-button input[type="radio"]:disabled + .label-text:before {
+  content: "";
+  color: #ccc;
+}
+
+@-webkit-keyframes tick {
+  0% {
+    -webkit-transform: scale(0);
+            transform: scale(0);
+  }
+  90% {
+    -webkit-transform: scale(1.4);
+            transform: scale(1.4);
+  }
+  100% {
+    -webkit-transform: scale(1);
+            transform: scale(1);
+  }
+}
+
+@keyframes tick {
+  0% {
+    -webkit-transform: scale(0);
+            transform: scale(0);
+  }
+  90% {
+    -webkit-transform: scale(1.4);
+            transform: scale(1.4);
+  }
+  100% {
+    -webkit-transform: scale(1);
+            transform: scale(1);
+  }
+}
+
+.toggle.lg input[type="checkbox"] + .button-indecator:before {
+  font-size: 30px;
+}
+
+.toggle input[type="checkbox"] {
+  display: none;
+}
+
+.toggle input[type="checkbox"] + .button-indecator {
+  cursor: pointer;
+  display: block;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+}
+
+.toggle input[type="checkbox"] + .button-indecator:before {
+  content: "";
+  font-family: "FontAwesome";
+  speak: none;
+  font-style: normal;
+  font-weight: normal;
+  font-variant: normal;
+  text-transform: none;
+  line-height: 1;
+  font-size: 25px;
+  -webkit-font-smoothing: antialiased;
+  display: inline-block;
+  margin-right: 5px;
+  vertical-align: -2px;
+}
+
+.toggle input[type="checkbox"]:checked + .button-indecator:before {
+  content: "";
+  color: #009688;
+  -webkit-animation: toggleBtn 0.3s ease-in-out;
+          animation: toggleBtn 0.3s ease-in-out;
+}
+
+.toggle input[type="checkbox"]:disabled + .button-indecator {
+  cursor: not-allowed !important;
+}
+
+.toggle input[type="checkbox"]:disabled + .button-indecator:before {
+  color: #ccc;
+}
+
+.toggle-flip input[type="checkbox"] {
+  display: none;
+}
+
+.toggle-flip input[type="checkbox"] + .flip-indecator {
+  position: relative;
+  width: 60px;
+  height: 30px;
+  display: block;
+  cursor: pointer;
+  -webkit-user-select: none;
+     -moz-user-select: none;
+      -ms-user-select: none;
+          user-select: none;
+  -webkit-perspective: 90px;
+          perspective: 90px;
+}
+
+.toggle-flip input[type="checkbox"] + .flip-indecator:before, .toggle-flip input[type="checkbox"] + .flip-indecator:after {
+  position: absolute;
+  top: 0;
+  left: 0;
+  display: inline-block;
+  width: 100%;
+  line-height: 30px;
+  -webkit-backface-visibility: hidden;
+          backface-visibility: hidden;
+  text-align: center;
+  border-radius: 3px;
+  -webkit-transition: all 0.5s ease;
+  -o-transition: all 0.5s ease;
+  transition: all 0.5s ease;
+}
+
+.toggle-flip input[type="checkbox"] + .flip-indecator:before {
+  content: attr(data-toggle-off);
+  background-color: #ddd;
+}
+
+.toggle-flip input[type="checkbox"] + .flip-indecator:after {
+  content: attr(data-toggle-on);
+  background-color: #009688;
+  color: #fff;
+  -webkit-transform: rotateY(-180deg);
+          transform: rotateY(-180deg);
+}
+
+.toggle-flip input[type="checkbox"]:checked + .flip-indecator:before {
+  -webkit-transform: rotateY(180deg);
+          transform: rotateY(180deg);
+}
+
+.toggle-flip input[type="checkbox"]:checked + .flip-indecator:after {
+  -webkit-transform: rotateY(0deg);
+          transform: rotateY(0deg);
+}
+
+.toggle-flip input[type="checkbox"]:disabled + .flip-indecator {
+  cursor: not-allowed !important;
+  color: #ccc;
+}
+
+@-webkit-keyframes toggleBtn {
+  0% {
+    opacity: 0;
+    -webkit-transform: translateX(-1px);
+            transform: translateX(-1px);
+  }
+  100% {
+    opacity: 1;
+    -webkit-transform: translateX(0);
+            transform: translateX(0);
+  }
+}
+
+@keyframes toggleBtn {
+  0% {
+    opacity: 0;
+    -webkit-transform: translateX(-1px);
+            transform: translateX(-1px);
+  }
+  100% {
+    opacity: 1;
+    -webkit-transform: translateX(0);
+            transform: translateX(0);
+  }
+}
+
+.material-half-bg {
+  height: 100vh;
+  background-color: #e7e7e7;
+  position: fixed;
+  top: 0;
+  left: 0;
+  right: 0;
+  bottom: 0;
+  z-index: -1;
+}
+
+.material-half-bg .cover {
+  background-color: #009688;
+  height: 50vh;
+}
+
+.m-loader {
+  position: relative;
+  width: 40px;
+}
+
+.m-loader:before {
+  content: '';
+  display: block;
+  padding-top: 100%;
+}
+
+.m-circular {
+  -webkit-animation: rotate 1.5s linear infinite;
+          animation: rotate 1.5s linear infinite;
+  height: 100%;
+  -webkit-transform-origin: center center;
+      -ms-transform-origin: center center;
+          transform-origin: center center;
+  width: 100%;
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  right: 0;
+  margin: auto;
+}
+
+.path {
+  stroke-dasharray: 1,200;
+  stroke-dashoffset: 0;
+  stroke: #009688;
+  -webkit-animation: dash 1.5s ease-in-out infinite;
+          animation: dash 1.5s ease-in-out infinite;
+  stroke-linecap: round;
+}
+
+@-webkit-keyframes rotate {
+  100% {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+@keyframes rotate {
+  100% {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+@-webkit-keyframes dash {
+  0% {
+    stroke-dasharray: 1,200;
+    stroke-dashoffset: 0;
+  }
+  50% {
+    stroke-dasharray: 89,200;
+    stroke-dashoffset: -35px;
+  }
+  100% {
+    stroke-dasharray: 89,200;
+    stroke-dashoffset: -124px;
+  }
+}
+
+@keyframes dash {
+  0% {
+    stroke-dasharray: 1,200;
+    stroke-dashoffset: 0;
+  }
+  50% {
+    stroke-dasharray: 89,200;
+    stroke-dashoffset: -35px;
+  }
+  100% {
+    stroke-dasharray: 89,200;
+    stroke-dashoffset: -124px;
+  }
+}
+
+.btn-spinner {
+  display: inline-block;
+  z-index: 2000;
+  width: 15px;
+  height: 15px;
+  position: relative;
+  top: 2px;
+  margin-right: 5px;
+  border: solid 2px transparent;
+  border-top-color: #fff;
+  border-left-color: #fff;
+  border-radius: 10px;
+  -webkit-animation: bSpinner 0.8s linear infinite;
+          animation: bSpinner 0.8s linear infinite;
+}
+
+@-webkit-keyframes bSpinner {
+  0% {
+    -webkit-transform: rotate(0deg);
+            transform: rotate(0deg);
+  }
+  100% {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+@keyframes bSpinner {
+  0% {
+    -webkit-transform: rotate(0deg);
+            transform: rotate(0deg);
+  }
+  100% {
+    -webkit-transform: rotate(360deg);
+            transform: rotate(360deg);
+  }
+}
+
+.widget-small {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  border-radius: 4px;
+  color: #FFF;
+  margin-bottom: 30px;
+  -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.1);
+          box-shadow: 0 1px 1px rgba(0, 0, 0, 0.1);
+}
+
+.widget-small .icon {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  min-width: 85px;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  padding: 20px;
+  background-color: rgba(0, 0, 0, 0.2);
+  border-radius: 4px 0 0 4px;
+  font-size: 2.5rem;
+}
+
+.widget-small .info {
+  -webkit-box-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  padding: 0 20px;
+  -ms-flex-item-align: center;
+      align-self: center;
+}
+
+.widget-small .info h4 {
+  text-transform: uppercase;
+  margin: 0;
+  margin-bottom: 5px;
+  font-weight: 400;
+  font-size: 1.1rem;
+}
+
+.widget-small .info p {
+  margin: 0;
+  font-size: 16px;
+}
+
+.widget-small.primary {
+  background-color: #009688;
+}
+
+.widget-small.primary.coloured-icon {
+  background-color: #fff;
+  color: #2a2a2a;
+}
+
+.widget-small.primary.coloured-icon .icon {
+  background-color: #009688;
+  color: #fff;
+}
+
+.widget-small.info {
+  background-color: #17a2b8;
+}
+
+.widget-small.info.coloured-icon {
+  background-color: #fff;
+  color: #2a2a2a;
+}
+
+.widget-small.info.coloured-icon .icon {
+  background-color: #17a2b8;
+  color: #fff;
+}
+
+.widget-small.warning {
+  background-color: #ffc107;
+}
+
+.widget-small.warning.coloured-icon {
+  background-color: #fff;
+  color: #2a2a2a;
+}
+
+.widget-small.warning.coloured-icon .icon {
+  background-color: #ffc107;
+  color: #fff;
+}
+
+.widget-small.danger {
+  background-color: #dc3545;
+}
+
+.widget-small.danger.coloured-icon {
+  background-color: #fff;
+  color: #2a2a2a;
+}
+
+.widget-small.danger.coloured-icon .icon {
+  background-color: #dc3545;
+  color: #fff;
+}
+
+.messanger {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+}
+
+.messanger .messages {
+  -webkit-box-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  margin: 10px 0;
+  padding: 0 10px;
+  max-height: 260px;
+  overflow-y: auto;
+  overflow-x: hidden;
+}
+
+.messanger .messages .message {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  margin-bottom: 15px;
+  -webkit-box-align: start;
+      -ms-flex-align: start;
+          align-items: flex-start;
+}
+
+.messanger .messages .message.me {
+  -webkit-box-orient: horizontal;
+  -webkit-box-direction: reverse;
+      -ms-flex-direction: row-reverse;
+          flex-direction: row-reverse;
+}
+
+.messanger .messages .message.me img {
+  margin-right: 0;
+  margin-left: 15px;
+}
+
+.messanger .messages .message.me .info {
+  background-color: #009688;
+  color: #FFF;
+}
+
+.messanger .messages .message.me .info:before {
+  display: none;
+}
+
+.messanger .messages .message.me .info:after {
+  position: absolute;
+  right: -13px;
+  top: 0;
+  content: "";
+  width: 0;
+  height: 0;
+  border-style: solid;
+  border-width: 0 16px 16px 0;
+  border-color: transparent #009688 transparent transparent;
+  -webkit-transform: rotate(270deg);
+      -ms-transform: rotate(270deg);
+          transform: rotate(270deg);
+}
+
+.messanger .messages .message img {
+  border-radius: 50%;
+  margin-right: 15px;
+}
+
+.messanger .messages .message .info {
+  margin: 0;
+  background-color: #ddd;
+  padding: 5px 10px;
+  border-radius: 3px;
+  position: relative;
+  -ms-flex-item-align: start;
+      align-self: flex-start;
+}
+
+.messanger .messages .message .info:before {
+  position: absolute;
+  left: -14px;
+  top: 0;
+  content: "";
+  width: 0;
+  height: 0;
+  border-style: solid;
+  border-width: 0 16px 16px 0;
+  border-color: transparent #ddd transparent transparent;
+}
+
+.messanger .sender {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.messanger .sender input[type="text"] {
+  -webkit-box-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  border: 1px solid #009688;
+  outline: none;
+  padding: 5px 10px;
+}
+
+.messanger .sender button {
+  border-radius: 0;
+}
+
+.login-content {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  min-height: 100vh;
+}
+
+.login-content .logo {
+  margin-bottom: 40px;
+  font-family: "Niconne";
+  color: #fff;
+}
+
+.login-content .logo h1 {
+  font-size: 52px;
+  font-weight: 400;
+}
+
+.login-content .login-box {
+  position: relative;
+  min-width: 350px;
+  min-height: 250px;
+  background-color: #fff;
+  -webkit-box-shadow: 0px 29px 147.5px 102.5px rgba(0, 0, 0, 0.05), 0px 29px 95px 0px rgba(0, 0, 0, 0.16);
+          box-shadow: 0px 29px 147.5px 102.5px rgba(0, 0, 0, 0.05), 0px 29px 95px 0px rgba(0, 0, 0, 0.16);
+  -webkit-perspective: 800px;
+          perspective: 800px;
+  -webkit-transition: all 0.5s ease-in-out;
+  -o-transition: all 0.5s ease-in-out;
+  transition: all 0.5s ease-in-out;
+}
+
+.login-content .login-box .login-head {
+  margin-top: 0;
+  margin-bottom: 20px;
+  padding-bottom: 20px;
+  border-bottom: 1px solid #ddd;
+  text-align: center;
+}
+
+.login-content .login-box label {
+  color: #666;
+  font-weight: 700;
+}
+
+.login-content .login-box .utility {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  padding: 1px;
+  -webkit-box-pack: justify;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+}
+
+.login-content .login-box .btn-container {
+  margin-bottom: 0;
+}
+
+.login-content .login-box .login-form, .login-content .login-box .forget-form {
+  position: absolute;
+  top: 0;
+  bottom: 0;
+  left: 0;
+  right: 0;
+  padding: 40px;
+  backface-visibility: hidden;
+  -webkit-backface-visibility: hidden;
+  -webkit-transition: all 0.5s ease-in-out;
+  -o-transition: all 0.5s ease-in-out;
+  transition: all 0.5s ease-in-out;
+}
+
+.login-content .login-box .forget-form {
+  opacity: 0;
+  -webkit-transform: rotateY(180deg);
+          transform: rotateY(180deg);
+}
+
+.login-content .login-box.flipped {
+  min-height: 300px;
+}
+
+.login-content .login-box.flipped .login-form {
+  opacity: 0;
+  -webkit-transform: rotateY(-180deg);
+          transform: rotateY(-180deg);
+}
+
+.login-content .login-box.flipped .forget-form {
+  opacity: 1;
+  -webkit-transform: rotateY(0deg);
+          transform: rotateY(0deg);
+}
+
+@media (max-width: 351px) {
+  .login-content .login-box {
+    min-width: 100%;
+  }
+  .login-content .login-box .login-form, .login-content .login-box .forget-form {
+    width: 100%;
+  }
+}
+
+.lockscreen-content {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  min-height: 100vh;
+}
+
+.lockscreen-content .logo {
+  font-family: "Niconne";
+  margin-bottom: 40px;
+  color: #fff;
+}
+
+.lockscreen-content .logo h1 {
+  font-size: 52px;
+  font-weight: 400;
+}
+
+.lockscreen-content .lock-box {
+  position: relative;
+  min-width: 320px;
+  padding: 20px 40px;
+  background-color: #fff;
+  -webkit-box-shadow: 0px 29px 147.5px 102.5px rgba(0, 0, 0, 0.05), 0px 29px 95px 0px rgba(0, 0, 0, 0.16);
+          box-shadow: 0px 29px 147.5px 102.5px rgba(0, 0, 0, 0.05), 0px 29px 95px 0px rgba(0, 0, 0, 0.16);
+  -webkit-perspective: 800px;
+          perspective: 800px;
+  -webkit-transition: all 0.5s ease-in-out;
+  -o-transition: all 0.5s ease-in-out;
+  transition: all 0.5s ease-in-out;
+}
+
+.lockscreen-content .lock-box .user-image {
+  border: 3px solid #fff;
+  max-width: 100px;
+  display: block;
+  margin: 0 auto;
+}
+
+.lockscreen-content .lock-box .user-name {
+  margin-bottom: 2px;
+}
+
+.lockscreen-content .lock-box label {
+  color: #666;
+  font-weight: 700;
+}
+
+.page-error {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: center;
+      -ms-flex-pack: center;
+          justify-content: center;
+  -webkit-box-orient: vertical;
+  -webkit-box-direction: normal;
+      -ms-flex-direction: column;
+          flex-direction: column;
+  min-height: calc(100vh - 110px);
+  margin-bottom: 0;
+}
+
+.page-error h1 {
+  margin: 10px;
+  color: #dc3545;
+  font-size: 42px;
+}
+
+.folder-head {
+  padding: 10px;
+  margin-bottom: 0 !important;
+  border-bottom: 1px solid #ddd;
+}
+
+.mailbox-controls {
+  margin-bottom: 10px;
+  border-bottom: 1px solid #ddd;
+  padding: 0 0 10px 5px;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: center;
+      -ms-flex-align: center;
+          align-items: center;
+  -webkit-box-pack: justify;
+      -ms-flex-pack: justify;
+          justify-content: space-between;
+}
+
+.mailbox-controls .animated-checkbox .label-text:before {
+  vertical-align: -7px !important;
+}
+
+.mail-nav > li > a {
+  display: block;
+  background-color: #fff;
+  color: #2a2a2a;
+  border-radius: 0;
+  font-weight: 500;
+}
+
+.mailbox-messages table tr td {
+  border: 0;
+  padding: 5px;
+}
+
+.mailbox-messages .mail-subject {
+  overflow: hidden;
+  -o-text-overflow: ellipsis;
+     text-overflow: ellipsis;
+  white-space: nowrap;
+  max-width: 500px;
+}
+
+.user .profile {
+  margin: -30px -30px 0 -30px;
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+}
+
+.user .profile .info {
+  padding: 30px 60px;
+  text-align: center;
+  background-color: #fff;
+  white-space: nowrap;
+  background-color: #404040;
+  color: #fff;
+}
+
+.user .profile .info img {
+  border-radius: 50%;
+  max-width: 110px;
+  margin-bottom: 20px;
+  margin-top: 10px;
+}
+
+.user .profile .cover-image {
+  -webkit-box-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  background-image: url(http://placeimg.com/1200/300/nature);
+  background-size: cover;
+  background-position: center;
+  min-height: 300px;
+}
+
+.user .user-tabs {
+  margin-top: 20px;
+}
+
+.user .user-tabs .nav-link {
+  border-left: 3px solid transparent;
+  padding: 12px 15px;
+  border-bottom: 0;
+  font-size: 15px;
+  border-radius: 0;
+}
+
+.user .user-tabs .nav-link.active {
+  border-left-color: #009688;
+  border-bottom: 0;
+}
+
+.user .user-tabs .nav-link:hover, .user .user-tabs .nav-link:active {
+  background-color: #eee !important;
+  border-bottom: 0;
+}
+
+.user .tab-content {
+  margin: 20px -10px -10px;
+}
+
+.user .timeline-post {
+  background-color: #fff;
+  padding: 20px;
+  margin-bottom: 20px;
+  -webkit-box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 3px 1px -2px rgba(0, 0, 0, 0.2), 0 1px 5px 0 rgba(0, 0, 0, 0.12);
+          box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 3px 1px -2px rgba(0, 0, 0, 0.2), 0 1px 5px 0 rgba(0, 0, 0, 0.12);
+}
+
+.user .timeline-post .post-media {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  -webkit-box-align: start;
+      -ms-flex-align: start;
+          align-items: flex-start;
+  margin-bottom: 15px;
+}
+
+.user .timeline-post .post-media img {
+  margin-right: 10px;
+}
+
+.user .timeline-post .post-media h5 {
+  margin-top: 0;
+  margin-bottom: 3px;
+  font-size: 15px;
+}
+
+.user .timeline-post .post-content {
+  margin-bottom: 20px;
+}
+
+.user .timeline-post .post-utility {
+  display: -webkit-box;
+  display: -ms-flexbox;
+  display: flex;
+  list-style: none;
+  padding-left: 0;
+  margin-bottom: 0;
+}
+
+.user .timeline-post .post-utility .likes,
+.user .timeline-post .post-utility .shares {
+  margin-right: 10px;
+}
+
+.user .timeline-post .post-utility .likes a,
+.user .timeline-post .post-utility .shares a {
+  color: #555;
+}
+
+.user .timeline-post .post-utility .comments {
+  color: #555;
+  -webkit-box-flex: 1;
+      -ms-flex: 1;
+          flex: 1;
+  text-align: right;
+}
+
+.user .user-settings .line-head {
+  font-size: 18px;
+  margin-bottom: 30px;
+  color: #2a2a2a;
+}
+
+.user .user-settings label {
+  color: #666;
+}
+
+li{
+  margin: 8px 0;
+}

static/fonts/fontawesome-webfont.svg

@@ -0,0 +1,2671 @@
+<?xml version="1.0" standalone="no"?>
+<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" >
+<svg>
+<metadata>
+Created by FontForge 20120731 at Mon Oct 24 17:37:40 2016
+ By ,,,
+Copyright Dave Gandy 2016. All rights reserved.
+</metadata>
+<defs>
+<font id="FontAwesome" horiz-adv-x="1536" >
+  <font-face 
+    font-family="FontAwesome"
+    font-weight="400"
+    font-stretch="normal"
+    units-per-em="1792"
+    panose-1="0 0 0 0 0 0 0 0 0 0"
+    ascent="1536"
+    descent="-256"
+    bbox="-1.02083 -256.962 2304.6 1537.02"
+    underline-thickness="0"
+    underline-position="0"
+    unicode-range="U+0020-F500"
+  />
+<missing-glyph horiz-adv-x="896" 
+d="M224 112h448v1312h-448v-1312zM112 0v1536h672v-1536h-672z" />
+    <glyph glyph-name=".notdef" horiz-adv-x="896" 
+d="M224 112h448v1312h-448v-1312zM112 0v1536h672v-1536h-672z" />
+    <glyph glyph-name=".null" horiz-adv-x="0" 
+ />
+    <glyph glyph-name="nonmarkingreturn" horiz-adv-x="597" 
+ />
+    <glyph glyph-name="space" unicode=" " horiz-adv-x="448" 
+ />
+    <glyph glyph-name="dieresis" unicode="&#xa8;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="copyright" unicode="&#xa9;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="registered" unicode="&#xae;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="acute" unicode="&#xb4;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="AE" unicode="&#xc6;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="Oslash" unicode="&#xd8;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="trademark" unicode="&#x2122;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="infinity" unicode="&#x221e;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="notequal" unicode="&#x2260;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="glass" unicode="&#xf000;" horiz-adv-x="1792" 
+d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" />
+    <glyph glyph-name="music" unicode="&#xf001;" 
+d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89
+t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="search" unicode="&#xf002;" horiz-adv-x="1664" 
+d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5
+t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
+    <glyph glyph-name="envelope" unicode="&#xf003;" horiz-adv-x="1792" 
+d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13
+t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z
+M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="heart" unicode="&#xf004;" horiz-adv-x="1792" 
+d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600
+q-18 -18 -44 -18z" />
+    <glyph glyph-name="star" unicode="&#xf005;" horiz-adv-x="1664" 
+d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455
+l502 -73q56 -9 56 -46z" />
+    <glyph glyph-name="star_empty" unicode="&#xf006;" horiz-adv-x="1664" 
+d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500
+l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" />
+    <glyph glyph-name="user" unicode="&#xf007;" horiz-adv-x="1280" 
+d="M1280 137q0 -109 -62.5 -187t-150.5 -78h-854q-88 0 -150.5 78t-62.5 187q0 85 8.5 160.5t31.5 152t58.5 131t94 89t134.5 34.5q131 -128 313 -128t313 128q76 0 134.5 -34.5t94 -89t58.5 -131t31.5 -152t8.5 -160.5zM1024 1024q0 -159 -112.5 -271.5t-271.5 -112.5
+t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="film" unicode="&#xf008;" horiz-adv-x="1920" 
+d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128
+q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45
+t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128
+q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19
+t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="th_large" unicode="&#xf009;" horiz-adv-x="1664" 
+d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38
+h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="th" unicode="&#xf00a;" horiz-adv-x="1792" 
+d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28
+h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192
+q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="th_list" unicode="&#xf00b;" horiz-adv-x="1792" 
+d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28
+h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="ok" unicode="&#xf00c;" horiz-adv-x="1792" 
+d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" />
+    <glyph glyph-name="remove" unicode="&#xf00d;" horiz-adv-x="1408" 
+d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68
+t-28 -68l-294 -294l294 -294q28 -28 28 -68z" />
+    <glyph glyph-name="zoom_in" unicode="&#xf00e;" horiz-adv-x="1664" 
+d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224
+q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5
+t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" />
+    <glyph glyph-name="zoom_out" unicode="&#xf010;" horiz-adv-x="1664" 
+d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z
+M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z
+" />
+    <glyph glyph-name="off" unicode="&#xf011;" 
+d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5
+t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" />
+    <glyph glyph-name="signal" unicode="&#xf012;" horiz-adv-x="1792" 
+d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23
+v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="cog" unicode="&#xf013;" 
+d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38
+q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13
+l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22
+q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" />
+    <glyph glyph-name="trash" unicode="&#xf014;" horiz-adv-x="1408" 
+d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576
+q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832
+q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="home" unicode="&#xf015;" horiz-adv-x="1664" 
+d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5
+l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" />
+    <glyph glyph-name="file_alt" unicode="&#xf016;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+" />
+    <glyph glyph-name="time" unicode="&#xf017;" 
+d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="road" unicode="&#xf018;" horiz-adv-x="1920" 
+d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256
+q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" />
+    <glyph glyph-name="download_alt" unicode="&#xf019;" horiz-adv-x="1664" 
+d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136
+q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" />
+    <glyph glyph-name="download" unicode="&#xf01a;" 
+d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273
+t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="upload" unicode="&#xf01b;" 
+d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198
+t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="inbox" unicode="&#xf01c;" 
+d="M1023 576h316q-1 3 -2.5 8.5t-2.5 7.5l-212 496h-708l-212 -496q-1 -3 -2.5 -8.5t-2.5 -7.5h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552
+q25 -61 25 -123z" />
+    <glyph glyph-name="play_circle" unicode="&#xf01d;" 
+d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="repeat" unicode="&#xf01e;" 
+d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q15 0 25 -9
+l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" />
+    <glyph glyph-name="refresh" unicode="&#xf021;" 
+d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117
+q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5
+q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" />
+    <glyph glyph-name="list_alt" unicode="&#xf022;" horiz-adv-x="1792" 
+d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z
+M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5
+t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47
+t47 -113z" />
+    <glyph glyph-name="lock" unicode="&#xf023;" horiz-adv-x="1152" 
+d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="flag" unicode="&#xf024;" horiz-adv-x="1792" 
+d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48
+t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="headphones" unicode="&#xf025;" horiz-adv-x="1664" 
+d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78
+t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5
+t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" />
+    <glyph glyph-name="volume_off" unicode="&#xf026;" horiz-adv-x="768" 
+d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" />
+    <glyph glyph-name="volume_down" unicode="&#xf027;" horiz-adv-x="1152" 
+d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 36
+t12 56.5t-12 56.5t-29 36t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" />
+    <glyph glyph-name="volume_up" unicode="&#xf028;" horiz-adv-x="1664" 
+d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 36
+t12 56.5t-12 56.5t-29 36t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5
+t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289
+t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" />
+    <glyph glyph-name="qrcode" unicode="&#xf029;" horiz-adv-x="1408" 
+d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z
+M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" />
+    <glyph glyph-name="barcode" unicode="&#xf02a;" horiz-adv-x="1792" 
+d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z
+M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" />
+    <glyph glyph-name="tag" unicode="&#xf02b;" 
+d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5
+l715 -714q37 -39 37 -91z" />
+    <glyph glyph-name="tags" unicode="&#xf02c;" horiz-adv-x="1920" 
+d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5
+l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" />
+    <glyph glyph-name="book" unicode="&#xf02d;" horiz-adv-x="1664" 
+d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23
+q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906
+q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5
+t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" />
+    <glyph glyph-name="bookmark" unicode="&#xf02e;" horiz-adv-x="1280" 
+d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
+    <glyph glyph-name="print" unicode="&#xf02f;" horiz-adv-x="1664" 
+d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68
+v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" />
+    <glyph glyph-name="camera" unicode="&#xf030;" horiz-adv-x="1920" 
+d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136
+q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="font" unicode="&#xf031;" horiz-adv-x="1664" 
+d="M725 977l-170 -450q33 0 136.5 -2t160.5 -2q19 0 57 2q-87 253 -184 452zM0 -128l2 79q23 7 56 12.5t57 10.5t49.5 14.5t44.5 29t31 50.5l237 616l280 724h75h53q8 -14 11 -21l205 -480q33 -78 106 -257.5t114 -274.5q15 -34 58 -144.5t72 -168.5q20 -45 35 -57
+q19 -15 88 -29.5t84 -20.5q6 -38 6 -57q0 -5 -0.5 -13.5t-0.5 -12.5q-63 0 -190 8t-191 8q-76 0 -215 -7t-178 -8q0 43 4 78l131 28q1 0 12.5 2.5t15.5 3.5t14.5 4.5t15 6.5t11 8t9 11t2.5 14q0 16 -31 96.5t-72 177.5t-42 100l-450 2q-26 -58 -76.5 -195.5t-50.5 -162.5
+q0 -22 14 -37.5t43.5 -24.5t48.5 -13.5t57 -8.5t41 -4q1 -19 1 -58q0 -9 -2 -27q-58 0 -174.5 10t-174.5 10q-8 0 -26.5 -4t-21.5 -4q-80 -14 -188 -14z" />
+    <glyph glyph-name="bold" unicode="&#xf032;" horiz-adv-x="1408" 
+d="M555 15q74 -32 140 -32q376 0 376 335q0 114 -41 180q-27 44 -61.5 74t-67.5 46.5t-80.5 25t-84 10.5t-94.5 2q-73 0 -101 -10q0 -53 -0.5 -159t-0.5 -158q0 -8 -1 -67.5t-0.5 -96.5t4.5 -83.5t12 -66.5zM541 761q42 -7 109 -7q82 0 143 13t110 44.5t74.5 89.5t25.5 142
+q0 70 -29 122.5t-79 82t-108 43.5t-124 14q-50 0 -130 -13q0 -50 4 -151t4 -152q0 -27 -0.5 -80t-0.5 -79q0 -46 1 -69zM0 -128l2 94q15 4 85 16t106 27q7 12 12.5 27t8.5 33.5t5.5 32.5t3 37.5t0.5 34v35.5v30q0 982 -22 1025q-4 8 -22 14.5t-44.5 11t-49.5 7t-48.5 4.5
+t-30.5 3l-4 83q98 2 340 11.5t373 9.5q23 0 68 -0.5t68 -0.5q70 0 136.5 -13t128.5 -42t108 -71t74 -104.5t28 -137.5q0 -52 -16.5 -95.5t-39 -72t-64.5 -57.5t-73 -45t-84 -40q154 -35 256.5 -134t102.5 -248q0 -100 -35 -179.5t-93.5 -130.5t-138 -85.5t-163.5 -48.5
+t-176 -14q-44 0 -132 3t-132 3q-106 0 -307 -11t-231 -12z" />
+    <glyph glyph-name="italic" unicode="&#xf033;" horiz-adv-x="1024" 
+d="M0 -126l17 85q22 7 61.5 16.5t72 19t59.5 23.5q28 35 41 101q1 7 62 289t114 543.5t52 296.5v25q-24 13 -54.5 18.5t-69.5 8t-58 5.5l19 103q33 -2 120 -6.5t149.5 -7t120.5 -2.5q48 0 98.5 2.5t121 7t98.5 6.5q-5 -39 -19 -89q-30 -10 -101.5 -28.5t-108.5 -33.5
+q-8 -19 -14 -42.5t-9 -40t-7.5 -45.5t-6.5 -42q-27 -148 -87.5 -419.5t-77.5 -355.5q-2 -9 -13 -58t-20 -90t-16 -83.5t-6 -57.5l1 -18q17 -4 185 -31q-3 -44 -16 -99q-11 0 -32.5 -1.5t-32.5 -1.5q-29 0 -87 10t-86 10q-138 2 -206 2q-51 0 -143 -9t-121 -11z" />
+    <glyph glyph-name="text_height" unicode="&#xf034;" horiz-adv-x="1792" 
+d="M1744 128q33 0 42 -18.5t-11 -44.5l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80zM81 1407l54 -27q12 -5 211 -5q44 0 132 2
+t132 2q36 0 107.5 -0.5t107.5 -0.5h293q6 0 21 -0.5t20.5 0t16 3t17.5 9t15 17.5l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 48t-14.5 73.5t-7.5 35.5q-6 8 -12 12.5t-15.5 6t-13 2.5t-18 0.5t-16.5 -0.5
+q-17 0 -66.5 0.5t-74.5 0.5t-64 -2t-71 -6q-9 -81 -8 -136q0 -94 2 -388t2 -455q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27
+q19 42 19 383q0 101 -3 303t-3 303v117q0 2 0.5 15.5t0.5 25t-1 25.5t-3 24t-5 14q-11 12 -162 12q-33 0 -93 -12t-80 -26q-19 -13 -34 -72.5t-31.5 -111t-42.5 -53.5q-42 26 -56 44v383z" />
+    <glyph glyph-name="text_width" unicode="&#xf035;" 
+d="M81 1407l54 -27q12 -5 211 -5q44 0 132 2t132 2q70 0 246.5 1t304.5 0.5t247 -4.5q33 -1 56 31l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 47.5t-15 73.5t-7 36q-10 13 -27 19q-5 2 -66 2q-30 0 -93 1t-103 1
+t-94 -2t-96 -7q-9 -81 -8 -136l1 -152v52q0 -55 1 -154t1.5 -180t0.5 -153q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27
+q7 16 11.5 74t6 145.5t1.5 155t-0.5 153.5t-0.5 89q0 7 -2.5 21.5t-2.5 22.5q0 7 0.5 44t1 73t0 76.5t-3 67.5t-6.5 32q-11 12 -162 12q-41 0 -163 -13.5t-138 -24.5q-19 -12 -34 -71.5t-31.5 -111.5t-42.5 -54q-42 26 -56 44v383zM1310 125q12 0 42 -19.5t57.5 -41.5
+t59.5 -49t36 -30q26 -21 26 -49t-26 -49q-4 -3 -36 -30t-59.5 -49t-57.5 -41.5t-42 -19.5q-13 0 -20.5 10.5t-10 28.5t-2.5 33.5t1.5 33t1.5 19.5h-1024q0 -2 1.5 -19.5t1.5 -33t-2.5 -33.5t-10 -28.5t-20.5 -10.5q-12 0 -42 19.5t-57.5 41.5t-59.5 49t-36 30q-26 21 -26 49
+t26 49q4 3 36 30t59.5 49t57.5 41.5t42 19.5q13 0 20.5 -10.5t10 -28.5t2.5 -33.5t-1.5 -33t-1.5 -19.5h1024q0 2 -1.5 19.5t-1.5 33t2.5 33.5t10 28.5t20.5 10.5z" />
+    <glyph glyph-name="align_left" unicode="&#xf036;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45
+t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="align_center" unicode="&#xf037;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19
+h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="align_right" unicode="&#xf038;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45
+t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="align_justify" unicode="&#xf039;" horiz-adv-x="1792" 
+d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45
+t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="list" unicode="&#xf03a;" horiz-adv-x="1792" 
+d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5
+t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344
+q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5
+t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192
+q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="indent_left" unicode="&#xf03b;" horiz-adv-x="1792" 
+d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5
+t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088
+q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="indent_right" unicode="&#xf03c;" horiz-adv-x="1792" 
+d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5
+t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088
+q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="facetime_video" unicode="&#xf03d;" horiz-adv-x="1792" 
+d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5
+q39 -17 39 -59z" />
+    <glyph glyph-name="picture" unicode="&#xf03e;" horiz-adv-x="1920" 
+d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216
+q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="pencil" unicode="&#xf040;" 
+d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38
+q53 0 91 -38l235 -234q37 -39 37 -91z" />
+    <glyph glyph-name="map_marker" unicode="&#xf041;" horiz-adv-x="1024" 
+d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" />
+    <glyph glyph-name="adjust" unicode="&#xf042;" 
+d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="tint" unicode="&#xf043;" horiz-adv-x="1024" 
+d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362
+q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" />
+    <glyph glyph-name="edit" unicode="&#xf044;" horiz-adv-x="1792" 
+d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832
+q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92
+l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" />
+    <glyph glyph-name="share" unicode="&#xf045;" horiz-adv-x="1664" 
+d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832
+q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5
+t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" />
+    <glyph glyph-name="check" unicode="&#xf046;" horiz-adv-x="1664" 
+d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832
+q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110
+q24 -24 24 -57t-24 -57z" />
+    <glyph glyph-name="move" unicode="&#xf047;" horiz-adv-x="1792" 
+d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45
+t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
+    <glyph glyph-name="step_backward" unicode="&#xf048;" horiz-adv-x="1024" 
+d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 10 13 19z" />
+    <glyph glyph-name="fast_backward" unicode="&#xf049;" horiz-adv-x="1792" 
+d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 10 13 19l710 710
+q19 19 32 13t13 -32v-710q4 10 13 19z" />
+    <glyph glyph-name="backward" unicode="&#xf04a;" horiz-adv-x="1664" 
+d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q4 10 13 19z" />
+    <glyph glyph-name="play" unicode="&#xf04b;" horiz-adv-x="1408" 
+d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" />
+    <glyph glyph-name="pause" unicode="&#xf04c;" 
+d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="stop" unicode="&#xf04d;" 
+d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="forward" unicode="&#xf04e;" horiz-adv-x="1664" 
+d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-4 -10 -13 -19z" />
+    <glyph glyph-name="fast_forward" unicode="&#xf050;" horiz-adv-x="1792" 
+d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v710q0 26 13 32t32 -13l710 -710q9 -9 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-4 -10 -13 -19l-710 -710
+q-19 -19 -32 -13t-13 32v710q-4 -10 -13 -19z" />
+    <glyph glyph-name="step_forward" unicode="&#xf051;" horiz-adv-x="1024" 
+d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-4 -10 -13 -19z" />
+    <glyph glyph-name="eject" unicode="&#xf052;" horiz-adv-x="1538" 
+d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" />
+    <glyph glyph-name="chevron_left" unicode="&#xf053;" horiz-adv-x="1280" 
+d="M1171 1235l-531 -531l531 -531q19 -19 19 -45t-19 -45l-166 -166q-19 -19 -45 -19t-45 19l-742 742q-19 19 -19 45t19 45l742 742q19 19 45 19t45 -19l166 -166q19 -19 19 -45t-19 -45z" />
+    <glyph glyph-name="chevron_right" unicode="&#xf054;" horiz-adv-x="1280" 
+d="M1107 659l-742 -742q-19 -19 -45 -19t-45 19l-166 166q-19 19 -19 45t19 45l531 531l-531 531q-19 19 -19 45t19 45l166 166q19 19 45 19t45 -19l742 -742q19 -19 19 -45t-19 -45z" />
+    <glyph glyph-name="plus_sign" unicode="&#xf055;" 
+d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5
+t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="minus_sign" unicode="&#xf056;" 
+d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5
+t103 -385.5z" />
+    <glyph glyph-name="remove_sign" unicode="&#xf057;" 
+d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19
+q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ok_sign" unicode="&#xf058;" 
+d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="question_sign" unicode="&#xf059;" 
+d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59
+q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="info_sign" unicode="&#xf05a;" 
+d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23
+t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="screenshot" unicode="&#xf05b;" 
+d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109
+q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143
+q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="remove_circle" unicode="&#xf05c;" 
+d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23
+l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5
+t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ok_circle" unicode="&#xf05d;" 
+d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198
+t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ban_circle" unicode="&#xf05e;" 
+d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61
+t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" />
+    <glyph glyph-name="arrow_left" unicode="&#xf060;" 
+d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5
+t32.5 -90.5z" />
+    <glyph glyph-name="arrow_right" unicode="&#xf061;" 
+d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" />
+    <glyph glyph-name="arrow_up" unicode="&#xf062;" horiz-adv-x="1664" 
+d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651
+q37 -39 37 -91z" />
+    <glyph glyph-name="arrow_down" unicode="&#xf063;" horiz-adv-x="1664" 
+d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" />
+    <glyph glyph-name="share_alt" unicode="&#xf064;" horiz-adv-x="1792" 
+d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22
+t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" />
+    <glyph glyph-name="resize_full" unicode="&#xf065;" 
+d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332
+q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="resize_small" unicode="&#xf066;" 
+d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45
+t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" />
+    <glyph glyph-name="plus" unicode="&#xf067;" horiz-adv-x="1408" 
+d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="minus" unicode="&#xf068;" horiz-adv-x="1408" 
+d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="asterisk" unicode="&#xf069;" horiz-adv-x="1664" 
+d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154
+q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" />
+    <glyph glyph-name="exclamation_sign" unicode="&#xf06a;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192
+q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" />
+    <glyph glyph-name="gift" unicode="&#xf06b;" 
+d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320
+q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5
+t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="leaf" unicode="&#xf06c;" horiz-adv-x="1792" 
+d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268
+q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-43 0 -63.5 17.5t-45.5 59.5q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5
+t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" />
+    <glyph glyph-name="fire" unicode="&#xf06d;" horiz-adv-x="1408" 
+d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1
+q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" />
+    <glyph glyph-name="eye_open" unicode="&#xf06e;" horiz-adv-x="1792" 
+d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5
+t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" />
+    <glyph glyph-name="eye_close" unicode="&#xf070;" horiz-adv-x="1792" 
+d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9
+q-106 -189 -316 -567t-315 -566l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5
+q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z
+" />
+    <glyph glyph-name="warning_sign" unicode="&#xf071;" horiz-adv-x="1792" 
+d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185
+q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" />
+    <glyph glyph-name="plane" unicode="&#xf072;" horiz-adv-x="1408" 
+d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9
+q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" />
+    <glyph glyph-name="calendar" unicode="&#xf073;" horiz-adv-x="1664" 
+d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z
+M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64
+q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47
+h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="random" unicode="&#xf074;" horiz-adv-x="1792" 
+d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1
+t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5
+v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111
+t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
+    <glyph glyph-name="comment" unicode="&#xf075;" horiz-adv-x="1792" 
+d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281
+q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" />
+    <glyph glyph-name="magnet" unicode="&#xf076;" 
+d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384
+q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="chevron_up" unicode="&#xf077;" horiz-adv-x="1792" 
+d="M1683 205l-166 -165q-19 -19 -45 -19t-45 19l-531 531l-531 -531q-19 -19 -45 -19t-45 19l-166 165q-19 19 -19 45.5t19 45.5l742 741q19 19 45 19t45 -19l742 -741q19 -19 19 -45.5t-19 -45.5z" />
+    <glyph glyph-name="chevron_down" unicode="&#xf078;" horiz-adv-x="1792" 
+d="M1683 728l-742 -741q-19 -19 -45 -19t-45 19l-742 741q-19 19 -19 45.5t19 45.5l166 165q19 19 45 19t45 -19l531 -531l531 531q19 19 45 19t45 -19l166 -165q19 -19 19 -45.5t-19 -45.5z" />
+    <glyph glyph-name="retweet" unicode="&#xf079;" horiz-adv-x="1920" 
+d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -10 7 -21
+zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z
+" />
+    <glyph glyph-name="shopping_cart" unicode="&#xf07a;" horiz-adv-x="1664" 
+d="M640 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1536 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1664 1088v-512q0 -24 -16.5 -42.5t-40.5 -21.5l-1044 -122q13 -60 13 -70q0 -16 -24 -64h920q26 0 45 -19t19 -45
+t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 11 8 31.5t16 36t21.5 40t15.5 29.5l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t19.5 -15.5t13 -24.5t8 -26t5.5 -29.5t4.5 -26h1201q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="folder_close" unicode="&#xf07b;" horiz-adv-x="1664" 
+d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="folder_open" unicode="&#xf07c;" horiz-adv-x="1920" 
+d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5
+t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="resize_vertical" unicode="&#xf07d;" horiz-adv-x="768" 
+d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" />
+    <glyph glyph-name="resize_horizontal" unicode="&#xf07e;" horiz-adv-x="1792" 
+d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" />
+    <glyph glyph-name="bar_chart" unicode="&#xf080;" horiz-adv-x="2048" 
+d="M640 640v-512h-256v512h256zM1024 1152v-1024h-256v1024h256zM2048 0v-128h-2048v1536h128v-1408h1920zM1408 896v-768h-256v768h256zM1792 1280v-1152h-256v1152h256z" />
+    <glyph glyph-name="twitter_sign" unicode="&#xf081;" 
+d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4
+q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5
+t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="facebook_sign" unicode="&#xf082;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-188v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-532q-119 0 -203.5 84.5t-84.5 203.5v960
+q0 119 84.5 203.5t203.5 84.5h960z" />
+    <glyph glyph-name="camera_retro" unicode="&#xf083;" horiz-adv-x="1792" 
+d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5
+t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280
+q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="key" unicode="&#xf084;" horiz-adv-x="1792" 
+d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26
+l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5
+t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" />
+    <glyph glyph-name="cogs" unicode="&#xf085;" horiz-adv-x="1920" 
+d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5
+t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -11 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5
+l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7
+l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -8 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31
+q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20
+t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68
+q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70
+q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" />
+    <glyph glyph-name="comments" unicode="&#xf086;" horiz-adv-x="1792" 
+d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224
+q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7
+q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" />
+    <glyph glyph-name="thumbs_up_alt" unicode="&#xf087;" 
+d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5
+t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769
+q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128
+q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" />
+    <glyph glyph-name="thumbs_down_alt" unicode="&#xf088;" 
+d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 31 18 69q0 37 -17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5
+t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z
+M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5
+h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -73 49 -163z" />
+    <glyph glyph-name="star_half" unicode="&#xf089;" horiz-adv-x="896" 
+d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" />
+    <glyph glyph-name="heart_empty" unicode="&#xf08a;" horiz-adv-x="1792" 
+d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559
+q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5
+q224 0 351 -124t127 -344z" />
+    <glyph glyph-name="signout" unicode="&#xf08b;" horiz-adv-x="1664" 
+d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704
+q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" />
+    <glyph glyph-name="linkedin_sign" unicode="&#xf08c;" 
+d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5
+q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="pushpin" unicode="&#xf08d;" horiz-adv-x="1152" 
+d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38
+t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" />
+    <glyph glyph-name="external_link" unicode="&#xf08e;" horiz-adv-x="1792" 
+d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320
+q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="signin" unicode="&#xf090;" 
+d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5
+q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="trophy" unicode="&#xf091;" horiz-adv-x="1664" 
+d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91
+t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96
+q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="github_sign" unicode="&#xf092;" 
+d="M519 336q4 6 -3 13q-9 7 -14 2q-4 -6 3 -13q9 -7 14 -2zM491 377q-5 7 -12 4q-6 -4 0 -12q7 -8 12 -5q6 4 0 13zM450 417q2 4 -5 8q-7 2 -8 -2q-3 -5 4 -8q8 -2 9 2zM471 394q2 1 1.5 4.5t-3.5 5.5q-6 7 -10 3t1 -11q6 -6 11 -2zM557 319q2 7 -9 11q-9 3 -13 -4
+q-2 -7 9 -11q9 -3 13 4zM599 316q0 8 -12 8q-10 0 -10 -8t11 -8t11 8zM638 323q-2 7 -13 5t-9 -9q2 -8 12 -6t10 10zM1280 640q0 212 -150 362t-362 150t-362 -150t-150 -362q0 -167 98 -300.5t252 -185.5q18 -3 26.5 5t8.5 20q0 52 -1 95q-6 -1 -15.5 -2.5t-35.5 -2t-48 4
+t-43.5 20t-29.5 41.5q-23 59 -57 74q-2 1 -4.5 3.5l-8 8t-7 9.5t4 7.5t19.5 3.5q6 0 15 -2t30 -15.5t33 -35.5q16 -28 37.5 -42t43.5 -14t38 3.5t30 9.5q7 47 33 69q-49 6 -86 18.5t-73 39t-55.5 76t-19.5 119.5q0 79 53 137q-24 62 5 136q19 6 54.5 -7.5t60.5 -29.5l26 -16
+q58 17 128 17t128 -17q11 7 28.5 18t55.5 26t57 9q29 -74 5 -136q53 -58 53 -137q0 -57 -14 -100.5t-35.5 -70t-53.5 -44.5t-62.5 -26t-68.5 -12q35 -31 35 -95q0 -40 -0.5 -89t-0.5 -51q0 -12 8.5 -20t26.5 -5q154 52 252 185.5t98 300.5zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="upload_alt" unicode="&#xf093;" horiz-adv-x="1664" 
+d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92
+t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" />
+    <glyph glyph-name="lemon" unicode="&#xf094;" 
+d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5
+q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44
+q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5
+q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -13 2 -25t3.5 -16.5t7.5 -20.5t8 -20q16 -40 25 -118.5t9 -136.5z" />
+    <glyph glyph-name="phone" unicode="&#xf095;" horiz-adv-x="1408" 
+d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -53 3.5t-57.5 12.5t-47 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-127 79 -264 216t-216 264q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47t-12.5 57.5t-3.5 53q0 92 51 186
+q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174q2 -1 19 -11.5t24 -14
+t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" />
+    <glyph glyph-name="check_empty" unicode="&#xf096;" horiz-adv-x="1408" 
+d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832
+q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="bookmark_empty" unicode="&#xf097;" horiz-adv-x="1280" 
+d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289
+q0 34 19.5 62t52.5 41q21 9 44 9h1048z" />
+    <glyph glyph-name="phone_sign" unicode="&#xf098;" 
+d="M1280 343q0 11 -2 16t-18 16.5t-40.5 25t-47.5 26.5t-45.5 25t-28.5 15q-5 3 -19 13t-25 15t-21 5q-15 0 -36.5 -20.5t-39.5 -45t-38.5 -45t-33.5 -20.5q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170 126.5t-127 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5
+t-3.5 16.5q0 13 20.5 33.5t45 38.5t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5
+t320.5 -216.5q6 -2 30 -11t33 -12.5t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z
+" />
+    <glyph glyph-name="twitter" unicode="&#xf099;" horiz-adv-x="1664" 
+d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41
+q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" />
+    <glyph glyph-name="facebook" unicode="&#xf09a;" horiz-adv-x="1024" 
+d="M959 1524v-264h-157q-86 0 -116 -36t-30 -108v-189h293l-39 -296h-254v-759h-306v759h-255v296h255v218q0 186 104 288.5t277 102.5q147 0 228 -12z" />
+    <glyph glyph-name="github" unicode="&#xf09b;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -40 7t-13 30q0 3 0.5 76.5t0.5 134.5q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 119 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24
+q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-85 13.5q-45 -113 -8 -204q-79 -87 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-39 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5
+t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -88.5t0.5 -54.5q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103zM291 305q3 7 -7 12
+q-10 3 -13 -2q-3 -7 7 -12q9 -6 13 2zM322 271q7 5 -2 16q-10 9 -16 3q-7 -5 2 -16q10 -10 16 -3zM352 226q9 7 0 19q-8 13 -17 6q-9 -5 0 -18t17 -7zM394 184q8 8 -4 19q-12 12 -20 3q-9 -8 4 -19q12 -12 20 -3zM451 159q3 11 -13 16q-15 4 -19 -7t13 -15q15 -6 19 6z
+M514 154q0 13 -17 11q-16 0 -16 -11q0 -13 17 -11q16 0 16 11zM572 164q-2 11 -18 9q-16 -3 -14 -15t18 -8t14 14z" />
+    <glyph glyph-name="unlock" unicode="&#xf09c;" horiz-adv-x="1664" 
+d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5
+t316.5 -131.5t131.5 -316.5z" />
+    <glyph glyph-name="credit_card" unicode="&#xf09d;" horiz-adv-x="1920" 
+d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608
+q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" />
+    <glyph glyph-name="rss" unicode="&#xf09e;" horiz-adv-x="1408" 
+d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5
+t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294
+q187 -186 294 -425.5t120 -501.5z" />
+    <glyph glyph-name="hdd" unicode="&#xf0a0;" 
+d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5
+h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75
+l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" />
+    <glyph glyph-name="bullhorn" unicode="&#xf0a1;" horiz-adv-x="1792" 
+d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5
+t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" />
+    <glyph glyph-name="bell" unicode="&#xf0a2;" horiz-adv-x="1792" 
+d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM246 128h1300q-266 300 -266 832q0 51 -24 105t-69 103t-121.5 80.5t-169.5 31.5t-169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -532 -266 -832z
+M1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5
+t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" />
+    <glyph glyph-name="certificate" unicode="&#xf0a3;" 
+d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70
+l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70
+l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" />
+    <glyph glyph-name="hand_right" unicode="&#xf0a4;" horiz-adv-x="1792" 
+d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106
+q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43
+q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5
+t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" />
+    <glyph glyph-name="hand_left" unicode="&#xf0a5;" horiz-adv-x="1792" 
+d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-8 9 -12 14q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576q-50 0 -89 -38.5
+t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45z
+M1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128q0 122 81.5 189t206.5 67
+q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="hand_up" unicode="&#xf0a6;" 
+d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576
+q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5
+t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76
+q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" />
+    <glyph glyph-name="hand_down" unicode="&#xf0a7;" 
+d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33
+t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580
+q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100
+q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" />
+    <glyph glyph-name="circle_arrow_left" unicode="&#xf0a8;" 
+d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="circle_arrow_right" unicode="&#xf0a9;" 
+d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="circle_arrow_up" unicode="&#xf0aa;" 
+d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="circle_arrow_down" unicode="&#xf0ab;" 
+d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="globe" unicode="&#xf0ac;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11
+q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 11t-9.5 10q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5
+q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5
+q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5
+t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-4 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3
+q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25
+q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5
+t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5
+t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10.5t17 -19.5q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21
+q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5
+q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3
+q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5
+t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q8 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5
+q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7
+q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" />
+    <glyph glyph-name="wrench" unicode="&#xf0ad;" horiz-adv-x="1664" 
+d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5
+t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" />
+    <glyph glyph-name="tasks" unicode="&#xf0ae;" horiz-adv-x="1792" 
+d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19
+t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="filter" unicode="&#xf0b0;" horiz-adv-x="1408" 
+d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" />
+    <glyph glyph-name="briefcase" unicode="&#xf0b1;" horiz-adv-x="1792" 
+d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68
+t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="fullscreen" unicode="&#xf0b2;" 
+d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144
+l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z
+" />
+    <glyph glyph-name="group" unicode="&#xf0c0;" horiz-adv-x="1920" 
+d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5
+t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75
+t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5
+t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" />
+    <glyph glyph-name="link" unicode="&#xf0c1;" horiz-adv-x="1664" 
+d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26
+l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15
+t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207
+q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" />
+    <glyph glyph-name="cloud" unicode="&#xf0c2;" horiz-adv-x="1920" 
+d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z
+" />
+    <glyph glyph-name="beaker" unicode="&#xf0c3;" horiz-adv-x="1664" 
+d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" />
+    <glyph glyph-name="cut" unicode="&#xf0c4;" horiz-adv-x="1792" 
+d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84
+q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148
+q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108
+q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6
+q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" />
+    <glyph glyph-name="copy" unicode="&#xf0c5;" horiz-adv-x="1792" 
+d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299
+h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" />
+    <glyph glyph-name="paper_clip" unicode="&#xf0c6;" horiz-adv-x="1408" 
+d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181
+l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235
+z" />
+    <glyph glyph-name="save" unicode="&#xf0c7;" 
+d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5
+h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" />
+    <glyph glyph-name="sign_blank" unicode="&#xf0c8;" 
+d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="reorder" unicode="&#xf0c9;" 
+d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45
+t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="ul" unicode="&#xf0ca;" horiz-adv-x="1792" 
+d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5
+t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z
+M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="ol" unicode="&#xf0cb;" horiz-adv-x="1792" 
+d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362
+q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5
+t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 121.5t0.5 121.5v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216
+q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" />
+    <glyph glyph-name="strikethrough" unicode="&#xf0cc;" horiz-adv-x="1792" 
+d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 98 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6
+l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -56 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23
+l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" />
+    <glyph glyph-name="underline" unicode="&#xf0cd;" 
+d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47
+q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41
+q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472
+q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" />
+    <glyph glyph-name="table" unicode="&#xf0ce;" horiz-adv-x="1664" 
+d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23
+v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192
+q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192
+q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113
+z" />
+    <glyph glyph-name="magic" unicode="&#xf0d0;" horiz-adv-x="1664" 
+d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276
+l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" />
+    <glyph glyph-name="truck" unicode="&#xf0d1;" horiz-adv-x="1792" 
+d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5
+t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38
+t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="pinterest" unicode="&#xf0d2;" 
+d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134
+q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33
+q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="pinterest_sign" unicode="&#xf0d3;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5
+t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5
+t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" />
+    <glyph glyph-name="google_plus_sign" unicode="&#xf0d4;" 
+d="M917 631q0 26 -6 64h-362v-132h217q-3 -24 -16.5 -50t-37.5 -53t-66.5 -44.5t-96.5 -17.5q-99 0 -169 71t-70 171t70 171t169 71q92 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585
+h109v110h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="google_plus" unicode="&#xf0d5;" horiz-adv-x="2304" 
+d="M1437 623q0 -208 -87 -370.5t-248 -254t-369 -91.5q-149 0 -285 58t-234 156t-156 234t-58 285t58 285t156 234t234 156t285 58q286 0 491 -192l-199 -191q-117 113 -292 113q-123 0 -227.5 -62t-165.5 -168.5t-61 -232.5t61 -232.5t165.5 -168.5t227.5 -62
+q83 0 152.5 23t114.5 57.5t78.5 78.5t49 83t21.5 74h-416v252h692q12 -63 12 -122zM2304 745v-210h-209v-209h-210v209h-209v210h209v209h210v-209h209z" />
+    <glyph glyph-name="money" unicode="&#xf0d6;" horiz-adv-x="1920" 
+d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384
+v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="caret_down" unicode="&#xf0d7;" horiz-adv-x="1024" 
+d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="caret_up" unicode="&#xf0d8;" horiz-adv-x="1024" 
+d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="caret_left" unicode="&#xf0d9;" horiz-adv-x="640" 
+d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" />
+    <glyph glyph-name="caret_right" unicode="&#xf0da;" horiz-adv-x="640" 
+d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="columns" unicode="&#xf0db;" horiz-adv-x="1664" 
+d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="sort" unicode="&#xf0dc;" horiz-adv-x="1024" 
+d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="sort_down" unicode="&#xf0dd;" horiz-adv-x="1024" 
+d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="sort_up" unicode="&#xf0de;" horiz-adv-x="1024" 
+d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" />
+    <glyph glyph-name="envelope_alt" unicode="&#xf0e0;" horiz-adv-x="1792" 
+d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123
+q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" />
+    <glyph glyph-name="linkedin" unicode="&#xf0e1;" 
+d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329
+q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" />
+    <glyph glyph-name="undo" unicode="&#xf0e2;" 
+d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5
+t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" />
+    <glyph glyph-name="legal" unicode="&#xf0e3;" horiz-adv-x="1792" 
+d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5
+t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14
+q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28
+q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" />
+    <glyph glyph-name="dashboard" unicode="&#xf0e4;" horiz-adv-x="1792" 
+d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5
+t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5
+t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29
+q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="comment_alt" unicode="&#xf0e5;" horiz-adv-x="1792" 
+d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640
+q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5
+t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
+    <glyph glyph-name="comments_alt" unicode="&#xf0e6;" horiz-adv-x="1792" 
+d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257
+t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5
+t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129
+q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" />
+    <glyph glyph-name="bolt" unicode="&#xf0e7;" horiz-adv-x="896" 
+d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" />
+    <glyph glyph-name="sitemap" unicode="&#xf0e8;" horiz-adv-x="1792" 
+d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320
+q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68
+z" />
+    <glyph glyph-name="umbrella" unicode="&#xf0e9;" horiz-adv-x="1664" 
+d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97
+q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69
+q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" />
+    <glyph glyph-name="paste" unicode="&#xf0ea;" horiz-adv-x="1792" 
+d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28
+h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" />
+    <glyph glyph-name="light_bulb" unicode="&#xf0eb;" horiz-adv-x="1024" 
+d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134
+q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47
+q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5
+t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" />
+    <glyph glyph-name="exchange" unicode="&#xf0ec;" horiz-adv-x="1792" 
+d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9
+q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" />
+    <glyph glyph-name="cloud_download" unicode="&#xf0ed;" horiz-adv-x="1920" 
+d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088
+q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
+    <glyph glyph-name="cloud_upload" unicode="&#xf0ee;" horiz-adv-x="1920" 
+d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088
+q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" />
+    <glyph glyph-name="user_md" unicode="&#xf0f0;" horiz-adv-x="1408" 
+d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56
+t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68
+t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5
+t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="stethoscope" unicode="&#xf0f1;" horiz-adv-x="1408" 
+d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48
+t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252
+t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" />
+    <glyph glyph-name="suitcase" unicode="&#xf0f2;" horiz-adv-x="1792" 
+d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66
+t66 -158z" />
+    <glyph glyph-name="bell_alt" unicode="&#xf0f3;" horiz-adv-x="1792" 
+d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5
+t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" />
+    <glyph glyph-name="coffee" unicode="&#xf0f4;" horiz-adv-x="1920" 
+d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45
+t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="food" unicode="&#xf0f5;" horiz-adv-x="1408" 
+d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45
+t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="file_text_alt" unicode="&#xf0f6;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M384 736q0 14 9 23t23 9h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64zM1120 512q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704zM1120 256q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704
+q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704z" />
+    <glyph glyph-name="building" unicode="&#xf0f7;" horiz-adv-x="1408" 
+d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="hospital" unicode="&#xf0f8;" horiz-adv-x="1408" 
+d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z
+M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5
+t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320
+v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="ambulance" unicode="&#xf0f9;" horiz-adv-x="1920" 
+d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5
+t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152
+q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="medkit" unicode="&#xf0fa;" horiz-adv-x="1792" 
+d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32
+q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="fighter_jet" unicode="&#xf0fb;" horiz-adv-x="1920" 
+d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96
+q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q128 -28 200 -52t80 -34z" />
+    <glyph glyph-name="beer" unicode="&#xf0fc;" horiz-adv-x="1664" 
+d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" />
+    <glyph glyph-name="h_sign" unicode="&#xf0fd;" 
+d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="f0fe" unicode="&#xf0fe;" 
+d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="double_angle_left" unicode="&#xf100;" horiz-adv-x="1024" 
+d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23
+t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" />
+    <glyph glyph-name="double_angle_right" unicode="&#xf101;" horiz-adv-x="1024" 
+d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23
+l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="double_angle_up" unicode="&#xf102;" horiz-adv-x="1152" 
+d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393
+q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="double_angle_down" unicode="&#xf103;" horiz-adv-x="1152" 
+d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23
+t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
+    <glyph glyph-name="angle_left" unicode="&#xf104;" horiz-adv-x="640" 
+d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
+    <glyph glyph-name="angle_right" unicode="&#xf105;" horiz-adv-x="640" 
+d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="angle_up" unicode="&#xf106;" horiz-adv-x="1152" 
+d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" />
+    <glyph glyph-name="angle_down" unicode="&#xf107;" horiz-adv-x="1152" 
+d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" />
+    <glyph glyph-name="desktop" unicode="&#xf108;" horiz-adv-x="1920" 
+d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19
+t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="laptop" unicode="&#xf109;" horiz-adv-x="1920" 
+d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z
+M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" />
+    <glyph glyph-name="tablet" unicode="&#xf10a;" horiz-adv-x="1152" 
+d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832
+q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="mobile_phone" unicode="&#xf10b;" horiz-adv-x="768" 
+d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136
+q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="circle_blank" unicode="&#xf10c;" 
+d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103
+t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="quote_left" unicode="&#xf10d;" horiz-adv-x="1664" 
+d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z
+M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" />
+    <glyph glyph-name="quote_right" unicode="&#xf10e;" horiz-adv-x="1664" 
+d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216
+v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" />
+    <glyph glyph-name="spinner" unicode="&#xf110;" horiz-adv-x="1792" 
+d="M526 142q0 -53 -37.5 -90.5t-90.5 -37.5q-52 0 -90 38t-38 90q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 -64q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -53 -37.5 -90.5t-90.5 -37.5
+t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1522 142q0 -52 -38 -90t-90 -38q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM558 1138q0 -66 -47 -113t-113 -47t-113 47t-47 113t47 113t113 47t113 -47t47 -113z
+M1728 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1088 1344q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1618 1138q0 -93 -66 -158.5t-158 -65.5q-93 0 -158.5 65.5t-65.5 158.5
+q0 92 65.5 158t158.5 66q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="circle" unicode="&#xf111;" 
+d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="reply" unicode="&#xf112;" horiz-adv-x="1792" 
+d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19
+l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" />
+    <glyph glyph-name="github_alt" unicode="&#xf113;" horiz-adv-x="1664" 
+d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320
+q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86
+t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218
+q0 -87 -27 -168q136 -160 136 -398z" />
+    <glyph glyph-name="folder_close_alt" unicode="&#xf114;" horiz-adv-x="1664" 
+d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320
+q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" />
+    <glyph glyph-name="folder_open_alt" unicode="&#xf115;" horiz-adv-x="1920" 
+d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68
+v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z
+" />
+    <glyph glyph-name="expand_alt" unicode="&#xf116;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="collapse_alt" unicode="&#xf117;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="smile" unicode="&#xf118;" 
+d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5
+t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5
+t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="frown" unicode="&#xf119;" 
+d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5
+t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204
+t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="meh" unicode="&#xf11a;" 
+d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5
+t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="gamepad" unicode="&#xf11b;" horiz-adv-x="1920" 
+d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5
+t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150
+t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" />
+    <glyph glyph-name="keyboard" unicode="&#xf11c;" horiz-adv-x="1920" 
+d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16
+h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16
+h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96
+q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896
+h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="flag_alt" unicode="&#xf11d;" horiz-adv-x="1792" 
+d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9
+h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102
+q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
+    <glyph glyph-name="flag_checkered" unicode="&#xf11e;" horiz-adv-x="1792" 
+d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2
+q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266
+q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8
+q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" />
+    <glyph glyph-name="terminal" unicode="&#xf120;" horiz-adv-x="1664" 
+d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9
+t9 -23z" />
+    <glyph glyph-name="code" unicode="&#xf121;" horiz-adv-x="1920" 
+d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5
+l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" />
+    <glyph glyph-name="reply_all" unicode="&#xf122;" horiz-adv-x="1792" 
+d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1
+q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" />
+    <glyph glyph-name="star_half_empty" unicode="&#xf123;" horiz-adv-x="1664" 
+d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5
+l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" />
+    <glyph glyph-name="location_arrow" unicode="&#xf124;" horiz-adv-x="1408" 
+d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" />
+    <glyph glyph-name="crop" unicode="&#xf125;" horiz-adv-x="1664" 
+d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23
+v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="code_fork" unicode="&#xf126;" horiz-adv-x="1024" 
+d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5
+q-2 -287 -226 -414q-67 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497
+q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" />
+    <glyph glyph-name="unlink" unicode="&#xf127;" horiz-adv-x="1664" 
+d="M439 265l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320
+q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18
+l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9
+t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
+    <glyph glyph-name="question" unicode="&#xf128;" horiz-adv-x="1024" 
+d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5
+t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" />
+    <glyph glyph-name="_279" unicode="&#xf129;" horiz-adv-x="640" 
+d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192
+q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="exclamation" unicode="&#xf12a;" horiz-adv-x="640" 
+d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" />
+    <glyph glyph-name="superscript" unicode="&#xf12b;" 
+d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3q-1 -3 -2.5 -6.5t-3.5 -8t-3 -6.5q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109z
+M1534 846v-206h-514l-3 27q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5
+t-65.5 -51.5t-30.5 -63h232v80h126z" />
+    <glyph glyph-name="subscript" unicode="&#xf12c;" 
+d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3q-1 -3 -2.5 -6.5t-3.5 -8t-3 -6.5q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109z
+M1536 -50v-206h-514l-4 27q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73
+h232v80h126z" />
+    <glyph glyph-name="_283" unicode="&#xf12d;" horiz-adv-x="1920" 
+d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" />
+    <glyph glyph-name="puzzle_piece" unicode="&#xf12e;" horiz-adv-x="1664" 
+d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5
+t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89
+q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117
+q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" />
+    <glyph glyph-name="microphone" unicode="&#xf130;" horiz-adv-x="1152" 
+d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5
+t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" />
+    <glyph glyph-name="microphone_off" unicode="&#xf131;" horiz-adv-x="1408" 
+d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128
+q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23
+t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" />
+    <glyph glyph-name="shield" unicode="&#xf132;" horiz-adv-x="1280" 
+d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150
+t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="calendar_empty" unicode="&#xf133;" horiz-adv-x="1664" 
+d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280
+q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="fire_extinguisher" unicode="&#xf134;" horiz-adv-x="1408" 
+d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800
+q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113
+q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" />
+    <glyph glyph-name="rocket" unicode="&#xf135;" horiz-adv-x="1664" 
+d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1
+q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" />
+    <glyph glyph-name="maxcdn" unicode="&#xf136;" horiz-adv-x="1792" 
+d="M1745 763l-164 -763h-334l178 832q13 56 -15 88q-27 33 -83 33h-169l-204 -953h-334l204 953h-286l-204 -953h-334l204 953l-153 327h1276q101 0 189.5 -40.5t147.5 -113.5q60 -73 81 -168.5t0 -194.5z" />
+    <glyph glyph-name="chevron_sign_left" unicode="&#xf137;" 
+d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="chevron_sign_right" unicode="&#xf138;" 
+d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="chevron_sign_up" unicode="&#xf139;" 
+d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="chevron_sign_down" unicode="&#xf13a;" 
+d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5
+t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="html5" unicode="&#xf13b;" horiz-adv-x="1408" 
+d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" />
+    <glyph glyph-name="css3" unicode="&#xf13c;" horiz-adv-x="1792" 
+d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" />
+    <glyph glyph-name="anchor" unicode="&#xf13d;" horiz-adv-x="1792" 
+d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-12 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352
+q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19
+t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="unlock_alt" unicode="&#xf13e;" horiz-adv-x="1152" 
+d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181
+v-320h736z" />
+    <glyph glyph-name="bullseye" unicode="&#xf140;" 
+d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150
+t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640
+q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="ellipsis_horizontal" unicode="&#xf141;" horiz-adv-x="1408" 
+d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="ellipsis_vertical" unicode="&#xf142;" horiz-adv-x="384" 
+d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192
+q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" />
+    <glyph glyph-name="_303" unicode="&#xf143;" 
+d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 233 -176.5 396.5t-396.5 176.5q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128
+q13 0 23 10t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="play_sign" unicode="&#xf144;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56
+q16 -8 32 -8q17 0 32 9z" />
+    <glyph glyph-name="ticket" unicode="&#xf145;" horiz-adv-x="1792" 
+d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136
+t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" />
+    <glyph glyph-name="minus_sign_alt" unicode="&#xf146;" 
+d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5
+t84.5 -203.5z" />
+    <glyph glyph-name="check_minus" unicode="&#xf147;" horiz-adv-x="1408" 
+d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5
+t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="level_up" unicode="&#xf148;" horiz-adv-x="1024" 
+d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" />
+    <glyph glyph-name="level_down" unicode="&#xf149;" horiz-adv-x="1024" 
+d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" />
+    <glyph glyph-name="check_sign" unicode="&#xf14a;" 
+d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5
+t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="edit_sign" unicode="&#xf14b;" 
+d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120
+v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_312" unicode="&#xf14c;" 
+d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960
+q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="share_sign" unicode="&#xf14d;" 
+d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q11 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5
+t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="compass" unicode="&#xf14e;" 
+d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="collapse" unicode="&#xf150;" 
+d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120
+v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="collapse_top" unicode="&#xf151;" 
+d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_317" unicode="&#xf152;" 
+d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5
+t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="eur" unicode="&#xf153;" horiz-adv-x="1024" 
+d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9
+t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26
+l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" />
+    <glyph glyph-name="gbp" unicode="&#xf154;" horiz-adv-x="1024" 
+d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7
+q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" />
+    <glyph glyph-name="usd" unicode="&#xf155;" horiz-adv-x="1024" 
+d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43
+t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5
+t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50
+t53 -63.5t31.5 -76.5t13 -94z" />
+    <glyph glyph-name="inr" unicode="&#xf156;" horiz-adv-x="898" 
+d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102
+q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="jpy" unicode="&#xf157;" horiz-adv-x="1027" 
+d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61
+l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" />
+    <glyph glyph-name="rub" unicode="&#xf158;" horiz-adv-x="1280" 
+d="M1043 971q0 100 -65 162t-171 62h-320v-448h320q106 0 171 62t65 162zM1280 971q0 -193 -126.5 -315t-326.5 -122h-340v-118h505q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-505v-192q0 -14 -9.5 -23t-22.5 -9h-167q-14 0 -23 9t-9 23v192h-224q-14 0 -23 9t-9 23v128
+q0 14 9 23t23 9h224v118h-224q-14 0 -23 9t-9 23v149q0 13 9 22.5t23 9.5h224v629q0 14 9 23t23 9h539q200 0 326.5 -122t126.5 -315z" />
+    <glyph glyph-name="krw" unicode="&#xf159;" horiz-adv-x="1792" 
+d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23
+t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28
+q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="btc" unicode="&#xf15a;" horiz-adv-x="1280" 
+d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164
+l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30
+t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" />
+    <glyph glyph-name="file" unicode="&#xf15b;" 
+d="M1024 1024v472q22 -14 36 -28l408 -408q14 -14 28 -36h-472zM896 992q0 -40 28 -68t68 -28h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544z" />
+    <glyph glyph-name="file_text" unicode="&#xf15c;" 
+d="M1468 1060q14 -14 28 -36h-472v472q22 -14 36 -28zM992 896h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544q0 -40 28 -68t68 -28zM1152 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704
+q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23z" />
+    <glyph glyph-name="sort_by_alphabet" unicode="&#xf15d;" horiz-adv-x="1664" 
+d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23
+v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162
+l230 -662h70z" />
+    <glyph glyph-name="_329" unicode="&#xf15e;" horiz-adv-x="1664" 
+d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150
+v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248
+v119h121z" />
+    <glyph glyph-name="sort_by_attributes" unicode="&#xf160;" horiz-adv-x="1792" 
+d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832
+q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256
+q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="sort_by_attributes_alt" unicode="&#xf161;" horiz-adv-x="1792" 
+d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192
+q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832
+q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="sort_by_order" unicode="&#xf162;" 
+d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23
+zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5
+t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" />
+    <glyph glyph-name="sort_by_order_alt" unicode="&#xf163;" 
+d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9
+t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13
+q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" />
+    <glyph glyph-name="_334" unicode="&#xf164;" horiz-adv-x="1664" 
+d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76
+q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5
+t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" />
+    <glyph glyph-name="_335" unicode="&#xf165;" horiz-adv-x="1664" 
+d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135
+t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121
+t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" />
+    <glyph glyph-name="youtube_sign" unicode="&#xf166;" 
+d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 17 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15
+q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38
+q21 -29 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5
+q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78q7 -23 23 -69l24 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38
+q-51 0 -78 -38q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5
+h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="youtube" unicode="&#xf167;" 
+d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73
+q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51
+q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99
+q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-38 -51 -106 -51q-67 0 -105 51
+q-28 38 -28 118v175q0 80 28 117q38 51 105 51q68 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" />
+    <glyph glyph-name="xing" unicode="&#xf168;" horiz-adv-x="1408" 
+d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942
+q25 45 64 45h241q22 0 31 -15z" />
+    <glyph glyph-name="xing_sign" unicode="&#xf169;" 
+d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1
+l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="youtube_play" unicode="&#xf16a;" horiz-adv-x="1792" 
+d="M711 408l484 250l-484 253v-503zM896 1270q168 0 324.5 -4.5t229.5 -9.5l73 -4q1 0 17 -1.5t23 -3t23.5 -4.5t28.5 -8t28 -13t31 -19.5t29 -26.5q6 -6 15.5 -18.5t29 -58.5t26.5 -101q8 -64 12.5 -136.5t5.5 -113.5v-40v-136q1 -145 -18 -290q-7 -55 -25 -99.5t-32 -61.5
+l-14 -17q-14 -15 -29 -26.5t-31 -19t-28 -12.5t-28.5 -8t-24 -4.5t-23 -3t-16.5 -1.5q-251 -19 -627 -19q-207 2 -359.5 6.5t-200.5 7.5l-49 4l-36 4q-36 5 -54.5 10t-51 21t-56.5 41q-6 6 -15.5 18.5t-29 58.5t-26.5 101q-8 64 -12.5 136.5t-5.5 113.5v40v136
+q-1 145 18 290q7 55 25 99.5t32 61.5l14 17q14 15 29 26.5t31 19.5t28 13t28.5 8t23.5 4.5t23 3t17 1.5q251 18 627 18z" />
+    <glyph glyph-name="dropbox" unicode="&#xf16b;" horiz-adv-x="1792" 
+d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" />
+    <glyph glyph-name="stackexchange" unicode="&#xf16c;" 
+d="M1289 -96h-1118v480h-160v-640h1438v640h-160v-480zM347 428l33 157l783 -165l-33 -156zM450 802l67 146l725 -339l-67 -145zM651 1158l102 123l614 -513l-102 -123zM1048 1536l477 -641l-128 -96l-477 641zM330 65v159h800v-159h-800z" />
+    <glyph glyph-name="instagram" unicode="&#xf16d;" 
+d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1162 640q0 -164 -115 -279t-279 -115t-279 115t-115 279t115 279t279 115t279 -115t115 -279zM1270 1050q0 -38 -27 -65t-65 -27t-65 27t-27 65t27 65t65 27t65 -27t27 -65zM768 1270
+q-7 0 -76.5 0.5t-105.5 0t-96.5 -3t-103 -10t-71.5 -18.5q-50 -20 -88 -58t-58 -88q-11 -29 -18.5 -71.5t-10 -103t-3 -96.5t0 -105.5t0.5 -76.5t-0.5 -76.5t0 -105.5t3 -96.5t10 -103t18.5 -71.5q20 -50 58 -88t88 -58q29 -11 71.5 -18.5t103 -10t96.5 -3t105.5 0t76.5 0.5
+t76.5 -0.5t105.5 0t96.5 3t103 10t71.5 18.5q50 20 88 58t58 88q11 29 18.5 71.5t10 103t3 96.5t0 105.5t-0.5 76.5t0.5 76.5t0 105.5t-3 96.5t-10 103t-18.5 71.5q-20 50 -58 88t-88 58q-29 11 -71.5 18.5t-103 10t-96.5 3t-105.5 0t-76.5 -0.5zM1536 640q0 -229 -5 -317
+q-10 -208 -124 -322t-322 -124q-88 -5 -317 -5t-317 5q-208 10 -322 124t-124 322q-5 88 -5 317t5 317q10 208 124 322t322 124q88 5 317 5t317 -5q208 -10 322 -124t124 -322q5 -88 5 -317z" />
+    <glyph glyph-name="flickr" unicode="&#xf16e;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150
+t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" />
+    <glyph glyph-name="adn" unicode="&#xf170;" 
+d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="f171" unicode="&#xf171;" horiz-adv-x="1408" 
+d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22
+t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18
+t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5
+t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" />
+    <glyph glyph-name="bitbucket_sign" unicode="&#xf172;" 
+d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5
+t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z
+M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120
+v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="tumblr" unicode="&#xf173;" horiz-adv-x="1024" 
+d="M944 207l80 -237q-23 -35 -111 -66t-177 -32q-104 -2 -190.5 26t-142.5 74t-95 106t-55.5 120t-16.5 118v544h-168v215q72 26 129 69.5t91 90t58 102t34 99t15 88.5q1 5 4.5 8.5t7.5 3.5h244v-424h333v-252h-334v-518q0 -30 6.5 -56t22.5 -52.5t49.5 -41.5t81.5 -14
+q78 2 134 29z" />
+    <glyph glyph-name="tumblr_sign" unicode="&#xf174;" 
+d="M1136 75l-62 183q-44 -22 -103 -22q-36 -1 -62 10.5t-38.5 31.5t-17.5 40.5t-5 43.5v398h257v194h-256v326h-188q-8 0 -9 -10q-5 -44 -17.5 -87t-39 -95t-77 -95t-118.5 -68v-165h130v-418q0 -57 21.5 -115t65 -111t121 -85.5t176.5 -30.5q69 1 136.5 25t85.5 50z
+M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="long_arrow_down" unicode="&#xf175;" horiz-adv-x="768" 
+d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" />
+    <glyph glyph-name="long_arrow_up" unicode="&#xf176;" horiz-adv-x="768" 
+d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" />
+    <glyph glyph-name="long_arrow_left" unicode="&#xf177;" horiz-adv-x="1792" 
+d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="long_arrow_right" unicode="&#xf178;" horiz-adv-x="1792" 
+d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" />
+    <glyph glyph-name="apple" unicode="&#xf179;" horiz-adv-x="1408" 
+d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q113 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65
+q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" />
+    <glyph glyph-name="windows" unicode="&#xf17a;" horiz-adv-x="1664" 
+d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" />
+    <glyph glyph-name="android" unicode="&#xf17b;" horiz-adv-x="1408" 
+d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30
+t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5
+h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" />
+    <glyph glyph-name="linux" unicode="&#xf17c;" 
+d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-10 -11 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z
+M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7
+q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15
+q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5
+t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19
+q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63
+q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18q-2 -1 -4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92
+q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152
+q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-6 0 -8 -2t0 -4
+t5 -3q14 -4 18 -31q0 -3 8 2q2 2 2 3zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5
+t-30 -18.5t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43
+q-19 4 -51 9.5t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49
+t-14 -48q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54
+q110 143 124 195q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5
+t-40.5 -33.5t-61 -14q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5
+t15.5 47.5q1 -31 8 -56.5t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" />
+    <glyph glyph-name="dribble" unicode="&#xf17d;" 
+d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81
+t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19
+q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -5 6.5 -17t7.5 -17q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6
+t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="skype" unicode="&#xf17e;" 
+d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5
+t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5
+q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80
+q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" />
+    <glyph glyph-name="foursquare" unicode="&#xf180;" horiz-adv-x="1280" 
+d="M1000 1102l37 194q5 23 -9 40t-35 17h-712q-23 0 -38.5 -17t-15.5 -37v-1101q0 -7 6 -1l291 352q23 26 38 33.5t48 7.5h239q22 0 37 14.5t18 29.5q24 130 37 191q4 21 -11.5 40t-36.5 19h-294q-29 0 -48 19t-19 48v42q0 29 19 47.5t48 18.5h346q18 0 35 13.5t20 29.5z
+M1227 1324q-15 -73 -53.5 -266.5t-69.5 -350t-35 -173.5q-6 -22 -9 -32.5t-14 -32.5t-24.5 -33t-38.5 -21t-58 -10h-271q-13 0 -22 -10q-8 -9 -426 -494q-22 -25 -58.5 -28.5t-48.5 5.5q-55 22 -55 98v1410q0 55 38 102.5t120 47.5h888q95 0 127 -53t10 -159zM1227 1324
+l-158 -790q4 17 35 173.5t69.5 350t53.5 266.5z" />
+    <glyph glyph-name="trello" unicode="&#xf181;" 
+d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408
+q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="female" unicode="&#xf182;" horiz-adv-x="1280" 
+d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43
+q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="male" unicode="&#xf183;" horiz-adv-x="1024" 
+d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z
+M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="gittip" unicode="&#xf184;" 
+d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="sun" unicode="&#xf185;" horiz-adv-x="1792" 
+d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4
+l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94
+q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" />
+    <glyph glyph-name="_366" unicode="&#xf186;" 
+d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61
+t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" />
+    <glyph glyph-name="archive" unicode="&#xf187;" horiz-adv-x="1792" 
+d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536
+q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="bug" unicode="&#xf188;" horiz-adv-x="1664" 
+d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207
+q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19
+t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" />
+    <glyph glyph-name="vk" unicode="&#xf189;" horiz-adv-x="1920" 
+d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-40 -51 -55 -72t-30.5 -49.5t-12 -42t13 -34.5t32.5 -43t57 -53q4 -2 5 -4q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58
+t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6
+q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q16 19 38 30q53 26 239 24
+q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2
+q39 5 64 -2.5t31 -16.5z" />
+    <glyph glyph-name="weibo" unicode="&#xf18a;" horiz-adv-x="1792" 
+d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12
+q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422
+q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178
+q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z
+M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" />
+    <glyph glyph-name="renren" unicode="&#xf18b;" 
+d="M1133 -34q-171 -94 -368 -94q-196 0 -367 94q138 87 235.5 211t131.5 268q35 -144 132.5 -268t235.5 -211zM638 1394v-485q0 -252 -126.5 -459.5t-330.5 -306.5q-181 215 -181 495q0 187 83.5 349.5t229.5 269.5t325 137zM1536 638q0 -280 -181 -495
+q-204 99 -330.5 306.5t-126.5 459.5v485q179 -30 325 -137t229.5 -269.5t83.5 -349.5z" />
+    <glyph glyph-name="_372" unicode="&#xf18c;" horiz-adv-x="1408" 
+d="M1402 433q-32 -80 -76 -138t-91 -88.5t-99 -46.5t-101.5 -14.5t-96.5 8.5t-86.5 22t-69.5 27.5t-46 22.5l-17 10q-113 -228 -289.5 -359.5t-384.5 -132.5q-19 0 -32 13t-13 32t13 31.5t32 12.5q173 1 322.5 107.5t251.5 294.5q-36 -14 -72 -23t-83 -13t-91 2.5t-93 28.5
+t-92 59t-84.5 100t-74.5 146q114 47 214 57t167.5 -7.5t124.5 -56.5t88.5 -77t56.5 -82q53 131 79 291q-7 -1 -18 -2.5t-46.5 -2.5t-69.5 0.5t-81.5 10t-88.5 23t-84 42.5t-75 65t-54.5 94.5t-28.5 127.5q70 28 133.5 36.5t112.5 -1t92 -30t73.5 -50t56 -61t42 -63t27.5 -56
+t16 -39.5l4 -16q12 122 12 195q-8 6 -21.5 16t-49 44.5t-63.5 71.5t-54 93t-33 112.5t12 127t70 138.5q73 -25 127.5 -61.5t84.5 -76.5t48 -85t20.5 -89t-0.5 -85.5t-13 -76.5t-19 -62t-17 -42l-7 -15q1 -4 1 -50t-1 -72q3 7 10 18.5t30.5 43t50.5 58t71 55.5t91.5 44.5
+t112 14.5t132.5 -24q-2 -78 -21.5 -141.5t-50 -104.5t-69.5 -71.5t-81.5 -45.5t-84.5 -24t-80 -9.5t-67.5 1t-46.5 4.5l-17 3q-23 -147 -73 -283q6 7 18 18.5t49.5 41t77.5 52.5t99.5 42t117.5 20t129 -23.5t137 -77.5z" />
+    <glyph glyph-name="stack_exchange" unicode="&#xf18d;" horiz-adv-x="1280" 
+d="M1259 283v-66q0 -85 -57.5 -144.5t-138.5 -59.5h-57l-260 -269v269h-529q-81 0 -138.5 59.5t-57.5 144.5v66h1238zM1259 609v-255h-1238v255h1238zM1259 937v-255h-1238v255h1238zM1259 1077v-67h-1238v67q0 84 57.5 143.5t138.5 59.5h846q81 0 138.5 -59.5t57.5 -143.5z
+" />
+    <glyph glyph-name="_374" unicode="&#xf18e;" 
+d="M1152 640q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198
+t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="arrow_circle_alt_left" unicode="&#xf190;" 
+d="M1152 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-192q0 -14 -9 -23t-23 -9q-12 0 -24 10l-319 319q-9 9 -9 23t9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h352q13 0 22.5 -9.5t9.5 -22.5zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198
+t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_376" unicode="&#xf191;" 
+d="M1024 960v-640q0 -26 -19 -45t-45 -19q-20 0 -37 12l-448 320q-27 19 -27 52t27 52l448 320q17 12 37 12q26 0 45 -19t19 -45zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5z
+M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="dot_circle_alt" unicode="&#xf192;" 
+d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5
+t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_378" unicode="&#xf193;" horiz-adv-x="1664" 
+d="M1023 349l102 -204q-58 -179 -210 -290t-339 -111q-156 0 -288.5 77.5t-210 210t-77.5 288.5q0 181 104.5 330t274.5 211l17 -131q-122 -54 -195 -165.5t-73 -244.5q0 -185 131.5 -316.5t316.5 -131.5q126 0 232.5 65t165 175.5t49.5 236.5zM1571 249l58 -114l-256 -128
+q-13 -7 -29 -7q-40 0 -57 35l-239 477h-472q-24 0 -42.5 16.5t-21.5 40.5l-96 779q-2 17 6 42q14 51 57 82.5t97 31.5q66 0 113 -47t47 -113q0 -69 -52 -117.5t-120 -41.5l37 -289h423v-128h-407l16 -128h455q40 0 57 -35l228 -455z" />
+    <glyph glyph-name="vimeo_square" unicode="&#xf194;" 
+d="M1292 898q10 216 -161 222q-231 8 -312 -261q44 19 82 19q85 0 74 -96q-4 -57 -74 -167t-105 -110q-43 0 -82 169q-13 54 -45 255q-30 189 -160 177q-59 -7 -164 -100l-81 -72l-81 -72l52 -67q76 52 87 52q57 0 107 -179q15 -55 45 -164.5t45 -164.5q68 -179 164 -179
+q157 0 383 294q220 283 226 444zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_380" unicode="&#xf195;" horiz-adv-x="1152" 
+d="M1152 704q0 -191 -94.5 -353t-256.5 -256.5t-353 -94.5h-160q-14 0 -23 9t-9 23v611l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v93l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v250q0 14 9 23t23 9h160
+q14 0 23 -9t9 -23v-181l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-93l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-487q188 13 318 151t130 328q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="plus_square_o" unicode="&#xf196;" horiz-adv-x="1408" 
+d="M1152 736v-64q0 -14 -9 -23t-23 -9h-352v-352q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v352h-352q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h352v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-352h352q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832
+q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_382" unicode="&#xf197;" horiz-adv-x="2176" 
+d="M620 416q-110 -64 -268 -64h-128v64h-64q-13 0 -22.5 23.5t-9.5 56.5q0 24 7 49q-58 2 -96.5 10.5t-38.5 20.5t38.5 20.5t96.5 10.5q-7 25 -7 49q0 33 9.5 56.5t22.5 23.5h64v64h128q158 0 268 -64h1113q42 -7 106.5 -18t80.5 -14q89 -15 150 -40.5t83.5 -47.5t22.5 -40
+t-22.5 -40t-83.5 -47.5t-150 -40.5q-16 -3 -80.5 -14t-106.5 -18h-1113zM1739 668q53 -36 53 -92t-53 -92l81 -30q68 48 68 122t-68 122zM625 400h1015q-217 -38 -456 -80q-57 0 -113 -24t-83 -48l-28 -24l-288 -288q-26 -26 -70.5 -45t-89.5 -19h-96l-93 464h29
+q157 0 273 64zM352 816h-29l93 464h96q46 0 90 -19t70 -45l288 -288q4 -4 11 -10.5t30.5 -23t48.5 -29t61.5 -23t72.5 -10.5l456 -80h-1015q-116 64 -273 64z" />
+    <glyph glyph-name="_383" unicode="&#xf198;" horiz-adv-x="1664" 
+d="M1519 760q62 0 103.5 -40.5t41.5 -101.5q0 -97 -93 -130l-172 -59l56 -167q7 -21 7 -47q0 -59 -42 -102t-101 -43q-47 0 -85.5 27t-53.5 72l-55 165l-310 -106l55 -164q8 -24 8 -47q0 -59 -42 -102t-102 -43q-47 0 -85 27t-53 72l-55 163l-153 -53q-29 -9 -50 -9
+q-61 0 -101.5 40t-40.5 101q0 47 27.5 85t71.5 53l156 53l-105 313l-156 -54q-26 -8 -48 -8q-60 0 -101 40.5t-41 100.5q0 47 27.5 85t71.5 53l157 53l-53 159q-8 24 -8 47q0 60 42 102.5t102 42.5q47 0 85 -27t53 -72l54 -160l310 105l-54 160q-8 24 -8 47q0 59 42.5 102
+t101.5 43q47 0 85.5 -27.5t53.5 -71.5l53 -161l162 55q21 6 43 6q60 0 102.5 -39.5t42.5 -98.5q0 -45 -30 -81.5t-74 -51.5l-157 -54l105 -316l164 56q24 8 46 8zM725 498l310 105l-105 315l-310 -107z" />
+    <glyph glyph-name="_384" unicode="&#xf199;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM1280 352v436q-31 -35 -64 -55q-34 -22 -132.5 -85t-151.5 -99q-98 -69 -164 -69v0v0q-66 0 -164 69
+q-47 32 -142 92.5t-142 92.5q-12 8 -33 27t-31 27v-436q0 -40 28 -68t68 -28h832q40 0 68 28t28 68zM1280 925q0 41 -27.5 70t-68.5 29h-832q-40 0 -68 -28t-28 -68q0 -37 30.5 -76.5t67.5 -64.5q47 -32 137.5 -89t129.5 -83q3 -2 17 -11.5t21 -14t21 -13t23.5 -13
+t21.5 -9.5t22.5 -7.5t20.5 -2.5t20.5 2.5t22.5 7.5t21.5 9.5t23.5 13t21 13t21 14t17 11.5l267 174q35 23 66.5 62.5t31.5 73.5z" />
+    <glyph glyph-name="_385" unicode="&#xf19a;" horiz-adv-x="1792" 
+d="M127 640q0 163 67 313l367 -1005q-196 95 -315 281t-119 411zM1415 679q0 -19 -2.5 -38.5t-10 -49.5t-11.5 -44t-17.5 -59t-17.5 -58l-76 -256l-278 826q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-75 1 -202 10q-12 1 -20.5 -5t-11.5 -15t-1.5 -18.5t9 -16.5
+t19.5 -8l80 -8l120 -328l-168 -504l-280 832q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-7 0 -23 0.5t-26 0.5q105 160 274.5 253.5t367.5 93.5q147 0 280.5 -53t238.5 -149h-10q-55 0 -92 -40.5t-37 -95.5q0 -12 2 -24t4 -21.5t8 -23t9 -21t12 -22.5t12.5 -21
+t14.5 -24t14 -23q63 -107 63 -212zM909 573l237 -647q1 -6 5 -11q-126 -44 -255 -44q-112 0 -217 32zM1570 1009q95 -174 95 -369q0 -209 -104 -385.5t-279 -278.5l235 678q59 169 59 276q0 42 -6 79zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286
+t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 -215q173 0 331.5 68t273 182.5t182.5 273t68 331.5t-68 331.5t-182.5 273t-273 182.5t-331.5 68t-331.5 -68t-273 -182.5t-182.5 -273t-68 -331.5t68 -331.5t182.5 -273
+t273 -182.5t331.5 -68z" />
+    <glyph glyph-name="_386" unicode="&#xf19b;" horiz-adv-x="1792" 
+d="M1086 1536v-1536l-272 -128q-228 20 -414 102t-293 208.5t-107 272.5q0 140 100.5 263.5t275 205.5t391.5 108v-172q-217 -38 -356.5 -150t-139.5 -255q0 -152 154.5 -267t388.5 -145v1360zM1755 954l37 -390l-525 114l147 83q-119 70 -280 99v172q277 -33 481 -157z" />
+    <glyph glyph-name="_387" unicode="&#xf19c;" horiz-adv-x="2048" 
+d="M960 1536l960 -384v-128h-128q0 -26 -20.5 -45t-48.5 -19h-1526q-28 0 -48.5 19t-20.5 45h-128v128zM256 896h256v-768h128v768h256v-768h128v768h256v-768h128v768h256v-768h59q28 0 48.5 -19t20.5 -45v-64h-1664v64q0 26 20.5 45t48.5 19h59v768zM1851 -64
+q28 0 48.5 -19t20.5 -45v-128h-1920v128q0 26 20.5 45t48.5 19h1782z" />
+    <glyph glyph-name="_388" unicode="&#xf19d;" horiz-adv-x="2304" 
+d="M1774 700l18 -316q4 -69 -82 -128t-235 -93.5t-323 -34.5t-323 34.5t-235 93.5t-82 128l18 316l574 -181q22 -7 48 -7t48 7zM2304 1024q0 -23 -22 -31l-1120 -352q-4 -1 -10 -1t-10 1l-652 206q-43 -34 -71 -111.5t-34 -178.5q63 -36 63 -109q0 -69 -58 -107l58 -433
+q2 -14 -8 -25q-9 -11 -24 -11h-192q-15 0 -24 11q-10 11 -8 25l58 433q-58 38 -58 107q0 73 65 111q11 207 98 330l-333 104q-22 8 -22 31t22 31l1120 352q4 1 10 1t10 -1l1120 -352q22 -8 22 -31z" />
+    <glyph glyph-name="_389" unicode="&#xf19e;" 
+d="M859 579l13 -707q-62 11 -105 11q-41 0 -105 -11l13 707q-40 69 -168.5 295.5t-216.5 374.5t-181 287q58 -15 108 -15q44 0 111 15q63 -111 133.5 -229.5t167 -276.5t138.5 -227q37 61 109.5 177.5t117.5 190t105 176t107 189.5q54 -14 107 -14q56 0 114 14v0
+q-28 -39 -60 -88.5t-49.5 -78.5t-56.5 -96t-49 -84q-146 -248 -353 -610z" />
+    <glyph glyph-name="uniF1A0" unicode="&#xf1a0;" 
+d="M768 750h725q12 -67 12 -128q0 -217 -91 -387.5t-259.5 -266.5t-386.5 -96q-157 0 -299 60.5t-245 163.5t-163.5 245t-60.5 299t60.5 299t163.5 245t245 163.5t299 60.5q300 0 515 -201l-209 -201q-123 119 -306 119q-129 0 -238.5 -65t-173.5 -176.5t-64 -243.5
+t64 -243.5t173.5 -176.5t238.5 -65q87 0 160 24t120 60t82 82t51.5 87t22.5 78h-436v264z" />
+    <glyph glyph-name="f1a1" unicode="&#xf1a1;" horiz-adv-x="1792" 
+d="M1095 369q16 -16 0 -31q-62 -62 -199 -62t-199 62q-16 15 0 31q6 6 15 6t15 -6q48 -49 169 -49q120 0 169 49q6 6 15 6t15 -6zM788 550q0 -37 -26 -63t-63 -26t-63.5 26t-26.5 63q0 38 26.5 64t63.5 26t63 -26.5t26 -63.5zM1183 550q0 -37 -26.5 -63t-63.5 -26t-63 26
+t-26 63t26 63.5t63 26.5t63.5 -26t26.5 -64zM1434 670q0 49 -35 84t-85 35t-86 -36q-130 90 -311 96l63 283l200 -45q0 -37 26 -63t63 -26t63.5 26.5t26.5 63.5t-26.5 63.5t-63.5 26.5q-54 0 -80 -50l-221 49q-19 5 -25 -16l-69 -312q-180 -7 -309 -97q-35 37 -87 37
+q-50 0 -85 -35t-35 -84q0 -35 18.5 -64t49.5 -44q-6 -27 -6 -56q0 -142 140 -243t337 -101q198 0 338 101t140 243q0 32 -7 57q30 15 48 43.5t18 63.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191
+t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_392" unicode="&#xf1a2;" 
+d="M939 407q13 -13 0 -26q-53 -53 -171 -53t-171 53q-13 13 0 26q5 6 13 6t13 -6q42 -42 145 -42t145 42q5 6 13 6t13 -6zM676 563q0 -31 -23 -54t-54 -23t-54 23t-23 54q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1014 563q0 -31 -23 -54t-54 -23t-54 23t-23 54
+q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1229 666q0 42 -30 72t-73 30q-42 0 -73 -31q-113 78 -267 82l54 243l171 -39q1 -32 23.5 -54t53.5 -22q32 0 54.5 22.5t22.5 54.5t-22.5 54.5t-54.5 22.5q-48 0 -69 -43l-189 42q-17 5 -21 -13l-60 -268q-154 -6 -265 -83
+q-30 32 -74 32q-43 0 -73 -30t-30 -72q0 -30 16 -55t42 -38q-5 -25 -5 -48q0 -122 120 -208.5t289 -86.5q170 0 290 86.5t120 208.5q0 25 -6 49q25 13 40.5 37.5t15.5 54.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960
+q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_393" unicode="&#xf1a3;" 
+d="M866 697l90 27v62q0 79 -58 135t-138 56t-138 -55.5t-58 -134.5v-283q0 -20 -14 -33.5t-33 -13.5t-32.5 13.5t-13.5 33.5v120h-151v-122q0 -82 57.5 -139t139.5 -57q81 0 138.5 56.5t57.5 136.5v280q0 19 13.5 33t33.5 14q19 0 32.5 -14t13.5 -33v-54zM1199 502v122h-150
+v-126q0 -20 -13.5 -33.5t-33.5 -13.5q-19 0 -32.5 14t-13.5 33v123l-90 -26l-60 28v-123q0 -80 58 -137t139 -57t138.5 57t57.5 139zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103
+t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="f1a4" unicode="&#xf1a4;" horiz-adv-x="1920" 
+d="M1062 824v118q0 42 -30 72t-72 30t-72 -30t-30 -72v-612q0 -175 -126 -299t-303 -124q-178 0 -303.5 125.5t-125.5 303.5v266h328v-262q0 -43 30 -72.5t72 -29.5t72 29.5t30 72.5v620q0 171 126.5 292t301.5 121q176 0 302 -122t126 -294v-136l-195 -58zM1592 602h328
+v-266q0 -178 -125.5 -303.5t-303.5 -125.5q-177 0 -303 124.5t-126 300.5v268l131 -61l195 58v-270q0 -42 30 -71.5t72 -29.5t72 29.5t30 71.5v275z" />
+    <glyph glyph-name="_395" unicode="&#xf1a5;" 
+d="M1472 160v480h-704v704h-480q-93 0 -158.5 -65.5t-65.5 -158.5v-480h704v-704h480q93 0 158.5 65.5t65.5 158.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5
+t84.5 -203.5z" />
+    <glyph glyph-name="_396" unicode="&#xf1a6;" horiz-adv-x="2048" 
+d="M328 1254h204v-983h-532v697h328v286zM328 435v369h-123v-369h123zM614 968v-697h205v697h-205zM614 1254v-204h205v204h-205zM901 968h533v-942h-533v163h328v82h-328v697zM1229 435v369h-123v-369h123zM1516 968h532v-942h-532v163h327v82h-327v697zM1843 435v369h-123
+v-369h123z" />
+    <glyph glyph-name="_397" unicode="&#xf1a7;" 
+d="M1046 516q0 -64 -38 -109t-91 -45q-43 0 -70 15v277q28 17 70 17q53 0 91 -45.5t38 -109.5zM703 944q0 -64 -38 -109.5t-91 -45.5q-43 0 -70 15v277q28 17 70 17q53 0 91 -45t38 -109zM1265 513q0 134 -88 229t-213 95q-20 0 -39 -3q-23 -78 -78 -136q-87 -95 -211 -101
+v-636l211 41v206q51 -19 117 -19q125 0 213 95t88 229zM922 940q0 134 -88.5 229t-213.5 95q-74 0 -141 -36h-186v-840l211 41v206q55 -19 116 -19q125 0 213.5 95t88.5 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960
+q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_398" unicode="&#xf1a8;" horiz-adv-x="2038" 
+d="M1222 607q75 3 143.5 -20.5t118 -58.5t101 -94.5t84 -108t75.5 -120.5q33 -56 78.5 -109t75.5 -80.5t99 -88.5q-48 -30 -108.5 -57.5t-138.5 -59t-114 -47.5q-44 37 -74 115t-43.5 164.5t-33 180.5t-42.5 168.5t-72.5 123t-122.5 48.5l-10 -2l-6 -4q4 -5 13 -14
+q6 -5 28 -23.5t25.5 -22t19 -18t18 -20.5t11.5 -21t10.5 -27.5t4.5 -31t4 -40.5l1 -33q1 -26 -2.5 -57.5t-7.5 -52t-12.5 -58.5t-11.5 -53q-35 1 -101 -9.5t-98 -10.5q-39 0 -72 10q-2 16 -2 47q0 74 3 96q2 13 31.5 41.5t57 59t26.5 51.5q-24 2 -43 -24
+q-36 -53 -111.5 -99.5t-136.5 -46.5q-25 0 -75.5 63t-106.5 139.5t-84 96.5q-6 4 -27 30q-482 -112 -513 -112q-16 0 -28 11t-12 27q0 15 8.5 26.5t22.5 14.5l486 106q-8 14 -8 25t5.5 17.5t16 11.5t20 7t23 4.5t18.5 4.5q4 1 15.5 7.5t17.5 6.5q15 0 28 -16t20 -33
+q163 37 172 37q17 0 29.5 -11t12.5 -28q0 -15 -8.5 -26t-23.5 -14l-182 -40l-1 -16q-1 -26 81.5 -117.5t104.5 -91.5q47 0 119 80t72 129q0 36 -23.5 53t-51 18.5t-51 11.5t-23.5 34q0 16 10 34l-68 19q43 44 43 117q0 26 -5 58q82 16 144 16q44 0 71.5 -1.5t48.5 -8.5
+t31 -13.5t20.5 -24.5t15.5 -33.5t17 -47.5t24 -60l50 25q-3 -40 -23 -60t-42.5 -21t-40 -6.5t-16.5 -20.5zM1282 842q-5 5 -13.5 15.5t-12 14.5t-10.5 11.5t-10 10.5l-8 8t-8.5 7.5t-8 5t-8.5 4.5q-7 3 -14.5 5t-20.5 2.5t-22 0.5h-32.5h-37.5q-126 0 -217 -43
+q16 30 36 46.5t54 29.5t65.5 36t46 36.5t50 55t43.5 50.5q12 -9 28 -31.5t32 -36.5t38 -13l12 1v-76l22 -1q247 95 371 190q28 21 50 39t42.5 37.5t33 31t29.5 34t24 31t24.5 37t23 38t27 47.5t29.5 53l7 9q-2 -53 -43 -139q-79 -165 -205 -264t-306 -142q-14 -3 -42 -7.5
+t-50 -9.5t-39 -14q3 -19 24.5 -46t21.5 -34q0 -11 -26 -30zM1061 -79q39 26 131.5 47.5t146.5 21.5q9 0 22.5 -15.5t28 -42.5t26 -50t24 -51t14.5 -33q-121 -45 -244 -45q-61 0 -125 11zM822 568l48 12l109 -177l-73 -48zM1323 51q3 -15 3 -16q0 -7 -17.5 -14.5t-46 -13
+t-54 -9.5t-53.5 -7.5t-32 -4.5l-7 43q21 2 60.5 8.5t72 10t60.5 3.5h14zM866 679l-96 -20l-6 17q10 1 32.5 7t34.5 6q19 0 35 -10zM1061 45h31l10 -83l-41 -12v95zM1950 1535v1v-1zM1950 1535l-1 -5l-2 -2l1 3zM1950 1535l1 1z" />
+    <glyph glyph-name="_399" unicode="&#xf1a9;" 
+d="M1167 -50q-5 19 -24 5q-30 -22 -87 -39t-131 -17q-129 0 -193 49q-5 4 -13 4q-11 0 -26 -12q-7 -6 -7.5 -16t7.5 -20q34 -32 87.5 -46t102.5 -12.5t99 4.5q41 4 84.5 20.5t65 30t28.5 20.5q12 12 7 29zM1128 65q-19 47 -39 61q-23 15 -76 15q-47 0 -71 -10
+q-29 -12 -78 -56q-26 -24 -12 -44q9 -8 17.5 -4.5t31.5 23.5q3 2 10.5 8.5t10.5 8.5t10 7t11.5 7t12.5 5t15 4.5t16.5 2.5t20.5 1q27 0 44.5 -7.5t23 -14.5t13.5 -22q10 -17 12.5 -20t12.5 1q23 12 14 34zM1483 346q0 22 -5 44.5t-16.5 45t-34 36.5t-52.5 14
+q-33 0 -97 -41.5t-129 -83.5t-101 -42q-27 -1 -63.5 19t-76 49t-83.5 58t-100 49t-111 19q-115 -1 -197 -78.5t-84 -178.5q-2 -112 74 -164q29 -20 62.5 -28.5t103.5 -8.5q57 0 132 32.5t134 71t120 70.5t93 31q26 -1 65 -31.5t71.5 -67t68 -67.5t55.5 -32q35 -3 58.5 14
+t55.5 63q28 41 42.5 101t14.5 106zM1536 506q0 -164 -62 -304.5t-166 -236t-242.5 -149.5t-290.5 -54t-293 57.5t-247.5 157t-170.5 241.5t-64 302q0 89 19.5 172.5t49 145.5t70.5 118.5t78.5 94t78.5 69.5t64.5 46.5t42.5 24.5q14 8 51 26.5t54.5 28.5t48 30t60.5 44
+q36 28 58 72.5t30 125.5q129 -155 186 -193q44 -29 130 -68t129 -66q21 -13 39 -25t60.5 -46.5t76 -70.5t75 -95t69 -122t47 -148.5t19.5 -177.5z" />
+    <glyph glyph-name="_400" unicode="&#xf1aa;" 
+d="M1070 463l-160 -160l-151 -152l-30 -30q-65 -64 -151.5 -87t-171.5 -2q-16 -70 -72 -115t-129 -45q-85 0 -145 60.5t-60 145.5q0 72 44.5 128t113.5 72q-22 86 1 173t88 152l12 12l151 -152l-11 -11q-37 -37 -37 -89t37 -90q37 -37 89 -37t89 37l30 30l151 152l161 160z
+M729 1145l12 -12l-152 -152l-12 12q-37 37 -89 37t-89 -37t-37 -89.5t37 -89.5l29 -29l152 -152l160 -160l-151 -152l-161 160l-151 152l-30 30q-68 67 -90 159.5t5 179.5q-70 15 -115 71t-45 129q0 85 60 145.5t145 60.5q76 0 133.5 -49t69.5 -123q84 20 169.5 -3.5
+t149.5 -87.5zM1536 78q0 -85 -60 -145.5t-145 -60.5q-74 0 -131 47t-71 118q-86 -28 -179.5 -6t-161.5 90l-11 12l151 152l12 -12q37 -37 89 -37t89 37t37 89t-37 89l-30 30l-152 152l-160 160l152 152l160 -160l152 -152l29 -30q64 -64 87.5 -150.5t2.5 -171.5
+q76 -11 126.5 -68.5t50.5 -134.5zM1534 1202q0 -77 -51 -135t-127 -69q26 -85 3 -176.5t-90 -158.5l-12 -12l-151 152l12 12q37 37 37 89t-37 89t-89 37t-89 -37l-30 -30l-152 -152l-160 -160l-152 152l161 160l152 152l29 30q67 67 159 89.5t178 -3.5q11 75 68.5 126
+t135.5 51q85 0 145 -60.5t60 -145.5z" />
+    <glyph glyph-name="f1ab" unicode="&#xf1ab;" 
+d="M654 458q-1 -3 -12.5 0.5t-31.5 11.5l-20 9q-44 20 -87 49q-7 5 -41 31.5t-38 28.5q-67 -103 -134 -181q-81 -95 -105 -110q-4 -2 -19.5 -4t-18.5 0q6 4 82 92q21 24 85.5 115t78.5 118q17 30 51 98.5t36 77.5q-8 1 -110 -33q-8 -2 -27.5 -7.5t-34.5 -9.5t-17 -5
+q-2 -2 -2 -10.5t-1 -9.5q-5 -10 -31 -15q-23 -7 -47 0q-18 4 -28 21q-4 6 -5 23q6 2 24.5 5t29.5 6q58 16 105 32q100 35 102 35q10 2 43 19.5t44 21.5q9 3 21.5 8t14.5 5.5t6 -0.5q2 -12 -1 -33q0 -2 -12.5 -27t-26.5 -53.5t-17 -33.5q-25 -50 -77 -131l64 -28
+q12 -6 74.5 -32t67.5 -28q4 -1 10.5 -25.5t4.5 -30.5zM449 944q3 -15 -4 -28q-12 -23 -50 -38q-30 -12 -60 -12q-26 3 -49 26q-14 15 -18 41l1 3q3 -3 19.5 -5t26.5 0t58 16q36 12 55 14q17 0 21 -17zM1147 815l63 -227l-139 42zM39 15l694 232v1032l-694 -233v-1031z
+M1280 332l102 -31l-181 657l-100 31l-216 -536l102 -31l45 110l211 -65zM777 1294l573 -184v380zM1088 -29l158 -13l-54 -160l-40 66q-130 -83 -276 -108q-58 -12 -91 -12h-84q-79 0 -199.5 39t-183.5 85q-8 7 -8 16q0 8 5 13.5t13 5.5q4 0 18 -7.5t30.5 -16.5t20.5 -11
+q73 -37 159.5 -61.5t157.5 -24.5q95 0 167 14.5t157 50.5q15 7 30.5 15.5t34 19t28.5 16.5zM1536 1050v-1079l-774 246q-14 -6 -375 -127.5t-368 -121.5q-13 0 -18 13q0 1 -1 3v1078q3 9 4 10q5 6 20 11q107 36 149 50v384l558 -198q2 0 160.5 55t316 108.5t161.5 53.5
+q20 0 20 -21v-418z" />
+    <glyph glyph-name="_402" unicode="&#xf1ac;" horiz-adv-x="1792" 
+d="M288 1152q66 0 113 -47t47 -113v-1088q0 -66 -47 -113t-113 -47h-128q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h128zM1664 989q58 -34 93 -93t35 -128v-768q0 -106 -75 -181t-181 -75h-864q-66 0 -113 47t-47 113v1536q0 40 28 68t68 28h672q40 0 88 -20t76 -48
+l152 -152q28 -28 48 -76t20 -88v-163zM928 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 512v128q0 14 -9 23
+t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128
+q14 0 23 9t9 23zM1184 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 256v128q0 14 -9 23t-23 9h-128
+q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1536 896v256h-160q-40 0 -68 28t-28 68v160h-640v-512h896z" />
+    <glyph glyph-name="_403" unicode="&#xf1ad;" 
+d="M1344 1536q26 0 45 -19t19 -45v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280zM512 1248v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 992v-64q0 -14 9 -23t23 -9h64q14 0 23 9
+t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 736v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 480v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 160v64
+q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64
+q14 0 23 9t9 23zM384 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 -96v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9
+t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM896 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 928v64
+q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 160v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64
+q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9
+t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23z" />
+    <glyph glyph-name="_404" unicode="&#xf1ae;" horiz-adv-x="1280" 
+d="M1188 988l-292 -292v-824q0 -46 -33 -79t-79 -33t-79 33t-33 79v384h-64v-384q0 -46 -33 -79t-79 -33t-79 33t-33 79v824l-292 292q-28 28 -28 68t28 68q29 28 68.5 28t67.5 -28l228 -228h368l228 228q28 28 68 28t68 -28q28 -29 28 -68.5t-28 -67.5zM864 1152
+q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="uniF1B1" unicode="&#xf1b0;" horiz-adv-x="1664" 
+d="M780 1064q0 -60 -19 -113.5t-63 -92.5t-105 -39q-76 0 -138 57.5t-92 135.5t-30 151q0 60 19 113.5t63 92.5t105 39q77 0 138.5 -57.5t91.5 -135t30 -151.5zM438 581q0 -80 -42 -139t-119 -59q-76 0 -141.5 55.5t-100.5 133.5t-35 152q0 80 42 139.5t119 59.5
+q76 0 141.5 -55.5t100.5 -134t35 -152.5zM832 608q118 0 255 -97.5t229 -237t92 -254.5q0 -46 -17 -76.5t-48.5 -45t-64.5 -20t-76 -5.5q-68 0 -187.5 45t-182.5 45q-66 0 -192.5 -44.5t-200.5 -44.5q-183 0 -183 146q0 86 56 191.5t139.5 192.5t187.5 146t193 59zM1071 819
+q-61 0 -105 39t-63 92.5t-19 113.5q0 74 30 151.5t91.5 135t138.5 57.5q61 0 105 -39t63 -92.5t19 -113.5q0 -73 -30 -151t-92 -135.5t-138 -57.5zM1503 923q77 0 119 -59.5t42 -139.5q0 -74 -35 -152t-100.5 -133.5t-141.5 -55.5q-77 0 -119 59t-42 139q0 74 35 152.5
+t100.5 134t141.5 55.5z" />
+    <glyph glyph-name="_406" unicode="&#xf1b1;" horiz-adv-x="768" 
+d="M704 1008q0 -145 -57 -243.5t-152 -135.5l45 -821q2 -26 -16 -45t-44 -19h-192q-26 0 -44 19t-16 45l45 821q-95 37 -152 135.5t-57 243.5q0 128 42.5 249.5t117.5 200t160 78.5t160 -78.5t117.5 -200t42.5 -249.5z" />
+    <glyph glyph-name="_407" unicode="&#xf1b2;" horiz-adv-x="1792" 
+d="M896 -93l640 349v636l-640 -233v-752zM832 772l698 254l-698 254l-698 -254zM1664 1024v-768q0 -35 -18 -65t-49 -47l-704 -384q-28 -16 -61 -16t-61 16l-704 384q-31 17 -49 47t-18 65v768q0 40 23 73t61 47l704 256q22 8 44 8t44 -8l704 -256q38 -14 61 -47t23 -73z
+" />
+    <glyph glyph-name="_408" unicode="&#xf1b3;" horiz-adv-x="2304" 
+d="M640 -96l384 192v314l-384 -164v-342zM576 358l404 173l-404 173l-404 -173zM1664 -96l384 192v314l-384 -164v-342zM1600 358l404 173l-404 173l-404 -173zM1152 651l384 165v266l-384 -164v-267zM1088 1030l441 189l-441 189l-441 -189zM2176 512v-416q0 -36 -19 -67
+t-52 -47l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-4 2 -7 4q-2 -2 -7 -4l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-33 16 -52 47t-19 67v416q0 38 21.5 70t56.5 48l434 186v400q0 38 21.5 70t56.5 48l448 192q23 10 50 10t50 -10l448 -192q35 -16 56.5 -48t21.5 -70
+v-400l434 -186q36 -16 57 -48t21 -70z" />
+    <glyph glyph-name="_409" unicode="&#xf1b4;" horiz-adv-x="2048" 
+d="M1848 1197h-511v-124h511v124zM1596 771q-90 0 -146 -52.5t-62 -142.5h408q-18 195 -200 195zM1612 186q63 0 122 32t76 87h221q-100 -307 -427 -307q-214 0 -340.5 132t-126.5 347q0 208 130.5 345.5t336.5 137.5q138 0 240.5 -68t153 -179t50.5 -248q0 -17 -2 -47h-658
+q0 -111 57.5 -171.5t166.5 -60.5zM277 236h296q205 0 205 167q0 180 -199 180h-302v-347zM277 773h281q78 0 123.5 36.5t45.5 113.5q0 144 -190 144h-260v-294zM0 1282h594q87 0 155 -14t126.5 -47.5t90 -96.5t31.5 -154q0 -181 -172 -263q114 -32 172 -115t58 -204
+q0 -75 -24.5 -136.5t-66 -103.5t-98.5 -71t-121 -42t-134 -13h-611v1260z" />
+    <glyph glyph-name="_410" unicode="&#xf1b5;" 
+d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM499 1041h-371v-787h382q117 0 197 57.5t80 170.5q0 158 -143 200q107 52 107 164q0 57 -19.5 96.5
+t-56.5 60.5t-79 29.5t-97 8.5zM477 723h-176v184h163q119 0 119 -90q0 -94 -106 -94zM486 388h-185v217h189q124 0 124 -113q0 -104 -128 -104zM1136 356q-68 0 -104 38t-36 107h411q1 10 1 30q0 132 -74.5 220.5t-203.5 88.5q-128 0 -210 -86t-82 -216q0 -135 79 -217
+t213 -82q205 0 267 191h-138q-11 -34 -47.5 -54t-75.5 -20zM1126 722q113 0 124 -122h-254q4 56 39 89t91 33zM964 988h319v-77h-319v77z" />
+    <glyph glyph-name="_411" unicode="&#xf1b6;" horiz-adv-x="1792" 
+d="M1582 954q0 -101 -71.5 -172.5t-172.5 -71.5t-172.5 71.5t-71.5 172.5t71.5 172.5t172.5 71.5t172.5 -71.5t71.5 -172.5zM812 212q0 104 -73 177t-177 73q-27 0 -54 -6l104 -42q77 -31 109.5 -106.5t1.5 -151.5q-31 -77 -107 -109t-152 -1q-21 8 -62 24.5t-61 24.5
+q32 -60 91 -96.5t130 -36.5q104 0 177 73t73 177zM1642 953q0 126 -89.5 215.5t-215.5 89.5q-127 0 -216.5 -89.5t-89.5 -215.5q0 -127 89.5 -216t216.5 -89q126 0 215.5 89t89.5 216zM1792 953q0 -189 -133.5 -322t-321.5 -133l-437 -319q-12 -129 -109 -218t-229 -89
+q-121 0 -214 76t-118 192l-230 92v429l389 -157q79 48 173 48q13 0 35 -2l284 407q2 187 135.5 319t320.5 132q188 0 321.5 -133.5t133.5 -321.5z" />
+    <glyph glyph-name="_412" unicode="&#xf1b7;" 
+d="M1242 889q0 80 -57 136.5t-137 56.5t-136.5 -57t-56.5 -136q0 -80 56.5 -136.5t136.5 -56.5t137 56.5t57 136.5zM632 301q0 -83 -58 -140.5t-140 -57.5q-56 0 -103 29t-72 77q52 -20 98 -40q60 -24 120 1.5t85 86.5q24 60 -1.5 120t-86.5 84l-82 33q22 5 42 5
+q82 0 140 -57.5t58 -140.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v153l172 -69q20 -92 93.5 -152t168.5 -60q104 0 181 70t87 173l345 252q150 0 255.5 105.5t105.5 254.5q0 150 -105.5 255.5t-255.5 105.5
+q-148 0 -253 -104.5t-107 -252.5l-225 -322q-9 1 -28 1q-75 0 -137 -37l-297 119v468q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5zM1289 887q0 -100 -71 -170.5t-171 -70.5t-170.5 70.5t-70.5 170.5t70.5 171t170.5 71q101 0 171.5 -70.5t70.5 -171.5z
+" />
+    <glyph glyph-name="_413" unicode="&#xf1b8;" horiz-adv-x="1792" 
+d="M836 367l-15 -368l-2 -22l-420 29q-36 3 -67 31.5t-47 65.5q-11 27 -14.5 55t4 65t12 55t21.5 64t19 53q78 -12 509 -28zM449 953l180 -379l-147 92q-63 -72 -111.5 -144.5t-72.5 -125t-39.5 -94.5t-18.5 -63l-4 -21l-190 357q-17 26 -18 56t6 47l8 18q35 63 114 188
+l-140 86zM1680 436l-188 -359q-12 -29 -36.5 -46.5t-43.5 -20.5l-18 -4q-71 -7 -219 -12l8 -164l-230 367l211 362l7 -173q170 -16 283 -5t170 33zM895 1360q-47 -63 -265 -435l-317 187l-19 12l225 356q20 31 60 45t80 10q24 -2 48.5 -12t42 -21t41.5 -33t36 -34.5
+t36 -39.5t32 -35zM1550 1053l212 -363q18 -37 12.5 -76t-27.5 -74q-13 -20 -33 -37t-38 -28t-48.5 -22t-47 -16t-51.5 -14t-46 -12q-34 72 -265 436l313 195zM1407 1279l142 83l-220 -373l-419 20l151 86q-34 89 -75 166t-75.5 123.5t-64.5 80t-47 46.5l-17 13l405 -1
+q31 3 58 -10.5t39 -28.5l11 -15q39 -61 112 -190z" />
+    <glyph glyph-name="_414" unicode="&#xf1b9;" horiz-adv-x="2048" 
+d="M480 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM516 768h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5zM1888 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM2048 544v-384
+q0 -14 -9 -23t-23 -9h-96v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-1024v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5t179 63.5h768q98 0 179 -63.5t104 -157.5
+l105 -419h28q93 0 158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="_415" unicode="&#xf1ba;" horiz-adv-x="2048" 
+d="M1824 640q93 0 158.5 -65.5t65.5 -158.5v-384q0 -14 -9 -23t-23 -9h-96v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-1024v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5
+t179 63.5h128v224q0 14 9 23t23 9h448q14 0 23 -9t9 -23v-224h128q98 0 179 -63.5t104 -157.5l105 -419h28zM320 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM516 640h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5z
+M1728 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47z" />
+    <glyph glyph-name="_416" unicode="&#xf1bb;" 
+d="M1504 64q0 -26 -19 -45t-45 -19h-462q1 -17 6 -87.5t5 -108.5q0 -25 -18 -42.5t-43 -17.5h-320q-25 0 -43 17.5t-18 42.5q0 38 5 108.5t6 87.5h-462q-26 0 -45 19t-19 45t19 45l402 403h-229q-26 0 -45 19t-19 45t19 45l402 403h-197q-26 0 -45 19t-19 45t19 45l384 384
+q19 19 45 19t45 -19l384 -384q19 -19 19 -45t-19 -45t-45 -19h-197l402 -403q19 -19 19 -45t-19 -45t-45 -19h-229l402 -403q19 -19 19 -45z" />
+    <glyph glyph-name="_417" unicode="&#xf1bc;" 
+d="M1127 326q0 32 -30 51q-193 115 -447 115q-133 0 -287 -34q-42 -9 -42 -52q0 -20 13.5 -34.5t35.5 -14.5q5 0 37 8q132 27 243 27q226 0 397 -103q19 -11 33 -11q19 0 33 13.5t14 34.5zM1223 541q0 40 -35 61q-237 141 -548 141q-153 0 -303 -42q-48 -13 -48 -64
+q0 -25 17.5 -42.5t42.5 -17.5q7 0 37 8q122 33 251 33q279 0 488 -124q24 -13 38 -13q25 0 42.5 17.5t17.5 42.5zM1331 789q0 47 -40 70q-126 73 -293 110.5t-343 37.5q-204 0 -364 -47q-23 -7 -38.5 -25.5t-15.5 -48.5q0 -31 20.5 -52t51.5 -21q11 0 40 8q133 37 307 37
+q159 0 309.5 -34t253.5 -95q21 -12 40 -12q29 0 50.5 20.5t21.5 51.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_418" unicode="&#xf1bd;" horiz-adv-x="1024" 
+d="M1024 1233l-303 -582l24 -31h279v-415h-507l-44 -30l-142 -273l-30 -30h-301v303l303 583l-24 30h-279v415h507l44 30l142 273l30 30h301v-303z" />
+    <glyph glyph-name="_419" unicode="&#xf1be;" horiz-adv-x="2304" 
+d="M784 164l16 241l-16 523q-1 10 -7.5 17t-16.5 7q-9 0 -16 -7t-7 -17l-14 -523l14 -241q1 -10 7.5 -16.5t15.5 -6.5q22 0 24 23zM1080 193l11 211l-12 586q0 16 -13 24q-8 5 -16 5t-16 -5q-13 -8 -13 -24l-1 -6l-10 -579q0 -1 11 -236v-1q0 -10 6 -17q9 -11 23 -11
+q11 0 20 9q9 7 9 20zM35 533l20 -128l-20 -126q-2 -9 -9 -9t-9 9l-17 126l17 128q2 9 9 9t9 -9zM121 612l26 -207l-26 -203q-2 -9 -10 -9q-9 0 -9 10l-23 202l23 207q0 9 9 9q8 0 10 -9zM401 159zM213 650l25 -245l-25 -237q0 -11 -11 -11q-10 0 -12 11l-21 237l21 245
+q2 12 12 12q11 0 11 -12zM307 657l23 -252l-23 -244q-2 -13 -14 -13q-13 0 -13 13l-21 244l21 252q0 13 13 13q12 0 14 -13zM401 639l21 -234l-21 -246q-2 -16 -16 -16q-6 0 -10.5 4.5t-4.5 11.5l-20 246l20 234q0 6 4.5 10.5t10.5 4.5q14 0 16 -15zM784 164zM495 785
+l21 -380l-21 -246q0 -7 -5 -12.5t-12 -5.5q-16 0 -18 18l-18 246l18 380q2 18 18 18q7 0 12 -5.5t5 -12.5zM589 871l19 -468l-19 -244q0 -8 -5.5 -13.5t-13.5 -5.5q-18 0 -20 19l-16 244l16 468q2 19 20 19q8 0 13.5 -5.5t5.5 -13.5zM687 911l18 -506l-18 -242
+q-2 -21 -22 -21q-19 0 -21 21l-16 242l16 506q0 9 6.5 15.5t14.5 6.5q9 0 15 -6.5t7 -15.5zM1079 169v0v0v0zM881 915l15 -510l-15 -239q0 -10 -7.5 -17.5t-17.5 -7.5t-17 7t-8 18l-14 239l14 510q0 11 7.5 18t17.5 7t17.5 -7t7.5 -18zM980 896l14 -492l-14 -236
+q0 -11 -8 -19t-19 -8t-19 8t-9 19l-12 236l12 492q1 12 9 20t19 8t18.5 -8t8.5 -20zM1192 404l-14 -231v0q0 -13 -9 -22t-22 -9t-22 9t-10 22l-6 114l-6 117l12 636v3q2 15 12 24q9 7 20 7q8 0 15 -5q14 -8 16 -26zM2304 423q0 -117 -83 -199.5t-200 -82.5h-786
+q-13 2 -22 11t-9 22v899q0 23 28 33q85 34 181 34q195 0 338 -131.5t160 -323.5q53 22 110 22q117 0 200 -83t83 -201z" />
+    <glyph glyph-name="uniF1C0" unicode="&#xf1c0;" 
+d="M768 768q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 0q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127
+t443 -43zM768 384q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 1536q208 0 385 -34.5t280 -93.5t103 -128v-128q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5
+t-103 128v128q0 69 103 128t280 93.5t385 34.5z" />
+    <glyph glyph-name="uniF1C1" unicode="&#xf1c1;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M894 465q33 -26 84 -56q59 7 117 7q147 0 177 -49q16 -22 2 -52q0 -1 -1 -2l-2 -2v-1q-6 -38 -71 -38q-48 0 -115 20t-130 53q-221 -24 -392 -83q-153 -262 -242 -262q-15 0 -28 7l-24 12q-1 1 -6 5q-10 10 -6 36q9 40 56 91.5t132 96.5q14 9 23 -6q2 -2 2 -4q52 85 107 197
+q68 136 104 262q-24 82 -30.5 159.5t6.5 127.5q11 40 42 40h21h1q23 0 35 -15q18 -21 9 -68q-2 -6 -4 -8q1 -3 1 -8v-30q-2 -123 -14 -192q55 -164 146 -238zM318 54q52 24 137 158q-51 -40 -87.5 -84t-49.5 -74zM716 974q-15 -42 -2 -132q1 7 7 44q0 3 7 43q1 4 4 8
+q-1 1 -1 2q-1 2 -1 3q-1 22 -13 36q0 -1 -1 -2v-2zM592 313q135 54 284 81q-2 1 -13 9.5t-16 13.5q-76 67 -127 176q-27 -86 -83 -197q-30 -56 -45 -83zM1238 329q-24 24 -140 24q76 -28 124 -28q14 0 18 1q0 1 -2 3z" />
+    <glyph glyph-name="_422" unicode="&#xf1c2;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M233 768v-107h70l164 -661h159l128 485q7 20 10 46q2 16 2 24h4l3 -24q1 -3 3.5 -20t5.5 -26l128 -485h159l164 661h70v107h-300v-107h90l-99 -438q-5 -20 -7 -46l-2 -21h-4q0 3 -0.5 6.5t-1.5 8t-1 6.5q-1 5 -4 21t-5 25l-144 545h-114l-144 -545q-2 -9 -4.5 -24.5
+t-3.5 -21.5l-4 -21h-4l-2 21q-2 26 -7 46l-99 438h90v107h-300z" />
+    <glyph glyph-name="_423" unicode="&#xf1c3;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M429 106v-106h281v106h-75l103 161q5 7 10 16.5t7.5 13.5t3.5 4h2q1 -4 5 -10q2 -4 4.5 -7.5t6 -8t6.5 -8.5l107 -161h-76v-106h291v106h-68l-192 273l195 282h67v107h-279v-107h74l-103 -159q-4 -7 -10 -16.5t-9 -13.5l-2 -3h-2q-1 4 -5 10q-6 11 -17 23l-106 159h76v107
+h-290v-107h68l189 -272l-194 -283h-68z" />
+    <glyph glyph-name="_424" unicode="&#xf1c4;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M416 106v-106h327v106h-93v167h137q76 0 118 15q67 23 106.5 87t39.5 146q0 81 -37 141t-100 87q-48 19 -130 19h-368v-107h92v-555h-92zM769 386h-119v268h120q52 0 83 -18q56 -33 56 -115q0 -89 -62 -120q-31 -15 -78 -15z" />
+    <glyph glyph-name="_425" unicode="&#xf1c5;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M1280 320v-320h-1024v192l192 192l128 -128l384 384zM448 512q-80 0 -136 56t-56 136t56 136t136 56t136 -56t56 -136t-56 -136t-136 -56z" />
+    <glyph glyph-name="_426" unicode="&#xf1c6;" 
+d="M640 1152v128h-128v-128h128zM768 1024v128h-128v-128h128zM640 896v128h-128v-128h128zM768 768v128h-128v-128h128zM1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400
+v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-128v-128h-128v128h-512v-1536h1280zM781 593l107 -349q8 -27 8 -52q0 -83 -72.5 -137.5t-183.5 -54.5t-183.5 54.5t-72.5 137.5q0 25 8 52q21 63 120 396v128h128v-128h79
+q22 0 39 -13t23 -34zM640 128q53 0 90.5 19t37.5 45t-37.5 45t-90.5 19t-90.5 -19t-37.5 -45t37.5 -45t90.5 -19z" />
+    <glyph glyph-name="_427" unicode="&#xf1c7;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M620 686q20 -8 20 -30v-544q0 -22 -20 -30q-8 -2 -12 -2q-12 0 -23 9l-166 167h-131q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h131l166 167q16 15 35 7zM1037 -3q31 0 50 24q129 159 129 363t-129 363q-16 21 -43 24t-47 -14q-21 -17 -23.5 -43.5t14.5 -47.5
+q100 -123 100 -282t-100 -282q-17 -21 -14.5 -47.5t23.5 -42.5q18 -15 40 -15zM826 145q27 0 47 20q87 93 87 219t-87 219q-18 19 -45 20t-46 -17t-20 -44.5t18 -46.5q52 -57 52 -131t-52 -131q-19 -20 -18 -46.5t20 -44.5q20 -17 44 -17z" />
+    <glyph glyph-name="_428" unicode="&#xf1c8;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M768 768q52 0 90 -38t38 -90v-384q0 -52 -38 -90t-90 -38h-384q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h384zM1260 766q20 -8 20 -30v-576q0 -22 -20 -30q-8 -2 -12 -2q-14 0 -23 9l-265 266v90l265 266q9 9 23 9q4 0 12 -2z" />
+    <glyph glyph-name="_429" unicode="&#xf1c9;" 
+d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z
+M480 768q8 11 21 12.5t24 -6.5l51 -38q11 -8 12.5 -21t-6.5 -24l-182 -243l182 -243q8 -11 6.5 -24t-12.5 -21l-51 -38q-11 -8 -24 -6.5t-21 12.5l-226 301q-14 19 0 38zM1282 467q14 -19 0 -38l-226 -301q-8 -11 -21 -12.5t-24 6.5l-51 38q-11 8 -12.5 21t6.5 24l182 243
+l-182 243q-8 11 -6.5 24t12.5 21l51 38q11 8 24 6.5t21 -12.5zM662 6q-13 2 -20.5 13t-5.5 24l138 831q2 13 13 20.5t24 5.5l63 -10q13 -2 20.5 -13t5.5 -24l-138 -831q-2 -13 -13 -20.5t-24 -5.5z" />
+    <glyph glyph-name="_430" unicode="&#xf1ca;" 
+d="M1497 709v-198q-101 -23 -198 -23q-65 -136 -165.5 -271t-181.5 -215.5t-128 -106.5q-80 -45 -162 3q-28 17 -60.5 43.5t-85 83.5t-102.5 128.5t-107.5 184t-105.5 244t-91.5 314.5t-70.5 390h283q26 -218 70 -398.5t104.5 -317t121.5 -235.5t140 -195q169 169 287 406
+q-142 72 -223 220t-81 333q0 192 104 314.5t284 122.5q178 0 273 -105.5t95 -297.5q0 -159 -58 -286q-7 -1 -19.5 -3t-46 -2t-63 6t-62 25.5t-50.5 51.5q31 103 31 184q0 87 -29 132t-79 45q-53 0 -85 -49.5t-32 -140.5q0 -186 105 -293.5t267 -107.5q62 0 121 14z" />
+    <glyph glyph-name="_431" unicode="&#xf1cb;" horiz-adv-x="1792" 
+d="M216 367l603 -402v359l-334 223zM154 511l193 129l-193 129v-258zM973 -35l603 402l-269 180l-334 -223v-359zM896 458l272 182l-272 182l-272 -182zM485 733l334 223v359l-603 -402zM1445 640l193 -129v258zM1307 733l269 180l-603 402v-359zM1792 913v-546
+q0 -41 -34 -64l-819 -546q-21 -13 -43 -13t-43 13l-819 546q-34 23 -34 64v546q0 41 34 64l819 546q21 13 43 13t43 -13l819 -546q34 -23 34 -64z" />
+    <glyph glyph-name="_432" unicode="&#xf1cc;" horiz-adv-x="2048" 
+d="M1800 764q111 -46 179.5 -145.5t68.5 -221.5q0 -164 -118 -280.5t-285 -116.5q-4 0 -11.5 0.5t-10.5 0.5h-1209h-1h-2h-5q-170 10 -288 125.5t-118 280.5q0 110 55 203t147 147q-12 39 -12 82q0 115 82 196t199 81q95 0 172 -58q75 154 222.5 248t326.5 94
+q166 0 306 -80.5t221.5 -218.5t81.5 -301q0 -6 -0.5 -18t-0.5 -18zM468 498q0 -122 84 -193t208 -71q137 0 240 99q-16 20 -47.5 56.5t-43.5 50.5q-67 -65 -144 -65q-55 0 -93.5 33.5t-38.5 87.5q0 53 38.5 87t91.5 34q44 0 84.5 -21t73 -55t65 -75t69 -82t77 -75t97 -55
+t121.5 -21q121 0 204.5 71.5t83.5 190.5q0 121 -84 192t-207 71q-143 0 -241 -97l93 -108q66 64 142 64q52 0 92 -33t40 -84q0 -57 -37 -91.5t-94 -34.5q-43 0 -82.5 21t-72 55t-65.5 75t-69.5 82t-77.5 75t-96.5 55t-118.5 21q-122 0 -207 -70.5t-85 -189.5z" />
+    <glyph glyph-name="_433" unicode="&#xf1cd;" horiz-adv-x="1792" 
+d="M896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 1408q-190 0 -361 -90l194 -194q82 28 167 28t167 -28l194 194q-171 90 -361 90zM218 279l194 194
+q-28 82 -28 167t28 167l-194 194q-90 -171 -90 -361t90 -361zM896 -128q190 0 361 90l-194 194q-82 -28 -167 -28t-167 28l-194 -194q171 -90 361 -90zM896 256q159 0 271.5 112.5t112.5 271.5t-112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5
+t271.5 -112.5zM1380 473l194 -194q90 171 90 361t-90 361l-194 -194q28 -82 28 -167t-28 -167z" />
+    <glyph glyph-name="_434" unicode="&#xf1ce;" horiz-adv-x="1792" 
+d="M1760 640q0 -176 -68.5 -336t-184 -275.5t-275.5 -184t-336 -68.5t-336 68.5t-275.5 184t-184 275.5t-68.5 336q0 213 97 398.5t265 305.5t374 151v-228q-221 -45 -366.5 -221t-145.5 -406q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5
+t136.5 204t51 248.5q0 230 -145.5 406t-366.5 221v228q206 -31 374 -151t265 -305.5t97 -398.5z" />
+    <glyph glyph-name="uniF1D0" unicode="&#xf1d0;" horiz-adv-x="1792" 
+d="M19 662q8 217 116 406t305 318h5q0 -1 -1 -3q-8 -8 -28 -33.5t-52 -76.5t-60 -110.5t-44.5 -135.5t-14 -150.5t39 -157.5t108.5 -154q50 -50 102 -69.5t90.5 -11.5t69.5 23.5t47 32.5l16 16q39 51 53 116.5t6.5 122.5t-21 107t-26.5 80l-14 29q-10 25 -30.5 49.5t-43 41
+t-43.5 29.5t-35 19l-13 6l104 115q39 -17 78 -52t59 -61l19 -27q1 48 -18.5 103.5t-40.5 87.5l-20 31l161 183l160 -181q-33 -46 -52.5 -102.5t-22.5 -90.5l-4 -33q22 37 61.5 72.5t67.5 52.5l28 17l103 -115q-44 -14 -85 -50t-60 -65l-19 -29q-31 -56 -48 -133.5t-7 -170
+t57 -156.5q33 -45 77.5 -60.5t85 -5.5t76 26.5t57.5 33.5l21 16q60 53 96.5 115t48.5 121.5t10 121.5t-18 118t-37 107.5t-45.5 93t-45 72t-34.5 47.5l-13 17q-14 13 -7 13l10 -3q40 -29 62.5 -46t62 -50t64 -58t58.5 -65t55.5 -77t45.5 -88t38 -103t23.5 -117t10.5 -136
+q3 -259 -108 -465t-312 -321t-456 -115q-185 0 -351 74t-283.5 198t-184 293t-60.5 353z" />
+    <glyph glyph-name="uniF1D1" unicode="&#xf1d1;" horiz-adv-x="1792" 
+d="M874 -102v-66q-208 6 -385 109.5t-283 275.5l58 34q29 -49 73 -99l65 57q148 -168 368 -212l-17 -86q65 -12 121 -13zM276 428l-83 -28q22 -60 49 -112l-57 -33q-98 180 -98 385t98 385l57 -33q-30 -56 -49 -112l82 -28q-35 -100 -35 -212q0 -109 36 -212zM1528 251
+l58 -34q-106 -172 -283 -275.5t-385 -109.5v66q56 1 121 13l-17 86q220 44 368 212l65 -57q44 50 73 99zM1377 805l-233 -80q14 -42 14 -85t-14 -85l232 -80q-31 -92 -98 -169l-185 162q-57 -67 -147 -85l48 -241q-52 -10 -98 -10t-98 10l48 241q-90 18 -147 85l-185 -162
+q-67 77 -98 169l232 80q-14 42 -14 85t14 85l-233 80q33 93 99 169l185 -162q59 68 147 86l-48 240q44 10 98 10t98 -10l-48 -240q88 -18 147 -86l185 162q66 -76 99 -169zM874 1448v-66q-65 -2 -121 -13l17 -86q-220 -42 -368 -211l-65 56q-38 -42 -73 -98l-57 33
+q106 172 282 275.5t385 109.5zM1705 640q0 -205 -98 -385l-57 33q27 52 49 112l-83 28q36 103 36 212q0 112 -35 212l82 28q-19 56 -49 112l57 33q98 -180 98 -385zM1585 1063l-57 -33q-35 56 -73 98l-65 -56q-148 169 -368 211l17 86q-56 11 -121 13v66q209 -6 385 -109.5
+t282 -275.5zM1748 640q0 173 -67.5 331t-181.5 272t-272 181.5t-331 67.5t-331 -67.5t-272 -181.5t-181.5 -272t-67.5 -331t67.5 -331t181.5 -272t272 -181.5t331 -67.5t331 67.5t272 181.5t181.5 272t67.5 331zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71
+t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF1D2" unicode="&#xf1d2;" 
+d="M582 228q0 -66 -93 -66q-107 0 -107 63q0 64 98 64q102 0 102 -61zM546 694q0 -85 -74 -85q-77 0 -77 84q0 90 77 90q36 0 55 -25.5t19 -63.5zM712 769v125q-78 -29 -135 -29q-50 29 -110 29q-86 0 -145 -57t-59 -143q0 -50 29.5 -102t73.5 -67v-3q-38 -17 -38 -85
+q0 -53 41 -77v-3q-113 -37 -113 -139q0 -45 20 -78.5t54 -51t72 -25.5t81 -8q224 0 224 188q0 67 -48 99t-126 46q-27 5 -51.5 20.5t-24.5 39.5q0 44 49 52q77 15 122 70t45 134q0 24 -10 52q37 9 49 13zM771 350h137q-2 27 -2 82v387q0 46 2 69h-137q3 -23 3 -71v-392
+q0 -50 -3 -75zM1280 366v121q-30 -21 -68 -21q-53 0 -53 82v225h52q9 0 26.5 -1t26.5 -1v117h-105q0 82 3 102h-140q4 -24 4 -55v-47h-60v-117q36 3 37 3q3 0 11 -0.5t12 -0.5v-2h-2v-217q0 -37 2.5 -64t11.5 -56.5t24.5 -48.5t43.5 -31t66 -12q64 0 108 24zM924 1072
+q0 36 -24 63.5t-60 27.5t-60.5 -27t-24.5 -64q0 -36 25 -62.5t60 -26.5t59.5 27t24.5 62zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_438" unicode="&#xf1d3;" horiz-adv-x="1792" 
+d="M595 22q0 100 -165 100q-158 0 -158 -104q0 -101 172 -101q151 0 151 105zM536 777q0 61 -30 102t-89 41q-124 0 -124 -145q0 -135 124 -135q119 0 119 137zM805 1101v-202q-36 -12 -79 -22q16 -43 16 -84q0 -127 -73 -216.5t-197 -112.5q-40 -8 -59.5 -27t-19.5 -58
+q0 -31 22.5 -51.5t58 -32t78.5 -22t86 -25.5t78.5 -37.5t58 -64t22.5 -98.5q0 -304 -363 -304q-69 0 -130 12.5t-116 41t-87.5 82t-32.5 127.5q0 165 182 225v4q-67 41 -67 126q0 109 63 137v4q-72 24 -119.5 108.5t-47.5 165.5q0 139 95 231.5t235 92.5q96 0 178 -47
+q98 0 218 47zM1123 220h-222q4 45 4 134v609q0 94 -4 128h222q-4 -33 -4 -124v-613q0 -89 4 -134zM1724 442v-196q-71 -39 -174 -39q-62 0 -107 20t-70 50t-39.5 78t-18.5 92t-4 103v351h2v4q-7 0 -19 1t-18 1q-21 0 -59 -6v190h96v76q0 54 -6 89h227q-6 -41 -6 -165h171
+v-190q-15 0 -43.5 2t-42.5 2h-85v-365q0 -131 87 -131q61 0 109 33zM1148 1389q0 -58 -39 -101.5t-96 -43.5q-58 0 -98 43.5t-40 101.5q0 59 39.5 103t98.5 44q58 0 96.5 -44.5t38.5 -102.5z" />
+    <glyph glyph-name="_439" unicode="&#xf1d4;" 
+d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="uniF1D5" unicode="&#xf1d5;" horiz-adv-x="1280" 
+d="M842 964q0 -80 -57 -136.5t-136 -56.5q-60 0 -111 35q-62 -67 -115 -146q-247 -371 -202 -859q1 -22 -12.5 -38.5t-34.5 -18.5h-5q-20 0 -35 13.5t-17 33.5q-14 126 -3.5 247.5t29.5 217t54 186t69 155.5t74 125q61 90 132 165q-16 35 -16 77q0 80 56.5 136.5t136.5 56.5
+t136.5 -56.5t56.5 -136.5zM1223 953q0 -158 -78 -292t-212.5 -212t-292.5 -78q-64 0 -131 14q-21 5 -32.5 23.5t-6.5 39.5q5 20 23 31.5t39 7.5q51 -13 108 -13q97 0 186 38t153 102t102 153t38 186t-38 186t-102 153t-153 102t-186 38t-186 -38t-153 -102t-102 -153
+t-38 -186q0 -114 52 -218q10 -20 3.5 -40t-25.5 -30t-39.5 -3t-30.5 26q-64 123 -64 265q0 119 46.5 227t124.5 186t186 124t226 46q158 0 292.5 -78t212.5 -212.5t78 -292.5z" />
+    <glyph glyph-name="uniF1D6" unicode="&#xf1d6;" horiz-adv-x="1792" 
+d="M270 730q-8 19 -8 52q0 20 11 49t24 45q-1 22 7.5 53t22.5 43q0 139 92.5 288.5t217.5 209.5q139 66 324 66q133 0 266 -55q49 -21 90 -48t71 -56t55 -68t42 -74t32.5 -84.5t25.5 -89.5t22 -98l1 -5q55 -83 55 -150q0 -14 -9 -40t-9 -38q0 -1 1.5 -3.5t3.5 -5t2 -3.5
+q77 -114 120.5 -214.5t43.5 -208.5q0 -43 -19.5 -100t-55.5 -57q-9 0 -19.5 7.5t-19 17.5t-19 26t-16 26.5t-13.5 26t-9 17.5q-1 1 -3 1l-5 -4q-59 -154 -132 -223q20 -20 61.5 -38.5t69 -41.5t35.5 -65q-2 -4 -4 -16t-7 -18q-64 -97 -302 -97q-53 0 -110.5 9t-98 20
+t-104.5 30q-15 5 -23 7q-14 4 -46 4.5t-40 1.5q-41 -45 -127.5 -65t-168.5 -20q-35 0 -69 1.5t-93 9t-101 20.5t-74.5 40t-32.5 64q0 40 10 59.5t41 48.5q11 2 40.5 13t49.5 12q4 0 14 2q2 2 2 4l-2 3q-48 11 -108 105.5t-73 156.5l-5 3q-4 0 -12 -20q-18 -41 -54.5 -74.5
+t-77.5 -37.5h-1q-4 0 -6 4.5t-5 5.5q-23 54 -23 100q0 275 252 466z" />
+    <glyph glyph-name="uniF1D7" unicode="&#xf1d7;" horiz-adv-x="2048" 
+d="M580 1075q0 41 -25 66t-66 25q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 66 24.5t25 65.5zM1323 568q0 28 -25.5 50t-65.5 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q40 0 65.5 22t25.5 51zM1087 1075q0 41 -24.5 66t-65.5 25
+q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 65.5 24.5t24.5 65.5zM1722 568q0 28 -26 50t-65 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q39 0 65 22t26 51zM1456 965q-31 4 -70 4q-169 0 -311 -77t-223.5 -208.5t-81.5 -287.5
+q0 -78 23 -152q-35 -3 -68 -3q-26 0 -50 1.5t-55 6.5t-44.5 7t-54.5 10.5t-50 10.5l-253 -127l72 218q-290 203 -290 490q0 169 97.5 311t264 223.5t363.5 81.5q176 0 332.5 -66t262 -182.5t136.5 -260.5zM2048 404q0 -117 -68.5 -223.5t-185.5 -193.5l55 -181l-199 109
+q-150 -37 -218 -37q-169 0 -311 70.5t-223.5 191.5t-81.5 264t81.5 264t223.5 191.5t311 70.5q161 0 303 -70.5t227.5 -192t85.5 -263.5z" />
+    <glyph glyph-name="_443" unicode="&#xf1d8;" horiz-adv-x="1792" 
+d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-453 185l-242 -295q-18 -23 -49 -23q-13 0 -22 4q-19 7 -30.5 23.5t-11.5 36.5v349l864 1059l-1069 -925l-395 162q-37 14 -40 55q-2 40 32 59l1664 960q15 9 32 9q20 0 36 -11z" />
+    <glyph glyph-name="_444" unicode="&#xf1d9;" horiz-adv-x="1792" 
+d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-527 215l-298 -327q-18 -21 -47 -21q-14 0 -23 4q-19 7 -30 23.5t-11 36.5v452l-472 193q-37 14 -40 55q-3 39 32 59l1664 960q35 21 68 -2zM1422 26l221 1323l-1434 -827l336 -137
+l863 639l-478 -797z" />
+    <glyph glyph-name="_445" unicode="&#xf1da;" 
+d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5
+t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298zM896 928v-448q0 -14 -9 -23
+t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_446" unicode="&#xf1db;" 
+d="M768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103
+t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_447" unicode="&#xf1dc;" horiz-adv-x="1792" 
+d="M1682 -128q-44 0 -132.5 3.5t-133.5 3.5q-44 0 -132 -3.5t-132 -3.5q-24 0 -37 20.5t-13 45.5q0 31 17 46t39 17t51 7t45 15q33 21 33 140l-1 391q0 21 -1 31q-13 4 -50 4h-675q-38 0 -51 -4q-1 -10 -1 -31l-1 -371q0 -142 37 -164q16 -10 48 -13t57 -3.5t45 -15
+t20 -45.5q0 -26 -12.5 -48t-36.5 -22q-47 0 -139.5 3.5t-138.5 3.5q-43 0 -128 -3.5t-127 -3.5q-23 0 -35.5 21t-12.5 45q0 30 15.5 45t36 17.5t47.5 7.5t42 15q33 23 33 143l-1 57v813q0 3 0.5 26t0 36.5t-1.5 38.5t-3.5 42t-6.5 36.5t-11 31.5t-16 18q-15 10 -45 12t-53 2
+t-41 14t-18 45q0 26 12 48t36 22q46 0 138.5 -3.5t138.5 -3.5q42 0 126.5 3.5t126.5 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17 -43.5t-38.5 -14.5t-49.5 -4t-43 -13q-35 -21 -35 -160l1 -320q0 -21 1 -32q13 -3 39 -3h699q25 0 38 3q1 11 1 32l1 320q0 139 -35 160
+q-18 11 -58.5 12.5t-66 13t-25.5 49.5q0 26 12.5 48t37.5 22q44 0 132 -3.5t132 -3.5q43 0 129 3.5t129 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17.5 -44t-40 -14.5t-51.5 -3t-44 -12.5q-35 -23 -35 -161l1 -943q0 -119 34 -140q16 -10 46 -13.5t53.5 -4.5t41.5 -15.5t18 -44.5
+q0 -26 -12 -48t-36 -22z" />
+    <glyph glyph-name="_448" unicode="&#xf1dd;" horiz-adv-x="1280" 
+d="M1278 1347v-73q0 -29 -18.5 -61t-42.5 -32q-50 0 -54 -1q-26 -6 -32 -31q-3 -11 -3 -64v-1152q0 -25 -18 -43t-43 -18h-108q-25 0 -43 18t-18 43v1218h-143v-1218q0 -25 -17.5 -43t-43.5 -18h-108q-26 0 -43.5 18t-17.5 43v496q-147 12 -245 59q-126 58 -192 179
+q-64 117 -64 259q0 166 88 286q88 118 209 159q111 37 417 37h479q25 0 43 -18t18 -43z" />
+    <glyph glyph-name="_449" unicode="&#xf1de;" 
+d="M352 128v-128h-352v128h352zM704 256q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM864 640v-128h-864v128h864zM224 1152v-128h-224v128h224zM1536 128v-128h-736v128h736zM576 1280q26 0 45 -19t19 -45v-256
+q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1216 768q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1536 640v-128h-224v128h224zM1536 1152v-128h-864v128h864z" />
+    <glyph glyph-name="uniF1E0" unicode="&#xf1e0;" 
+d="M1216 512q133 0 226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5t-226.5 93.5t-93.5 226.5q0 12 2 34l-360 180q-92 -86 -218 -86q-133 0 -226.5 93.5t-93.5 226.5t93.5 226.5t226.5 93.5q126 0 218 -86l360 180q-2 22 -2 34q0 133 93.5 226.5t226.5 93.5
+t226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5q-126 0 -218 86l-360 -180q2 -22 2 -34t-2 -34l360 -180q92 86 218 86z" />
+    <glyph glyph-name="_451" unicode="&#xf1e1;" 
+d="M1280 341q0 88 -62.5 151t-150.5 63q-84 0 -145 -58l-241 120q2 16 2 23t-2 23l241 120q61 -58 145 -58q88 0 150.5 63t62.5 151t-62.5 150.5t-150.5 62.5t-151 -62.5t-63 -150.5q0 -7 2 -23l-241 -120q-62 57 -145 57q-88 0 -150.5 -62.5t-62.5 -150.5t62.5 -150.5
+t150.5 -62.5q83 0 145 57l241 -120q-2 -16 -2 -23q0 -88 63 -150.5t151 -62.5t150.5 62.5t62.5 150.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_452" unicode="&#xf1e2;" horiz-adv-x="1792" 
+d="M571 947q-10 25 -34 35t-49 0q-108 -44 -191 -127t-127 -191q-10 -25 0 -49t35 -34q13 -5 24 -5q42 0 60 40q34 84 98.5 148.5t148.5 98.5q25 11 35 35t0 49zM1513 1303l46 -46l-244 -243l68 -68q19 -19 19 -45.5t-19 -45.5l-64 -64q89 -161 89 -343q0 -143 -55.5 -273.5
+t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5q182 0 343 -89l64 64q19 19 45.5 19t45.5 -19l68 -68zM1521 1359q-10 -10 -22 -10q-13 0 -23 10l-91 90q-9 10 -9 23t9 23q10 9 23 9t23 -9l90 -91
+q10 -9 10 -22.5t-10 -22.5zM1751 1129q-11 -9 -23 -9t-23 9l-90 91q-10 9 -10 22.5t10 22.5q9 10 22.5 10t22.5 -10l91 -90q9 -10 9 -23t-9 -23zM1792 1312q0 -14 -9 -23t-23 -9h-96q-14 0 -23 9t-9 23t9 23t23 9h96q14 0 23 -9t9 -23zM1600 1504v-96q0 -14 -9 -23t-23 -9
+t-23 9t-9 23v96q0 14 9 23t23 9t23 -9t9 -23zM1751 1449l-91 -90q-10 -10 -22 -10q-13 0 -23 10q-10 9 -10 22.5t10 22.5l90 91q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" />
+    <glyph glyph-name="_453" unicode="&#xf1e3;" horiz-adv-x="1792" 
+d="M609 720l287 208l287 -208l-109 -336h-355zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM1515 186q149 203 149 454v3l-102 -89l-240 224l63 323
+l134 -12q-150 206 -389 282l53 -124l-287 -159l-287 159l53 124q-239 -76 -389 -282l135 12l62 -323l-240 -224l-102 89v-3q0 -251 149 -454l30 132l326 -40l139 -298l-116 -69q117 -39 240 -39t240 39l-116 69l139 298l326 40z" />
+    <glyph glyph-name="_454" unicode="&#xf1e4;" horiz-adv-x="1792" 
+d="M448 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM256 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM832 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23
+v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM66 768q-28 0 -47 19t-19 46v129h514v-129q0 -27 -19 -46t-46 -19h-383zM1216 224v-192q0 -14 -9 -23t-23 -9h-192
+q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1600 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23
+zM1408 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1016v-13h-514v10q0 104 -382 102q-382 -1 -382 -102v-10h-514v13q0 17 8.5 43t34 64t65.5 75.5t110.5 76t160 67.5t224 47.5t293.5 18.5t293 -18.5t224 -47.5
+t160.5 -67.5t110.5 -76t65.5 -75.5t34 -64t8.5 -43zM1792 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 962v-129q0 -27 -19 -46t-46 -19h-384q-27 0 -46 19t-19 46v129h514z" />
+    <glyph glyph-name="_455" unicode="&#xf1e5;" horiz-adv-x="1792" 
+d="M704 1216v-768q0 -26 -19 -45t-45 -19v-576q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v512l249 873q7 23 31 23h424zM1024 1216v-704h-256v704h256zM1792 320v-512q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v576q-26 0 -45 19t-19 45v768h424q24 0 31 -23z
+M736 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23zM1408 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_456" unicode="&#xf1e6;" horiz-adv-x="1792" 
+d="M1755 1083q37 -38 37 -90.5t-37 -90.5l-401 -400l150 -150l-160 -160q-163 -163 -389.5 -186.5t-411.5 100.5l-362 -362h-181v181l362 362q-124 185 -100.5 411.5t186.5 389.5l160 160l150 -150l400 401q38 37 91 37t90 -37t37 -90.5t-37 -90.5l-400 -401l234 -234
+l401 400q38 37 91 37t90 -37z" />
+    <glyph glyph-name="_457" unicode="&#xf1e7;" horiz-adv-x="1792" 
+d="M873 796q0 -83 -63.5 -142.5t-152.5 -59.5t-152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59t152.5 -59t63.5 -143zM1375 796q0 -83 -63 -142.5t-153 -59.5q-89 0 -152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59q90 0 153 -59t63 -143zM1600 616v667q0 87 -32 123.5
+t-111 36.5h-1112q-83 0 -112.5 -34t-29.5 -126v-673q43 -23 88.5 -40t81 -28t81 -18.5t71 -11t70 -4t58.5 -0.5t56.5 2t44.5 2q68 1 95 -27q6 -6 10 -9q26 -25 61 -51q7 91 118 87q5 0 36.5 -1.5t43 -2t45.5 -1t53 1t54.5 4.5t61 8.5t62 13.5t67 19.5t67.5 27t72 34.5z
+M1763 621q-121 -149 -372 -252q84 -285 -23 -465q-66 -113 -183 -148q-104 -32 -182 15q-86 51 -82 164l-1 326v1q-8 2 -24.5 6t-23.5 5l-1 -338q4 -114 -83 -164q-79 -47 -183 -15q-117 36 -182 150q-105 180 -22 463q-251 103 -372 252q-25 37 -4 63t60 -1q4 -2 11.5 -7
+t10.5 -8v694q0 72 47 123t114 51h1257q67 0 114 -51t47 -123v-694l21 15q39 27 60 1t-4 -63z" />
+    <glyph glyph-name="_458" unicode="&#xf1e8;" horiz-adv-x="1792" 
+d="M896 1102v-434h-145v434h145zM1294 1102v-434h-145v434h145zM1294 342l253 254v795h-1194v-1049h326v-217l217 217h398zM1692 1536v-1013l-434 -434h-326l-217 -217h-217v217h-398v1158l109 289h1483z" />
+    <glyph glyph-name="_459" unicode="&#xf1e9;" 
+d="M773 217v-127q-1 -292 -6 -305q-12 -32 -51 -40q-54 -9 -181.5 38t-162.5 89q-13 15 -17 36q-1 12 4 26q4 10 34 47t181 216q1 0 60 70q15 19 39.5 24.5t49.5 -3.5q24 -10 37.5 -29t12.5 -42zM624 468q-3 -55 -52 -70l-120 -39q-275 -88 -292 -88q-35 2 -54 36
+q-12 25 -17 75q-8 76 1 166.5t30 124.5t56 32q13 0 202 -77q71 -29 115 -47l84 -34q23 -9 35.5 -30.5t11.5 -48.5zM1450 171q-7 -54 -91.5 -161t-135.5 -127q-37 -14 -63 7q-14 10 -184 287l-47 77q-14 21 -11.5 46t19.5 46q35 43 83 26q1 -1 119 -40q203 -66 242 -79.5
+t47 -20.5q28 -22 22 -61zM778 803q5 -102 -54 -122q-58 -17 -114 71l-378 598q-8 35 19 62q41 43 207.5 89.5t224.5 31.5q40 -10 49 -45q3 -18 22 -305.5t24 -379.5zM1440 695q3 -39 -26 -59q-15 -10 -329 -86q-67 -15 -91 -23l1 2q-23 -6 -46 4t-37 32q-30 47 0 87
+q1 1 75 102q125 171 150 204t34 39q28 19 65 2q48 -23 123 -133.5t81 -167.5v-3z" />
+    <glyph glyph-name="_460" unicode="&#xf1ea;" horiz-adv-x="2048" 
+d="M1024 1024h-384v-384h384v384zM1152 384v-128h-640v128h640zM1152 1152v-640h-640v640h640zM1792 384v-128h-512v128h512zM1792 640v-128h-512v128h512zM1792 896v-128h-512v128h512zM1792 1152v-128h-512v128h512zM256 192v960h-128v-960q0 -26 19 -45t45 -19t45 19
+t19 45zM1920 192v1088h-1536v-1088q0 -33 -11 -64h1483q26 0 45 19t19 45zM2048 1408v-1216q0 -80 -56 -136t-136 -56h-1664q-80 0 -136 56t-56 136v1088h256v128h1792z" />
+    <glyph glyph-name="_461" unicode="&#xf1eb;" horiz-adv-x="2048" 
+d="M1024 13q-20 0 -93 73.5t-73 93.5q0 32 62.5 54t103.5 22t103.5 -22t62.5 -54q0 -20 -73 -93.5t-93 -73.5zM1294 284q-2 0 -40 25t-101.5 50t-128.5 25t-128.5 -25t-101 -50t-40.5 -25q-18 0 -93.5 75t-75.5 93q0 13 10 23q78 77 196 121t233 44t233 -44t196 -121
+q10 -10 10 -23q0 -18 -75.5 -93t-93.5 -75zM1567 556q-11 0 -23 8q-136 105 -252 154.5t-268 49.5q-85 0 -170.5 -22t-149 -53t-113.5 -62t-79 -53t-31 -22q-17 0 -92 75t-75 93q0 12 10 22q132 132 320 205t380 73t380 -73t320 -205q10 -10 10 -22q0 -18 -75 -93t-92 -75z
+M1838 827q-11 0 -22 9q-179 157 -371.5 236.5t-420.5 79.5t-420.5 -79.5t-371.5 -236.5q-11 -9 -22 -9q-17 0 -92.5 75t-75.5 93q0 13 10 23q187 186 445 288t527 102t527 -102t445 -288q10 -10 10 -23q0 -18 -75.5 -93t-92.5 -75z" />
+    <glyph glyph-name="_462" unicode="&#xf1ec;" horiz-adv-x="1792" 
+d="M384 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5
+t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5
+t37.5 90.5zM384 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 768q0 53 -37.5 90.5t-90.5 37.5
+t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1536 0v384q0 52 -38 90t-90 38t-90 -38t-38 -90v-384q0 -52 38 -90t90 -38t90 38t38 90zM1152 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z
+M1536 1088v256q0 26 -19 45t-45 19h-1280q-26 0 -45 -19t-19 -45v-256q0 -26 19 -45t45 -19h1280q26 0 45 19t19 45zM1536 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1408v-1536q0 -52 -38 -90t-90 -38
+h-1408q-52 0 -90 38t-38 90v1536q0 52 38 90t90 38h1408q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_463" unicode="&#xf1ed;" 
+d="M1519 890q18 -84 -4 -204q-87 -444 -565 -444h-44q-25 0 -44 -16.5t-24 -42.5l-4 -19l-55 -346l-2 -15q-5 -26 -24.5 -42.5t-44.5 -16.5h-251q-21 0 -33 15t-9 36q9 56 26.5 168t26.5 168t27 167.5t27 167.5q5 37 43 37h131q133 -2 236 21q175 39 287 144q102 95 155 246
+q24 70 35 133q1 6 2.5 7.5t3.5 1t6 -3.5q79 -59 98 -162zM1347 1172q0 -107 -46 -236q-80 -233 -302 -315q-113 -40 -252 -42q0 -1 -90 -1l-90 1q-100 0 -118 -96q-2 -8 -85 -530q-1 -10 -12 -10h-295q-22 0 -36.5 16.5t-11.5 38.5l232 1471q5 29 27.5 48t51.5 19h598
+q34 0 97.5 -13t111.5 -32q107 -41 163.5 -123t56.5 -196z" />
+    <glyph glyph-name="_464" unicode="&#xf1ee;" horiz-adv-x="1792" 
+d="M441 864q33 0 52 -26q266 -364 362 -774h-446q-127 441 -367 749q-12 16 -3 33.5t29 17.5h373zM1000 507q-49 -199 -125 -393q-79 310 -256 594q40 221 44 449q211 -340 337 -650zM1099 1216q235 -324 384.5 -698.5t184.5 -773.5h-451q-41 665 -553 1472h435zM1792 640
+q0 -424 -101 -812q-67 560 -359 1083q-25 301 -106 584q-4 16 5.5 28.5t25.5 12.5h359q21 0 38.5 -13t22.5 -33q115 -409 115 -850z" />
+    <glyph glyph-name="uniF1F0" unicode="&#xf1f0;" horiz-adv-x="2304" 
+d="M1975 546h-138q14 37 66 179l3 9q4 10 10 26t9 26l12 -55zM531 611l-58 295q-11 54 -75 54h-268l-2 -13q311 -79 403 -336zM710 960l-162 -438l-17 89q-26 70 -85 129.5t-131 88.5l135 -510h175l261 641h-176zM849 318h166l104 642h-166zM1617 944q-69 27 -149 27
+q-123 0 -201 -59t-79 -153q-1 -102 145 -174q48 -23 67 -41t19 -39q0 -30 -30 -46t-69 -16q-86 0 -156 33l-22 11l-23 -144q74 -34 185 -34q130 -1 208.5 59t80.5 160q0 106 -140 174q-49 25 -71 42t-22 38q0 22 24.5 38.5t70.5 16.5q70 1 124 -24l15 -8zM2042 960h-128
+q-65 0 -87 -54l-246 -588h174l35 96h212q5 -22 20 -96h154zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_466" unicode="&#xf1f1;" horiz-adv-x="2304" 
+d="M1119 1195q-128 85 -281 85q-103 0 -197.5 -40.5t-162.5 -108.5t-108.5 -162t-40.5 -197q0 -104 40.5 -198t108.5 -162t162 -108.5t198 -40.5q153 0 281 85q-131 107 -178 265.5t0.5 316.5t177.5 265zM1152 1171q-126 -99 -172 -249.5t-0.5 -300.5t172.5 -249
+q127 99 172.5 249t-0.5 300.5t-172 249.5zM1185 1195q130 -107 177.5 -265.5t0.5 -317t-178 -264.5q128 -85 281 -85q104 0 198 40.5t162 108.5t108.5 162t40.5 198q0 103 -40.5 197t-108.5 162t-162.5 108.5t-197.5 40.5q-153 0 -281 -85zM1926 473h7v3h-17v-3h7v-17h3v17z
+M1955 456h4v20h-5l-6 -13l-6 13h-5v-20h3v15l6 -13h4l5 13v-15zM1947 16v-2h-2h-3v3h3h2v-1zM1947 7h3l-4 5h2l1 1q1 1 1 3t-1 3l-1 1h-3h-6v-13h3v5h1zM685 75q0 19 11 31t30 12q18 0 29 -12.5t11 -30.5q0 -19 -11 -31t-29 -12q-19 0 -30 12t-11 31zM1158 119q30 0 35 -32
+h-70q5 32 35 32zM1514 75q0 19 11 31t29 12t29.5 -12.5t11.5 -30.5q0 -19 -11 -31t-30 -12q-18 0 -29 12t-11 31zM1786 75q0 18 11.5 30.5t29.5 12.5t29.5 -12.5t11.5 -30.5q0 -19 -11.5 -31t-29.5 -12t-29.5 12.5t-11.5 30.5zM1944 3q-2 0 -4 1q-1 0 -3 2t-2 3q-1 2 -1 4
+q0 3 1 4q0 2 2 4l1 1q2 0 2 1q2 1 4 1q3 0 4 -1l4 -2l2 -4v-1q1 -2 1 -3l-1 -1v-3t-1 -1l-1 -2q-2 -2 -4 -2q-1 -1 -4 -1zM599 7h30v85q0 24 -14.5 38.5t-39.5 15.5q-32 0 -47 -24q-14 24 -45 24q-24 0 -39 -20v16h-30v-135h30v75q0 36 33 36q30 0 30 -36v-75h29v75
+q0 36 33 36q30 0 30 -36v-75zM765 7h29v68v67h-29v-16q-17 20 -43 20q-29 0 -48 -20t-19 -51t19 -51t48 -20q28 0 43 20v-17zM943 48q0 34 -47 40l-14 2q-23 4 -23 14q0 15 25 15q23 0 43 -11l12 24q-22 14 -55 14q-26 0 -41 -12t-15 -32q0 -33 47 -39l13 -2q24 -4 24 -14
+q0 -17 -31 -17q-25 0 -45 14l-13 -23q25 -17 58 -17q29 0 45.5 12t16.5 32zM1073 14l-8 25q-13 -7 -26 -7q-19 0 -19 22v61h48v27h-48v41h-30v-41h-28v-27h28v-61q0 -50 47 -50q21 0 36 10zM1159 146q-29 0 -48 -20t-19 -51q0 -32 19.5 -51.5t49.5 -19.5q33 0 55 19l-14 22
+q-18 -15 -39 -15q-34 0 -41 33h101v12q0 32 -18 51.5t-46 19.5zM1318 146q-23 0 -35 -20v16h-30v-135h30v76q0 35 29 35q10 0 18 -4l9 28q-9 4 -21 4zM1348 75q0 -31 19.5 -51t52.5 -20q29 0 48 16l-14 24q-18 -13 -35 -12q-18 0 -29.5 12t-11.5 31t11.5 31t29.5 12
+q19 0 35 -12l14 24q-20 16 -48 16q-33 0 -52.5 -20t-19.5 -51zM1593 7h30v68v67h-30v-16q-15 20 -42 20q-29 0 -48.5 -20t-19.5 -51t19.5 -51t48.5 -20q28 0 42 20v-17zM1726 146q-23 0 -35 -20v16h-29v-135h29v76q0 35 29 35q10 0 18 -4l9 28q-8 4 -21 4zM1866 7h29v68v122
+h-29v-71q-15 20 -43 20t-47.5 -20.5t-19.5 -50.5t19.5 -50.5t47.5 -20.5q29 0 43 20v-17zM1944 27l-2 -1h-3q-2 -1 -4 -3q-3 -1 -3 -4q-1 -2 -1 -6q0 -3 1 -5q0 -2 3 -4q2 -2 4 -3t5 -1q4 0 6 1q0 1 2 2l2 1q1 1 3 4q1 2 1 5q0 4 -1 6q-1 1 -3 4q0 1 -2 2l-2 1q-1 0 -3 0.5
+t-3 0.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_467" unicode="&#xf1f2;" horiz-adv-x="2304" 
+d="M313 759q0 -51 -36 -84q-29 -26 -89 -26h-17v220h17q61 0 89 -27q36 -31 36 -83zM2089 824q0 -52 -64 -52h-19v101h20q63 0 63 -49zM380 759q0 74 -50 120.5t-129 46.5h-95v-333h95q74 0 119 38q60 51 60 128zM410 593h65v333h-65v-333zM730 694q0 40 -20.5 62t-75.5 42
+q-29 10 -39.5 19t-10.5 23q0 16 13.5 26.5t34.5 10.5q29 0 53 -27l34 44q-41 37 -98 37q-44 0 -74 -27.5t-30 -67.5q0 -35 18 -55.5t64 -36.5q37 -13 45 -19q19 -12 19 -34q0 -20 -14 -33.5t-36 -13.5q-48 0 -71 44l-42 -40q44 -64 115 -64q51 0 83 30.5t32 79.5zM1008 604
+v77q-37 -37 -78 -37q-49 0 -80.5 32.5t-31.5 82.5q0 48 31.5 81.5t77.5 33.5q43 0 81 -38v77q-40 20 -80 20q-74 0 -125.5 -50.5t-51.5 -123.5t51 -123.5t125 -50.5q42 0 81 19zM2240 0v527q-65 -40 -144.5 -84t-237.5 -117t-329.5 -137.5t-417.5 -134.5t-504 -118h1569
+q26 0 45 19t19 45zM1389 757q0 75 -53 128t-128 53t-128 -53t-53 -128t53 -128t128 -53t128 53t53 128zM1541 584l144 342h-71l-90 -224l-89 224h-71l142 -342h35zM1714 593h184v56h-119v90h115v56h-115v74h119v57h-184v-333zM2105 593h80l-105 140q76 16 76 94q0 47 -31 73
+t-87 26h-97v-333h65v133h9zM2304 1274v-1268q0 -56 -38.5 -95t-93.5 -39h-2040q-55 0 -93.5 39t-38.5 95v1268q0 56 38.5 95t93.5 39h2040q55 0 93.5 -39t38.5 -95z" />
+    <glyph glyph-name="f1f3" unicode="&#xf1f3;" horiz-adv-x="2304" 
+d="M119 854h89l-45 108zM740 328l74 79l-70 79h-163v-49h142v-55h-142v-54h159zM898 406l99 -110v217zM1186 453q0 33 -40 33h-84v-69h83q41 0 41 36zM1475 457q0 29 -42 29h-82v-61h81q43 0 43 32zM1197 923q0 29 -42 29h-82v-60h81q43 0 43 31zM1656 854h89l-44 108z
+M699 1009v-271h-66v212l-94 -212h-57l-94 212v-212h-132l-25 60h-135l-25 -60h-70l116 271h96l110 -257v257h106l85 -184l77 184h108zM1255 453q0 -20 -5.5 -35t-14 -25t-22.5 -16.5t-26 -10t-31.5 -4.5t-31.5 -1t-32.5 0.5t-29.5 0.5v-91h-126l-80 90l-83 -90h-256v271h260
+l80 -89l82 89h207q109 0 109 -89zM964 794v-56h-217v271h217v-57h-152v-49h148v-55h-148v-54h152zM2304 235v-229q0 -55 -38.5 -94.5t-93.5 -39.5h-2040q-55 0 -93.5 39.5t-38.5 94.5v678h111l25 61h55l25 -61h218v46l19 -46h113l20 47v-47h541v99l10 1q10 0 10 -14v-86h279
+v23q23 -12 55 -18t52.5 -6.5t63 0.5t51.5 1l25 61h56l25 -61h227v58l34 -58h182v378h-180v-44l-25 44h-185v-44l-23 44h-249q-69 0 -109 -22v22h-172v-22q-24 22 -73 22h-628l-43 -97l-43 97h-198v-44l-22 44h-169l-78 -179v391q0 55 38.5 94.5t93.5 39.5h2040
+q55 0 93.5 -39.5t38.5 -94.5v-678h-120q-51 0 -81 -22v22h-177q-55 0 -78 -22v22h-316v-22q-31 22 -87 22h-209v-22q-23 22 -91 22h-234l-54 -58l-50 58h-349v-378h343l55 59l52 -59h211v89h21q59 0 90 13v-102h174v99h8q8 0 10 -2t2 -10v-87h529q57 0 88 24v-24h168
+q60 0 95 17zM1546 469q0 -23 -12 -43t-34 -29q25 -9 34 -26t9 -46v-54h-65v45q0 33 -12 43.5t-46 10.5h-69v-99h-65v271h154q48 0 77 -15t29 -58zM1269 936q0 -24 -12.5 -44t-33.5 -29q26 -9 34.5 -25.5t8.5 -46.5v-53h-65q0 9 0.5 26.5t0 25t-3 18.5t-8.5 16t-17.5 8.5
+t-29.5 3.5h-70v-98h-64v271l153 -1q49 0 78 -14.5t29 -57.5zM1798 327v-56h-216v271h216v-56h-151v-49h148v-55h-148v-54zM1372 1009v-271h-66v271h66zM2065 357q0 -86 -102 -86h-126v58h126q34 0 34 25q0 16 -17 21t-41.5 5t-49.5 3.5t-42 22.5t-17 55q0 39 26 60t66 21
+h130v-57h-119q-36 0 -36 -25q0 -16 17.5 -20.5t42 -4t49 -2.5t42 -21.5t17.5 -54.5zM2304 407v-101q-24 -35 -88 -35h-125v58h125q33 0 33 25q0 13 -12.5 19t-31 5.5t-40 2t-40 8t-31 24t-12.5 48.5q0 39 26.5 60t66.5 21h129v-57h-118q-36 0 -36 -25q0 -20 29 -22t68.5 -5
+t56.5 -26zM2139 1008v-270h-92l-122 203v-203h-132l-26 60h-134l-25 -60h-75q-129 0 -129 133q0 138 133 138h63v-59q-7 0 -28 1t-28.5 0.5t-23 -2t-21.5 -6.5t-14.5 -13.5t-11.5 -23t-3 -33.5q0 -38 13.5 -58t49.5 -20h29l92 213h97l109 -256v256h99l114 -188v188h66z" />
+    <glyph glyph-name="_469" unicode="&#xf1f4;" horiz-adv-x="2304" 
+d="M745 630q0 -37 -25.5 -61.5t-62.5 -24.5q-29 0 -46.5 16t-17.5 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM1530 779q0 -42 -22 -57t-66 -15l-32 -1l17 107q2 11 13 11h18q22 0 35 -2t25 -12.5t12 -30.5zM1881 630q0 -36 -25.5 -61t-61.5 -25q-29 0 -47 16
+t-18 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM513 801q0 59 -38.5 85.5t-100.5 26.5h-160q-19 0 -21 -19l-65 -408q-1 -6 3 -11t10 -5h76q20 0 22 19l18 110q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM822 489l41 261q1 6 -3 11t-10 5h-76
+q-14 0 -17 -33q-27 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q28 0 58 12t48 32q-4 -12 -4 -21q0 -16 13 -16h69q19 0 22 19zM1269 752q0 5 -4 9.5t-9 4.5h-77q-11 0 -18 -10l-106 -156l-44 150q-5 16 -22 16h-75q-5 0 -9 -4.5t-4 -9.5q0 -2 19.5 -59
+t42 -123t23.5 -70q-82 -112 -82 -120q0 -13 13 -13h77q11 0 18 10l255 368q2 2 2 7zM1649 801q0 59 -38.5 85.5t-100.5 26.5h-159q-20 0 -22 -19l-65 -408q-1 -6 3 -11t10 -5h82q12 0 16 13l18 116q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM1958 489
+l41 261q1 6 -3 11t-10 5h-76q-14 0 -17 -33q-26 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q29 0 59 12t47 32q0 -1 -2 -9t-2 -12q0 -16 13 -16h69q19 0 22 19zM2176 898v1q0 14 -13 14h-74q-11 0 -13 -11l-65 -416l-1 -2q0 -5 4 -9.5t10 -4.5h66
+q19 0 21 19zM392 764q-5 -35 -26 -46t-60 -11l-33 -1l17 107q2 11 13 11h19q40 0 58 -11.5t12 -48.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_470" unicode="&#xf1f5;" horiz-adv-x="2304" 
+d="M1597 633q0 -69 -21 -106q-19 -35 -52 -35q-23 0 -41 9v224q29 30 57 30q57 0 57 -122zM2035 669h-110q6 98 56 98q51 0 54 -98zM476 534q0 59 -33 91.5t-101 57.5q-36 13 -52 24t-16 25q0 26 38 26q58 0 124 -33l18 112q-67 32 -149 32q-77 0 -123 -38q-48 -39 -48 -109
+q0 -58 32.5 -90.5t99.5 -56.5q39 -14 54.5 -25.5t15.5 -27.5q0 -31 -48 -31q-29 0 -70 12.5t-72 30.5l-18 -113q72 -41 168 -41q81 0 129 37q51 41 51 117zM771 749l19 111h-96v135l-129 -21l-18 -114l-46 -8l-17 -103h62v-219q0 -84 44 -120q38 -30 111 -30q32 0 79 11v118
+q-32 -7 -44 -7q-42 0 -42 50v197h77zM1087 724v139q-15 3 -28 3q-32 0 -55.5 -16t-33.5 -46l-10 56h-131v-471h150v306q26 31 82 31q16 0 26 -2zM1124 389h150v471h-150v-471zM1746 638q0 122 -45 179q-40 52 -111 52q-64 0 -117 -56l-8 47h-132v-645l150 25v151
+q36 -11 68 -11q83 0 134 56q61 65 61 202zM1278 986q0 33 -23 56t-56 23t-56 -23t-23 -56t23 -56.5t56 -23.5t56 23.5t23 56.5zM2176 629q0 113 -48 176q-50 64 -144 64q-96 0 -151.5 -66t-55.5 -180q0 -128 63 -188q55 -55 161 -55q101 0 160 40l-16 103q-57 -31 -128 -31
+q-43 0 -63 19q-23 19 -28 66h248q2 14 2 52zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_471" unicode="&#xf1f6;" horiz-adv-x="2048" 
+d="M1558 684q61 -356 298 -556q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5zM1024 -176q16 0 16 16t-16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5zM2026 1424q8 -10 7.5 -23.5t-10.5 -22.5
+l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5
+l418 363q10 8 23.5 7t21.5 -11z" />
+    <glyph glyph-name="_472" unicode="&#xf1f7;" horiz-adv-x="2048" 
+d="M1040 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM503 315l877 760q-42 88 -132.5 146.5t-223.5 58.5q-93 0 -169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -384 -137 -645zM1856 128
+q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5l149 129h757q-166 187 -227 459l111 97q61 -356 298 -556zM1942 1520l84 -96q8 -10 7.5 -23.5t-10.5 -22.5l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161
+q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5l418 363q10 8 23.5 7t21.5 -11z" />
+    <glyph glyph-name="_473" unicode="&#xf1f8;" horiz-adv-x="1408" 
+d="M512 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM768 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1024 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704
+q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167
+q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_474" unicode="&#xf1f9;" 
+d="M1150 462v-109q0 -50 -36.5 -89t-94 -60.5t-118 -32.5t-117.5 -11q-205 0 -342.5 139t-137.5 346q0 203 136 339t339 136q34 0 75.5 -4.5t93 -18t92.5 -34t69 -56.5t28 -81v-109q0 -16 -16 -16h-118q-16 0 -16 16v70q0 43 -65.5 67.5t-137.5 24.5q-140 0 -228.5 -91.5
+t-88.5 -237.5q0 -151 91.5 -249.5t233.5 -98.5q68 0 138 24t70 66v70q0 7 4.5 11.5t10.5 4.5h119q6 0 11 -4.5t5 -11.5zM768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5
+t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_475" unicode="&#xf1fa;" 
+d="M972 761q0 108 -53.5 169t-147.5 61q-63 0 -124 -30.5t-110 -84.5t-79.5 -137t-30.5 -180q0 -112 53.5 -173t150.5 -61q96 0 176 66.5t122.5 166t42.5 203.5zM1536 640q0 -111 -37 -197t-98.5 -135t-131.5 -74.5t-145 -27.5q-6 0 -15.5 -0.5t-16.5 -0.5q-95 0 -142 53
+q-28 33 -33 83q-52 -66 -131.5 -110t-173.5 -44q-161 0 -249.5 95.5t-88.5 269.5q0 157 66 290t179 210.5t246 77.5q87 0 155 -35.5t106 -99.5l2 19l11 56q1 6 5.5 12t9.5 6h118q5 0 13 -11q5 -5 3 -16l-120 -614q-5 -24 -5 -48q0 -39 12.5 -52t44.5 -13q28 1 57 5.5t73 24
+t77 50t57 89.5t24 137q0 292 -174 466t-466 174q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51q228 0 405 144q11 9 24 8t21 -12l41 -49q8 -12 7 -24q-2 -13 -12 -22q-102 -83 -227.5 -128t-258.5 -45q-156 0 -298 61
+t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q344 0 556 -212t212 -556z" />
+    <glyph glyph-name="_476" unicode="&#xf1fb;" horiz-adv-x="1792" 
+d="M1698 1442q94 -94 94 -226.5t-94 -225.5l-225 -223l104 -104q10 -10 10 -23t-10 -23l-210 -210q-10 -10 -23 -10t-23 10l-105 105l-603 -603q-37 -37 -90 -37h-203l-256 -128l-64 64l128 256v203q0 53 37 90l603 603l-105 105q-10 10 -10 23t10 23l210 210q10 10 23 10
+t23 -10l104 -104l223 225q93 94 225.5 94t226.5 -94zM512 64l576 576l-192 192l-576 -576v-192h192z" />
+    <glyph glyph-name="f1fc" unicode="&#xf1fc;" horiz-adv-x="1792" 
+d="M1615 1536q70 0 122.5 -46.5t52.5 -116.5q0 -63 -45 -151q-332 -629 -465 -752q-97 -91 -218 -91q-126 0 -216.5 92.5t-90.5 219.5q0 128 92 212l638 579q59 54 130 54zM706 502q39 -76 106.5 -130t150.5 -76l1 -71q4 -213 -129.5 -347t-348.5 -134q-123 0 -218 46.5
+t-152.5 127.5t-86.5 183t-29 220q7 -5 41 -30t62 -44.5t59 -36.5t46 -17q41 0 55 37q25 66 57.5 112.5t69.5 76t88 47.5t103 25.5t125 10.5z" />
+    <glyph glyph-name="_478" unicode="&#xf1fd;" horiz-adv-x="1792" 
+d="M1792 128v-384h-1792v384q45 0 85 14t59 27.5t47 37.5q30 27 51.5 38t56.5 11q24 0 44 -7t31 -15t33 -27q29 -25 47 -38t58 -27t86 -14q45 0 85 14.5t58 27t48 37.5q21 19 32.5 27t31 15t43.5 7q35 0 56.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14t85 14t59 27.5
+t47 37.5q30 27 51.5 38t56.5 11q34 0 55.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14zM1792 448v-192q-24 0 -44 7t-31 15t-33 27q-29 25 -47 38t-58 27t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-22 -19 -33 -27t-31 -15t-44 -7q-35 0 -56.5 11t-51.5 38q-29 25 -47 38
+t-58 27t-86 14q-45 0 -85 -14.5t-58 -27t-48 -37.5q-21 -19 -32.5 -27t-31 -15t-43.5 -7q-35 0 -56.5 11t-51.5 38q-28 24 -47 37.5t-59 27.5t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-30 -27 -51.5 -38t-56.5 -11v192q0 80 56 136t136 56h64v448h256v-448h256v448h256v-448
+h256v448h256v-448h64q80 0 136 -56t56 -136zM512 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1024 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5
+q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1536 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150z" />
+    <glyph glyph-name="_479" unicode="&#xf1fe;" horiz-adv-x="2048" 
+d="M2048 0v-128h-2048v1536h128v-1408h1920zM1664 1024l256 -896h-1664v576l448 576l576 -576z" />
+    <glyph glyph-name="_480" unicode="&#xf200;" horiz-adv-x="1792" 
+d="M768 646l546 -546q-106 -108 -247.5 -168t-298.5 -60q-209 0 -385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103v-762zM955 640h773q0 -157 -60 -298.5t-168 -247.5zM1664 768h-768v768q209 0 385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_481" unicode="&#xf201;" horiz-adv-x="2048" 
+d="M2048 0v-128h-2048v1536h128v-1408h1920zM1920 1248v-435q0 -21 -19.5 -29.5t-35.5 7.5l-121 121l-633 -633q-10 -10 -23 -10t-23 10l-233 233l-416 -416l-192 192l585 585q10 10 23 10t23 -10l233 -233l464 464l-121 121q-16 16 -7.5 35.5t29.5 19.5h435q14 0 23 -9
+t9 -23z" />
+    <glyph glyph-name="_482" unicode="&#xf202;" horiz-adv-x="1792" 
+d="M1292 832q0 -6 10 -41q10 -29 25 -49.5t41 -34t44 -20t55 -16.5q325 -91 325 -332q0 -146 -105.5 -242.5t-254.5 -96.5q-59 0 -111.5 18.5t-91.5 45.5t-77 74.5t-63 87.5t-53.5 103.5t-43.5 103t-39.5 106.5t-35.5 95q-32 81 -61.5 133.5t-73.5 96.5t-104 64t-142 20
+q-96 0 -183 -55.5t-138 -144.5t-51 -185q0 -160 106.5 -279.5t263.5 -119.5q177 0 258 95q56 63 83 116l84 -152q-15 -34 -44 -70l1 -1q-131 -152 -388 -152q-147 0 -269.5 79t-190.5 207.5t-68 274.5q0 105 43.5 206t116 176.5t172 121.5t204.5 46q87 0 159 -19t123.5 -50
+t95 -80t72.5 -99t58.5 -117t50.5 -124.5t50 -130.5t55 -127q96 -200 233 -200q81 0 138.5 48.5t57.5 128.5q0 42 -19 72t-50.5 46t-72.5 31.5t-84.5 27t-87.5 34t-81 52t-65 82t-39 122.5q-3 16 -3 33q0 110 87.5 192t198.5 78q78 -3 120.5 -14.5t90.5 -53.5h-1
+q12 -11 23 -24.5t26 -36t19 -27.5l-129 -99q-26 49 -54 70v1q-23 21 -97 21q-49 0 -84 -33t-35 -83z" />
+    <glyph glyph-name="_483" unicode="&#xf203;" 
+d="M1432 484q0 173 -234 239q-35 10 -53 16.5t-38 25t-29 46.5q0 2 -2 8.5t-3 12t-1 7.5q0 36 24.5 59.5t60.5 23.5q54 0 71 -15h-1q20 -15 39 -51l93 71q-39 54 -49 64q-33 29 -67.5 39t-85.5 10q-80 0 -142 -57.5t-62 -137.5q0 -7 2 -23q16 -96 64.5 -140t148.5 -73
+q29 -8 49 -15.5t45 -21.5t38.5 -34.5t13.5 -46.5v-5q1 -58 -40.5 -93t-100.5 -35q-97 0 -167 144q-23 47 -51.5 121.5t-48 125.5t-54 110.5t-74 95.5t-103.5 60.5t-147 24.5q-101 0 -192 -56t-144 -148t-50 -192v-1q4 -108 50.5 -199t133.5 -147.5t196 -56.5q186 0 279 110
+q20 27 31 51l-60 109q-42 -80 -99 -116t-146 -36q-115 0 -191 87t-76 204q0 105 82 189t186 84q112 0 170 -53.5t104 -172.5q8 -21 25.5 -68.5t28.5 -76.5t31.5 -74.5t38.5 -74t45.5 -62.5t55.5 -53.5t66 -33t80 -13.5q107 0 183 69.5t76 174.5zM1536 1120v-960
+q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_484" unicode="&#xf204;" horiz-adv-x="2048" 
+d="M1152 640q0 104 -40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM1920 640q0 104 -40.5 198.5
+t-109.5 163.5t-163.5 109.5t-198.5 40.5h-386q119 -90 188.5 -224t69.5 -288t-69.5 -288t-188.5 -224h386q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM2048 640q0 -130 -51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5
+t-136.5 204t-51 248.5t51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5z" />
+    <glyph glyph-name="_485" unicode="&#xf205;" horiz-adv-x="2048" 
+d="M0 640q0 130 51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5t-51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5t-136.5 204t-51 248.5zM1408 128q104 0 198.5 40.5t163.5 109.5
+t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5z" />
+    <glyph glyph-name="_486" unicode="&#xf206;" horiz-adv-x="2304" 
+d="M762 384h-314q-40 0 -57.5 35t6.5 67l188 251q-65 31 -137 31q-132 0 -226 -94t-94 -226t94 -226t226 -94q115 0 203 72.5t111 183.5zM576 512h186q-18 85 -75 148zM1056 512l288 384h-480l-99 -132q105 -103 126 -252h165zM2176 448q0 132 -94 226t-226 94
+q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94t226 94t94 226zM2304 448q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 97 39.5 183.5t109.5 149.5l-65 98l-353 -469
+q-18 -26 -51 -26h-197q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q114 0 215 -55l137 183h-224q-26 0 -45 19t-19 45t19 45t45 19h384v-128h435l-85 128h-222q-26 0 -45 19t-19 45t19 45t45 19h256q33 0 53 -28l267 -400
+q91 44 192 44q185 0 316.5 -131.5t131.5 -316.5z" />
+    <glyph glyph-name="_487" unicode="&#xf207;" 
+d="M384 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1362 716l-72 384q-5 23 -22.5 37.5t-40.5 14.5
+h-918q-23 0 -40.5 -14.5t-22.5 -37.5l-72 -384q-5 -30 14 -53t49 -23h1062q30 0 49 23t14 53zM1136 1328q0 20 -14 34t-34 14h-640q-20 0 -34 -14t-14 -34t14 -34t34 -14h640q20 0 34 14t14 34zM1536 603v-603h-128v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5
+t-37.5 90.5v128h-768v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5v128h-128v603q0 112 25 223l103 454q9 78 97.5 137t230 89t312.5 30t312.5 -30t230 -89t97.5 -137l105 -454q23 -102 23 -223z" />
+    <glyph glyph-name="_488" unicode="&#xf208;" horiz-adv-x="2048" 
+d="M1463 704q0 -35 -25 -60.5t-61 -25.5h-702q-36 0 -61 25.5t-25 60.5t25 60.5t61 25.5h702q36 0 61 -25.5t25 -60.5zM1677 704q0 86 -23 170h-982q-36 0 -61 25t-25 60q0 36 25 61t61 25h908q-88 143 -235 227t-320 84q-177 0 -327.5 -87.5t-238 -237.5t-87.5 -327
+q0 -86 23 -170h982q36 0 61 -25t25 -60q0 -36 -25 -61t-61 -25h-908q88 -143 235.5 -227t320.5 -84q132 0 253 51.5t208 139t139 208t52 253.5zM2048 959q0 -35 -25 -60t-61 -25h-131q17 -85 17 -170q0 -167 -65.5 -319.5t-175.5 -263t-262.5 -176t-319.5 -65.5
+q-246 0 -448.5 133t-301.5 350h-189q-36 0 -61 25t-25 61q0 35 25 60t61 25h132q-17 85 -17 170q0 167 65.5 319.5t175.5 263t262.5 176t320.5 65.5q245 0 447.5 -133t301.5 -350h188q36 0 61 -25t25 -61z" />
+    <glyph glyph-name="_489" unicode="&#xf209;" horiz-adv-x="1280" 
+d="M953 1158l-114 -328l117 -21q165 451 165 518q0 56 -38 56q-57 0 -130 -225zM654 471l33 -88q37 42 71 67l-33 5.5t-38.5 7t-32.5 8.5zM362 1367q0 -98 159 -521q17 10 49 10q15 0 75 -5l-121 351q-75 220 -123 220q-19 0 -29 -17.5t-10 -37.5zM283 608q0 -36 51.5 -119
+t117.5 -153t100 -70q14 0 25.5 13t11.5 27q0 24 -32 102q-13 32 -32 72t-47.5 89t-61.5 81t-62 32q-20 0 -45.5 -27t-25.5 -47zM125 273q0 -41 25 -104q59 -145 183.5 -227t281.5 -82q227 0 382 170q152 169 152 427q0 43 -1 67t-11.5 62t-30.5 56q-56 49 -211.5 75.5
+t-270.5 26.5q-37 0 -49 -11q-12 -5 -12 -35q0 -34 21.5 -60t55.5 -40t77.5 -23.5t87.5 -11.5t85 -4t70 0h23q24 0 40 -19q15 -19 19 -55q-28 -28 -96 -54q-61 -22 -93 -46q-64 -46 -108.5 -114t-44.5 -137q0 -31 18.5 -88.5t18.5 -87.5l-3 -12q-4 -12 -4 -14
+q-137 10 -146 216q-8 -2 -41 -2q2 -7 2 -21q0 -53 -40.5 -89.5t-94.5 -36.5q-82 0 -166.5 78t-84.5 159q0 34 33 67q52 -64 60 -76q77 -104 133 -104q12 0 26.5 8.5t14.5 20.5q0 34 -87.5 145t-116.5 111q-43 0 -70 -44.5t-27 -90.5zM11 264q0 101 42.5 163t136.5 88
+q-28 74 -28 104q0 62 61 123t122 61q29 0 70 -15q-163 462 -163 567q0 80 41 130.5t119 50.5q131 0 325 -581q6 -17 8 -23q6 16 29 79.5t43.5 118.5t54 127.5t64.5 123t70.5 86.5t76.5 36q71 0 112 -49t41 -122q0 -108 -159 -550q61 -15 100.5 -46t58.5 -78t26 -93.5
+t7 -110.5q0 -150 -47 -280t-132 -225t-211 -150t-278 -55q-111 0 -223 42q-149 57 -258 191.5t-109 286.5z" />
+    <glyph glyph-name="_490" unicode="&#xf20a;" horiz-adv-x="2048" 
+d="M785 528h207q-14 -158 -98.5 -248.5t-214.5 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-203q-5 64 -35.5 99t-81.5 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t40 -51.5t66 -18q95 0 109 139zM1497 528h206
+q-14 -158 -98 -248.5t-214 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-204q-4 64 -35 99t-81 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t39.5 -51.5t65.5 -18q49 0 76.5 38t33.5 101zM1856 647q0 207 -15.5 307
+t-60.5 161q-6 8 -13.5 14t-21.5 15t-16 11q-86 63 -697 63q-625 0 -710 -63q-5 -4 -17.5 -11.5t-21 -14t-14.5 -14.5q-45 -60 -60 -159.5t-15 -308.5q0 -208 15 -307.5t60 -160.5q6 -8 15 -15t20.5 -14t17.5 -12q44 -33 239.5 -49t470.5 -16q610 0 697 65q5 4 17 11t20.5 14
+t13.5 16q46 60 61 159t15 309zM2048 1408v-1536h-2048v1536h2048z" />
+    <glyph glyph-name="_491" unicode="&#xf20b;" 
+d="M992 912v-496q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v496q0 112 -80 192t-192 80h-272v-1152q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v1344q0 14 9 23t23 9h464q135 0 249 -66.5t180.5 -180.5t66.5 -249zM1376 1376v-880q0 -135 -66.5 -249t-180.5 -180.5
+t-249 -66.5h-464q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h160q14 0 23 -9t9 -23v-768h272q112 0 192 80t80 192v880q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="_492" unicode="&#xf20c;" 
+d="M1311 694v-114q0 -24 -13.5 -38t-37.5 -14h-202q-24 0 -38 14t-14 38v114q0 24 14 38t38 14h202q24 0 37.5 -14t13.5 -38zM821 464v250q0 53 -32.5 85.5t-85.5 32.5h-133q-68 0 -96 -52q-28 52 -96 52h-130q-53 0 -85.5 -32.5t-32.5 -85.5v-250q0 -22 21 -22h55
+q22 0 22 22v230q0 24 13.5 38t38.5 14h94q24 0 38 -14t14 -38v-230q0 -22 21 -22h54q22 0 22 22v230q0 24 14 38t38 14h97q24 0 37.5 -14t13.5 -38v-230q0 -22 22 -22h55q21 0 21 22zM1410 560v154q0 53 -33 85.5t-86 32.5h-264q-53 0 -86 -32.5t-33 -85.5v-410
+q0 -21 22 -21h55q21 0 21 21v180q31 -42 94 -42h191q53 0 86 32.5t33 85.5zM1536 1176v-1072q0 -96 -68 -164t-164 -68h-1072q-96 0 -164 68t-68 164v1072q0 96 68 164t164 68h1072q96 0 164 -68t68 -164z" />
+    <glyph glyph-name="_493" unicode="&#xf20d;" 
+d="M915 450h-294l147 551zM1001 128h311l-324 1024h-440l-324 -1024h311l383 314zM1536 1120v-960q0 -118 -85 -203t-203 -85h-960q-118 0 -203 85t-85 203v960q0 118 85 203t203 85h960q118 0 203 -85t85 -203z" />
+    <glyph glyph-name="_494" unicode="&#xf20e;" horiz-adv-x="2048" 
+d="M2048 641q0 -21 -13 -36.5t-33 -19.5l-205 -356q3 -9 3 -18q0 -20 -12.5 -35.5t-32.5 -19.5l-193 -337q3 -8 3 -16q0 -23 -16.5 -40t-40.5 -17q-25 0 -41 18h-400q-17 -20 -43 -20t-43 20h-399q-17 -20 -43 -20q-23 0 -40 16.5t-17 40.5q0 8 4 20l-193 335
+q-20 4 -32.5 19.5t-12.5 35.5q0 9 3 18l-206 356q-20 5 -32.5 20.5t-12.5 35.5q0 21 13.5 36.5t33.5 19.5l199 344q0 1 -0.5 3t-0.5 3q0 36 34 51l209 363q-4 10 -4 18q0 24 17 40.5t40 16.5q26 0 44 -21h396q16 21 43 21t43 -21h398q18 21 44 21q23 0 40 -16.5t17 -40.5
+q0 -6 -4 -18l207 -358q23 -1 39 -17.5t16 -38.5q0 -13 -7 -27l187 -324q19 -4 31.5 -19.5t12.5 -35.5zM1063 -158h389l-342 354h-143l-342 -354h360q18 16 39 16t39 -16zM112 654q1 -4 1 -13q0 -10 -2 -15l208 -360l15 -6l188 199v347l-187 194q-13 -8 -29 -10zM986 1438
+h-388l190 -200l554 200h-280q-16 -16 -38 -16t-38 16zM1689 226q1 6 5 11l-64 68l-17 -79h76zM1583 226l22 105l-252 266l-296 -307l63 -64h463zM1495 -142l16 28l65 310h-427l333 -343q8 4 13 5zM578 -158h5l342 354h-373v-335l4 -6q14 -5 22 -13zM552 226h402l64 66
+l-309 321l-157 -166v-221zM359 226h163v189l-168 -177q4 -8 5 -12zM358 1051q0 -1 0.5 -2t0.5 -2q0 -16 -8 -29l171 -177v269zM552 1121v-311l153 -157l297 314l-223 236zM556 1425l-4 -8v-264l205 74l-191 201q-6 -2 -10 -3zM1447 1438h-16l-621 -224l213 -225zM1023 946
+l-297 -315l311 -319l296 307zM688 634l-136 141v-284zM1038 270l-42 -44h85zM1374 618l238 -251l132 624l-3 5l-1 1zM1718 1018q-8 13 -8 29v2l-216 376q-5 1 -13 5l-437 -463l310 -327zM522 1142v223l-163 -282zM522 196h-163l163 -283v283zM1607 196l-48 -227l130 227h-82
+zM1729 266l207 361q-2 10 -2 14q0 1 3 16l-171 296l-129 -612l77 -82q5 3 15 7z" />
+    <glyph glyph-name="f210" unicode="&#xf210;" 
+d="M0 856q0 131 91.5 226.5t222.5 95.5h742l352 358v-1470q0 -132 -91.5 -227t-222.5 -95h-780q-131 0 -222.5 95t-91.5 227v790zM1232 102l-176 180v425q0 46 -32 79t-78 33h-484q-46 0 -78 -33t-32 -79v-492q0 -46 32.5 -79.5t77.5 -33.5h770z" />
+    <glyph glyph-name="_496" unicode="&#xf211;" 
+d="M934 1386q-317 -121 -556 -362.5t-358 -560.5q-20 89 -20 176q0 208 102.5 384.5t278.5 279t384 102.5q82 0 169 -19zM1203 1267q93 -65 164 -155q-389 -113 -674.5 -400.5t-396.5 -676.5q-93 72 -155 162q112 386 395 671t667 399zM470 -67q115 356 379.5 622t619.5 384
+q40 -92 54 -195q-292 -120 -516 -345t-343 -518q-103 14 -194 52zM1536 -125q-193 50 -367 115q-135 -84 -290 -107q109 205 274 370.5t369 275.5q-21 -152 -101 -284q65 -175 115 -370z" />
+    <glyph glyph-name="f212" unicode="&#xf212;" horiz-adv-x="2048" 
+d="M1893 1144l155 -1272q-131 0 -257 57q-200 91 -393 91q-226 0 -374 -148q-148 148 -374 148q-193 0 -393 -91q-128 -57 -252 -57h-5l155 1272q224 127 482 127q233 0 387 -106q154 106 387 106q258 0 482 -127zM1398 157q129 0 232 -28.5t260 -93.5l-124 1021
+q-171 78 -368 78q-224 0 -374 -141q-150 141 -374 141q-197 0 -368 -78l-124 -1021q105 43 165.5 65t148.5 39.5t178 17.5q202 0 374 -108q172 108 374 108zM1438 191l-55 907q-211 -4 -359 -155q-152 155 -374 155q-176 0 -336 -66l-114 -941q124 51 228.5 76t221.5 25
+q209 0 374 -102q172 107 374 102z" />
+    <glyph glyph-name="_498" unicode="&#xf213;" horiz-adv-x="2048" 
+d="M1500 165v733q0 21 -15 36t-35 15h-93q-20 0 -35 -15t-15 -36v-733q0 -20 15 -35t35 -15h93q20 0 35 15t15 35zM1216 165v531q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-531q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM924 165v429q0 20 -15 35t-35 15h-101
+q-20 0 -35 -15t-15 -35v-429q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM632 165v362q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-362q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM2048 311q0 -166 -118 -284t-284 -118h-1244q-166 0 -284 118t-118 284
+q0 116 63 214.5t168 148.5q-10 34 -10 73q0 113 80.5 193.5t193.5 80.5q102 0 180 -67q45 183 194 300t338 117q149 0 275 -73.5t199.5 -199.5t73.5 -275q0 -66 -14 -122q135 -33 221 -142.5t86 -247.5z" />
+    <glyph glyph-name="_499" unicode="&#xf214;" 
+d="M0 1536h1536v-1392l-776 -338l-760 338v1392zM1436 209v926h-1336v-926l661 -294zM1436 1235v201h-1336v-201h1336zM181 937v-115h-37v115h37zM181 789v-115h-37v115h37zM181 641v-115h-37v115h37zM181 493v-115h-37v115h37zM181 345v-115h-37v115h37zM207 202l15 34
+l105 -47l-15 -33zM343 142l15 34l105 -46l-15 -34zM478 82l15 34l105 -46l-15 -34zM614 23l15 33l104 -46l-15 -34zM797 10l105 46l15 -33l-105 -47zM932 70l105 46l15 -34l-105 -46zM1068 130l105 46l15 -34l-105 -46zM1203 189l105 47l15 -34l-105 -46zM259 1389v-36h-114
+v36h114zM421 1389v-36h-115v36h115zM583 1389v-36h-115v36h115zM744 1389v-36h-114v36h114zM906 1389v-36h-114v36h114zM1068 1389v-36h-115v36h115zM1230 1389v-36h-115v36h115zM1391 1389v-36h-114v36h114zM181 1049v-79h-37v115h115v-36h-78zM421 1085v-36h-115v36h115z
+M583 1085v-36h-115v36h115zM744 1085v-36h-114v36h114zM906 1085v-36h-114v36h114zM1068 1085v-36h-115v36h115zM1230 1085v-36h-115v36h115zM1355 970v79h-78v36h115v-115h-37zM1355 822v115h37v-115h-37zM1355 674v115h37v-115h-37zM1355 526v115h37v-115h-37zM1355 378
+v115h37v-115h-37zM1355 230v115h37v-115h-37zM760 265q-129 0 -221 91.5t-92 221.5q0 129 92 221t221 92q130 0 221.5 -92t91.5 -221q0 -130 -91.5 -221.5t-221.5 -91.5zM595 646q0 -36 19.5 -56.5t49.5 -25t64 -7t64 -2t49.5 -9t19.5 -30.5q0 -49 -112 -49q-97 0 -123 51
+h-3l-31 -63q67 -42 162 -42q29 0 56.5 5t55.5 16t45.5 33t17.5 53q0 46 -27.5 69.5t-67.5 27t-79.5 3t-67 5t-27.5 25.5q0 21 20.5 33t40.5 15t41 3q34 0 70.5 -11t51.5 -34h3l30 58q-3 1 -21 8.5t-22.5 9t-19.5 7t-22 7t-20 4.5t-24 4t-23 1q-29 0 -56.5 -5t-54 -16.5
+t-43 -34t-16.5 -53.5z" />
+    <glyph glyph-name="_500" unicode="&#xf215;" horiz-adv-x="2048" 
+d="M863 504q0 112 -79.5 191.5t-191.5 79.5t-191 -79.5t-79 -191.5t79 -191t191 -79t191.5 79t79.5 191zM1726 505q0 112 -79 191t-191 79t-191.5 -79t-79.5 -191q0 -113 79.5 -192t191.5 -79t191 79.5t79 191.5zM2048 1314v-1348q0 -44 -31.5 -75.5t-76.5 -31.5h-1832
+q-45 0 -76.5 31.5t-31.5 75.5v1348q0 44 31.5 75.5t76.5 31.5h431q44 0 76 -31.5t32 -75.5v-161h754v161q0 44 32 75.5t76 31.5h431q45 0 76.5 -31.5t31.5 -75.5z" />
+    <glyph glyph-name="_501" unicode="&#xf216;" horiz-adv-x="2048" 
+d="M1430 953zM1690 749q148 0 253 -98.5t105 -244.5q0 -157 -109 -261.5t-267 -104.5q-85 0 -162 27.5t-138 73.5t-118 106t-109 126t-103.5 132.5t-108.5 126.5t-117 106t-136 73.5t-159 27.5q-154 0 -251.5 -91.5t-97.5 -244.5q0 -157 104 -250t263 -93q100 0 208 37.5
+t193 98.5q5 4 21 18.5t30 24t22 9.5q14 0 24.5 -10.5t10.5 -24.5q0 -24 -60 -77q-101 -88 -234.5 -142t-260.5 -54q-133 0 -245.5 58t-180 165t-67.5 241q0 205 141.5 341t347.5 136q120 0 226.5 -43.5t185.5 -113t151.5 -153t139 -167.5t133.5 -153.5t149.5 -113
+t172.5 -43.5q102 0 168.5 61.5t66.5 162.5q0 95 -64.5 159t-159.5 64q-30 0 -81.5 -18.5t-68.5 -18.5q-20 0 -35.5 15t-15.5 35q0 18 8.5 57t8.5 59q0 159 -107.5 263t-266.5 104q-58 0 -111.5 -18.5t-84 -40.5t-55.5 -40.5t-33 -18.5q-15 0 -25.5 10.5t-10.5 25.5
+q0 19 25 46q59 67 147 103.5t182 36.5q191 0 318 -125.5t127 -315.5q0 -37 -4 -66q57 15 115 15z" />
+    <glyph glyph-name="_502" unicode="&#xf217;" horiz-adv-x="1664" 
+d="M1216 832q0 26 -19 45t-45 19h-128v128q0 26 -19 45t-45 19t-45 -19t-19 -45v-128h-128q-26 0 -45 -19t-19 -45t19 -45t45 -19h128v-128q0 -26 19 -45t45 -19t45 19t19 45v128h128q26 0 45 19t19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5
+t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920
+q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="_503" unicode="&#xf218;" horiz-adv-x="1664" 
+d="M1280 832q0 26 -19 45t-45 19t-45 -19l-147 -146v293q0 26 -19 45t-45 19t-45 -19t-19 -45v-293l-147 146q-19 19 -45 19t-45 -19t-19 -45t19 -45l256 -256q19 -19 45 -19t45 19l256 256q19 19 19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5
+t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920
+q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="_504" unicode="&#xf219;" horiz-adv-x="2048" 
+d="M212 768l623 -665l-300 665h-323zM1024 -4l349 772h-698zM538 896l204 384h-262l-288 -384h346zM1213 103l623 665h-323zM683 896h682l-204 384h-274zM1510 896h346l-288 384h-262zM1651 1382l384 -512q14 -18 13 -41.5t-17 -40.5l-960 -1024q-18 -20 -47 -20t-47 20
+l-960 1024q-16 17 -17 40.5t13 41.5l384 512q18 26 51 26h1152q33 0 51 -26z" />
+    <glyph glyph-name="_505" unicode="&#xf21a;" horiz-adv-x="2048" 
+d="M1811 -19q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83
+q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83
+q19 19 45 19t45 -19l83 -83zM237 19q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -82l83 82q19 19 45 19t45 -19l83 -82l64 64v293l-210 314q-17 26 -7 56.5t40 40.5l177 58v299h128v128h256v128h256v-128h256v-128h128v-299l177 -58q30 -10 40 -40.5t-7 -56.5l-210 -314
+v-293l19 18q19 19 45 19t45 -19l83 -82l83 82q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83
+q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83zM640 1152v-128l384 128l384 -128v128h-128v128h-512v-128h-128z" />
+    <glyph glyph-name="_506" unicode="&#xf21b;" 
+d="M576 0l96 448l-96 128l-128 64zM832 0l128 640l-128 -64l-96 -128zM992 1010q-2 4 -4 6q-10 8 -96 8q-70 0 -167 -19q-7 -2 -21 -2t-21 2q-97 19 -167 19q-86 0 -96 -8q-2 -2 -4 -6q2 -18 4 -27q2 -3 7.5 -6.5t7.5 -10.5q2 -4 7.5 -20.5t7 -20.5t7.5 -17t8.5 -17t9 -14
+t12 -13.5t14 -9.5t17.5 -8t20.5 -4t24.5 -2q36 0 59 12.5t32.5 30t14.5 34.5t11.5 29.5t17.5 12.5h12q11 0 17.5 -12.5t11.5 -29.5t14.5 -34.5t32.5 -30t59 -12.5q13 0 24.5 2t20.5 4t17.5 8t14 9.5t12 13.5t9 14t8.5 17t7.5 17t7 20.5t7.5 20.5q2 7 7.5 10.5t7.5 6.5
+q2 9 4 27zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 61 4.5 118t19 125.5t37.5 123.5t63.5 103.5t93.5 74.5l-90 220h214q-22 64 -22 128q0 12 2 32q-194 40 -194 96q0 57 210 99q17 62 51.5 134t70.5 114q32 37 76 37q30 0 84 -31t84 -31t84 31
+t84 31q44 0 76 -37q36 -42 70.5 -114t51.5 -134q210 -42 210 -99q0 -56 -194 -96q7 -81 -20 -160h214l-82 -225q63 -33 107.5 -96.5t65.5 -143.5t29 -151.5t8 -148.5z" />
+    <glyph glyph-name="_507" unicode="&#xf21c;" horiz-adv-x="2304" 
+d="M2301 500q12 -103 -22 -198.5t-99 -163.5t-158.5 -106t-196.5 -31q-161 11 -279.5 125t-134.5 274q-12 111 27.5 210.5t118.5 170.5l-71 107q-96 -80 -151 -194t-55 -244q0 -27 -18.5 -46.5t-45.5 -19.5h-256h-69q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5
+t-131.5 316.5t131.5 316.5t316.5 131.5q76 0 152 -27l24 45q-123 110 -304 110h-64q-26 0 -45 19t-19 45t19 45t45 19h128q78 0 145 -13.5t116.5 -38.5t71.5 -39.5t51 -36.5h512h115l-85 128h-222q-30 0 -49 22.5t-14 52.5q4 23 23 38t43 15h253q33 0 53 -28l70 -105
+l114 114q19 19 46 19h101q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-179l115 -172q131 63 275 36q143 -26 244 -134.5t118 -253.5zM448 128q115 0 203 72.5t111 183.5h-314q-35 0 -55 31q-18 32 -1 63l147 277q-47 13 -91 13q-132 0 -226 -94t-94 -226t94 -226
+t226 -94zM1856 128q132 0 226 94t94 226t-94 226t-226 94q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94z" />
+    <glyph glyph-name="_508" unicode="&#xf21d;" 
+d="M1408 0q0 -63 -61.5 -113.5t-164 -81t-225 -46t-253.5 -15.5t-253.5 15.5t-225 46t-164 81t-61.5 113.5q0 49 33 88.5t91 66.5t118 44.5t131 29.5q26 5 48 -10.5t26 -41.5q5 -26 -10.5 -48t-41.5 -26q-58 -10 -106 -23.5t-76.5 -25.5t-48.5 -23.5t-27.5 -19.5t-8.5 -12
+q3 -11 27 -26.5t73 -33t114 -32.5t160.5 -25t201.5 -10t201.5 10t160.5 25t114 33t73 33.5t27 27.5q-1 4 -8.5 11t-27.5 19t-48.5 23.5t-76.5 25t-106 23.5q-26 4 -41.5 26t-10.5 48q4 26 26 41.5t48 10.5q71 -12 131 -29.5t118 -44.5t91 -66.5t33 -88.5zM1024 896v-384
+q0 -26 -19 -45t-45 -19h-64v-384q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v384h-64q-26 0 -45 19t-19 45v384q0 53 37.5 90.5t90.5 37.5h384q53 0 90.5 -37.5t37.5 -90.5zM928 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5
+t158.5 -65.5t65.5 -158.5z" />
+    <glyph glyph-name="_509" unicode="&#xf21e;" horiz-adv-x="1792" 
+d="M1280 512h305q-5 -6 -10 -10.5t-9 -7.5l-3 -4l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-5 2 -21 20h369q22 0 39.5 13.5t22.5 34.5l70 281l190 -667q6 -20 23 -33t39 -13q21 0 38 13t23 33l146 485l56 -112q18 -35 57 -35zM1792 940q0 -145 -103 -300h-369l-111 221
+q-8 17 -25.5 27t-36.5 8q-45 -5 -56 -46l-129 -430l-196 686q-6 20 -23.5 33t-39.5 13t-39 -13.5t-22 -34.5l-116 -464h-423q-103 155 -103 300q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124
+t127 -344z" />
+    <glyph glyph-name="venus" unicode="&#xf221;" horiz-adv-x="1280" 
+d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292
+q11 134 80.5 249t182 188t245.5 88q170 19 319 -54t236 -212t87 -306zM128 960q0 -185 131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5z" />
+    <glyph glyph-name="_511" unicode="&#xf222;" 
+d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-382 -383q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5
+q203 0 359 -126l382 382h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_512" unicode="&#xf223;" horiz-adv-x="1280" 
+d="M830 1220q145 -72 233.5 -210.5t88.5 -305.5q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5
+t-147.5 384.5q0 167 88.5 305.5t233.5 210.5q-165 96 -228 273q-6 16 3.5 29.5t26.5 13.5h69q21 0 29 -20q44 -106 140 -171t214 -65t214 65t140 171q8 20 37 20h61q17 0 26.5 -13.5t3.5 -29.5q-63 -177 -228 -273zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5
+t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_513" unicode="&#xf224;" 
+d="M1024 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64
+q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-149 16 -270.5 103t-186.5 223.5t-53 291.5q16 204 160 353.5t347 172.5q118 14 228 -19t198 -103l255 254h-134q-14 0 -23 9t-9 23v64zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5
+t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_514" unicode="&#xf225;" horiz-adv-x="1792" 
+d="M1280 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64
+q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5t-147.5 384.5q0 201 126 359l-52 53l-101 -111q-9 -10 -22 -10.5t-23 7.5l-48 44q-10 8 -10.5 21.5t8.5 23.5l105 115l-111 112v-134q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9
+t-9 23v288q0 26 19 45t45 19h288q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-133l106 -107l86 94q9 10 22 10.5t23 -7.5l48 -44q10 -8 10.5 -21.5t-8.5 -23.5l-90 -99l57 -56q158 126 359 126t359 -126l255 254h-134q-14 0 -23 9t-9 23v64zM832 256q185 0 316.5 131.5
+t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_515" unicode="&#xf226;" horiz-adv-x="1792" 
+d="M1790 1007q12 -155 -52.5 -292t-186 -224t-271.5 -103v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-512v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23
+t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292q17 206 164.5 356.5t352.5 169.5q206 21 377 -94q171 115 377 94q205 -19 352.5 -169.5t164.5 -356.5zM896 647q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM576 512q115 0 218 57q-154 165 -154 391
+q0 224 154 391q-103 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5zM1152 128v260q-137 15 -256 94q-119 -79 -256 -94v-260h512zM1216 512q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5q-115 0 -218 -57q154 -167 154 -391
+q0 -226 -154 -391q103 -57 218 -57z" />
+    <glyph glyph-name="_516" unicode="&#xf227;" horiz-adv-x="1920" 
+d="M1536 1120q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-31 -182 -166 -312t-318 -156q-210 -29 -384.5 80t-241.5 300q-117 6 -221 57.5t-177.5 133t-113.5 192.5t-32 230
+q9 135 78 252t182 191.5t248 89.5q118 14 227.5 -19t198.5 -103l255 254h-134q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q59 -74 93 -169q182 -9 328 -124l255 254h-134q-14 0 -23 9
+t-9 23v64zM1024 704q0 20 -4 58q-162 -25 -271 -150t-109 -292q0 -20 4 -58q162 25 271 150t109 292zM128 704q0 -168 111 -294t276 -149q-3 29 -3 59q0 210 135 369.5t338 196.5q-53 120 -163.5 193t-245.5 73q-185 0 -316.5 -131.5t-131.5 -316.5zM1088 -128
+q185 0 316.5 131.5t131.5 316.5q0 168 -111 294t-276 149q3 -28 3 -59q0 -210 -135 -369.5t-338 -196.5q53 -120 163.5 -193t245.5 -73z" />
+    <glyph glyph-name="_517" unicode="&#xf228;" horiz-adv-x="2048" 
+d="M1664 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-32 -180 -164.5 -310t-313.5 -157q-223 -34 -409 90q-117 -78 -256 -93v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23
+t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-155 17 -279.5 109.5t-187 237.5t-39.5 307q25 187 159.5 322.5t320.5 164.5q224 34 410 -90q146 97 320 97q201 0 359 -126l255 254h-134q-14 0 -23 9
+t-9 23v64zM896 391q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM128 704q0 -185 131.5 -316.5t316.5 -131.5q117 0 218 57q-154 167 -154 391t154 391q-101 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5zM1216 256q185 0 316.5 131.5t131.5 316.5
+t-131.5 316.5t-316.5 131.5q-117 0 -218 -57q154 -167 154 -391t-154 -391q101 -57 218 -57z" />
+    <glyph glyph-name="_518" unicode="&#xf229;" 
+d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-213 -214l140 -140q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-140 141l-78 -79q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5
+t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5q203 0 359 -126l78 78l-172 172q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l172 -172l213 213h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5
+t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_519" unicode="&#xf22a;" horiz-adv-x="1280" 
+d="M640 892q217 -24 364.5 -187.5t147.5 -384.5q0 -167 -87 -306t-236 -212t-319 -54q-133 15 -245.5 88t-182 188t-80.5 249q-12 155 52.5 292t186 224t271.5 103v132h-160q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h160v165l-92 -92q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22
+t9 23l202 201q19 19 45 19t45 -19l202 -201q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-92 92v-165h160q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-160v-132zM576 -128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5
+t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_520" unicode="&#xf22b;" horiz-adv-x="2048" 
+d="M1901 621q19 -19 19 -45t-19 -45l-294 -294q-9 -10 -22.5 -10t-22.5 10l-45 45q-10 9 -10 22.5t10 22.5l185 185h-294v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-132q-24 -217 -187.5 -364.5t-384.5 -147.5q-167 0 -306 87t-212 236t-54 319q15 133 88 245.5
+t188 182t249 80.5q155 12 292 -52.5t224 -186t103 -271.5h132v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224h294l-185 185q-10 9 -10 22.5t10 22.5l45 45q9 10 22.5 10t22.5 -10zM576 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5
+t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_521" unicode="&#xf22c;" horiz-adv-x="1280" 
+d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-612q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v612q-217 24 -364.5 187.5t-147.5 384.5q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM576 512q185 0 316.5 131.5
+t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" />
+    <glyph glyph-name="_522" unicode="&#xf22d;" horiz-adv-x="1280" 
+d="M1024 576q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1152 576q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123
+t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5z" />
+    <glyph glyph-name="_523" unicode="&#xf22e;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="_524" unicode="&#xf22f;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="_525" unicode="&#xf230;" 
+d="M1451 1408q35 0 60 -25t25 -60v-1366q0 -35 -25 -60t-60 -25h-391v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-735q-35 0 -60 25t-25 60v1366q0 35 25 60t60 25h1366z" />
+    <glyph glyph-name="_526" unicode="&#xf231;" horiz-adv-x="1280" 
+d="M0 939q0 108 37.5 203.5t103.5 166.5t152 123t185 78t202 26q158 0 294 -66.5t221 -193.5t85 -287q0 -96 -19 -188t-60 -177t-100 -149.5t-145 -103t-189 -38.5q-68 0 -135 32t-96 88q-10 -39 -28 -112.5t-23.5 -95t-20.5 -71t-26 -71t-32 -62.5t-46 -77.5t-62 -86.5
+l-14 -5l-9 10q-15 157 -15 188q0 92 21.5 206.5t66.5 287.5t52 203q-32 65 -32 169q0 83 52 156t132 73q61 0 95 -40.5t34 -102.5q0 -66 -44 -191t-44 -187q0 -63 45 -104.5t109 -41.5q55 0 102 25t78.5 68t56 95t38 110.5t20 111t6.5 99.5q0 173 -109.5 269.5t-285.5 96.5
+q-200 0 -334 -129.5t-134 -328.5q0 -44 12.5 -85t27 -65t27 -45.5t12.5 -30.5q0 -28 -15 -73t-37 -45q-2 0 -17 3q-51 15 -90.5 56t-61 94.5t-32.5 108t-11 106.5z" />
+    <glyph glyph-name="_527" unicode="&#xf232;" 
+d="M985 562q13 0 97.5 -44t89.5 -53q2 -5 2 -15q0 -33 -17 -76q-16 -39 -71 -65.5t-102 -26.5q-57 0 -190 62q-98 45 -170 118t-148 185q-72 107 -71 194v8q3 91 74 158q24 22 52 22q6 0 18 -1.5t19 -1.5q19 0 26.5 -6.5t15.5 -27.5q8 -20 33 -88t25 -75q0 -21 -34.5 -57.5
+t-34.5 -46.5q0 -7 5 -15q34 -73 102 -137q56 -53 151 -101q12 -7 22 -7q15 0 54 48.5t52 48.5zM782 32q127 0 243.5 50t200.5 134t134 200.5t50 243.5t-50 243.5t-134 200.5t-200.5 134t-243.5 50t-243.5 -50t-200.5 -134t-134 -200.5t-50 -243.5q0 -203 120 -368l-79 -233
+l242 77q158 -104 345 -104zM782 1414q153 0 292.5 -60t240.5 -161t161 -240.5t60 -292.5t-60 -292.5t-161 -240.5t-240.5 -161t-292.5 -60q-195 0 -365 94l-417 -134l136 405q-108 178 -108 389q0 153 60 292.5t161 240.5t240.5 161t292.5 60z" />
+    <glyph glyph-name="_528" unicode="&#xf233;" horiz-adv-x="1792" 
+d="M128 128h1024v128h-1024v-128zM128 640h1024v128h-1024v-128zM1696 192q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM128 1152h1024v128h-1024v-128zM1696 704q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1696 1216
+q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1792 384v-384h-1792v384h1792zM1792 896v-384h-1792v384h1792zM1792 1408v-384h-1792v384h1792z" />
+    <glyph glyph-name="_529" unicode="&#xf234;" horiz-adv-x="2048" 
+d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1664 512h352q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-352q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5
+t-9.5 22.5v352h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v352q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5v-352zM928 288q0 -52 38 -90t90 -38h256v-238q-68 -50 -171 -50h-874q-121 0 -194 69t-73 190q0 53 3.5 103.5t14 109t26.5 108.5
+t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q79 -61 154.5 -91.5t164.5 -30.5t164.5 30.5t154.5 91.5q20 17 39 17q132 0 217 -96h-223q-52 0 -90 -38t-38 -90v-192z" />
+    <glyph glyph-name="_530" unicode="&#xf235;" horiz-adv-x="2048" 
+d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1781 320l249 -249q9 -9 9 -23q0 -13 -9 -22l-136 -136q-9 -9 -22 -9q-14 0 -23 9l-249 249l-249 -249q-9 -9 -23 -9q-13 0 -22 9l-136 136
+q-9 9 -9 22q0 14 9 23l249 249l-249 249q-9 9 -9 23q0 13 9 22l136 136q9 9 22 9q14 0 23 -9l249 -249l249 249q9 9 23 9q13 0 22 -9l136 -136q9 -9 9 -22q0 -14 -9 -23zM1283 320l-181 -181q-37 -37 -37 -91q0 -53 37 -90l83 -83q-21 -3 -44 -3h-874q-121 0 -194 69
+t-73 190q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q154 -122 319 -122t319 122q20 17 39 17q28 0 57 -6q-28 -27 -41 -50t-13 -56q0 -54 37 -91z" />
+    <glyph glyph-name="_531" unicode="&#xf236;" horiz-adv-x="2048" 
+d="M256 512h1728q26 0 45 -19t19 -45v-448h-256v256h-1536v-256h-256v1216q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-704zM832 832q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM2048 576v64q0 159 -112.5 271.5t-271.5 112.5h-704
+q-26 0 -45 -19t-19 -45v-384h1152z" />
+    <glyph glyph-name="_532" unicode="&#xf237;" 
+d="M1536 1536l-192 -448h192v-192h-274l-55 -128h329v-192h-411l-357 -832l-357 832h-411v192h329l-55 128h-274v192h192l-192 448h256l323 -768h378l323 768h256zM768 320l108 256h-216z" />
+    <glyph glyph-name="_533" unicode="&#xf238;" 
+d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM768 192q80 0 136 56t56 136t-56 136t-136 56
+t-136 -56t-56 -136t56 -136t136 -56zM1344 768v512h-1152v-512h1152z" />
+    <glyph glyph-name="_534" unicode="&#xf239;" 
+d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM288 224q66 0 113 47t47 113t-47 113t-113 47
+t-113 -47t-47 -113t47 -113t113 -47zM704 768v512h-544v-512h544zM1248 224q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM1408 768v512h-576v-512h576z" />
+    <glyph glyph-name="_535" unicode="&#xf23a;" horiz-adv-x="1792" 
+d="M597 1115v-1173q0 -25 -12.5 -42.5t-36.5 -17.5q-17 0 -33 8l-465 233q-21 10 -35.5 33.5t-14.5 46.5v1140q0 20 10 34t29 14q14 0 44 -15l511 -256q3 -3 3 -5zM661 1014l534 -866l-534 266v600zM1792 996v-1054q0 -25 -14 -40.5t-38 -15.5t-47 13l-441 220zM1789 1116
+q0 -3 -256.5 -419.5t-300.5 -487.5l-390 634l324 527q17 28 52 28q14 0 26 -6l541 -270q4 -2 4 -6z" />
+    <glyph glyph-name="_536" unicode="&#xf23b;" 
+d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1408v-1536h-1536v1536h1536z" />
+    <glyph glyph-name="_537" unicode="&#xf23c;" horiz-adv-x="2296" 
+d="M478 -139q-8 -16 -27 -34.5t-37 -25.5q-25 -9 -51.5 3.5t-28.5 31.5q-1 22 40 55t68 38q23 4 34 -21.5t2 -46.5zM1819 -139q7 -16 26 -34.5t38 -25.5q25 -9 51.5 3.5t27.5 31.5q2 22 -39.5 55t-68.5 38q-22 4 -33 -21.5t-2 -46.5zM1867 -30q13 -27 56.5 -59.5t77.5 -41.5
+q45 -13 82 4.5t37 50.5q0 46 -67.5 100.5t-115.5 59.5q-40 5 -63.5 -37.5t-6.5 -76.5zM428 -30q-13 -27 -56 -59.5t-77 -41.5q-45 -13 -82 4.5t-37 50.5q0 46 67.5 100.5t115.5 59.5q40 5 63 -37.5t6 -76.5zM1158 1094h1q-41 0 -76 -15q27 -8 44 -30.5t17 -49.5
+q0 -35 -27 -60t-65 -25q-52 0 -80 43q-5 -23 -5 -42q0 -74 56 -126.5t135 -52.5q80 0 136 52.5t56 126.5t-56 126.5t-136 52.5zM1462 1312q-99 109 -220.5 131.5t-245.5 -44.5q27 60 82.5 96.5t118 39.5t121.5 -17t99.5 -74.5t44.5 -131.5zM2212 73q8 -11 -11 -42
+q7 -23 7 -40q1 -56 -44.5 -112.5t-109.5 -91.5t-118 -37q-48 -2 -92 21.5t-66 65.5q-687 -25 -1259 0q-23 -41 -66.5 -65t-92.5 -22q-86 3 -179.5 80.5t-92.5 160.5q2 22 7 40q-19 31 -11 42q6 10 31 1q14 22 41 51q-7 29 2 38q11 10 39 -4q29 20 59 34q0 29 13 37
+q23 12 51 -16q35 5 61 -2q18 -4 38 -19v73q-11 0 -18 2q-53 10 -97 44.5t-55 87.5q-9 38 0 81q15 62 93 95q2 17 19 35.5t36 23.5t33 -7.5t19 -30.5h13q46 -5 60 -23q3 -3 5 -7q10 1 30.5 3.5t30.5 3.5q-15 11 -30 17q-23 40 -91 43q0 6 1 10q-62 2 -118.5 18.5t-84.5 47.5
+q-32 36 -42.5 92t-2.5 112q16 126 90 179q23 16 52 4.5t32 -40.5q0 -1 1.5 -14t2.5 -21t3 -20t5.5 -19t8.5 -10q27 -14 76 -12q48 46 98 74q-40 4 -162 -14l47 46q61 58 163 111q145 73 282 86q-20 8 -41 15.5t-47 14t-42.5 10.5t-47.5 11t-43 10q595 126 904 -139
+q98 -84 158 -222q85 -10 121 9h1q5 3 8.5 10t5.5 19t3 19.5t3 21.5l1 14q3 28 32 40t52 -5q73 -52 91 -178q7 -57 -3.5 -113t-42.5 -91q-28 -32 -83.5 -48.5t-115.5 -18.5v-10q-71 -2 -95 -43q-14 -5 -31 -17q11 -1 32 -3.5t30 -3.5q1 5 5 8q16 18 60 23h13q5 18 19 30t33 8
+t36 -23t19 -36q79 -32 93 -95q9 -40 1 -81q-12 -53 -56 -88t-97 -44q-10 -2 -17 -2q0 -49 -1 -73q20 15 38 19q26 7 61 2q28 28 51 16q14 -9 14 -37q33 -16 59 -34q27 13 38 4q10 -10 2 -38q28 -30 41 -51q23 8 31 -1zM1937 1025q0 -29 -9 -54q82 -32 112 -132
+q4 37 -9.5 98.5t-41.5 90.5q-20 19 -36 17t-16 -20zM1859 925q35 -42 47.5 -108.5t-0.5 -124.5q67 13 97 45q13 14 18 28q-3 64 -31 114.5t-79 66.5q-15 -15 -52 -21zM1822 921q-30 0 -44 1q42 -115 53 -239q21 0 43 3q16 68 1 135t-53 100zM258 839q30 100 112 132
+q-9 25 -9 54q0 18 -16.5 20t-35.5 -17q-28 -29 -41.5 -90.5t-9.5 -98.5zM294 737q29 -31 97 -45q-13 58 -0.5 124.5t47.5 108.5v0q-37 6 -52 21q-51 -16 -78.5 -66t-31.5 -115q9 -17 18 -28zM471 683q14 124 73 235q-19 -4 -55 -18l-45 -19v1q-46 -89 -20 -196q25 -3 47 -3z
+M1434 644q8 -38 16.5 -108.5t11.5 -89.5q3 -18 9.5 -21.5t23.5 4.5q40 20 62 85.5t23 125.5q-24 2 -146 4zM1152 1285q-116 0 -199 -82.5t-83 -198.5q0 -117 83 -199.5t199 -82.5t199 82.5t83 199.5q0 116 -83 198.5t-199 82.5zM1380 646q-105 2 -211 0v1q-1 -27 2.5 -86
+t13.5 -66q29 -14 93.5 -14.5t95.5 10.5q9 3 11 39t-0.5 69.5t-4.5 46.5zM1112 447q8 4 9.5 48t-0.5 88t-4 63v1q-212 -3 -214 -3q-4 -20 -7 -62t0 -83t14 -46q34 -15 101 -16t101 10zM718 636q-16 -59 4.5 -118.5t77.5 -84.5q15 -8 24 -5t12 21q3 16 8 90t10 103
+q-69 -2 -136 -6zM591 510q3 -23 -34 -36q132 -141 271.5 -240t305.5 -154q172 49 310.5 146t293.5 250q-33 13 -30 34q0 2 0.5 3.5t1.5 3t1 2.5v1v-1q-17 2 -50 5.5t-48 4.5q-26 -90 -82 -132q-51 -38 -82 1q-5 6 -9 14q-7 13 -17 62q-2 -5 -5 -9t-7.5 -7t-8 -5.5t-9.5 -4
+l-10 -2.5t-12 -2l-12 -1.5t-13.5 -1t-13.5 -0.5q-106 -9 -163 11q-4 -17 -10 -26.5t-21 -15t-23 -7t-36 -3.5q-6 -1 -9 -1q-179 -17 -203 40q-2 -63 -56 -54q-47 8 -91 54q-12 13 -20 26q-17 29 -26 65q-58 -6 -87 -10q1 -2 4 -10zM507 -118q3 14 3 30q-17 71 -51 130
+t-73 70q-41 12 -101.5 -14.5t-104.5 -80t-39 -107.5q35 -53 100 -93t119 -42q51 -2 94 28t53 79zM510 53q23 -63 27 -119q195 113 392 174q-98 52 -180.5 120t-179.5 165q-6 -4 -29 -13q0 -1 -1 -4t-1 -5q31 -18 22 -37q-12 -23 -56 -34q-10 -13 -29 -24h-1q-2 -83 1 -150
+q19 -34 35 -73zM579 -113q532 -21 1145 0q-254 147 -428 196q-76 -35 -156 -57q-8 -3 -16 0q-65 21 -129 49q-208 -60 -416 -188h-1v-1q1 0 1 1zM1763 -67q4 54 28 120q14 38 33 71l-1 -1q3 77 3 153q-15 8 -30 25q-42 9 -56 33q-9 20 22 38q-2 4 -2 9q-16 4 -28 12
+q-204 -190 -383 -284q198 -59 414 -176zM2155 -90q5 54 -39 107.5t-104 80t-102 14.5q-38 -11 -72.5 -70.5t-51.5 -129.5q0 -16 3 -30q10 -49 53 -79t94 -28q54 2 119 42t100 93z" />
+    <glyph glyph-name="_538" unicode="&#xf23d;" horiz-adv-x="2304" 
+d="M1524 -25q0 -68 -48 -116t-116 -48t-116.5 48t-48.5 116t48.5 116.5t116.5 48.5t116 -48.5t48 -116.5zM775 -25q0 -68 -48.5 -116t-116.5 -48t-116 48t-48 116t48 116.5t116 48.5t116.5 -48.5t48.5 -116.5zM0 1469q57 -60 110.5 -104.5t121 -82t136 -63t166 -45.5
+t200 -31.5t250 -18.5t304 -9.5t372.5 -2.5q139 0 244.5 -5t181 -16.5t124 -27.5t71 -39.5t24 -51.5t-19.5 -64t-56.5 -76.5t-89.5 -91t-116 -104.5t-139 -119q-185 -157 -286 -247q29 51 76.5 109t94 105.5t94.5 98.5t83 91.5t54 80.5t13 70t-45.5 55.5t-116.5 41t-204 23.5
+t-304 5q-168 -2 -314 6t-256 23t-204.5 41t-159.5 51.5t-122.5 62.5t-91.5 66.5t-68 71.5t-50.5 69.5t-40 68t-36.5 59.5z" />
+    <glyph glyph-name="_539" unicode="&#xf23e;" horiz-adv-x="1792" 
+d="M896 1472q-169 0 -323 -66t-265.5 -177.5t-177.5 -265.5t-66 -323t66 -323t177.5 -265.5t265.5 -177.5t323 -66t323 66t265.5 177.5t177.5 265.5t66 323t-66 323t-177.5 265.5t-265.5 177.5t-323 66zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348
+t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM496 704q16 0 16 -16v-480q0 -16 -16 -16h-32q-16 0 -16 16v480q0 16 16 16h32zM896 640q53 0 90.5 -37.5t37.5 -90.5q0 -35 -17.5 -64t-46.5 -46v-114q0 -14 -9 -23
+t-23 -9h-64q-14 0 -23 9t-9 23v114q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5zM896 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM544 928v-96
+q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 93 65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5v-96q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 146 -103 249t-249 103t-249 -103t-103 -249zM1408 192v512q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-512
+q0 -26 19 -45t45 -19h896q26 0 45 19t19 45z" />
+    <glyph glyph-name="_540" unicode="&#xf240;" horiz-adv-x="2304" 
+d="M1920 1024v-768h-1664v768h1664zM2048 448h128v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288zM2304 832v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113
+v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160q53 0 90.5 -37.5t37.5 -90.5z" />
+    <glyph glyph-name="_541" unicode="&#xf241;" horiz-adv-x="2304" 
+d="M256 256v768h1280v-768h-1280zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9
+h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_542" unicode="&#xf242;" horiz-adv-x="2304" 
+d="M256 256v768h896v-768h-896zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9
+h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_543" unicode="&#xf243;" horiz-adv-x="2304" 
+d="M256 256v768h512v-768h-512zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9
+h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_544" unicode="&#xf244;" horiz-adv-x="2304" 
+d="M2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23
+v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" />
+    <glyph glyph-name="_545" unicode="&#xf245;" horiz-adv-x="1280" 
+d="M1133 493q31 -30 14 -69q-17 -40 -59 -40h-382l201 -476q10 -25 0 -49t-34 -35l-177 -75q-25 -10 -49 0t-35 34l-191 452l-312 -312q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v1504q0 42 40 59q12 5 24 5q27 0 45 -19z" />
+    <glyph glyph-name="_546" unicode="&#xf246;" horiz-adv-x="1024" 
+d="M832 1408q-320 0 -320 -224v-416h128v-128h-128v-544q0 -224 320 -224h64v-128h-64q-272 0 -384 146q-112 -146 -384 -146h-64v128h64q320 0 320 224v544h-128v128h128v416q0 224 -320 224h-64v128h64q272 0 384 -146q112 146 384 146h64v-128h-64z" />
+    <glyph glyph-name="_547" unicode="&#xf247;" horiz-adv-x="2048" 
+d="M2048 1152h-128v-1024h128v-384h-384v128h-1280v-128h-384v384h128v1024h-128v384h384v-128h1280v128h384v-384zM1792 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 -128v128h-128v-128h128zM1664 0v128h128v1024h-128v128h-1280v-128h-128v-1024h128v-128
+h1280zM1920 -128v128h-128v-128h128zM1280 896h384v-768h-896v256h-384v768h896v-256zM512 512h640v512h-640v-512zM1536 256v512h-256v-384h-384v-128h640z" />
+    <glyph glyph-name="_548" unicode="&#xf248;" horiz-adv-x="2304" 
+d="M2304 768h-128v-640h128v-384h-384v128h-896v-128h-384v384h128v128h-384v-128h-384v384h128v640h-128v384h384v-128h896v128h384v-384h-128v-128h384v128h384v-384zM2048 1024v-128h128v128h-128zM1408 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 256
+v128h-128v-128h128zM1536 384h-128v-128h128v128zM384 384h896v128h128v640h-128v128h-896v-128h-128v-640h128v-128zM896 -128v128h-128v-128h128zM2176 -128v128h-128v-128h128zM2048 128v640h-128v128h-384v-384h128v-384h-384v128h-384v-128h128v-128h896v128h128z" />
+    <glyph glyph-name="_549" unicode="&#xf249;" 
+d="M1024 288v-416h-928q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68v-928h-416q-40 0 -68 -28t-28 -68zM1152 256h381q-15 -82 -65 -132l-184 -184q-50 -50 -132 -65v381z" />
+    <glyph glyph-name="_550" unicode="&#xf24a;" 
+d="M1400 256h-248v-248q29 10 41 22l185 185q12 12 22 41zM1120 384h288v896h-1280v-1280h896v288q0 40 28 68t68 28zM1536 1312v-1024q0 -40 -20 -88t-48 -76l-184 -184q-28 -28 -76 -48t-88 -20h-1024q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68
+z" />
+    <glyph glyph-name="_551" unicode="&#xf24b;" horiz-adv-x="2304" 
+d="M1951 538q0 -26 -15.5 -44.5t-38.5 -23.5q-8 -2 -18 -2h-153v140h153q10 0 18 -2q23 -5 38.5 -23.5t15.5 -44.5zM1933 751q0 -25 -15 -42t-38 -21q-3 -1 -15 -1h-139v129h139q3 0 8.5 -0.5t6.5 -0.5q23 -4 38 -21.5t15 -42.5zM728 587v308h-228v-308q0 -58 -38 -94.5
+t-105 -36.5q-108 0 -229 59v-112q53 -15 121 -23t109 -9l42 -1q328 0 328 217zM1442 403v113q-99 -52 -200 -59q-108 -8 -169 41t-61 142t61 142t169 41q101 -7 200 -58v112q-48 12 -100 19.5t-80 9.5l-28 2q-127 6 -218.5 -14t-140.5 -60t-71 -88t-22 -106t22 -106t71 -88
+t140.5 -60t218.5 -14q101 4 208 31zM2176 518q0 54 -43 88.5t-109 39.5v3q57 8 89 41.5t32 79.5q0 55 -41 88t-107 36q-3 0 -12 0.5t-14 0.5h-455v-510h491q74 0 121.5 36.5t47.5 96.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90
+t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_552" unicode="&#xf24c;" horiz-adv-x="2304" 
+d="M858 295v693q-106 -41 -172 -135.5t-66 -211.5t66 -211.5t172 -134.5zM1362 641q0 117 -66 211.5t-172 135.5v-694q106 41 172 135.5t66 211.5zM1577 641q0 -159 -78.5 -294t-213.5 -213.5t-294 -78.5q-119 0 -227.5 46.5t-187 125t-125 187t-46.5 227.5q0 159 78.5 294
+t213.5 213.5t294 78.5t294 -78.5t213.5 -213.5t78.5 -294zM1960 634q0 139 -55.5 261.5t-147.5 205.5t-213.5 131t-252.5 48h-301q-176 0 -323.5 -81t-235 -230t-87.5 -335q0 -171 87 -317.5t236 -231.5t323 -85h301q129 0 251.5 50.5t214.5 135t147.5 202.5t55.5 246z
+M2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_553" unicode="&#xf24d;" horiz-adv-x="1792" 
+d="M1664 -96v1088q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5zM1792 992v-1088q0 -66 -47 -113t-113 -47h-1088q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113
+zM1408 1376v-160h-128v160q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h160v-128h-160q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="_554" unicode="&#xf24e;" horiz-adv-x="2304" 
+d="M1728 1088l-384 -704h768zM448 1088l-384 -704h768zM1269 1280q-14 -40 -45.5 -71.5t-71.5 -45.5v-1291h608q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1344q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h608v1291q-40 14 -71.5 45.5t-45.5 71.5h-491q-14 0 -23 9t-9 23v64
+q0 14 9 23t23 9h491q21 57 70 92.5t111 35.5t111 -35.5t70 -92.5h491q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-491zM1088 1264q33 0 56.5 23.5t23.5 56.5t-23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5zM2176 384q0 -73 -46.5 -131t-117.5 -91
+t-144.5 -49.5t-139.5 -16.5t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81zM896 384q0 -73 -46.5 -131t-117.5 -91t-144.5 -49.5t-139.5 -16.5
+t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81z" />
+    <glyph glyph-name="_555" unicode="&#xf250;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-77 -29 -149 -92.5
+t-129.5 -152.5t-92.5 -210t-35 -253h1024q0 132 -35 253t-92.5 210t-129.5 152.5t-149 92.5q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" />
+    <glyph glyph-name="_556" unicode="&#xf251;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -66 9 -128h1006q9 61 9 128zM1280 -128q0 130 -34 249.5t-90.5 208t-126.5 152t-146 94.5h-230q-76 -31 -146 -94.5t-126.5 -152t-90.5 -208t-34 -249.5h1024z" />
+    <glyph glyph-name="_557" unicode="&#xf252;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -206 85 -384h854q85 178 85 384zM1223 192q-54 141 -145.5 241.5t-194.5 142.5h-230q-103 -42 -194.5 -142.5t-145.5 -241.5h910z" />
+    <glyph glyph-name="_558" unicode="&#xf253;" 
+d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9
+t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-137 -51 -244 -196
+h700q-107 145 -244 196q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" />
+    <glyph glyph-name="_559" unicode="&#xf254;" 
+d="M1504 -64q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472zM130 0q3 55 16 107t30 95t46 87t53.5 76t64.5 69.5t66 60t70.5 55t66.5 47.5t65 43q-43 28 -65 43t-66.5 47.5t-70.5 55t-66 60t-64.5 69.5t-53.5 76t-46 87
+t-30 95t-16 107h1276q-3 -55 -16 -107t-30 -95t-46 -87t-53.5 -76t-64.5 -69.5t-66 -60t-70.5 -55t-66.5 -47.5t-65 -43q43 -28 65 -43t66.5 -47.5t70.5 -55t66 -60t64.5 -69.5t53.5 -76t46 -87t30 -95t16 -107h-1276zM1504 1536q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9
+h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472z" />
+    <glyph glyph-name="_560" unicode="&#xf255;" 
+d="M768 1152q-53 0 -90.5 -37.5t-37.5 -90.5v-128h-32v93q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-429l-32 30v172q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-224q0 -47 35 -82l310 -296q39 -39 39 -102q0 -26 19 -45t45 -19h640q26 0 45 19t19 45v25
+q0 41 10 77l108 436q10 36 10 77v246q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-32h-32v125q0 40 -25 72.5t-64 40.5q-14 2 -23 2q-46 0 -79 -33t-33 -79v-128h-32v122q0 51 -32.5 89.5t-82.5 43.5q-5 1 -13 1zM768 1280q84 0 149 -50q57 34 123 34q59 0 111 -27
+t86 -76q27 7 59 7q100 0 170 -71.5t70 -171.5v-246q0 -51 -13 -108l-109 -436q-6 -24 -6 -71q0 -80 -56 -136t-136 -56h-640q-84 0 -138 58.5t-54 142.5l-308 296q-76 73 -76 175v224q0 99 70.5 169.5t169.5 70.5q11 0 16 -1q6 95 75.5 160t164.5 65q52 0 98 -21
+q72 69 174 69z" />
+    <glyph glyph-name="_561" unicode="&#xf256;" horiz-adv-x="1792" 
+d="M880 1408q-46 0 -79 -33t-33 -79v-656h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528v-256l-154 205q-38 51 -102 51q-53 0 -90.5 -37.5t-37.5 -90.5q0 -43 26 -77l384 -512q38 -51 102 -51h688q34 0 61 22t34 56l76 405q5 32 5 59v498q0 46 -33 79t-79 33t-79 -33
+t-33 -79v-272h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528h-32v656q0 46 -33 79t-79 33zM880 1536q68 0 125.5 -35.5t88.5 -96.5q19 4 42 4q99 0 169.5 -70.5t70.5 -169.5v-17q105 6 180.5 -64t75.5 -175v-498q0 -40 -8 -83l-76 -404q-14 -79 -76.5 -131t-143.5 -52
+h-688q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 106 75 181t181 75q78 0 128 -34v434q0 99 70.5 169.5t169.5 70.5q23 0 42 -4q31 61 88.5 96.5t125.5 35.5z" />
+    <glyph glyph-name="_562" unicode="&#xf257;" horiz-adv-x="1792" 
+d="M1073 -128h-177q-163 0 -226 141q-23 49 -23 102v5q-62 30 -98.5 88.5t-36.5 127.5q0 38 5 48h-261q-106 0 -181 75t-75 181t75 181t181 75h113l-44 17q-74 28 -119.5 93.5t-45.5 145.5q0 106 75 181t181 75q46 0 91 -17l628 -239h401q106 0 181 -75t75 -181v-668
+q0 -88 -54 -157.5t-140 -90.5l-339 -85q-92 -23 -186 -23zM1024 583l-155 -71l-163 -74q-30 -14 -48 -41.5t-18 -60.5q0 -46 33 -79t79 -33q26 0 46 10l338 154q-49 10 -80.5 50t-31.5 90v55zM1344 272q0 46 -33 79t-79 33q-26 0 -46 -10l-290 -132q-28 -13 -37 -17
+t-30.5 -17t-29.5 -23.5t-16 -29t-8 -40.5q0 -50 31.5 -82t81.5 -32q20 0 38 9l352 160q30 14 48 41.5t18 60.5zM1112 1024l-650 248q-24 8 -46 8q-53 0 -90.5 -37.5t-37.5 -90.5q0 -40 22.5 -73t59.5 -47l526 -200v-64h-640q-53 0 -90.5 -37.5t-37.5 -90.5t37.5 -90.5
+t90.5 -37.5h535l233 106v198q0 63 46 106l111 102h-69zM1073 0q82 0 155 19l339 85q43 11 70 45.5t27 78.5v668q0 53 -37.5 90.5t-90.5 37.5h-308l-136 -126q-36 -33 -36 -82v-296q0 -46 33 -77t79 -31t79 35t33 81v208h32v-208q0 -70 -57 -114q52 -8 86.5 -48.5t34.5 -93.5
+q0 -42 -23 -78t-61 -53l-310 -141h91z" />
+    <glyph glyph-name="_563" unicode="&#xf258;" horiz-adv-x="2048" 
+d="M1151 1536q61 0 116 -28t91 -77l572 -781q118 -159 118 -359v-355q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v177l-286 143h-546q-80 0 -136 56t-56 136v32q0 119 84.5 203.5t203.5 84.5h420l42 128h-686q-100 0 -173.5 67.5t-81.5 166.5q-65 79 -65 182v32
+q0 80 56 136t136 56h959zM1920 -64v355q0 157 -93 284l-573 781q-39 52 -103 52h-959q-26 0 -45 -19t-19 -45q0 -32 1.5 -49.5t9.5 -40.5t25 -43q10 31 35.5 50t56.5 19h832v-32h-832q-26 0 -45 -19t-19 -45q0 -44 3 -58q8 -44 44 -73t81 -29h640h91q40 0 68 -28t28 -68
+q0 -15 -5 -30l-64 -192q-10 -29 -35 -47.5t-56 -18.5h-443q-66 0 -113 -47t-47 -113v-32q0 -26 19 -45t45 -19h561q16 0 29 -7l317 -158q24 -13 38.5 -36t14.5 -50v-197q0 -26 19 -45t45 -19h384q26 0 45 19t19 45z" />
+    <glyph glyph-name="_564" unicode="&#xf259;" horiz-adv-x="2048" 
+d="M459 -256q-77 0 -137.5 47.5t-79.5 122.5l-101 401q-13 57 -13 108q0 45 -5 67l-116 477q-7 27 -7 57q0 93 62 161t155 78q17 85 82.5 139t152.5 54q83 0 148 -51.5t85 -132.5l83 -348l103 428q20 81 85 132.5t148 51.5q89 0 155.5 -57.5t80.5 -144.5q92 -10 152 -79
+t60 -162q0 -24 -7 -59l-123 -512q10 7 37.5 28.5t38.5 29.5t35 23t41 20.5t41.5 11t49.5 5.5q105 0 180 -74t75 -179q0 -62 -28.5 -118t-78.5 -94l-507 -380q-68 -51 -153 -51h-694zM1104 1408q-38 0 -68.5 -24t-39.5 -62l-164 -682h-127l-145 602q-9 38 -39.5 62t-68.5 24
+q-48 0 -80 -33t-32 -80q0 -15 3 -28l132 -547h-26l-99 408q-9 37 -40 62.5t-69 25.5q-47 0 -80 -33t-33 -79q0 -14 3 -26l116 -478q7 -28 9 -86t10 -88l100 -401q8 -32 34 -52.5t59 -20.5h694q42 0 76 26l507 379q56 43 56 110q0 52 -37.5 88.5t-89.5 36.5q-43 0 -77 -26
+l-307 -230v227q0 4 32 138t68 282t39 161q4 18 4 29q0 47 -32 81t-79 34q-39 0 -69.5 -24t-39.5 -62l-116 -482h-26l150 624q3 14 3 28q0 48 -31.5 82t-79.5 34z" />
+    <glyph glyph-name="_565" unicode="&#xf25a;" horiz-adv-x="1792" 
+d="M640 1408q-53 0 -90.5 -37.5t-37.5 -90.5v-512v-384l-151 202q-41 54 -107 54q-52 0 -89 -38t-37 -90q0 -43 26 -77l384 -512q38 -51 102 -51h718q22 0 39.5 13.5t22.5 34.5l92 368q24 96 24 194v217q0 41 -28 71t-68 30t-68 -28t-28 -68h-32v61q0 48 -32 81.5t-80 33.5
+q-46 0 -79 -33t-33 -79v-64h-32v90q0 55 -37 94.5t-91 39.5q-53 0 -90.5 -37.5t-37.5 -90.5v-96h-32v570q0 55 -37 94.5t-91 39.5zM640 1536q107 0 181.5 -77.5t74.5 -184.5v-220q22 2 32 2q99 0 173 -69q47 21 99 21q113 0 184 -87q27 7 56 7q94 0 159 -67.5t65 -161.5
+v-217q0 -116 -28 -225l-92 -368q-16 -64 -68 -104.5t-118 -40.5h-718q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 105 74.5 180.5t179.5 75.5q71 0 130 -35v547q0 106 75 181t181 75zM768 128v384h-32v-384h32zM1024 128v384h-32v-384h32zM1280 128v384h-32
+v-384h32z" />
+    <glyph glyph-name="_566" unicode="&#xf25b;" 
+d="M1288 889q60 0 107 -23q141 -63 141 -226v-177q0 -94 -23 -186l-85 -339q-21 -86 -90.5 -140t-157.5 -54h-668q-106 0 -181 75t-75 181v401l-239 628q-17 45 -17 91q0 106 75 181t181 75q80 0 145.5 -45.5t93.5 -119.5l17 -44v113q0 106 75 181t181 75t181 -75t75 -181
+v-261q27 5 48 5q69 0 127.5 -36.5t88.5 -98.5zM1072 896q-33 0 -60.5 -18t-41.5 -48l-74 -163l-71 -155h55q50 0 90 -31.5t50 -80.5l154 338q10 20 10 46q0 46 -33 79t-79 33zM1293 761q-22 0 -40.5 -8t-29 -16t-23.5 -29.5t-17 -30.5t-17 -37l-132 -290q-10 -20 -10 -46
+q0 -46 33 -79t79 -33q33 0 60.5 18t41.5 48l160 352q9 18 9 38q0 50 -32 81.5t-82 31.5zM128 1120q0 -22 8 -46l248 -650v-69l102 111q43 46 106 46h198l106 233v535q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5v-640h-64l-200 526q-14 37 -47 59.5t-73 22.5
+q-53 0 -90.5 -37.5t-37.5 -90.5zM1180 -128q44 0 78.5 27t45.5 70l85 339q19 73 19 155v91l-141 -310q-17 -38 -53 -61t-78 -23q-53 0 -93.5 34.5t-48.5 86.5q-44 -57 -114 -57h-208v32h208q46 0 81 33t35 79t-31 79t-77 33h-296q-49 0 -82 -36l-126 -136v-308
+q0 -53 37.5 -90.5t90.5 -37.5h668z" />
+    <glyph glyph-name="_567" unicode="&#xf25c;" horiz-adv-x="1973" 
+d="M857 992v-117q0 -13 -9.5 -22t-22.5 -9h-298v-812q0 -13 -9 -22.5t-22 -9.5h-135q-13 0 -22.5 9t-9.5 23v812h-297q-13 0 -22.5 9t-9.5 22v117q0 14 9 23t23 9h793q13 0 22.5 -9.5t9.5 -22.5zM1895 995l77 -961q1 -13 -8 -24q-10 -10 -23 -10h-134q-12 0 -21 8.5
+t-10 20.5l-46 588l-189 -425q-8 -19 -29 -19h-120q-20 0 -29 19l-188 427l-45 -590q-1 -12 -10 -20.5t-21 -8.5h-135q-13 0 -23 10q-9 10 -9 24l78 961q1 12 10 20.5t21 8.5h142q20 0 29 -19l220 -520q10 -24 20 -51q3 7 9.5 24.5t10.5 26.5l221 520q9 19 29 19h141
+q13 0 22 -8.5t10 -20.5z" />
+    <glyph glyph-name="_568" unicode="&#xf25d;" horiz-adv-x="1792" 
+d="M1042 833q0 88 -60 121q-33 18 -117 18h-123v-281h162q66 0 102 37t36 105zM1094 548l205 -373q8 -17 -1 -31q-8 -16 -27 -16h-152q-20 0 -28 17l-194 365h-155v-350q0 -14 -9 -23t-23 -9h-134q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h294q128 0 190 -24q85 -31 134 -109
+t49 -180q0 -92 -42.5 -165.5t-115.5 -109.5q6 -10 9 -16zM896 1376q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM1792 640
+q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_569" unicode="&#xf25e;" horiz-adv-x="1792" 
+d="M605 303q153 0 257 104q14 18 3 36l-45 82q-6 13 -24 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13.5t-23.5 -14.5t-28.5 -13t-33.5 -9.5t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78
+q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-148 0 -246 -96.5t-98 -240.5q0 -146 97 -241.5t247 -95.5zM1235 303q153 0 257 104q14 18 4 36l-45 82q-8 14 -25 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13.5t-23.5 -14.5t-28.5 -13t-33.5 -9.5
+t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-147 0 -245.5 -96.5t-98.5 -240.5q0 -146 97 -241.5t247 -95.5zM896 1376
+q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191
+t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71z" />
+    <glyph glyph-name="f260" unicode="&#xf260;" horiz-adv-x="2048" 
+d="M736 736l384 -384l-384 -384l-672 672l672 672l168 -168l-96 -96l-72 72l-480 -480l480 -480l193 193l-289 287zM1312 1312l672 -672l-672 -672l-168 168l96 96l72 -72l480 480l-480 480l-193 -193l289 -287l-96 -96l-384 384z" />
+    <glyph glyph-name="f261" unicode="&#xf261;" horiz-adv-x="1792" 
+d="M717 182l271 271l-279 279l-88 -88l192 -191l-96 -96l-279 279l279 279l40 -40l87 87l-127 128l-454 -454zM1075 190l454 454l-454 454l-271 -271l279 -279l88 88l-192 191l96 96l279 -279l-279 -279l-40 40l-87 -88zM1792 640q0 -182 -71 -348t-191 -286t-286 -191
+t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_572" unicode="&#xf262;" horiz-adv-x="2304" 
+d="M651 539q0 -39 -27.5 -66.5t-65.5 -27.5q-39 0 -66.5 27.5t-27.5 66.5q0 38 27.5 65.5t66.5 27.5q38 0 65.5 -27.5t27.5 -65.5zM1805 540q0 -39 -27.5 -66.5t-66.5 -27.5t-66.5 27.5t-27.5 66.5t27.5 66t66.5 27t66.5 -27t27.5 -66zM765 539q0 79 -56.5 136t-136.5 57
+t-136.5 -56.5t-56.5 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM1918 540q0 80 -56.5 136.5t-136.5 56.5q-79 0 -136 -56.5t-57 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM850 539q0 -116 -81.5 -197.5t-196.5 -81.5q-116 0 -197.5 82t-81.5 197
+t82 196.5t197 81.5t196.5 -81.5t81.5 -196.5zM2004 540q0 -115 -81.5 -196.5t-197.5 -81.5q-115 0 -196.5 81.5t-81.5 196.5t81.5 196.5t196.5 81.5q116 0 197.5 -81.5t81.5 -196.5zM1040 537q0 191 -135.5 326.5t-326.5 135.5q-125 0 -231 -62t-168 -168.5t-62 -231.5
+t62 -231.5t168 -168.5t231 -62q191 0 326.5 135.5t135.5 326.5zM1708 1110q-254 111 -556 111q-319 0 -573 -110q117 0 223 -45.5t182.5 -122.5t122 -183t45.5 -223q0 115 43.5 219.5t118 180.5t177.5 123t217 50zM2187 537q0 191 -135 326.5t-326 135.5t-326.5 -135.5
+t-135.5 -326.5t135.5 -326.5t326.5 -135.5t326 135.5t135 326.5zM1921 1103h383q-44 -51 -75 -114.5t-40 -114.5q110 -151 110 -337q0 -156 -77 -288t-209 -208.5t-287 -76.5q-133 0 -249 56t-196 155q-47 -56 -129 -179q-11 22 -53.5 82.5t-74.5 97.5
+q-80 -99 -196.5 -155.5t-249.5 -56.5q-155 0 -287 76.5t-209 208.5t-77 288q0 186 110 337q-9 51 -40 114.5t-75 114.5h365q149 100 355 156.5t432 56.5q224 0 421 -56t348 -157z" />
+    <glyph glyph-name="f263" unicode="&#xf263;" horiz-adv-x="1280" 
+d="M640 629q-188 0 -321 133t-133 320q0 188 133 321t321 133t321 -133t133 -321q0 -187 -133 -320t-321 -133zM640 1306q-92 0 -157.5 -65.5t-65.5 -158.5q0 -92 65.5 -157.5t157.5 -65.5t157.5 65.5t65.5 157.5q0 93 -65.5 158.5t-157.5 65.5zM1163 574q13 -27 15 -49.5
+t-4.5 -40.5t-26.5 -38.5t-42.5 -37t-61.5 -41.5q-115 -73 -315 -94l73 -72l267 -267q30 -31 30 -74t-30 -73l-12 -13q-31 -30 -74 -30t-74 30q-67 68 -267 268l-267 -268q-31 -30 -74 -30t-73 30l-12 13q-31 30 -31 73t31 74l267 267l72 72q-203 21 -317 94
+q-39 25 -61.5 41.5t-42.5 37t-26.5 38.5t-4.5 40.5t15 49.5q10 20 28 35t42 22t56 -2t65 -35q5 -4 15 -11t43 -24.5t69 -30.5t92 -24t113 -11q91 0 174 25.5t120 50.5l38 25q33 26 65 35t56 2t42 -22t28 -35z" />
+    <glyph glyph-name="_574" unicode="&#xf264;" 
+d="M927 956q0 -66 -46.5 -112.5t-112.5 -46.5t-112.5 46.5t-46.5 112.5t46.5 112.5t112.5 46.5t112.5 -46.5t46.5 -112.5zM1141 593q-10 20 -28 32t-47.5 9.5t-60.5 -27.5q-10 -8 -29 -20t-81 -32t-127 -20t-124 18t-86 36l-27 18q-31 25 -60.5 27.5t-47.5 -9.5t-28 -32
+q-22 -45 -2 -74.5t87 -73.5q83 -53 226 -67l-51 -52q-142 -142 -191 -190q-22 -22 -22 -52.5t22 -52.5l9 -9q22 -22 52.5 -22t52.5 22l191 191q114 -115 191 -191q22 -22 52.5 -22t52.5 22l9 9q22 22 22 52.5t-22 52.5l-191 190l-52 52q141 14 225 67q67 44 87 73.5t-2 74.5
+zM1092 956q0 134 -95 229t-229 95t-229 -95t-95 -229t95 -229t229 -95t229 95t95 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="_575" unicode="&#xf265;" horiz-adv-x="1720" 
+d="M1565 1408q65 0 110 -45.5t45 -110.5v-519q0 -176 -68 -336t-182.5 -275t-274 -182.5t-334.5 -67.5q-176 0 -335.5 67.5t-274.5 182.5t-183 275t-68 336v519q0 64 46 110t110 46h1409zM861 344q47 0 82 33l404 388q37 35 37 85q0 49 -34.5 83.5t-83.5 34.5q-47 0 -82 -33
+l-323 -310l-323 310q-35 33 -81 33q-49 0 -83.5 -34.5t-34.5 -83.5q0 -51 36 -85l405 -388q33 -33 81 -33z" />
+    <glyph glyph-name="_576" unicode="&#xf266;" horiz-adv-x="2304" 
+d="M1494 -103l-295 695q-25 -49 -158.5 -305.5t-198.5 -389.5q-1 -1 -27.5 -0.5t-26.5 1.5q-82 193 -255.5 587t-259.5 596q-21 50 -66.5 107.5t-103.5 100.5t-102 43q0 5 -0.5 24t-0.5 27h583v-50q-39 -2 -79.5 -16t-66.5 -43t-10 -64q26 -59 216.5 -499t235.5 -540
+q31 61 140 266.5t131 247.5q-19 39 -126 281t-136 295q-38 69 -201 71v50l513 -1v-47q-60 -2 -93.5 -25t-12.5 -69q33 -70 87 -189.5t86 -187.5q110 214 173 363q24 55 -10 79.5t-129 26.5q1 7 1 25v24q64 0 170.5 0.5t180 1t92.5 0.5v-49q-62 -2 -119 -33t-90 -81
+l-213 -442q13 -33 127.5 -290t121.5 -274l441 1017q-14 38 -49.5 62.5t-65 31.5t-55.5 8v50l460 -4l1 -2l-1 -44q-139 -4 -201 -145q-526 -1216 -559 -1291h-49z" />
+    <glyph glyph-name="_577" unicode="&#xf267;" horiz-adv-x="1792" 
+d="M949 643q0 -26 -16.5 -45t-41.5 -19q-26 0 -45 16.5t-19 41.5q0 26 17 45t42 19t44 -16.5t19 -41.5zM964 585l350 581q-9 -8 -67.5 -62.5t-125.5 -116.5t-136.5 -127t-117 -110.5t-50.5 -51.5l-349 -580q7 7 67 62t126 116.5t136 127t117 111t50 50.5zM1611 640
+q0 -201 -104 -371q-3 2 -17 11t-26.5 16.5t-16.5 7.5q-13 0 -13 -13q0 -10 59 -44q-74 -112 -184.5 -190.5t-241.5 -110.5l-16 67q-1 10 -15 10q-5 0 -8 -5.5t-2 -9.5l16 -68q-72 -15 -146 -15q-199 0 -372 105q1 2 13 20.5t21.5 33.5t9.5 19q0 13 -13 13q-6 0 -17 -14.5
+t-22.5 -34.5t-13.5 -23q-113 75 -192 187.5t-110 244.5l69 15q10 3 10 15q0 5 -5.5 8t-10.5 2l-68 -15q-14 72 -14 139q0 206 109 379q2 -1 18.5 -12t30 -19t17.5 -8q13 0 13 12q0 6 -12.5 15.5t-32.5 21.5l-20 12q77 112 189 189t244 107l15 -67q2 -10 15 -10q5 0 8 5.5
+t2 10.5l-15 66q71 13 134 13q204 0 379 -109q-39 -56 -39 -65q0 -13 12 -13q11 0 48 64q111 -75 187.5 -186t107.5 -241l-56 -12q-10 -2 -10 -16q0 -5 5.5 -8t9.5 -2l57 13q14 -72 14 -140zM1696 640q0 163 -63.5 311t-170.5 255t-255 170.5t-311 63.5t-311 -63.5
+t-255 -170.5t-170.5 -255t-63.5 -311t63.5 -311t170.5 -255t255 -170.5t311 -63.5t311 63.5t255 170.5t170.5 255t63.5 311zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191
+t191 -286t71 -348z" />
+    <glyph glyph-name="_578" unicode="&#xf268;" horiz-adv-x="1792" 
+d="M893 1536q240 2 451 -120q232 -134 352 -372l-742 39q-160 9 -294 -74.5t-185 -229.5l-276 424q128 159 311 245.5t383 87.5zM146 1131l337 -663q72 -143 211 -217t293 -45l-230 -451q-212 33 -385 157.5t-272.5 316t-99.5 411.5q0 267 146 491zM1732 962
+q58 -150 59.5 -310.5t-48.5 -306t-153 -272t-246 -209.5q-230 -133 -498 -119l405 623q88 131 82.5 290.5t-106.5 277.5zM896 942q125 0 213.5 -88.5t88.5 -213.5t-88.5 -213.5t-213.5 -88.5t-213.5 88.5t-88.5 213.5t88.5 213.5t213.5 88.5z" />
+    <glyph glyph-name="_579" unicode="&#xf269;" horiz-adv-x="1792" 
+d="M903 -256q-283 0 -504.5 150.5t-329.5 398.5q-58 131 -67 301t26 332.5t111 312t179 242.5l-11 -281q11 14 68 15.5t70 -15.5q42 81 160.5 138t234.5 59q-54 -45 -119.5 -148.5t-58.5 -163.5q25 -8 62.5 -13.5t63 -7.5t68 -4t50.5 -3q15 -5 9.5 -45.5t-30.5 -75.5
+q-5 -7 -16.5 -18.5t-56.5 -35.5t-101 -34l15 -189l-139 67q-18 -43 -7.5 -81.5t36 -66.5t65.5 -41.5t81 -6.5q51 9 98 34.5t83.5 45t73.5 17.5q61 -4 89.5 -33t19.5 -65q-1 -2 -2.5 -5.5t-8.5 -12.5t-18 -15.5t-31.5 -10.5t-46.5 -1q-60 -95 -144.5 -135.5t-209.5 -29.5
+q74 -61 162.5 -82.5t168.5 -6t154.5 52t128 87.5t80.5 104q43 91 39 192.5t-37.5 188.5t-78.5 125q87 -38 137 -79.5t77 -112.5q15 170 -57.5 343t-209.5 284q265 -77 412 -279.5t151 -517.5q2 -127 -40.5 -255t-123.5 -238t-189 -196t-247.5 -135.5t-288.5 -49.5z" />
+    <glyph glyph-name="_580" unicode="&#xf26a;" horiz-adv-x="1792" 
+d="M1493 1308q-165 110 -359 110q-155 0 -293 -73t-240 -200q-75 -93 -119.5 -218t-48.5 -266v-42q4 -141 48.5 -266t119.5 -218q102 -127 240 -200t293 -73q194 0 359 110q-121 -108 -274.5 -168t-322.5 -60q-29 0 -43 1q-175 8 -333 82t-272 193t-181 281t-67 339
+q0 182 71 348t191 286t286 191t348 71h3q168 -1 320.5 -60.5t273.5 -167.5zM1792 640q0 -192 -77 -362.5t-213 -296.5q-104 -63 -222 -63q-137 0 -255 84q154 56 253.5 233t99.5 405q0 227 -99 404t-253 234q119 83 254 83q119 0 226 -65q135 -125 210.5 -295t75.5 -361z
+" />
+    <glyph glyph-name="_581" unicode="&#xf26b;" horiz-adv-x="1792" 
+d="M1792 599q0 -56 -7 -104h-1151q0 -146 109.5 -244.5t257.5 -98.5q99 0 185.5 46.5t136.5 130.5h423q-56 -159 -170.5 -281t-267.5 -188.5t-321 -66.5q-187 0 -356 83q-228 -116 -394 -116q-237 0 -237 263q0 115 45 275q17 60 109 229q199 360 475 606
+q-184 -79 -427 -354q63 274 283.5 449.5t501.5 175.5q30 0 45 -1q255 117 433 117q64 0 116 -13t94.5 -40.5t66.5 -76.5t24 -115q0 -116 -75 -286q101 -182 101 -390zM1722 1239q0 83 -53 132t-137 49q-108 0 -254 -70q121 -47 222.5 -131.5t170.5 -195.5q51 135 51 216z
+M128 2q0 -86 48.5 -132.5t134.5 -46.5q115 0 266 83q-122 72 -213.5 183t-137.5 245q-98 -205 -98 -332zM632 715h728q-5 142 -113 237t-251 95q-144 0 -251.5 -95t-112.5 -237z" />
+    <glyph glyph-name="_582" unicode="&#xf26c;" horiz-adv-x="2048" 
+d="M1792 288v960q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1248v-960q0 -66 -47 -113t-113 -47h-736v-128h352q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23
+v64q0 14 9 23t23 9h352v128h-736q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="_583" unicode="&#xf26d;" horiz-adv-x="1792" 
+d="M138 1408h197q-70 -64 -126 -149q-36 -56 -59 -115t-30 -125.5t-8.5 -120t10.5 -132t21 -126t28 -136.5q4 -19 6 -28q51 -238 81 -329q57 -171 152 -275h-272q-48 0 -82 34t-34 82v1304q0 48 34 82t82 34zM1346 1408h308q48 0 82 -34t34 -82v-1304q0 -48 -34 -82t-82 -34
+h-178q212 210 196 565l-469 -101q-2 -45 -12 -82t-31 -72t-59.5 -59.5t-93.5 -36.5q-123 -26 -199 40q-32 27 -53 61t-51.5 129t-64.5 258q-35 163 -45.5 263t-5.5 139t23 77q20 41 62.5 73t102.5 45q45 12 83.5 6.5t67 -17t54 -35t43 -48t34.5 -56.5l468 100
+q-68 175 -180 287z" />
+    <glyph glyph-name="_584" unicode="&#xf26e;" 
+d="M1401 -11l-6 -6q-113 -113 -259 -175q-154 -64 -317 -64q-165 0 -317 64q-148 63 -259 175q-113 112 -175 258q-42 103 -54 189q-4 28 48 36q51 8 56 -20q1 -1 1 -4q18 -90 46 -159q50 -124 152 -226q98 -98 226 -152q132 -56 276 -56q143 0 276 56q128 55 225 152l6 6
+q10 10 25 6q12 -3 33 -22q36 -37 17 -58zM929 604l-66 -66l63 -63q21 -21 -7 -49q-17 -17 -32 -17q-10 0 -19 10l-62 61l-66 -66q-5 -5 -15 -5q-15 0 -31 16l-2 2q-18 15 -18 29q0 7 8 17l66 65l-66 66q-16 16 14 45q18 18 31 18q6 0 13 -5l65 -66l65 65q18 17 48 -13
+q27 -27 11 -44zM1400 547q0 -118 -46 -228q-45 -105 -126 -186q-80 -80 -187 -126t-228 -46t-228 46t-187 126q-82 82 -125 186q-15 33 -15 40h-1q-9 27 43 44q50 16 60 -12q37 -99 97 -167h1v339v2q3 136 102 232q105 103 253 103q147 0 251 -103t104 -249
+q0 -147 -104.5 -251t-250.5 -104q-58 0 -112 16q-28 11 -13 61q16 51 44 43l14 -3q14 -3 33 -6t30 -3q104 0 176 71.5t72 174.5q0 101 -72 171q-71 71 -175 71q-107 0 -178 -80q-64 -72 -64 -160v-413q110 -67 242 -67q96 0 185 36.5t156 103.5t103.5 155t36.5 183
+q0 198 -141 339q-140 140 -339 140q-200 0 -340 -140q-53 -53 -77 -87l-2 -2q-8 -11 -13 -15.5t-21.5 -9.5t-38.5 3q-21 5 -36.5 16.5t-15.5 26.5v680q0 15 10.5 26.5t27.5 11.5h877q30 0 30 -55t-30 -55h-811v-483h1q40 42 102 84t108 61q109 46 231 46q121 0 228 -46
+t187 -126q81 -81 126 -186q46 -112 46 -229zM1369 1128q9 -8 9 -18t-5.5 -18t-16.5 -21q-26 -26 -39 -26q-9 0 -16 7q-106 91 -207 133q-128 56 -276 56q-133 0 -262 -49q-27 -10 -45 37q-9 25 -8 38q3 16 16 20q130 57 299 57q164 0 316 -64q137 -58 235 -152z" />
+    <glyph glyph-name="_585" unicode="&#xf270;" horiz-adv-x="1792" 
+d="M1551 60q15 6 26 3t11 -17.5t-15 -33.5q-13 -16 -44 -43.5t-95.5 -68t-141 -74t-188 -58t-229.5 -24.5q-119 0 -238 31t-209 76.5t-172.5 104t-132.5 105t-84 87.5q-8 9 -10 16.5t1 12t8 7t11.5 2t11.5 -4.5q192 -117 300 -166q389 -176 799 -90q190 40 391 135z
+M1758 175q11 -16 2.5 -69.5t-28.5 -102.5q-34 -83 -85 -124q-17 -14 -26 -9t0 24q21 45 44.5 121.5t6.5 98.5q-5 7 -15.5 11.5t-27 6t-29.5 2.5t-35 0t-31.5 -2t-31 -3t-22.5 -2q-6 -1 -13 -1.5t-11 -1t-8.5 -1t-7 -0.5h-5.5h-4.5t-3 0.5t-2 1.5l-1.5 3q-6 16 47 40t103 30
+q46 7 108 1t76 -24zM1364 618q0 -31 13.5 -64t32 -58t37.5 -46t33 -32l13 -11l-227 -224q-40 37 -79 75.5t-58 58.5l-19 20q-11 11 -25 33q-38 -59 -97.5 -102.5t-127.5 -63.5t-140 -23t-137.5 21t-117.5 65.5t-83 113t-31 162.5q0 84 28 154t72 116.5t106.5 83t122.5 57
+t130 34.5t119.5 18.5t99.5 6.5v127q0 65 -21 97q-34 53 -121 53q-6 0 -16.5 -1t-40.5 -12t-56 -29.5t-56 -59.5t-48 -96l-294 27q0 60 22 119t67 113t108 95t151.5 65.5t190.5 24.5q100 0 181 -25t129.5 -61.5t81 -83t45 -86t12.5 -73.5v-589zM692 597q0 -86 70 -133
+q66 -44 139 -22q84 25 114 123q14 45 14 101v162q-59 -2 -111 -12t-106.5 -33.5t-87 -71t-32.5 -114.5z" />
+    <glyph glyph-name="_586" unicode="&#xf271;" horiz-adv-x="1792" 
+d="M1536 1280q52 0 90 -38t38 -90v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128zM1152 1376v-288q0 -14 9 -23t23 -9
+h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 1376v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM1536 -128v1024h-1408v-1024h1408zM896 448h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224
+v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224z" />
+    <glyph glyph-name="_587" unicode="&#xf272;" horiz-adv-x="1792" 
+d="M1152 416v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23
+t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47
+t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_588" unicode="&#xf273;" horiz-adv-x="1792" 
+d="M1111 151l-46 -46q-9 -9 -22 -9t-23 9l-188 189l-188 -189q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22t9 23l189 188l-189 188q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l188 -188l188 188q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23l-188 -188l188 -188q9 -10 9 -23t-9 -22z
+M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280
+q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_589" unicode="&#xf274;" horiz-adv-x="1792" 
+d="M1303 572l-512 -512q-10 -9 -23 -9t-23 9l-288 288q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l220 -220l444 444q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23
+t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47
+t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" />
+    <glyph glyph-name="_590" unicode="&#xf275;" horiz-adv-x="1792" 
+d="M448 1536q26 0 45 -19t19 -45v-891l536 429q17 14 40 14q26 0 45 -19t19 -45v-379l536 429q17 14 40 14q26 0 45 -19t19 -45v-1152q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h384z" />
+    <glyph glyph-name="_591" unicode="&#xf276;" horiz-adv-x="1024" 
+d="M512 448q66 0 128 15v-655q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v655q62 -15 128 -15zM512 1536q212 0 362 -150t150 -362t-150 -362t-362 -150t-362 150t-150 362t150 362t362 150zM512 1312q14 0 23 9t9 23t-9 23t-23 9q-146 0 -249 -103t-103 -249
+q0 -14 9 -23t23 -9t23 9t9 23q0 119 84.5 203.5t203.5 84.5z" />
+    <glyph glyph-name="_592" unicode="&#xf277;" horiz-adv-x="1792" 
+d="M1745 1239q10 -10 10 -23t-10 -23l-141 -141q-28 -28 -68 -28h-1344q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h576v64q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-64h512q40 0 68 -28zM768 320h256v-512q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v512zM1600 768
+q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-1344q-40 0 -68 28l-141 141q-10 10 -10 23t10 23l141 141q28 28 68 28h512v192h256v-192h576z" />
+    <glyph glyph-name="_593" unicode="&#xf278;" horiz-adv-x="2048" 
+d="M2020 1525q28 -20 28 -53v-1408q0 -20 -11 -36t-29 -23l-640 -256q-24 -11 -48 0l-616 246l-616 -246q-10 -5 -24 -5q-19 0 -36 11q-28 20 -28 53v1408q0 20 11 36t29 23l640 256q24 11 48 0l616 -246l616 246q32 13 60 -6zM736 1390v-1270l576 -230v1270zM128 1173
+v-1270l544 217v1270zM1920 107v1270l-544 -217v-1270z" />
+    <glyph glyph-name="_594" unicode="&#xf279;" horiz-adv-x="1792" 
+d="M512 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472q0 20 17 28l480 256q7 4 15 4zM1760 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472
+q0 20 17 28l480 256q7 4 15 4zM640 1536q8 0 14 -3l512 -256q18 -10 18 -29v-1472q0 -13 -9.5 -22.5t-22.5 -9.5q-8 0 -14 3l-512 256q-18 10 -18 29v1472q0 13 9.5 22.5t22.5 9.5z" />
+    <glyph glyph-name="_595" unicode="&#xf27a;" horiz-adv-x="1792" 
+d="M640 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 640q0 53 -37.5 90.5t-90.5 37.5
+t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-110 0 -211 18q-173 -173 -435 -229q-52 -10 -86 -13q-12 -1 -22 6t-13 18q-4 15 20 37q5 5 23.5 21.5t25.5 23.5t23.5 25.5t24 31.5t20.5 37
+t20 48t14.5 57.5t12.5 72.5q-146 90 -229.5 216.5t-83.5 269.5q0 174 120 321.5t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" />
+    <glyph glyph-name="_596" unicode="&#xf27b;" horiz-adv-x="1792" 
+d="M640 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 -53 -37.5 -90.5t-90.5 -37.5
+t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5
+t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51
+t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 130 71 248.5t191 204.5t286 136.5t348 50.5t348 -50.5t286 -136.5t191 -204.5t71 -248.5z" />
+    <glyph glyph-name="_597" unicode="&#xf27c;" horiz-adv-x="1024" 
+d="M512 345l512 295v-591l-512 -296v592zM0 640v-591l512 296zM512 1527v-591l-512 -296v591zM512 936l512 295v-591z" />
+    <glyph glyph-name="_598" unicode="&#xf27d;" horiz-adv-x="1792" 
+d="M1709 1018q-10 -236 -332 -651q-333 -431 -562 -431q-142 0 -240 263q-44 160 -132 482q-72 262 -157 262q-18 0 -127 -76l-77 98q24 21 108 96.5t130 115.5q156 138 241 146q95 9 153 -55.5t81 -203.5q44 -287 66 -373q55 -249 120 -249q51 0 154 161q101 161 109 246
+q13 139 -109 139q-57 0 -121 -26q120 393 459 382q251 -8 236 -326z" />
+    <glyph glyph-name="f27e" unicode="&#xf27e;" 
+d="M0 1408h1536v-1536h-1536v1536zM1085 293l-221 631l221 297h-634l221 -297l-221 -631l317 -304z" />
+    <glyph glyph-name="uniF280" unicode="&#xf280;" 
+d="M0 1408h1536v-1536h-1536v1536zM908 1088l-12 -33l75 -83l-31 -114l25 -25l107 57l107 -57l25 25l-31 114l75 83l-12 33h-95l-53 96h-32l-53 -96h-95zM641 925q32 0 44.5 -16t11.5 -63l174 21q0 55 -17.5 92.5t-50.5 56t-69 25.5t-85 7q-133 0 -199 -57.5t-66 -182.5v-72
+h-96v-128h76q20 0 20 -8v-382q0 -14 -5 -20t-18 -7l-73 -7v-88h448v86l-149 14q-6 1 -8.5 1.5t-3.5 2.5t-0.5 4t1 7t0.5 10v387h191l38 128h-231q-6 0 -2 6t4 9v80q0 27 1.5 40.5t7.5 28t19.5 20t36.5 5.5zM1248 96v86l-54 9q-7 1 -9.5 2.5t-2.5 3t1 7.5t1 12v520h-275
+l-23 -101l83 -22q23 -7 23 -27v-370q0 -14 -6 -18.5t-20 -6.5l-70 -9v-86h352z" />
+    <glyph glyph-name="uniF281" unicode="&#xf281;" horiz-adv-x="1792" 
+d="M1792 690q0 -58 -29.5 -105.5t-79.5 -72.5q12 -46 12 -96q0 -155 -106.5 -287t-290.5 -208.5t-400 -76.5t-399.5 76.5t-290 208.5t-106.5 287q0 47 11 94q-51 25 -82 73.5t-31 106.5q0 82 58 140.5t141 58.5q85 0 145 -63q218 152 515 162l116 521q3 13 15 21t26 5
+l369 -81q18 37 54 59.5t79 22.5q62 0 106 -43.5t44 -105.5t-44 -106t-106 -44t-105.5 43.5t-43.5 105.5l-334 74l-104 -472q300 -9 519 -160q58 61 143 61q83 0 141 -58.5t58 -140.5zM418 491q0 -62 43.5 -106t105.5 -44t106 44t44 106t-44 105.5t-106 43.5q-61 0 -105 -44
+t-44 -105zM1228 136q11 11 11 26t-11 26q-10 10 -25 10t-26 -10q-41 -42 -121 -62t-160 -20t-160 20t-121 62q-11 10 -26 10t-25 -10q-11 -10 -11 -25.5t11 -26.5q43 -43 118.5 -68t122.5 -29.5t91 -4.5t91 4.5t122.5 29.5t118.5 68zM1225 341q62 0 105.5 44t43.5 106
+q0 61 -44 105t-105 44q-62 0 -106 -43.5t-44 -105.5t44 -106t106 -44z" />
+    <glyph glyph-name="_602" unicode="&#xf282;" horiz-adv-x="1792" 
+d="M69 741h1q16 126 58.5 241.5t115 217t167.5 176t223.5 117.5t276.5 43q231 0 414 -105.5t294 -303.5q104 -187 104 -442v-188h-1125q1 -111 53.5 -192.5t136.5 -122.5t189.5 -57t213 -3t208 46.5t173.5 84.5v-377q-92 -55 -229.5 -92t-312.5 -38t-316 53
+q-189 73 -311.5 249t-124.5 372q-3 242 111 412t325 268q-48 -60 -78 -125.5t-46 -159.5h635q8 77 -8 140t-47 101.5t-70.5 66.5t-80.5 41t-75 20.5t-56 8.5l-22 1q-135 -5 -259.5 -44.5t-223.5 -104.5t-176 -140.5t-138 -163.5z" />
+    <glyph glyph-name="_603" unicode="&#xf283;" horiz-adv-x="2304" 
+d="M0 32v608h2304v-608q0 -66 -47 -113t-113 -47h-1984q-66 0 -113 47t-47 113zM640 256v-128h384v128h-384zM256 256v-128h256v128h-256zM2144 1408q66 0 113 -47t47 -113v-224h-2304v224q0 66 47 113t113 47h1984z" />
+    <glyph glyph-name="_604" unicode="&#xf284;" horiz-adv-x="1792" 
+d="M1584 246l-218 111q-74 -120 -196.5 -189t-263.5 -69q-147 0 -271 72t-196 196t-72 270q0 110 42.5 209.5t115 172t172 115t209.5 42.5q131 0 247.5 -60.5t192.5 -168.5l215 125q-110 169 -286.5 265t-378.5 96q-161 0 -308 -63t-253 -169t-169 -253t-63 -308t63 -308
+t169 -253t253 -169t308 -63q213 0 397.5 107t290.5 292zM1030 643l693 -352q-116 -253 -334.5 -400t-492.5 -147q-182 0 -348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71q260 0 470.5 -133.5t335.5 -366.5zM1543 640h-39v-160h-96v352h136q32 0 54.5 -20
+t28.5 -48t1 -56t-27.5 -48t-57.5 -20z" />
+    <glyph glyph-name="uniF285" unicode="&#xf285;" horiz-adv-x="1792" 
+d="M1427 827l-614 386l92 151h855zM405 562l-184 116v858l1183 -743zM1424 697l147 -95v-858l-532 335zM1387 718l-500 -802h-855l356 571z" />
+    <glyph glyph-name="uniF286" unicode="&#xf286;" horiz-adv-x="1792" 
+d="M640 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1152 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1664 496v-752h-640v320q0 80 -56 136t-136 56t-136 -56t-56 -136v-320h-640v752q0 16 16 16h96
+q16 0 16 -16v-112h128v624q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 6 2.5 9.5t8.5 5t9.5 2t11.5 0t9 -0.5v391q-32 15 -32 50q0 23 16.5 39t38.5 16t38.5 -16t16.5 -39q0 -35 -32 -50v-17q45 10 83 10q21 0 59.5 -7.5t54.5 -7.5
+q17 0 47 7.5t37 7.5q16 0 16 -16v-210q0 -15 -35 -21.5t-62 -6.5q-18 0 -54.5 7.5t-55.5 7.5q-40 0 -90 -12v-133q1 0 9 0.5t11.5 0t9.5 -2t8.5 -5t2.5 -9.5v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-624h128v112q0 16 16 16h96
+q16 0 16 -16z" />
+    <glyph glyph-name="_607" unicode="&#xf287;" horiz-adv-x="2304" 
+d="M2288 731q16 -8 16 -27t-16 -27l-320 -192q-8 -5 -16 -5q-9 0 -16 4q-16 10 -16 28v128h-858q37 -58 83 -165q16 -37 24.5 -55t24 -49t27 -47t27 -34t31.5 -26t33 -8h96v96q0 14 9 23t23 9h320q14 0 23 -9t9 -23v-320q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v96h-96
+q-32 0 -61 10t-51 23.5t-45 40.5t-37 46t-33.5 57t-28.5 57.5t-28 60.5q-23 53 -37 81.5t-36 65t-44.5 53.5t-46.5 17h-360q-22 -84 -91 -138t-157 -54q-106 0 -181 75t-75 181t75 181t181 75q88 0 157 -54t91 -138h104q24 0 46.5 17t44.5 53.5t36 65t37 81.5q19 41 28 60.5
+t28.5 57.5t33.5 57t37 46t45 40.5t51 23.5t61 10h107q21 57 70 92.5t111 35.5q80 0 136 -56t56 -136t-56 -136t-136 -56q-62 0 -111 35.5t-70 92.5h-107q-17 0 -33 -8t-31.5 -26t-27 -34t-27 -47t-24 -49t-24.5 -55q-46 -107 -83 -165h1114v128q0 18 16 28t32 -1z" />
+    <glyph glyph-name="_608" unicode="&#xf288;" horiz-adv-x="1792" 
+d="M1150 774q0 -56 -39.5 -95t-95.5 -39h-253v269h253q56 0 95.5 -39.5t39.5 -95.5zM1329 774q0 130 -91.5 222t-222.5 92h-433v-896h180v269h253q130 0 222 91.5t92 221.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348
+t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_609" unicode="&#xf289;" horiz-adv-x="2304" 
+d="M1645 438q0 59 -34 106.5t-87 68.5q-7 -45 -23 -92q-7 -24 -27.5 -38t-44.5 -14q-12 0 -24 3q-31 10 -45 38.5t-4 58.5q23 71 23 143q0 123 -61 227.5t-166 165.5t-228 61q-134 0 -247 -73t-167 -194q108 -28 188 -106q22 -23 22 -55t-22 -54t-54 -22t-55 22
+q-75 75 -180 75q-106 0 -181 -74.5t-75 -180.5t75 -180.5t181 -74.5h1046q79 0 134.5 55.5t55.5 133.5zM1798 438q0 -142 -100.5 -242t-242.5 -100h-1046q-169 0 -289 119.5t-120 288.5q0 153 100 267t249 136q62 184 221 298t354 114q235 0 408.5 -158.5t196.5 -389.5
+q116 -25 192.5 -118.5t76.5 -214.5zM2048 438q0 -175 -97 -319q-23 -33 -64 -33q-24 0 -43 13q-26 17 -32 48.5t12 57.5q71 104 71 233t-71 233q-18 26 -12 57t32 49t57.5 11.5t49.5 -32.5q97 -142 97 -318zM2304 438q0 -244 -134 -443q-23 -34 -64 -34q-23 0 -42 13
+q-26 18 -32.5 49t11.5 57q108 164 108 358q0 195 -108 357q-18 26 -11.5 57.5t32.5 48.5q26 18 57 12t49 -33q134 -198 134 -442z" />
+    <glyph glyph-name="_610" unicode="&#xf28a;" 
+d="M1500 -13q0 -89 -63 -152.5t-153 -63.5t-153.5 63.5t-63.5 152.5q0 90 63.5 153.5t153.5 63.5t153 -63.5t63 -153.5zM1267 268q-115 -15 -192.5 -102.5t-77.5 -205.5q0 -74 33 -138q-146 -78 -379 -78q-109 0 -201 21t-153.5 54.5t-110.5 76.5t-76 85t-44.5 83
+t-23.5 66.5t-6 39.5q0 19 4.5 42.5t18.5 56t36.5 58t64 43.5t94.5 18t94 -17.5t63 -41t35.5 -53t17.5 -49t4 -33.5q0 -34 -23 -81q28 -27 82 -42t93 -17l40 -1q115 0 190 51t75 133q0 26 -9 48.5t-31.5 44.5t-49.5 41t-74 44t-93.5 47.5t-119.5 56.5q-28 13 -43 20
+q-116 55 -187 100t-122.5 102t-72 125.5t-20.5 162.5q0 78 20.5 150t66 137.5t112.5 114t166.5 77t221.5 28.5q120 0 220 -26t164.5 -67t109.5 -94t64 -105.5t19 -103.5q0 -46 -15 -82.5t-36.5 -58t-48.5 -36t-49 -19.5t-39 -5h-8h-32t-39 5t-44 14t-41 28t-37 46t-24 70.5
+t-10 97.5q-15 16 -59 25.5t-81 10.5l-37 1q-68 0 -117.5 -31t-70.5 -70t-21 -76q0 -24 5 -43t24 -46t53 -51t97 -53.5t150 -58.5q76 -25 138.5 -53.5t109 -55.5t83 -59t60.5 -59.5t41 -62.5t26.5 -62t14.5 -63.5t6 -62t1 -62.5z" />
+    <glyph glyph-name="_611" unicode="&#xf28b;" 
+d="M704 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1152 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103
+t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_612" unicode="&#xf28c;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273
+t73 -273t198 -198t273 -73zM864 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192z" />
+    <glyph glyph-name="_613" unicode="&#xf28d;" 
+d="M1088 352v576q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5
+t103 -385.5z" />
+    <glyph glyph-name="_614" unicode="&#xf28e;" 
+d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273
+t73 -273t198 -198t273 -73zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h576q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-576z" />
+    <glyph glyph-name="_615" unicode="&#xf290;" horiz-adv-x="1792" 
+d="M1757 128l35 -313q3 -28 -16 -50q-19 -21 -48 -21h-1664q-29 0 -48 21q-19 22 -16 50l35 313h1722zM1664 967l86 -775h-1708l86 775q3 24 21 40.5t43 16.5h256v-128q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5v128h384v-128q0 -53 37.5 -90.5t90.5 -37.5
+t90.5 37.5t37.5 90.5v128h256q25 0 43 -16.5t21 -40.5zM1280 1152v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 159 112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="_616" unicode="&#xf291;" horiz-adv-x="2048" 
+d="M1920 768q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5h-15l-115 -662q-8 -46 -44 -76t-82 -30h-1280q-46 0 -82 30t-44 76l-115 662h-15q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5h1792zM485 -32q26 2 43.5 22.5t15.5 46.5l-32 416q-2 26 -22.5 43.5
+t-46.5 15.5t-43.5 -22.5t-15.5 -46.5l32 -416q2 -25 20.5 -42t43.5 -17h5zM896 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1280 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1632 27l32 416
+q2 26 -15.5 46.5t-43.5 22.5t-46.5 -15.5t-22.5 -43.5l-32 -416q-2 -26 15.5 -46.5t43.5 -22.5h5q25 0 43.5 17t20.5 42zM476 1244l-93 -412h-132l101 441q19 88 89 143.5t160 55.5h167q0 26 19 45t45 19h384q26 0 45 -19t19 -45h167q90 0 160 -55.5t89 -143.5l101 -441
+h-132l-93 412q-11 44 -45.5 72t-79.5 28h-167q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45h-167q-45 0 -79.5 -28t-45.5 -72z" />
+    <glyph glyph-name="_617" unicode="&#xf292;" horiz-adv-x="1792" 
+d="M991 512l64 256h-254l-64 -256h254zM1759 1016l-56 -224q-7 -24 -31 -24h-327l-64 -256h311q15 0 25 -12q10 -14 6 -28l-56 -224q-5 -24 -31 -24h-327l-81 -328q-7 -24 -31 -24h-224q-16 0 -26 12q-9 12 -6 28l78 312h-254l-81 -328q-7 -24 -31 -24h-225q-15 0 -25 12
+q-9 12 -6 28l78 312h-311q-15 0 -25 12q-9 12 -6 28l56 224q7 24 31 24h327l64 256h-311q-15 0 -25 12q-10 14 -6 28l56 224q5 24 31 24h327l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h254l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h311
+q15 0 25 -12q9 -12 6 -28z" />
+    <glyph glyph-name="_618" unicode="&#xf293;" 
+d="M841 483l148 -148l-149 -149zM840 1094l149 -149l-148 -148zM710 -130l464 464l-306 306l306 306l-464 464v-611l-255 255l-93 -93l320 -321l-320 -321l93 -93l255 255v-611zM1429 640q0 -209 -32 -365.5t-87.5 -257t-140.5 -162.5t-181.5 -86.5t-219.5 -24.5
+t-219.5 24.5t-181.5 86.5t-140.5 162.5t-87.5 257t-32 365.5t32 365.5t87.5 257t140.5 162.5t181.5 86.5t219.5 24.5t219.5 -24.5t181.5 -86.5t140.5 -162.5t87.5 -257t32 -365.5z" />
+    <glyph glyph-name="_619" unicode="&#xf294;" horiz-adv-x="1024" 
+d="M596 113l173 172l-173 172v-344zM596 823l173 172l-173 172v-344zM628 640l356 -356l-539 -540v711l-297 -296l-108 108l372 373l-372 373l108 108l297 -296v711l539 -540z" />
+    <glyph glyph-name="_620" unicode="&#xf295;" 
+d="M1280 256q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM512 1024q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5
+t112.5 -271.5zM1440 1344q0 -20 -13 -38l-1056 -1408q-19 -26 -51 -26h-160q-26 0 -45 19t-19 45q0 20 13 38l1056 1408q19 26 51 26h160q26 0 45 -19t19 -45zM768 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5
+t271.5 -112.5t112.5 -271.5z" />
+    <glyph glyph-name="_621" unicode="&#xf296;" horiz-adv-x="1792" 
+d="M104 830l792 -1015l-868 630q-18 13 -25 34.5t0 42.5l101 308v0zM566 830h660l-330 -1015v0zM368 1442l198 -612h-462l198 612q8 23 33 23t33 -23zM1688 830l101 -308q7 -21 0 -42.5t-25 -34.5l-868 -630l792 1015v0zM1688 830h-462l198 612q8 23 33 23t33 -23z" />
+    <glyph glyph-name="_622" unicode="&#xf297;" horiz-adv-x="1792" 
+d="M384 704h160v224h-160v-224zM1221 372v92q-104 -36 -243 -38q-135 -1 -259.5 46.5t-220.5 122.5l1 -96q88 -80 212 -128.5t272 -47.5q129 0 238 49zM640 704h640v224h-640v-224zM1792 736q0 -187 -99 -352q89 -102 89 -229q0 -157 -129.5 -268t-313.5 -111
+q-122 0 -225 52.5t-161 140.5q-19 -1 -57 -1t-57 1q-58 -88 -161 -140.5t-225 -52.5q-184 0 -313.5 111t-129.5 268q0 127 89 229q-99 165 -99 352q0 209 120 385.5t326.5 279.5t449.5 103t449.5 -103t326.5 -279.5t120 -385.5z" />
+    <glyph glyph-name="_623" unicode="&#xf298;" 
+d="M515 625v-128h-252v128h252zM515 880v-127h-252v127h252zM1273 369v-128h-341v128h341zM1273 625v-128h-672v128h672zM1273 880v-127h-672v127h672zM1408 20v1240q0 8 -6 14t-14 6h-32l-378 -256l-210 171l-210 -171l-378 256h-32q-8 0 -14 -6t-6 -14v-1240q0 -8 6 -14
+t14 -6h1240q8 0 14 6t6 14zM553 1130l185 150h-406zM983 1130l221 150h-406zM1536 1260v-1240q0 -62 -43 -105t-105 -43h-1240q-62 0 -105 43t-43 105v1240q0 62 43 105t105 43h1240q62 0 105 -43t43 -105z" />
+    <glyph glyph-name="_624" unicode="&#xf299;" horiz-adv-x="1792" 
+d="M896 720q-104 196 -160 278q-139 202 -347 318q-34 19 -70 36q-89 40 -94 32t34 -38l39 -31q62 -43 112.5 -93.5t94.5 -116.5t70.5 -113t70.5 -131q9 -17 13 -25q44 -84 84 -153t98 -154t115.5 -150t131 -123.5t148.5 -90.5q153 -66 154 -60q1 3 -49 37q-53 36 -81 57
+q-77 58 -179 211t-185 310zM549 177q-76 60 -132.5 125t-98 143.5t-71 154.5t-58.5 186t-52 209t-60.5 252t-76.5 289q273 0 497.5 -36t379 -92t271 -144.5t185.5 -172.5t110 -198.5t56 -199.5t12.5 -198.5t-9.5 -173t-20 -143.5t-13 -107l323 -327h-104l-281 285
+q-22 -2 -91.5 -14t-121.5 -19t-138 -6t-160.5 17t-167.5 59t-179 111z" />
+    <glyph glyph-name="_625" unicode="&#xf29a;" horiz-adv-x="1792" 
+d="M1374 879q-6 26 -28.5 39.5t-48.5 7.5q-261 -62 -401 -62t-401 62q-26 6 -48.5 -7.5t-28.5 -39.5t7.5 -48.5t39.5 -28.5q194 -46 303 -58q-2 -158 -15.5 -269t-26.5 -155.5t-41 -115.5l-9 -21q-10 -25 1 -49t36 -34q9 -4 23 -4q44 0 60 41l8 20q54 139 71 259h42
+q17 -120 71 -259l8 -20q16 -41 60 -41q14 0 23 4q25 10 36 34t1 49l-9 21q-28 71 -41 115.5t-26.5 155.5t-15.5 269q109 12 303 58q26 6 39.5 28.5t7.5 48.5zM1024 1024q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z
+M1600 640q0 -143 -55.5 -273.5t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5zM896 1408q-156 0 -298 -61t-245 -164t-164 -245t-61 -298t61 -298
+t164 -245t245 -164t298 -61t298 61t245 164t164 245t61 298t-61 298t-164 245t-245 164t-298 61zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="_626" unicode="&#xf29b;" 
+d="M1438 723q34 -35 29 -82l-44 -551q-4 -42 -34.5 -70t-71.5 -28q-6 0 -9 1q-44 3 -72.5 36.5t-25.5 77.5l35 429l-143 -8q55 -113 55 -240q0 -216 -148 -372l-137 137q91 101 91 235q0 145 -102.5 248t-247.5 103q-134 0 -236 -92l-137 138q120 114 284 141l264 300
+l-149 87l-181 -161q-33 -30 -77 -27.5t-73 35.5t-26.5 77t34.5 73l239 213q26 23 60 26.5t64 -14.5l488 -283q36 -21 48 -68q17 -67 -26 -117l-205 -232l371 20q49 3 83 -32zM1240 1180q-74 0 -126 52t-52 126t52 126t126 52t126.5 -52t52.5 -126t-52.5 -126t-126.5 -52z
+M613 -62q106 0 196 61l139 -139q-146 -116 -335 -116q-148 0 -273.5 73t-198.5 198t-73 273q0 188 116 336l139 -139q-60 -88 -60 -197q0 -145 102.5 -247.5t247.5 -102.5z" />
+    <glyph glyph-name="_627" unicode="&#xf29c;" 
+d="M880 336v-160q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v160q0 14 9 23t23 9h160q14 0 23 -9t9 -23zM1136 832q0 -50 -15 -90t-45.5 -69t-52 -44t-59.5 -36q-32 -18 -46.5 -28t-26 -24t-11.5 -29v-32q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v68q0 35 10.5 64.5
+t24 47.5t39 35.5t41 25.5t44.5 21q53 25 75 43t22 49q0 42 -43.5 71.5t-95.5 29.5q-56 0 -95 -27q-29 -20 -80 -83q-9 -12 -25 -12q-11 0 -19 6l-108 82q-10 7 -12 20t5 23q122 192 349 192q129 0 238.5 -89.5t109.5 -214.5zM768 1280q-130 0 -248.5 -51t-204 -136.5
+t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5
+t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="_628" unicode="&#xf29d;" horiz-adv-x="1408" 
+d="M366 1225q-64 0 -110 45.5t-46 110.5q0 64 46 109.5t110 45.5t109.5 -45.5t45.5 -109.5q0 -65 -45.5 -110.5t-109.5 -45.5zM917 583q0 -50 -30 -67.5t-63.5 -6.5t-47.5 34l-367 438q-7 12 -14 15.5t-11 1.5l-3 -3q-7 -8 4 -21l122 -139l1 -354l-161 -457
+q-67 -192 -92 -234q-15 -26 -28 -32q-50 -26 -103 -1q-29 13 -41.5 43t-9.5 57q2 17 197 618l5 416l-85 -164l35 -222q4 -24 -1 -42t-14 -27.5t-19 -16t-17 -7.5l-7 -2q-19 -3 -34.5 3t-24 16t-14 22t-7.5 19.5t-2 9.5l-46 299l211 381q23 34 113 34q75 0 107 -40l424 -521
+q7 -5 14 -17l3 -3l-1 -1q7 -13 7 -29zM514 433q43 -113 88.5 -225t69.5 -168l24 -55q36 -93 42 -125q11 -70 -36 -97q-35 -22 -66 -16t-51 22t-29 35h-1q-6 16 -8 25l-124 351zM1338 -159q31 -49 31 -57q0 -5 -3 -7q-9 -5 -14.5 0.5t-15.5 26t-16 30.5q-114 172 -423 661
+q3 -1 7 1t7 4l3 2q11 9 11 17z" />
+    <glyph glyph-name="_629" unicode="&#xf29e;" horiz-adv-x="2304" 
+d="M504 542h171l-1 265zM1530 641q0 87 -50.5 140t-146.5 53h-54v-388h52q91 0 145 57t54 138zM956 1018l1 -756q0 -14 -9.5 -24t-23.5 -10h-216q-14 0 -23.5 10t-9.5 24v62h-291l-55 -81q-10 -15 -28 -15h-267q-21 0 -30.5 18t3.5 35l556 757q9 14 27 14h332q14 0 24 -10
+t10 -24zM1783 641q0 -193 -125.5 -303t-324.5 -110h-270q-14 0 -24 10t-10 24v756q0 14 10 24t24 10h268q200 0 326 -109t126 -302zM1939 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5
+t-7.5 60t-20 91.5t-41 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2123 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-45 -108t-74 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5
+h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2304 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66 104.5t41 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96
+t9.5 -70.5z" />
+    <glyph glyph-name="uniF2A0" unicode="&#xf2a0;" horiz-adv-x="1408" 
+d="M617 -153q0 11 -13 58t-31 107t-20 69q-1 4 -5 26.5t-8.5 36t-13.5 21.5q-15 14 -51 14q-23 0 -70 -5.5t-71 -5.5q-34 0 -47 11q-6 5 -11 15.5t-7.5 20t-6.5 24t-5 18.5q-37 128 -37 255t37 255q1 4 5 18.5t6.5 24t7.5 20t11 15.5q13 11 47 11q24 0 71 -5.5t70 -5.5
+q36 0 51 14q9 8 13.5 21.5t8.5 36t5 26.5q2 9 20 69t31 107t13 58q0 22 -43.5 52.5t-75.5 42.5q-20 8 -45 8q-34 0 -98 -18q-57 -17 -96.5 -40.5t-71 -66t-46 -70t-45.5 -94.5q-6 -12 -9 -19q-49 -107 -68 -216t-19 -244t19 -244t68 -216q56 -122 83 -161q63 -91 179 -127
+l6 -2q64 -18 98 -18q25 0 45 8q32 12 75.5 42.5t43.5 52.5zM776 760q-26 0 -45 19t-19 45.5t19 45.5q37 37 37 90q0 52 -37 91q-19 19 -19 45t19 45t45 19t45 -19q75 -75 75 -181t-75 -181q-21 -19 -45 -19zM957 579q-27 0 -45 19q-19 19 -19 45t19 45q112 114 112 272
+t-112 272q-19 19 -19 45t19 45t45 19t45 -19q150 -150 150 -362t-150 -362q-18 -19 -45 -19zM1138 398q-27 0 -45 19q-19 19 -19 45t19 45q90 91 138.5 208t48.5 245t-48.5 245t-138.5 208q-19 19 -19 45t19 45t45 19t45 -19q109 -109 167 -249t58 -294t-58 -294t-167 -249
+q-18 -19 -45 -19z" />
+    <glyph glyph-name="uniF2A1" unicode="&#xf2a1;" horiz-adv-x="2176" 
+d="M192 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 352
+q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 864
+q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 1376q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 192q0 -80 -56 -136
+t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 1216q0 -80 -56 -136t-136 -56
+t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 192q0 -80 -56 -136t-136 -56t-136 56
+t-56 136t56 136t136 56t136 -56t56 -136zM1664 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136
+t56 136t136 56t136 -56t56 -136zM2176 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136z" />
+    <glyph glyph-name="uniF2A2" unicode="&#xf2a2;" horiz-adv-x="1792" 
+d="M128 -192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM320 0q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM365 365l256 -256l-90 -90l-256 256zM704 384q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45z
+M1411 704q0 -59 -11.5 -108.5t-37.5 -93.5t-44 -67.5t-53 -64.5q-31 -35 -45.5 -54t-33.5 -50t-26.5 -64t-7.5 -74q0 -159 -112.5 -271.5t-271.5 -112.5q-26 0 -45 19t-19 45t19 45t45 19q106 0 181 75t75 181q0 57 11.5 105.5t37 91t43.5 66.5t52 63q40 46 59.5 72
+t37.5 74.5t18 103.5q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM896 576q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45
+t45 19t45 -19t19 -45zM1184 704q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 93 -65.5 158.5t-158.5 65.5q-92 0 -158 -65.5t-66 -158.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 146 103 249t249 103t249 -103t103 -249zM1578 993q10 -25 -1 -49t-36 -34q-9 -4 -23 -4
+q-19 0 -35.5 11t-23.5 30q-68 178 -224 295q-21 16 -25 42t12 47q17 21 43 25t47 -12q183 -137 266 -351zM1788 1074q9 -25 -1.5 -49t-35.5 -34q-11 -4 -23 -4q-44 0 -60 41q-92 238 -297 393q-22 16 -25.5 42t12.5 47q16 22 42 25.5t47 -12.5q235 -175 341 -449z" />
+    <glyph glyph-name="uniF2A3" unicode="&#xf2a3;" horiz-adv-x="2304" 
+d="M1032 576q-59 2 -84 55q-17 34 -48 53.5t-68 19.5q-53 0 -90.5 -37.5t-37.5 -90.5q0 -56 36 -89l10 -8q34 -31 82 -31q37 0 68 19.5t48 53.5q25 53 84 55zM1600 704q0 56 -36 89l-10 8q-34 31 -82 31q-37 0 -68 -19.5t-48 -53.5q-25 -53 -84 -55q59 -2 84 -55
+q17 -34 48 -53.5t68 -19.5q53 0 90.5 37.5t37.5 90.5zM1174 925q-17 -35 -55 -48t-73 4q-62 31 -134 31q-51 0 -99 -17q3 0 9.5 0.5t9.5 0.5q92 0 170.5 -50t118.5 -133q17 -36 3.5 -73.5t-49.5 -54.5q-18 -9 -39 -9q21 0 39 -9q36 -17 49.5 -54.5t-3.5 -73.5
+q-40 -83 -118.5 -133t-170.5 -50h-6q-16 2 -44 4l-290 27l-239 -120q-14 -7 -29 -7q-40 0 -57 35l-160 320q-11 23 -4 47.5t29 37.5l209 119l148 267q17 155 91.5 291.5t195.5 236.5q31 25 70.5 21.5t64.5 -34.5t21.5 -70t-34.5 -65q-70 -59 -117 -128q123 84 267 101
+q40 5 71.5 -19t35.5 -64q5 -40 -19 -71.5t-64 -35.5q-84 -10 -159 -55q46 10 99 10q115 0 218 -50q36 -18 49 -55.5t-5 -73.5zM2137 1085l160 -320q11 -23 4 -47.5t-29 -37.5l-209 -119l-148 -267q-17 -155 -91.5 -291.5t-195.5 -236.5q-26 -22 -61 -22q-45 0 -74 35
+q-25 31 -21.5 70t34.5 65q70 59 117 128q-123 -84 -267 -101q-4 -1 -12 -1q-36 0 -63.5 24t-31.5 60q-5 40 19 71.5t64 35.5q84 10 159 55q-46 -10 -99 -10q-115 0 -218 50q-36 18 -49 55.5t5 73.5q17 35 55 48t73 -4q62 -31 134 -31q51 0 99 17q-3 0 -9.5 -0.5t-9.5 -0.5
+q-92 0 -170.5 50t-118.5 133q-17 36 -3.5 73.5t49.5 54.5q18 9 39 9q-21 0 -39 9q-36 17 -49.5 54.5t3.5 73.5q40 83 118.5 133t170.5 50h6h1q14 -2 42 -4l291 -27l239 120q14 7 29 7q40 0 57 -35z" />
+    <glyph glyph-name="uniF2A4" unicode="&#xf2a4;" horiz-adv-x="1792" 
+d="M1056 704q0 -26 19 -45t45 -19t45 19t19 45q0 146 -103 249t-249 103t-249 -103t-103 -249q0 -26 19 -45t45 -19t45 19t19 45q0 93 66 158.5t158 65.5t158 -65.5t66 -158.5zM835 1280q-117 0 -223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5q0 -26 19 -45t45 -19t45 19
+t19 45q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -55 -18 -103.5t-37.5 -74.5t-59.5 -72q-34 -39 -52 -63t-43.5 -66.5t-37 -91t-11.5 -105.5q0 -106 -75 -181t-181 -75q-26 0 -45 -19t-19 -45t19 -45t45 -19q159 0 271.5 112.5t112.5 271.5q0 41 7.5 74
+t26.5 64t33.5 50t45.5 54q35 41 53 64.5t44 67.5t37.5 93.5t11.5 108.5q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5zM591 561l226 -226l-579 -579q-12 -12 -29 -12t-29 12l-168 168q-12 12 -12 29t12 29zM1612 1524l168 -168q12 -12 12 -29t-12 -30l-233 -233
+l-26 -25l-71 -71q-66 153 -195 258l91 91l207 207q13 12 30 12t29 -12z" />
+    <glyph glyph-name="uniF2A5" unicode="&#xf2a5;" 
+d="M866 1021q0 -27 -13 -94q-11 -50 -31.5 -150t-30.5 -150q-2 -11 -4.5 -12.5t-13.5 -2.5q-20 -2 -31 -2q-58 0 -84 49.5t-26 113.5q0 88 35 174t103 124q28 14 51 14q28 0 36.5 -16.5t8.5 -47.5zM1352 597q0 14 -39 75.5t-52 66.5q-21 8 -34 8q-91 0 -226 -77l-2 2
+q3 22 27.5 135t24.5 178q0 233 -242 233q-24 0 -68 -6q-94 -17 -168.5 -89.5t-111.5 -166.5t-37 -189q0 -146 80.5 -225t227.5 -79q25 0 25 -3t-1 -5q-4 -34 -26 -117q-14 -52 -51.5 -101t-82.5 -49q-42 0 -42 47q0 24 10.5 47.5t25 39.5t29.5 28.5t26 20t11 8.5q0 3 -7 10
+q-24 22 -58.5 36.5t-65.5 14.5q-35 0 -63.5 -34t-41 -75t-12.5 -75q0 -88 51.5 -142t138.5 -54q82 0 155 53t117.5 126t65.5 153q6 22 15.5 66.5t14.5 66.5q3 12 14 18q118 60 227 60q48 0 127 -18q1 -1 4 -1q5 0 9.5 4.5t4.5 8.5zM1536 1120v-960q0 -119 -84.5 -203.5
+t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="uniF2A6" unicode="&#xf2a6;" horiz-adv-x="1535" 
+d="M744 1231q0 24 -2 38.5t-8.5 30t-21 23t-37.5 7.5q-39 0 -78 -23q-105 -58 -159 -190.5t-54 -269.5q0 -44 8.5 -85.5t26.5 -80.5t52.5 -62.5t81.5 -23.5q4 0 18 -0.5t20 0t16 3t15 8.5t7 16q16 77 48 231.5t48 231.5q19 91 19 146zM1498 575q0 -7 -7.5 -13.5t-15.5 -6.5
+l-6 1q-22 3 -62 11t-72 12.5t-63 4.5q-167 0 -351 -93q-15 -8 -21 -27q-10 -36 -24.5 -105.5t-22.5 -100.5q-23 -91 -70 -179.5t-112.5 -164.5t-154.5 -123t-185 -47q-135 0 -214.5 83.5t-79.5 219.5q0 53 19.5 117t63 116.5t97.5 52.5q38 0 120 -33.5t83 -61.5
+q0 -1 -16.5 -12.5t-39.5 -31t-46 -44.5t-39 -61t-16 -74q0 -33 16.5 -53t48.5 -20q45 0 85 31.5t66.5 78t48 105.5t32.5 107t16 90v9q0 2 -3.5 3.5t-8.5 1.5h-10t-10 -0.5t-6 -0.5q-227 0 -352 122.5t-125 348.5q0 108 34.5 221t96 210t156 167.5t204.5 89.5q52 9 106 9
+q374 0 374 -360q0 -98 -38 -273t-43 -211l3 -3q101 57 182.5 88t167.5 31q22 0 53 -13q19 -7 80 -102.5t61 -116.5z" />
+    <glyph glyph-name="uniF2A7" unicode="&#xf2a7;" horiz-adv-x="1664" 
+d="M831 863q32 0 59 -18l222 -148q61 -40 110 -97l146 -170q40 -46 29 -106l-72 -413q-6 -32 -29.5 -53.5t-55.5 -25.5l-527 -56l-352 -32h-9q-39 0 -67.5 28t-28.5 68q0 37 27 64t65 32l260 32h-448q-41 0 -69.5 30t-26.5 71q2 39 32 65t69 26l442 1l-521 64q-41 5 -66 37
+t-19 73q6 35 34.5 57.5t65.5 22.5h10l481 -60l-351 94q-38 10 -62 41.5t-18 68.5q6 36 33 58.5t62 22.5q6 0 20 -2l448 -96l217 -37q1 0 3 -0.5t3 -0.5q23 0 30.5 23t-12.5 36l-186 125q-35 23 -42 63.5t18 73.5q27 38 76 38zM761 661l186 -125l-218 37l-5 2l-36 38
+l-238 262q-1 1 -2.5 3.5t-2.5 3.5q-24 31 -18.5 70t37.5 64q31 23 68 17.5t64 -33.5l142 -147q-2 -1 -5 -3.5t-4 -4.5q-32 -45 -23 -99t55 -85zM1648 1115l15 -266q4 -73 -11 -147l-48 -219q-12 -59 -67 -87l-106 -54q2 62 -39 109l-146 170q-53 61 -117 103l-222 148
+q-34 23 -76 23q-51 0 -88 -37l-235 312q-25 33 -18 73.5t41 63.5q33 22 71.5 14t62.5 -40l266 -352l-262 455q-21 35 -10.5 75t47.5 59q35 18 72.5 6t57.5 -46l241 -420l-136 337q-15 35 -4.5 74t44.5 56q37 19 76 6t56 -51l193 -415l101 -196q8 -15 23 -17.5t27 7.5t11 26
+l-12 224q-2 41 26 71t69 31q39 0 67 -28.5t30 -67.5z" />
+    <glyph glyph-name="uniF2A8" unicode="&#xf2a8;" horiz-adv-x="1792" 
+d="M335 180q-2 0 -6 2q-86 57 -168.5 145t-139.5 180q-21 30 -21 69q0 9 2 19t4 18t7 18t8.5 16t10.5 17t10 15t12 15.5t11 14.5q184 251 452 365q-110 198 -110 211q0 19 17 29q116 64 128 64q18 0 28 -16l124 -229q92 19 192 19q266 0 497.5 -137.5t378.5 -369.5
+q20 -31 20 -69t-20 -69q-91 -142 -218.5 -253.5t-278.5 -175.5q110 -198 110 -211q0 -20 -17 -29q-116 -64 -127 -64q-19 0 -29 16l-124 229l-64 119l-444 820l7 7q-58 -24 -99 -47q3 -5 127 -234t243 -449t119 -223q0 -7 -9 -9q-13 -3 -72 -3q-57 0 -60 7l-456 841
+q-39 -28 -82 -68q24 -43 214 -393.5t190 -354.5q0 -10 -11 -10q-14 0 -82.5 22t-72.5 28l-106 197l-224 413q-44 -53 -78 -106q2 -3 18 -25t23 -34l176 -327q0 -10 -10 -10zM1165 282l49 -91q273 111 450 385q-180 277 -459 389q67 -64 103 -148.5t36 -176.5
+q0 -106 -47 -200.5t-132 -157.5zM848 896q0 -20 14 -34t34 -14q86 0 147 -61t61 -147q0 -20 14 -34t34 -14t34 14t14 34q0 126 -89 215t-215 89q-20 0 -34 -14t-14 -34zM1214 961l-9 4l7 -7z" />
+    <glyph glyph-name="uniF2A9" unicode="&#xf2a9;" horiz-adv-x="1280" 
+d="M1050 430q0 -215 -147 -374q-148 -161 -378 -161q-232 0 -378 161q-147 159 -147 374q0 147 68 270.5t189 196.5t268 73q96 0 182 -31q-32 -62 -39 -126q-66 28 -143 28q-167 0 -280.5 -123t-113.5 -291q0 -170 112.5 -288.5t281.5 -118.5t281 118.5t112 288.5
+q0 89 -32 166q66 13 123 49q41 -98 41 -212zM846 619q0 -192 -79.5 -345t-238.5 -253l-14 -1q-29 0 -62 5q83 32 146.5 102.5t99.5 154.5t58.5 189t30 192.5t7.5 178.5q0 69 -3 103q55 -160 55 -326zM791 947v-2q-73 214 -206 440q88 -59 142.5 -186.5t63.5 -251.5z
+M1035 744q-83 0 -160 75q218 120 290 247q19 37 21 56q-42 -94 -139.5 -166.5t-204.5 -97.5q-35 54 -35 113q0 37 17 79t43 68q46 44 157 74q59 16 106 58.5t74 100.5q74 -105 74 -253q0 -109 -24 -170q-32 -77 -88.5 -130.5t-130.5 -53.5z" />
+    <glyph glyph-name="uniF2AA" unicode="&#xf2aa;" 
+d="M1050 495q0 78 -28 147q-41 -25 -85 -34q22 -50 22 -114q0 -117 -77 -198.5t-193 -81.5t-193.5 81.5t-77.5 198.5q0 115 78 199.5t193 84.5q53 0 98 -19q4 43 27 87q-60 21 -125 21q-154 0 -257.5 -108.5t-103.5 -263.5t103.5 -261t257.5 -106t257.5 106.5t103.5 260.5z
+M872 850q2 -24 2 -71q0 -63 -5 -123t-20.5 -132.5t-40.5 -130t-68.5 -106t-100.5 -70.5q21 -3 42 -3h10q219 139 219 411q0 116 -38 225zM872 850q-4 80 -44 171.5t-98 130.5q92 -156 142 -302zM1207 955q0 102 -51 174q-41 -86 -124 -109q-69 -19 -109 -53.5t-40 -99.5
+q0 -40 24 -77q74 17 140.5 67t95.5 115q-4 -52 -74.5 -111.5t-138.5 -97.5q52 -52 110 -52q51 0 90 37t60 90q17 42 17 117zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5
+t84.5 -203.5z" />
+    <glyph glyph-name="uniF2AB" unicode="&#xf2ab;" 
+d="M1279 388q0 22 -22 27q-67 15 -118 59t-80 108q-7 19 -7 25q0 15 19.5 26t43 17t43 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-12 0 -32 -8t-31 -8q-4 0 -12 2q5 95 5 114q0 79 -17 114q-36 78 -103 121.5t-152 43.5q-199 0 -275 -165q-17 -35 -17 -114q0 -19 5 -114
+q-4 -2 -14 -2q-12 0 -32 7.5t-30 7.5q-21 0 -38.5 -12t-17.5 -32q0 -21 19.5 -35.5t43 -20.5t43 -17t19.5 -26q0 -6 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -46 137 -68q2 -5 6 -26t11.5 -30.5t23.5 -9.5q12 0 37.5 4.5t39.5 4.5q35 0 67 -15t54 -32.5t57.5 -32.5
+t76.5 -15q43 0 79 15t57.5 32.5t53.5 32.5t67 15q14 0 39.5 -4t38.5 -4q16 0 23 10t11 30t6 25q137 22 137 68zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5
+t103 -385.5z" />
+    <glyph glyph-name="uniF2AC" unicode="&#xf2ac;" horiz-adv-x="1664" 
+d="M848 1408q134 1 240.5 -68.5t163.5 -192.5q27 -58 27 -179q0 -47 -9 -191q14 -7 28 -7q18 0 51 13.5t51 13.5q29 0 56 -18t27 -46q0 -32 -31.5 -54t-69 -31.5t-69 -29t-31.5 -47.5q0 -15 12 -43q37 -82 102.5 -150t144.5 -101q28 -12 80 -23q28 -6 28 -35
+q0 -70 -219 -103q-7 -11 -11 -39t-14 -46.5t-33 -18.5q-20 0 -62 6.5t-64 6.5q-37 0 -62 -5q-32 -5 -63 -22.5t-58 -38t-58 -40.5t-76 -33.5t-99 -13.5q-52 0 -96.5 13.5t-75 33.5t-57.5 40.5t-58 38t-62 22.5q-26 5 -63 5q-24 0 -65.5 -7.5t-58.5 -7.5q-25 0 -35 18.5
+t-14 47.5t-11 40q-219 33 -219 103q0 29 28 35q52 11 80 23q78 32 144.5 101t102.5 150q12 28 12 43q0 28 -31.5 47.5t-69.5 29.5t-69.5 31.5t-31.5 52.5q0 27 26 45.5t55 18.5q15 0 48 -13t53 -13q18 0 32 7q-9 142 -9 190q0 122 27 180q64 137 172 198t264 63z" />
+    <glyph glyph-name="uniF2AD" unicode="&#xf2ad;" 
+d="M1280 388q0 22 -22 27q-67 14 -118 58t-80 109q-7 14 -7 25q0 15 19.5 26t42.5 17t42.5 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-11 0 -31 -8t-32 -8q-4 0 -12 2q5 63 5 115q0 78 -17 114q-36 78 -102.5 121.5t-152.5 43.5q-198 0 -275 -165q-18 -38 -18 -115
+q0 -38 6 -114q-10 -2 -15 -2q-11 0 -31.5 8t-30.5 8q-20 0 -37.5 -12.5t-17.5 -32.5q0 -21 19.5 -35.5t42.5 -20.5t42.5 -17t19.5 -26q0 -11 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -47 138 -69q2 -5 6 -26t11 -30.5t23 -9.5q13 0 38.5 5t38.5 5q35 0 67.5 -15
+t54.5 -32.5t57.5 -32.5t76.5 -15q43 0 79 15t57.5 32.5t54 32.5t67.5 15q13 0 39 -4.5t39 -4.5q15 0 22.5 9.5t11.5 31t5 24.5q138 22 138 69zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960
+q119 0 203.5 -84.5t84.5 -203.5z" />
+    <glyph glyph-name="uniF2AE" unicode="&#xf2ae;" horiz-adv-x="2304" 
+d="M2304 1536q-69 -46 -125 -92t-89 -81t-59.5 -71.5t-37.5 -57.5t-22 -44.5t-14 -29.5q-10 -18 -35.5 -136.5t-48.5 -164.5q-15 -29 -50 -60.5t-67.5 -50.5t-72.5 -41t-48 -28q-47 -31 -151 -231q-341 14 -630 -158q-92 -53 -303 -179q47 16 86 31t55 22l15 7
+q71 27 163 64.5t133.5 53.5t108 34.5t142.5 31.5q186 31 465 -7q1 0 10 -3q11 -6 14 -17t-3 -22l-194 -345q-15 -29 -47 -22q-128 24 -354 24q-146 0 -402 -44.5t-392 -46.5q-82 -1 -149 13t-107 37t-61 40t-33 34l-1 1v2q0 6 6 6q138 0 371 55q192 366 374.5 524t383.5 158
+q5 0 14.5 -0.5t38 -5t55 -12t61.5 -24.5t63 -39.5t54 -59t40 -82.5l102 177q2 4 21 42.5t44.5 86.5t61 109.5t84 133.5t100.5 137q66 82 128 141.5t121.5 96.5t92.5 53.5t88 39.5z" />
+    <glyph glyph-name="uniF2B0" unicode="&#xf2b0;" 
+d="M1322 640q0 -45 -5 -76l-236 14l224 -78q-19 -73 -58 -141l-214 103l177 -158q-44 -61 -107 -108l-157 178l103 -215q-61 -37 -140 -59l-79 228l14 -240q-38 -6 -76 -6t-76 6l14 238l-78 -226q-74 19 -140 59l103 215l-157 -178q-59 43 -108 108l178 158l-214 -104
+q-39 69 -58 141l224 79l-237 -14q-5 42 -5 76q0 35 5 77l238 -14l-225 79q19 73 58 140l214 -104l-177 159q46 61 107 108l158 -178l-103 215q67 39 140 58l77 -224l-13 236q36 6 75 6q38 0 76 -6l-14 -237l78 225q74 -19 140 -59l-103 -214l158 178q61 -47 107 -108
+l-177 -159l213 104q37 -62 58 -141l-224 -78l237 14q5 -31 5 -77zM1352 640q0 160 -78.5 295.5t-213 214t-292.5 78.5q-119 0 -227 -46.5t-186.5 -125t-124.5 -187.5t-46 -229q0 -119 46 -228t124.5 -187.5t186.5 -125t227 -46.5q158 0 292.5 78.5t213 214t78.5 294.5z
+M1425 1023v-766l-657 -383l-657 383v766l657 383zM768 -183l708 412v823l-708 411l-708 -411v-823zM1536 1088v-896l-768 -448l-768 448v896l768 448z" />
+    <glyph glyph-name="uniF2B1" unicode="&#xf2b1;" horiz-adv-x="1664" 
+d="M339 1318h691l-26 -72h-665q-110 0 -188.5 -79t-78.5 -189v-771q0 -95 60.5 -169.5t153.5 -93.5q23 -5 98 -5v-72h-45q-140 0 -239.5 100t-99.5 240v771q0 140 99.5 240t239.5 100zM1190 1536h247l-482 -1294q-23 -61 -40.5 -103.5t-45 -98t-54 -93.5t-64.5 -78.5
+t-79.5 -65t-95.5 -41t-116 -18.5v195q163 26 220 182q20 52 20 105q0 54 -20 106l-285 733h228l187 -585zM1664 978v-1111h-795q37 55 45 73h678v1038q0 85 -49.5 155t-129.5 99l25 67q101 -34 163.5 -123.5t62.5 -197.5z" />
+    <glyph glyph-name="uniF2B2" unicode="&#xf2b2;" horiz-adv-x="1792" 
+d="M852 1227q0 -29 -17 -52.5t-45 -23.5t-45 23.5t-17 52.5t17 52.5t45 23.5t45 -23.5t17 -52.5zM688 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50 -21.5t-20 -51.5v-114q0 -30 20.5 -52t49.5 -22q30 0 50.5 22t20.5 52zM860 -149v114q0 30 -20 51.5t-50 21.5t-50.5 -21.5
+t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22q29 0 49.5 22t20.5 52zM1034 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1208 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114
+q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1476 535q-84 -160 -232 -259.5t-323 -99.5q-123 0 -229.5 51.5t-178.5 137t-113 197.5t-41 232q0 88 21 174q-104 -175 -104 -390q0 -162 65 -312t185 -251q30 57 91 57q56 0 86 -50q32 50 87 50q56 0 86 -50q32 50 87 50t87 -50
+q30 50 86 50q28 0 52.5 -15.5t37.5 -40.5q112 94 177 231.5t73 287.5zM1326 564q0 75 -72 75q-17 0 -47 -6q-95 -19 -149 -19q-226 0 -226 243q0 86 30 204q-83 -127 -83 -275q0 -150 89 -260.5t235 -110.5q111 0 210 70q13 48 13 79zM884 1223q0 50 -32 89.5t-81 39.5
+t-81 -39.5t-32 -89.5q0 -51 31.5 -90.5t81.5 -39.5t81.5 39.5t31.5 90.5zM1513 884q0 96 -37.5 179t-113 137t-173.5 54q-77 0 -149 -35t-127 -94q-48 -159 -48 -268q0 -104 45.5 -157t147.5 -53q53 0 142 19q36 6 53 6q51 0 77.5 -28t26.5 -80q0 -26 -4 -46
+q75 68 117.5 165.5t42.5 200.5zM1792 667q0 -111 -33.5 -249.5t-93.5 -204.5q-58 -64 -195 -142.5t-228 -104.5l-4 -1v-114q0 -43 -29.5 -75t-72.5 -32q-56 0 -86 50q-32 -50 -87 -50t-87 50q-30 -50 -86 -50q-55 0 -87 50q-30 -50 -86 -50q-47 0 -75 33.5t-28 81.5
+q-90 -68 -198 -68q-118 0 -211 80q54 1 106 20q-113 31 -182 127q32 -7 71 -7q89 0 164 46q-192 192 -240 306q-24 56 -24 160q0 57 9 125.5t31.5 146.5t55 141t86.5 105t120 42q59 0 81 -52q19 29 42 54q2 3 12 13t13 16q10 15 23 38t25 42t28 39q87 111 211.5 177
+t260.5 66q35 0 62 -4q59 64 146 64q83 0 140 -57q5 -5 5 -12q0 -5 -6 -13.5t-12.5 -16t-16 -17l-10.5 -10.5q17 -6 36 -18t19 -24q0 -6 -16 -25q157 -138 197 -378q25 30 60 30q45 0 100 -49q90 -80 90 -279z" />
+    <glyph glyph-name="uniF2B3" unicode="&#xf2b3;" 
+d="M917 631q0 33 -6 64h-362v-132h217q-12 -76 -74.5 -120.5t-142.5 -44.5q-99 0 -169 71.5t-70 170.5t70 170.5t169 71.5q93 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585h109v110
+h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" />
+    <glyph glyph-name="uniF2B4" unicode="&#xf2b4;" 
+d="M1536 1024v-839q0 -48 -49 -62q-174 -52 -338 -52q-73 0 -215.5 29.5t-227.5 29.5q-164 0 -370 -48v-338h-160v1368q-63 25 -101 81t-38 124q0 91 64 155t155 64t155 -64t64 -155q0 -68 -38 -124t-101 -81v-68q190 44 343 44q99 0 198 -15q14 -2 111.5 -22.5t149.5 -20.5
+q77 0 165 18q11 2 80 21t89 19q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="uniF2B5" unicode="&#xf2b5;" horiz-adv-x="2304" 
+d="M192 384q40 0 56 32t0 64t-56 32t-56 -32t0 -64t56 -32zM1665 442q-10 13 -38.5 50t-41.5 54t-38 49t-42.5 53t-40.5 47t-45 49l-125 -140q-83 -94 -208.5 -92t-205.5 98q-57 69 -56.5 158t58.5 157l177 206q-22 11 -51 16.5t-47.5 6t-56.5 -0.5t-49 -1q-92 0 -158 -66
+l-158 -158h-155v-544q5 0 21 0.5t22 0t19.5 -2t20.5 -4.5t17.5 -8.5t18.5 -13.5l297 -292q115 -111 227 -111q78 0 125 47q57 -20 112.5 8t72.5 85q74 -6 127 44q20 18 36 45.5t14 50.5q10 -10 43 -10q43 0 77 21t49.5 53t12 71.5t-30.5 73.5zM1824 384h96v512h-93l-157 180
+q-66 76 -169 76h-167q-89 0 -146 -67l-209 -243q-28 -33 -28 -75t27 -75q43 -51 110 -52t111 49l193 218q25 23 53.5 21.5t47 -27t8.5 -56.5q16 -19 56 -63t60 -68q29 -36 82.5 -105.5t64.5 -84.5q52 -66 60 -140zM2112 384q40 0 56 32t0 64t-56 32t-56 -32t0 -64t56 -32z
+M2304 960v-640q0 -26 -19 -45t-45 -19h-434q-27 -65 -82 -106.5t-125 -51.5q-33 -48 -80.5 -81.5t-102.5 -45.5q-42 -53 -104.5 -81.5t-128.5 -24.5q-60 -34 -126 -39.5t-127.5 14t-117 53.5t-103.5 81l-287 282h-358q-26 0 -45 19t-19 45v672q0 26 19 45t45 19h421
+q14 14 47 48t47.5 48t44 40t50.5 37.5t51 25.5t62 19.5t68 5.5h117q99 0 181 -56q82 56 181 56h167q35 0 67 -6t56.5 -14.5t51.5 -26.5t44.5 -31t43 -39.5t39 -42t41 -48t41.5 -48.5h355q26 0 45 -19t19 -45z" />
+    <glyph glyph-name="uniF2B6" unicode="&#xf2b6;" horiz-adv-x="1792" 
+d="M1792 882v-978q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v978q0 15 11 24q8 7 39 34.5t41.5 36t45.5 37.5t70 55.5t96 73t143.5 107t192.5 140.5q5 4 52.5 40t71.5 52.5t64 35t69 18.5t69 -18.5t65 -35.5t71 -52t52 -40q110 -80 192.5 -140.5t143.5 -107
+t96 -73t70 -55.5t45.5 -37.5t41.5 -36t39 -34.5q11 -9 11 -24zM1228 297q263 191 345 252q11 8 12.5 20.5t-6.5 23.5l-38 52q-8 11 -21 12.5t-24 -6.5q-231 -169 -343 -250q-5 -3 -52 -39t-71.5 -52.5t-64.5 -35t-69 -18.5t-69 18.5t-64.5 35t-71.5 52.5t-52 39
+q-186 134 -343 250q-11 8 -24 6.5t-21 -12.5l-38 -52q-8 -11 -6.5 -23.5t12.5 -20.5q82 -61 345 -252q10 -8 50 -38t65 -47t64 -39.5t77.5 -33.5t75.5 -11t75.5 11t79 34.5t64.5 39.5t65 47.5t48 36.5z" />
+    <glyph glyph-name="uniF2B7" unicode="&#xf2b7;" horiz-adv-x="1792" 
+d="M1474 623l39 -51q8 -11 6.5 -23.5t-11.5 -20.5q-43 -34 -126.5 -98.5t-146.5 -113t-67 -51.5q-39 -32 -60 -48t-60.5 -41t-76.5 -36.5t-74 -11.5h-1h-1q-37 0 -74 11.5t-76 36.5t-61 41.5t-60 47.5q-5 4 -65 50.5t-143.5 111t-122.5 94.5q-11 8 -12.5 20.5t6.5 23.5
+l37 52q8 11 21.5 13t24.5 -7q94 -73 306 -236q5 -4 43.5 -35t60.5 -46.5t56.5 -32.5t58.5 -17h1h1q24 0 58.5 17t56.5 32.5t60.5 46.5t43.5 35q258 198 313 242q11 8 24 6.5t21 -12.5zM1664 -96v928q-90 83 -159 139q-91 74 -389 304q-3 2 -43 35t-61 48t-56 32.5t-59 17.5
+h-1h-1q-24 0 -59 -17.5t-56 -32.5t-61 -48t-43 -35q-215 -166 -315.5 -245.5t-129.5 -104t-82 -74.5q-14 -12 -21 -19v-928q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 832v-928q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v928q0 56 41 94
+q123 114 350 290.5t233 181.5q36 30 59 47.5t61.5 42t76 36.5t74.5 12h1h1q37 0 74.5 -12t76 -36.5t61.5 -42t59 -47.5q43 -36 156 -122t226 -177t201 -173q41 -38 41 -94z" />
+    <glyph glyph-name="uniF2B8" unicode="&#xf2b8;" 
+d="M330 1l202 -214l-34 236l-216 213zM556 -225l274 218l-11 245l-300 -215zM245 413l227 -213l-48 327l-245 204zM495 189l317 214l-14 324l-352 -200zM843 178l95 -80l-2 239l-103 79q0 -1 1 -8.5t0 -12t-5 -7.5l-78 -52l85 -70q7 -6 7 -88zM138 930l256 -200l-68 465
+l-279 173zM1173 267l15 234l-230 -164l2 -240zM417 722l373 194l-19 441l-423 -163zM1270 357l20 233l-226 142l-2 -105l144 -95q6 -4 4 -9l-7 -119zM1461 496l30 222l-179 -128l-20 -228zM1273 329l-71 49l-8 -117q0 -5 -4 -8l-234 -187q-7 -5 -14 0l-98 83l7 -161
+q0 -5 -4 -8l-293 -234q-4 -2 -6 -2q-8 2 -8 3l-228 242q-4 4 -59 277q-2 7 5 11l61 37q-94 86 -95 92l-72 351q-2 7 6 12l94 45q-133 100 -135 108l-96 466q-2 10 7 13l433 135q5 0 8 -1l317 -153q6 -4 6 -9l20 -463q0 -7 -6 -10l-118 -61l126 -85q5 -2 5 -8l5 -123l121 74
+q5 4 11 0l84 -56l3 110q0 6 5 9l206 126q6 3 11 0l245 -135q4 -4 5 -7t-6.5 -60t-17.5 -124.5t-10 -70.5q0 -5 -4 -7l-191 -153q-6 -5 -13 0z" />
+    <glyph glyph-name="uniF2B9" unicode="&#xf2b9;" horiz-adv-x="1664" 
+d="M1201 298q0 57 -5.5 107t-21 100.5t-39.5 86t-64 58t-91 22.5q-6 -4 -33.5 -20.5t-42.5 -24.5t-40.5 -20t-49 -17t-46.5 -5t-46.5 5t-49 17t-40.5 20t-42.5 24.5t-33.5 20.5q-51 0 -91 -22.5t-64 -58t-39.5 -86t-21 -100.5t-5.5 -107q0 -73 42 -121.5t103 -48.5h576
+q61 0 103 48.5t42 121.5zM1028 892q0 108 -76.5 184t-183.5 76t-183.5 -76t-76.5 -184q0 -107 76.5 -183t183.5 -76t183.5 76t76.5 183zM1664 352v-192q0 -14 -9 -23t-23 -9h-96v-224q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h1216
+q66 0 113 -47t47 -113v-224h96q14 0 23 -9t9 -23v-192q0 -14 -9 -23t-23 -9h-96v-128h96q14 0 23 -9t9 -23v-192q0 -14 -9 -23t-23 -9h-96v-128h96q14 0 23 -9t9 -23z" />
+    <glyph glyph-name="uniF2BA" unicode="&#xf2ba;" horiz-adv-x="1664" 
+d="M1028 892q0 -107 -76.5 -183t-183.5 -76t-183.5 76t-76.5 183q0 108 76.5 184t183.5 76t183.5 -76t76.5 -184zM980 672q46 0 82.5 -17t60 -47.5t39.5 -67t24 -81t11.5 -82.5t3.5 -79q0 -67 -39.5 -118.5t-105.5 -51.5h-576q-66 0 -105.5 51.5t-39.5 118.5q0 48 4.5 93.5
+t18.5 98.5t36.5 91.5t63 64.5t93.5 26h5q7 -4 32 -19.5t35.5 -21t33 -17t37 -16t35 -9t39.5 -4.5t39.5 4.5t35 9t37 16t33 17t35.5 21t32 19.5zM1664 928q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-128h96q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-128h96
+q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-224q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h1216q66 0 113 -47t47 -113v-224h96q13 0 22.5 -9.5t9.5 -22.5v-192zM1408 -96v1472q0 13 -9.5 22.5t-22.5 9.5h-1216
+q-13 0 -22.5 -9.5t-9.5 -22.5v-1472q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5z" />
+    <glyph glyph-name="uniF2BB" unicode="&#xf2bb;" horiz-adv-x="2048" 
+d="M1024 405q0 64 -9 117.5t-29.5 103t-60.5 78t-97 28.5q-6 -4 -30 -18t-37.5 -21.5t-35.5 -17.5t-43 -14.5t-42 -4.5t-42 4.5t-43 14.5t-35.5 17.5t-37.5 21.5t-30 18q-57 0 -97 -28.5t-60.5 -78t-29.5 -103t-9 -117.5t37 -106.5t91 -42.5h512q54 0 91 42.5t37 106.5z
+M867 925q0 94 -66.5 160.5t-160.5 66.5t-160.5 -66.5t-66.5 -160.5t66.5 -160.5t160.5 -66.5t160.5 66.5t66.5 160.5zM1792 416v64q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM1792 676v56q0 15 -10.5 25.5t-25.5 10.5h-568
+q-15 0 -25.5 -10.5t-10.5 -25.5v-56q0 -15 10.5 -25.5t25.5 -10.5h568q15 0 25.5 10.5t10.5 25.5zM1792 928v64q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-352v96q0 14 -9 23t-23 9
+h-64q-14 0 -23 -9t-9 -23v-96h-768v96q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-96h-352q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2BC" unicode="&#xf2bc;" horiz-adv-x="2048" 
+d="M1024 405q0 -64 -37 -106.5t-91 -42.5h-512q-54 0 -91 42.5t-37 106.5t9 117.5t29.5 103t60.5 78t97 28.5q6 -4 30 -18t37.5 -21.5t35.5 -17.5t43 -14.5t42 -4.5t42 4.5t43 14.5t35.5 17.5t37.5 21.5t30 18q57 0 97 -28.5t60.5 -78t29.5 -103t9 -117.5zM867 925
+q0 -94 -66.5 -160.5t-160.5 -66.5t-160.5 66.5t-66.5 160.5t66.5 160.5t160.5 66.5t160.5 -66.5t66.5 -160.5zM1792 480v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM1792 732v-56q0 -15 -10.5 -25.5t-25.5 -10.5h-568
+q-15 0 -25.5 10.5t-10.5 25.5v56q0 15 10.5 25.5t25.5 10.5h568q15 0 25.5 -10.5t10.5 -25.5zM1792 992v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM1920 32v1216q0 13 -9.5 22.5t-22.5 9.5h-1728q-13 0 -22.5 -9.5
+t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h352v96q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-96h768v96q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-96h352q13 0 22.5 9.5t9.5 22.5zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-1728q-66 0 -113 47t-47 113v1216q0 66 47 113
+t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2BD" unicode="&#xf2bd;" horiz-adv-x="1792" 
+d="M1523 197q-22 155 -87.5 257.5t-184.5 118.5q-67 -74 -159.5 -115.5t-195.5 -41.5t-195.5 41.5t-159.5 115.5q-119 -16 -184.5 -118.5t-87.5 -257.5q106 -150 271 -237.5t356 -87.5t356 87.5t271 237.5zM1280 896q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5
+t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1792 640q0 -182 -71 -347.5t-190.5 -286t-285.5 -191.5t-349 -71q-182 0 -348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2BE" unicode="&#xf2be;" horiz-adv-x="1792" 
+d="M896 1536q182 0 348 -71t286 -191t191 -286t71 -348q0 -181 -70.5 -347t-190.5 -286t-286 -191.5t-349 -71.5t-349 71t-285.5 191.5t-190.5 286t-71 347.5t71 348t191 286t286 191t348 71zM1515 185q149 205 149 455q0 156 -61 298t-164 245t-245 164t-298 61t-298 -61
+t-245 -164t-164 -245t-61 -298q0 -250 149 -455q66 327 306 327q131 -128 313 -128t313 128q240 0 306 -327zM1280 832q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5z" />
+    <glyph glyph-name="uniF2C0" unicode="&#xf2c0;" 
+d="M1201 752q47 -14 89.5 -38t89 -73t79.5 -115.5t55 -172t22 -236.5q0 -154 -100 -263.5t-241 -109.5h-854q-141 0 -241 109.5t-100 263.5q0 131 22 236.5t55 172t79.5 115.5t89 73t89.5 38q-79 125 -79 272q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5
+t198.5 -40.5t163.5 -109.5t109.5 -163.5t40.5 -198.5q0 -147 -79 -272zM768 1408q-159 0 -271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5t-112.5 271.5t-271.5 112.5zM1195 -128q88 0 150.5 71.5t62.5 173.5q0 239 -78.5 377t-225.5 145
+q-145 -127 -336 -127t-336 127q-147 -7 -225.5 -145t-78.5 -377q0 -102 62.5 -173.5t150.5 -71.5h854z" />
+    <glyph glyph-name="uniF2C1" unicode="&#xf2c1;" horiz-adv-x="1280" 
+d="M1024 278q0 -64 -37 -107t-91 -43h-512q-54 0 -91 43t-37 107t9 118t29.5 104t61 78.5t96.5 28.5q80 -75 188 -75t188 75q56 0 96.5 -28.5t61 -78.5t29.5 -104t9 -118zM870 797q0 -94 -67.5 -160.5t-162.5 -66.5t-162.5 66.5t-67.5 160.5t67.5 160.5t162.5 66.5
+t162.5 -66.5t67.5 -160.5zM1152 -96v1376h-1024v-1376q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1280 1376v-1472q0 -66 -47 -113t-113 -47h-960q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h352v-96q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v96h352
+q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2C2" unicode="&#xf2c2;" horiz-adv-x="2048" 
+d="M896 324q0 54 -7.5 100.5t-24.5 90t-51 68.5t-81 25q-64 -64 -156 -64t-156 64q-47 0 -81 -25t-51 -68.5t-24.5 -90t-7.5 -100.5q0 -55 31.5 -93.5t75.5 -38.5h426q44 0 75.5 38.5t31.5 93.5zM768 768q0 80 -56 136t-136 56t-136 -56t-56 -136t56 -136t136 -56t136 56
+t56 136zM1792 288v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1408 544v64q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1792 544v64q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23
+v-64q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1792 800v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM128 1152h1792v96q0 14 -9 23t-23 9h-1728q-14 0 -23 -9t-9 -23v-96zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-1728
+q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2C3" unicode="&#xf2c3;" horiz-adv-x="2048" 
+d="M896 324q0 -55 -31.5 -93.5t-75.5 -38.5h-426q-44 0 -75.5 38.5t-31.5 93.5q0 54 7.5 100.5t24.5 90t51 68.5t81 25q64 -64 156 -64t156 64q47 0 81 -25t51 -68.5t24.5 -90t7.5 -100.5zM768 768q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136z
+M1792 352v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1408 608v-64q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h320q14 0 23 -9t9 -23zM1792 608v-64q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v64
+q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 864v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1920 32v1120h-1792v-1120q0 -13 9.5 -22.5t22.5 -9.5h1728q13 0 22.5 9.5t9.5 22.5zM2048 1248v-1216q0 -66 -47 -113t-113 -47
+h-1728q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2C4" unicode="&#xf2c4;" horiz-adv-x="1792" 
+d="M1255 749q0 318 -105 474.5t-330 156.5q-222 0 -326 -157t-104 -474q0 -316 104 -471.5t326 -155.5q74 0 131 17q-22 43 -39 73t-44 65t-53.5 56.5t-63 36t-77.5 14.5q-46 0 -79 -16l-49 97q105 91 276 91q132 0 215.5 -54t150.5 -155q67 149 67 402zM1645 117h117
+q3 -27 -2 -67t-26.5 -95t-58 -100.5t-107 -78t-162.5 -32.5q-71 0 -130.5 19t-105.5 56t-79 78t-66 96q-97 -27 -205 -27q-150 0 -292.5 58t-253 158.5t-178 249t-67.5 317.5q0 170 67.5 319.5t178.5 250.5t253.5 159t291.5 58q121 0 238.5 -36t217 -106t176 -164.5
+t119.5 -219t43 -261.5q0 -190 -80.5 -347.5t-218.5 -264.5q47 -70 93.5 -106.5t104.5 -36.5q61 0 94 37.5t38 85.5z" />
+    <glyph glyph-name="uniF2C5" unicode="&#xf2c5;" horiz-adv-x="2304" 
+d="M453 -101q0 -21 -16 -37.5t-37 -16.5q-1 0 -13 3q-63 15 -162 140q-225 284 -225 676q0 341 213 614q39 51 95 103.5t94 52.5q19 0 35 -13.5t16 -32.5q0 -27 -63 -90q-98 -102 -147 -184q-119 -199 -119 -449q0 -281 123 -491q50 -85 136 -173q2 -3 14.5 -16t19.5 -21
+t17 -20.5t14.5 -23.5t4.5 -21zM1796 33q0 -29 -17.5 -48.5t-46.5 -19.5h-1081q-26 0 -45 19t-19 45q0 29 17.5 48.5t46.5 19.5h1081q26 0 45 -19t19 -45zM1581 644q0 -134 -67 -233q-25 -38 -69.5 -78.5t-83.5 -60.5q-16 -10 -27 -10q-7 0 -15 6t-8 12q0 9 19 30t42 46
+t42 67.5t19 88.5q0 76 -35 130q-29 42 -46 42q-3 0 -3 -5q0 -12 7.5 -35.5t7.5 -36.5q0 -22 -21.5 -35t-44.5 -13q-66 0 -66 76q0 15 1.5 44t1.5 44q0 25 -10 46q-13 25 -42 53.5t-51 28.5q-5 0 -7 -0.5t-3.5 -2.5t-1.5 -6q0 -2 16 -26t16 -54q0 -37 -19 -68t-46 -54
+t-53.5 -46t-45.5 -54t-19 -68q0 -98 42 -160q29 -43 79 -63q16 -5 17 -10q1 -2 1 -5q0 -16 -18 -16q-6 0 -33 11q-119 43 -195 139.5t-76 218.5q0 55 24.5 115.5t60 115t70.5 108.5t59.5 113.5t24.5 111.5q0 53 -25 94q-29 48 -56 64q-19 9 -19 21q0 20 41 20q50 0 110 -29
+q41 -19 71 -44.5t49.5 -51t33.5 -62.5t22 -69t16 -80q0 -1 3 -17.5t4.5 -25t5.5 -25t9 -27t11 -21.5t14.5 -16.5t18.5 -5.5q23 0 37 14t14 37q0 25 -20 67t-20 52t10 10q27 0 93 -70q72 -76 102.5 -156t30.5 -186zM2304 615q0 -274 -138 -503q-19 -32 -48 -72t-68 -86.5
+t-81 -77t-74 -30.5q-16 0 -31 15.5t-15 31.5q0 15 29 50.5t68.5 77t48.5 52.5q183 230 183 531q0 131 -20.5 235t-72.5 211q-58 119 -163 228q-2 3 -13 13.5t-16.5 16.5t-15 17.5t-15 20t-9.5 18.5t-4 19q0 19 16 35.5t35 16.5q70 0 196 -169q98 -131 146 -273t60 -314
+q2 -42 2 -64z" />
+    <glyph glyph-name="uniF2C6" unicode="&#xf2c6;" horiz-adv-x="1792" 
+d="M1189 229l147 693q9 44 -10.5 63t-51.5 7l-864 -333q-29 -11 -39.5 -25t-2.5 -26.5t32 -19.5l221 -69l513 323q21 14 32 6q7 -5 -4 -15l-415 -375v0v0l-16 -228q23 0 45 22l108 104l224 -165q64 -36 81 38zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71
+t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2C7" unicode="&#xf2c7;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v907h128v-907q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2C8" unicode="&#xf2c8;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v651h128v-651q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2C9" unicode="&#xf2c9;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v395h128v-395q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2CA" unicode="&#xf2ca;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v139h128v-139q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5
+t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192
+v128h192z" />
+    <glyph glyph-name="uniF2CB" unicode="&#xf2cb;" horiz-adv-x="1024" 
+d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 79 56 135.5t136 56.5t136 -56.5t56 -135.5zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5t93.5 226.5z
+M896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192v128h192z" />
+    <glyph glyph-name="uniF2CC" unicode="&#xf2cc;" horiz-adv-x="1920" 
+d="M1433 1287q10 -10 10 -23t-10 -23l-626 -626q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l44 44q-72 91 -81.5 207t46.5 215q-74 71 -176 71q-106 0 -181 -75t-75 -181v-1280h-256v1280q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5q106 0 201 -41
+t166 -115q94 39 197 24.5t185 -79.5l44 44q10 10 23 10t23 -10zM1344 1024q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1600 896q-26 0 -45 19t-19 45t19 45t45 19t45 -19t19 -45t-19 -45t-45 -19zM1856 1024q26 0 45 -19t19 -45t-19 -45t-45 -19
+t-45 19t-19 45t19 45t45 19zM1216 896q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1408 832q0 26 19 45t45 19t45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45zM1728 896q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 768
+q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1344 640q-26 0 -45 19t-19 45t19 45t45 19t45 -19t19 -45t-19 -45t-45 -19zM1600 768q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1216 512q-26 0 -45 19t-19 45t19 45t45 19t45 -19
+t19 -45t-19 -45t-45 -19zM1472 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 512q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1344 512q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1216 384
+q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 256q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19z" />
+    <glyph glyph-name="uniF2CD" unicode="&#xf2cd;" horiz-adv-x="1792" 
+d="M1664 448v-192q0 -169 -128 -286v-194q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v118q-63 -22 -128 -22h-768q-65 0 -128 22v-110q0 -17 -9.5 -28.5t-22.5 -11.5h-64q-13 0 -22.5 11.5t-9.5 28.5v186q-128 117 -128 286v192h1536zM704 864q0 -14 -9 -23t-23 -9t-23 9
+t-9 23t9 23t23 9t23 -9t9 -23zM768 928q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM704 992q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 992q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM768 1056q0 -14 -9 -23t-23 -9t-23 9
+t-9 23t9 23t23 9t23 -9t9 -23zM704 1120q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1792 608v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v640q0 106 75 181t181 75q108 0 184 -78q46 19 98 12t93 -39l22 22q11 11 22 0l42 -42
+q11 -11 0 -22l-314 -314q-11 -11 -22 0l-42 42q-11 11 0 22l22 22q-36 46 -40.5 104t23.5 108q-37 35 -88 35q-53 0 -90.5 -37.5t-37.5 -90.5v-640h1504q14 0 23 -9t9 -23zM896 1056q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 1120q0 -14 -9 -23t-23 -9
+t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM768 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM960 1120q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM896 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 1248q0 -14 -9 -23
+t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1024 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM960 1248q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1088 1248q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23z" />
+    <glyph glyph-name="uniF2CE" unicode="&#xf2ce;" 
+d="M994 344q0 -86 -17 -197q-31 -215 -55 -313q-22 -90 -152 -90t-152 90q-24 98 -55 313q-17 110 -17 197q0 168 224 168t224 -168zM1536 768q0 -240 -134 -434t-350 -280q-8 -3 -15 3t-6 15q7 48 10 66q4 32 6 47q1 9 9 12q159 81 255.5 234t96.5 337q0 180 -91 330.5
+t-247 234.5t-337 74q-124 -7 -237 -61t-193.5 -140.5t-128 -202t-46.5 -240.5q1 -184 99 -336.5t257 -231.5q7 -3 9 -12q3 -21 6 -45q1 -9 5 -32.5t6 -35.5q1 -9 -6.5 -15t-15.5 -2q-148 58 -261 169.5t-173.5 264t-52.5 319.5q7 143 66 273.5t154.5 227t225 157.5t272.5 70
+q164 10 315.5 -46.5t261 -160.5t175 -250.5t65.5 -308.5zM994 800q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5zM1282 768q0 -122 -53.5 -228.5t-146.5 -177.5q-8 -6 -16 -2t-10 14q-6 52 -29 92q-7 10 3 20
+q58 54 91 127t33 155q0 111 -58.5 204t-157.5 141.5t-212 36.5q-133 -15 -229 -113t-109 -231q-10 -92 23.5 -176t98.5 -144q10 -10 3 -20q-24 -41 -29 -93q-2 -9 -10 -13t-16 2q-95 74 -148.5 183t-51.5 234q3 131 69 244t177 181.5t241 74.5q144 7 268 -60t196.5 -187.5
+t72.5 -263.5z" />
+    <glyph glyph-name="uniF2D0" unicode="&#xf2d0;" horiz-adv-x="1792" 
+d="M256 128h1280v768h-1280v-768zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D1" unicode="&#xf2d1;" horiz-adv-x="1792" 
+d="M1792 224v-192q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D2" unicode="&#xf2d2;" horiz-adv-x="2048" 
+d="M256 0h768v512h-768v-512zM1280 512h512v768h-768v-256h96q66 0 113 -47t47 -113v-352zM2048 1376v-960q0 -66 -47 -113t-113 -47h-608v-352q0 -66 -47 -113t-113 -47h-960q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h608v352q0 66 47 113t113 47h960q66 0 113 -47
+t47 -113z" />
+    <glyph glyph-name="uniF2D3" unicode="&#xf2d3;" horiz-adv-x="1792" 
+d="M1175 215l146 146q10 10 10 23t-10 23l-233 233l233 233q10 10 10 23t-10 23l-146 146q-10 10 -23 10t-23 -10l-233 -233l-233 233q-10 10 -23 10t-23 -10l-146 -146q-10 -10 -10 -23t10 -23l233 -233l-233 -233q-10 -10 -10 -23t10 -23l146 -146q10 -10 23 -10t23 10
+l233 233l233 -233q10 -10 23 -10t23 10zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D4" unicode="&#xf2d4;" horiz-adv-x="1792" 
+d="M1257 425l-146 -146q-10 -10 -23 -10t-23 10l-169 169l-169 -169q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l169 169l-169 169q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l169 -169l169 169q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23
+l-169 -169l169 -169q10 -10 10 -23t-10 -23zM256 128h1280v1024h-1280v-1024zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D5" unicode="&#xf2d5;" horiz-adv-x="1792" 
+d="M1070 358l306 564h-654l-306 -564h654zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2D6" unicode="&#xf2d6;" horiz-adv-x="1794" 
+d="M1291 1060q-15 17 -35 8.5t-26 -28.5t5 -38q14 -17 40 -14.5t34 20.5t-18 52zM895 814q-8 -8 -19.5 -8t-18.5 8q-8 8 -8 19t8 18q7 8 18.5 8t19.5 -8q7 -7 7 -18t-7 -19zM1060 740l-35 -35q-12 -13 -29.5 -13t-30.5 13l-38 38q-12 13 -12 30t12 30l35 35q12 12 29.5 12
+t30.5 -12l38 -39q12 -12 12 -29.5t-12 -29.5zM951 870q-7 -8 -18.5 -8t-19.5 8q-7 8 -7 19t7 19q8 8 19 8t19 -8t8 -19t-8 -19zM1354 968q-34 -64 -107.5 -85.5t-127.5 16.5q-38 28 -61 66.5t-21 87.5t39 92t75.5 53t70.5 -5t70 -51q2 -2 13 -12.5t14.5 -13.5t13 -13.5
+t12.5 -15.5t10 -15.5t8.5 -18t4 -18.5t1 -21t-5 -22t-9.5 -24zM1555 486q3 20 -8.5 34.5t-27.5 21.5t-33 17t-23 20q-40 71 -84 98.5t-113 11.5q19 13 40 18.5t33 4.5l12 -1q2 45 -34 90q6 20 6.5 40.5t-2.5 30.5l-3 10q43 24 71 65t34 91q10 84 -43 150.5t-137 76.5
+q-60 7 -114 -18.5t-82 -74.5q-30 -51 -33.5 -101t14.5 -87t43.5 -64t56.5 -42q-45 4 -88 36t-57 88q-28 108 32 222q-16 21 -29 32q-50 0 -89 -19q19 24 42 37t36 14l13 1q0 50 -13 78q-10 21 -32.5 28.5t-47 -3.5t-37.5 -40q2 4 4 7q-7 -28 -6.5 -75.5t19 -117t48.5 -122.5
+q-25 -14 -47 -36q-35 -16 -85.5 -70.5t-84.5 -101.5l-33 -46q-90 -34 -181 -125.5t-75 -162.5q1 -16 11 -27q-15 -12 -30 -30q-21 -25 -21 -54t21.5 -40t63.5 6q41 19 77 49.5t55 60.5q-2 2 -6.5 5t-20.5 7.5t-33 3.5q23 5 51 12.5t40 10t27.5 6t26 4t23.5 0.5q14 -7 22 34
+q7 37 7 90q0 102 -40 150q106 -103 101 -219q-1 -29 -15 -50t-27 -27l-13 -6q-4 -7 -19 -32t-26 -45.5t-26.5 -52t-25 -61t-17 -63t-6.5 -66.5t10 -63q-35 54 -37 80q-22 -24 -34.5 -39t-33.5 -42t-30.5 -46t-16.5 -41t-0.5 -38t25.5 -27q45 -25 144 64t190.5 221.5
+t122.5 228.5q86 52 145 115.5t86 119.5q47 -93 154 -178q104 -83 167 -80q39 2 46 43zM1794 640q0 -182 -71 -348t-191 -286t-286.5 -191t-348.5 -71t-348.5 71t-286.5 191t-191 286t-71 348t71 348t191 286t286.5 191t348.5 71t348.5 -71t286.5 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2D7" unicode="&#xf2d7;" 
+d="M518 1353v-655q103 -1 191.5 1.5t125.5 5.5l37 3q68 2 90.5 24.5t39.5 94.5l33 142h103l-14 -322l7 -319h-103l-29 127q-15 68 -45 93t-84 26q-87 8 -352 8v-556q0 -78 43.5 -115.5t133.5 -37.5h357q35 0 59.5 2t55 7.5t54 18t48.5 32t46 50.5t39 73l93 216h89
+q-6 -37 -31.5 -252t-30.5 -276q-146 5 -263.5 8t-162.5 4h-44h-628l-376 -12v102l127 25q67 13 91.5 37t25.5 79l8 643q3 402 -8 645q-2 61 -25.5 84t-91.5 36l-127 24v102l376 -12h702q139 0 374 27q-6 -68 -14 -194.5t-12 -219.5l-5 -92h-93l-32 124q-31 121 -74 179.5
+t-113 58.5h-548q-28 0 -35.5 -8.5t-7.5 -30.5z" />
+    <glyph glyph-name="uniF2D8" unicode="&#xf2d8;" 
+d="M922 739v-182q0 -4 0.5 -15t0 -15l-1.5 -12t-3.5 -11.5t-6.5 -7.5t-11 -5.5t-16 -1.5v309q9 0 16 -1t11 -5t6.5 -5.5t3.5 -9.5t1 -10.5v-13.5v-14zM1238 643v-121q0 -1 0.5 -12.5t0 -15.5t-2.5 -11.5t-7.5 -10.5t-13.5 -3q-9 0 -14 9q-4 10 -4 165v7v8.5v9t1.5 8.5l3.5 7
+t5 5.5t8 1.5q6 0 10 -1.5t6.5 -4.5t4 -6t2 -8.5t0.5 -8v-9.5v-9zM180 407h122v472h-122v-472zM614 407h106v472h-159l-28 -221q-20 148 -32 221h-158v-472h107v312l45 -312h76l43 319v-319zM1039 712q0 67 -5 90q-3 16 -11 28.5t-17 20.5t-25 14t-26.5 8.5t-31 4t-29 1.5
+h-29.5h-12h-91v-472h56q169 -1 197 24.5t25 180.5q-1 62 -1 100zM1356 515v133q0 29 -2 45t-9.5 33.5t-24.5 25t-46 7.5q-46 0 -77 -34v154h-117v-472h110l7 30q30 -36 77 -36q50 0 66 30.5t16 83.5zM1536 1248v-1216q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113
+v1216q0 66 47 113t113 47h1216q66 0 113 -47t47 -113z" />
+    <glyph glyph-name="uniF2D9" unicode="&#xf2d9;" horiz-adv-x="2176" 
+d="M1143 -197q-6 1 -11 4q-13 8 -36 23t-86 65t-116.5 104.5t-112 140t-89.5 172.5q-17 3 -175 37q66 -213 235 -362t391 -184zM502 409l168 -28q-25 76 -41 167.5t-19 145.5l-4 53q-84 -82 -121 -224q5 -65 17 -114zM612 1018q-43 -64 -77 -148q44 46 74 68zM2049 584
+q0 161 -62 307t-167.5 252t-250.5 168.5t-304 62.5q-147 0 -281 -52.5t-240 -148.5q-30 -58 -45 -160q60 51 143 83.5t158.5 43t143 13.5t108.5 -1l40 -3q33 -1 53 -15.5t24.5 -33t6.5 -37t-1 -28.5q-126 11 -227.5 0.5t-183 -43.5t-142.5 -71.5t-131 -98.5
+q4 -36 11.5 -92.5t35.5 -178t62 -179.5q123 -6 247.5 14.5t214.5 53.5t162.5 67t109.5 59l37 24q22 16 39.5 20.5t30.5 -5t17 -34.5q14 -97 -39 -121q-208 -97 -467 -134q-135 -20 -317 -16q41 -96 110 -176.5t137 -127t130.5 -79t101.5 -43.5l39 -12q143 -23 263 15
+q195 99 314 289t119 418zM2123 621q-14 -135 -40 -212q-70 -208 -181.5 -346.5t-318.5 -253.5q-48 -33 -82 -44q-72 -26 -163 -16q-36 -3 -73 -3q-283 0 -504.5 173t-295.5 442q-1 0 -4 0.5t-5 0.5q-6 -50 2.5 -112.5t26 -115t36 -98t31.5 -71.5l14 -26q8 -12 54 -82
+q-71 38 -124.5 106.5t-78.5 140t-39.5 137t-17.5 107.5l-2 42q-5 2 -33.5 12.5t-48.5 18t-53 20.5t-57.5 25t-50 25.5t-42.5 27t-25 25.5q19 -10 50.5 -25.5t113 -45.5t145.5 -38l2 32q11 149 94 290q41 202 176 365q28 115 81 214q15 28 32 45t49 32q158 74 303.5 104
+t302 11t306.5 -97q220 -115 333 -336t87 -474z" />
+    <glyph glyph-name="uniF2DA" unicode="&#xf2da;" horiz-adv-x="1792" 
+d="M1341 752q29 44 -6.5 129.5t-121.5 142.5q-58 39 -125.5 53.5t-118 4.5t-68.5 -37q-12 -23 -4.5 -28t42.5 -10q23 -3 38.5 -5t44.5 -9.5t56 -17.5q36 -13 67.5 -31.5t53 -37t40 -38.5t30.5 -38t22 -34.5t16.5 -28.5t12 -18.5t10.5 -6t11 9.5zM1704 178
+q-52 -127 -148.5 -220t-214.5 -141.5t-253 -60.5t-266 13.5t-251 91t-210 161.5t-141.5 235.5t-46.5 303.5q1 41 8.5 84.5t12.5 64t24 80.5t23 73q-51 -208 1 -397t173 -318t291 -206t346 -83t349 74.5t289 244.5q20 27 18 14q0 -4 -4 -14zM1465 627q0 -104 -40.5 -199
+t-108.5 -164t-162 -109.5t-198 -40.5t-198 40.5t-162 109.5t-108.5 164t-40.5 199t40.5 199t108.5 164t162 109.5t198 40.5t198 -40.5t162 -109.5t108.5 -164t40.5 -199zM1752 915q-65 147 -180.5 251t-253 153.5t-292 53.5t-301 -36.5t-275.5 -129t-220 -211.5t-131 -297
+t-10 -373q-49 161 -51.5 311.5t35.5 272.5t109 227t165.5 180.5t207 126t232 71t242.5 9t236 -54t216 -124.5t178 -197q33 -50 62 -121t31 -112zM1690 573q12 244 -136.5 416t-396.5 240q-8 0 -10 5t24 8q125 -4 230 -50t173 -120t116 -168.5t58.5 -199t-1 -208
+t-61.5 -197.5t-122.5 -167t-185 -117.5t-248.5 -46.5q108 30 201.5 80t174 123t129.5 176.5t55 225.5z" />
+    <glyph glyph-name="uniF2DB" unicode="&#xf2db;" 
+d="M192 256v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 512v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 768v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16
+q0 16 16 16h112zM192 1024v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 1280v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM1280 1440v-1472q0 -40 -28 -68t-68 -28h-832q-40 0 -68 28
+t-28 68v1472q0 40 28 68t68 28h832q40 0 68 -28t28 -68zM1536 208v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 464v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 720v-32
+q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 976v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 1232v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16
+h48q16 0 16 -16z" />
+    <glyph glyph-name="uniF2DC" unicode="&#xf2dc;" horiz-adv-x="1664" 
+d="M1566 419l-167 -33l186 -107q23 -13 29.5 -38.5t-6.5 -48.5q-14 -23 -39 -29.5t-48 6.5l-186 106l55 -160q13 -38 -12 -63.5t-60.5 -20.5t-48.5 42l-102 300l-271 156v-313l208 -238q16 -18 17 -39t-11 -36.5t-28.5 -25t-37 -5.5t-36.5 22l-112 128v-214q0 -26 -19 -45
+t-45 -19t-45 19t-19 45v214l-112 -128q-16 -18 -36.5 -22t-37 5.5t-28.5 25t-11 36.5t17 39l208 238v313l-271 -156l-102 -300q-13 -37 -48.5 -42t-60.5 20.5t-12 63.5l55 160l-186 -106q-23 -13 -48 -6.5t-39 29.5q-13 23 -6.5 48.5t29.5 38.5l186 107l-167 33
+q-29 6 -42 29t-8.5 46.5t25.5 40t50 10.5l310 -62l271 157l-271 157l-310 -62q-4 -1 -13 -1q-27 0 -44 18t-19 40t11 43t40 26l167 33l-186 107q-23 13 -29.5 38.5t6.5 48.5t39 30t48 -7l186 -106l-55 160q-13 38 12 63.5t60.5 20.5t48.5 -42l102 -300l271 -156v313
+l-208 238q-16 18 -17 39t11 36.5t28.5 25t37 5.5t36.5 -22l112 -128v214q0 26 19 45t45 19t45 -19t19 -45v-214l112 128q16 18 36.5 22t37 -5.5t28.5 -25t11 -36.5t-17 -39l-208 -238v-313l271 156l102 300q13 37 48.5 42t60.5 -20.5t12 -63.5l-55 -160l186 106
+q23 13 48 6.5t39 -29.5q13 -23 6.5 -48.5t-29.5 -38.5l-186 -107l167 -33q27 -5 40 -26t11 -43t-19 -40t-44 -18q-9 0 -13 1l-310 62l-271 -157l271 -157l310 62q29 6 50 -10.5t25.5 -40t-8.5 -46.5t-42 -29z" />
+    <glyph glyph-name="uniF2DD" unicode="&#xf2dd;" horiz-adv-x="1792" 
+d="M1473 607q7 118 -33 226.5t-113 189t-177 131t-221 57.5q-116 7 -225.5 -32t-192 -110.5t-135 -175t-59.5 -220.5q-7 -118 33 -226.5t113 -189t177.5 -131t221.5 -57.5q155 -9 293 59t224 195.5t94 283.5zM1792 1536l-349 -348q120 -117 180.5 -272t50.5 -321
+q-11 -183 -102 -339t-241 -255.5t-332 -124.5l-999 -132l347 347q-120 116 -180.5 271.5t-50.5 321.5q11 184 102 340t241.5 255.5t332.5 124.5q167 22 500 66t500 66z" />
+    <glyph glyph-name="uniF2DE" unicode="&#xf2de;" horiz-adv-x="1792" 
+d="M948 508l163 -329h-51l-175 350l-171 -350h-49l179 374l-78 33l21 49l240 -102l-21 -50zM563 1100l304 -130l-130 -304l-304 130zM907 915l240 -103l-103 -239l-239 102zM1188 765l191 -81l-82 -190l-190 81zM1680 640q0 159 -62 304t-167.5 250.5t-250.5 167.5t-304 62
+t-304 -62t-250.5 -167.5t-167.5 -250.5t-62 -304t62 -304t167.5 -250.5t250.5 -167.5t304 -62t304 62t250.5 167.5t167.5 250.5t62 304zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71
+t286 -191t191 -286t71 -348z" />
+    <glyph glyph-name="uniF2E0" unicode="&#xf2e0;" horiz-adv-x="1920" 
+d="M1334 302q-4 24 -27.5 34t-49.5 10.5t-48.5 12.5t-25.5 38q-5 47 33 139.5t75 181t32 127.5q-14 101 -117 103q-45 1 -75 -16l-3 -2l-5 -2.5t-4.5 -2t-5 -2t-5 -0.5t-6 1.5t-6 3.5t-6.5 5q-3 2 -9 8.5t-9 9t-8.5 7.5t-9.5 7.5t-9.5 5.5t-11 4.5t-11.5 2.5q-30 5 -48 -3
+t-45 -31q-1 -1 -9 -8.5t-12.5 -11t-15 -10t-16.5 -5.5t-17 3q-54 27 -84 40q-41 18 -94 -5t-76 -65q-16 -28 -41 -98.5t-43.5 -132.5t-40 -134t-21.5 -73q-22 -69 18.5 -119t110.5 -46q30 2 50.5 15t38.5 46q7 13 79 199.5t77 194.5q6 11 21.5 18t29.5 0q27 -15 21 -53
+q-2 -18 -51 -139.5t-50 -132.5q-6 -38 19.5 -56.5t60.5 -7t55 49.5q4 8 45.5 92t81.5 163.5t46 88.5q20 29 41 28q29 0 25 -38q-2 -16 -65.5 -147.5t-70.5 -159.5q-12 -53 13 -103t74 -74q17 -9 51 -15.5t71.5 -8t62.5 14t20 48.5zM383 86q3 -15 -5 -27.5t-23 -15.5
+q-14 -3 -26.5 5t-15.5 23q-3 14 5 27t22 16t27 -5t16 -23zM953 -177q12 -17 8.5 -37.5t-20.5 -32.5t-37.5 -8t-32.5 21q-11 17 -7.5 37.5t20.5 32.5t37.5 8t31.5 -21zM177 635q-18 -27 -49.5 -33t-57.5 13q-26 18 -32 50t12 58q18 27 49.5 33t57.5 -12q26 -19 32 -50.5
+t-12 -58.5zM1467 -42q19 -28 13 -61.5t-34 -52.5t-60.5 -13t-51.5 34t-13 61t33 53q28 19 60.5 13t52.5 -34zM1579 562q69 -113 42.5 -244.5t-134.5 -207.5q-90 -63 -199 -60q-20 -80 -84.5 -127t-143.5 -44.5t-140 57.5q-12 -9 -13 -10q-103 -71 -225 -48.5t-193 126.5
+q-50 73 -53 164q-83 14 -142.5 70.5t-80.5 128t-2 152t81 138.5q-36 60 -38 128t24.5 125t79.5 98.5t121 50.5q32 85 99 148t146.5 91.5t168 17t159.5 -66.5q72 21 140 17.5t128.5 -36t104.5 -80t67.5 -115t17.5 -140.5q52 -16 87 -57t45.5 -89t-5.5 -99.5t-58 -87.5z
+M455 1222q14 -20 9.5 -44.5t-24.5 -38.5q-19 -14 -43.5 -9.5t-37.5 24.5q-14 20 -9.5 44.5t24.5 38.5q19 14 43.5 9.5t37.5 -24.5zM614 1503q4 -16 -5 -30.5t-26 -18.5t-31 5.5t-18 26.5q-3 17 6.5 31t25.5 18q17 4 31 -5.5t17 -26.5zM1800 555q4 -20 -6.5 -37t-30.5 -21
+q-19 -4 -36 6.5t-21 30.5t6.5 37t30.5 22q20 4 36.5 -7.5t20.5 -30.5zM1136 1448q16 -27 8.5 -58.5t-35.5 -47.5q-27 -16 -57.5 -8.5t-46.5 34.5q-16 28 -8.5 59t34.5 48t58 9t47 -36zM1882 792q4 -15 -4 -27.5t-23 -16.5q-15 -3 -27.5 5.5t-15.5 22.5q-3 15 5 28t23 16
+q14 3 26.5 -5t15.5 -23zM1691 1033q15 -22 10.5 -49t-26.5 -43q-22 -15 -49 -10t-42 27t-10 49t27 43t48.5 11t41.5 -28z" />
+    <glyph glyph-name="uniF2E1" unicode="&#xf2e1;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E2" unicode="&#xf2e2;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E3" unicode="&#xf2e3;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E4" unicode="&#xf2e4;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E5" unicode="&#xf2e5;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E6" unicode="&#xf2e6;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E7" unicode="&#xf2e7;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="_698" unicode="&#xf2e8;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2E9" unicode="&#xf2e9;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EA" unicode="&#xf2ea;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EB" unicode="&#xf2eb;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EC" unicode="&#xf2ec;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2ED" unicode="&#xf2ed;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="uniF2EE" unicode="&#xf2ee;" horiz-adv-x="1792" 
+ />
+    <glyph glyph-name="lessequal" unicode="&#xf500;" horiz-adv-x="1792" 
+ />
+  </font>
+</defs></svg>

static/js/main.js

@@ -0,0 +1,27 @@
+(function () {
+	"use strict";
+
+	var treeviewMenu = $('.app-menu');
+
+	// Toggle Sidebar
+	$('[data-toggle="sidebar"]').click(function(event) {
+		event.preventDefault();
+		$('.app').toggleClass('sidenav-toggled');
+	});
+
+	// Activate sidebar treeview toggle
+	$("[data-toggle='treeview']").click(function(event) {
+		event.preventDefault();
+		if(!$(this).parent().hasClass('is-expanded')) {
+			treeviewMenu.find("[data-toggle='treeview']").parent().removeClass('is-expanded');
+		}
+		$(this).parent().toggleClass('is-expanded');
+	});
+
+	// Set initial active toggle
+	$("[data-toggle='treeview.'].is-expanded").parent().toggleClass('is-expanded');
+
+	//Activate bootstrip tooltips
+	// $("[data-toggle='tooltip']").tooltip();
+
+})();

tunnel.go

@@ -1,111 +0,0 @@
-package main
-
-import (
-	"bytes"
-	"errors"
-	"log"
-	"net"
-	"sync"
-	"time"
-)
-
-type Tunnel struct {
-	tunnelPort int              //通信隧道端口
-	listener   *net.TCPListener //server端监听
-	signalList chan *Conn       //通信
-	tunnelList chan *Conn       //隧道
-	sync.RWMutex
-}
-
-func (s *Tunnel) StartTunnel() error {
-	var err error
-	s.listener, err = net.ListenTCP("tcp", &net.TCPAddr{net.ParseIP("0.0.0.0"), s.tunnelPort, ""})
-	if err != nil {
-		return err
-	}
-	go s.tunnelProcess()
-	return nil
-}
-
-//tcp server
-func (s *Tunnel) tunnelProcess() error {
-	var err error
-	for {
-		conn, err := s.listener.Accept()
-		if err != nil {
-			log.Println(err)
-			continue
-		}
-		go s.cliProcess(NewConn(conn))
-	}
-	return err
-}
-
-//验证失败，返回错误验证flag，并且关闭连接
-func (s *Tunnel) verifyError(c *Conn) {
-	c.conn.Write([]byte(VERIFY_EER))
-	c.conn.Close()
-}
-
-func (s *Tunnel) cliProcess(c *Conn) error {
-	c.conn.(*net.TCPConn).SetReadDeadline(time.Now().Add(time.Duration(5) * time.Second))
-	vval := make([]byte, 20)
-	_, err := c.conn.Read(vval)
-	if err != nil {
-		log.Println("客户端读超时。客户端地址为：:", c.conn.RemoteAddr())
-		c.conn.Close()
-		return err
-	}
-	if bytes.Compare(vval, getverifyval()[:]) != 0 {
-		log.Println("当前客户端连接校验错误，关闭此客户端:", c.conn.RemoteAddr())
-		s.verifyError(c)
-		return err
-	}
-	c.conn.(*net.TCPConn).SetReadDeadline(time.Time{})
-	//做一个判断 添加到对应的channel里面以供使用
-	flag, err := c.ReadFlag()
-	if err != nil {
-		return err
-	}
-	return s.typeDeal(flag, c)
-}
-
-//tcp连接类型区分
-func (s *Tunnel) typeDeal(typeVal string, c *Conn) error {
-	switch typeVal {
-	case WORK_MAIN:
-		s.signalList <- c
-	case WORK_CHAN:
-		s.tunnelList <- c
-	default:
-		return errors.New("无法识别")
-	}
-	c.SetAlive()
-	return nil
-}
-
-//新建隧道
-func (s *Tunnel) newChan() {
-retry:
-	connPass := <-s.signalList
-	_, err := connPass.conn.Write([]byte("chan"))
-	if err != nil {
-		log.Println(err)
-		goto retry
-	}
-	s.signalList <- connPass
-}
-
-func (s *Tunnel) GetTunnel() *Conn {
-	if len(s.tunnelList) < 10 { //新建通道
-		go s.newChan()
-	}
-retry:
-	c := <-s.tunnelList
-	_, err := c.wTest()
-	if err != nil {
-		c.Close()
-		goto retry
-	}
-	return c
-}

udp.go

@@ -1,83 +0,0 @@
-package main
-
-import (
-	"io"
-	"log"
-	"net"
-	"time"
-)
-
-type UdpModeServer struct {
-	Tunnel
-	udpPort      int    //监听的udp端口
-	tunnelTarget string //udp目标地址
-	listener     *net.UDPConn
-	udpMap       map[string]*Conn
-}
-
-func NewUdpModeServer(tcpPort, udpPort int, tunnelTarget string) *UdpModeServer {
-	s := new(UdpModeServer)
-	s.tunnelPort = tcpPort
-	s.udpPort = udpPort
-	s.tunnelTarget = tunnelTarget
-	s.tunnelList = make(chan *Conn, 1000)
-	s.signalList = make(chan *Conn, 10)
-	s.udpMap = make(map[string]*Conn)
-	return s
-}
-
-//开始
-func (s *UdpModeServer) Start() (error) {
-	err := s.StartTunnel()
-	if err != nil {
-		log.Fatalln("启动失败!", err)
-		return err
-	}
-	s.startTunnelServer()
-	return nil
-}
-
-//udp监听
-func (s *UdpModeServer) startTunnelServer() {
-	s.listener, err = net.ListenUDP("udp", &net.UDPAddr{net.ParseIP("0.0.0.0"), s.udpPort, ""})
-	if err != nil {
-		log.Fatalln(err)
-	}
-	data := make([]byte, 1472) //udp数据包大小
-	for {
-		n, addr, err := s.listener.ReadFromUDP(data)
-		if err != nil {
-			log.Println(err)
-			continue
-		}
-		go s.process(addr, data[:n])
-	}
-}
-
-func (s *UdpModeServer) process(addr *net.UDPAddr, data []byte) {
-	conn := s.GetTunnel()
-	if _, err := conn.WriteHost(CONN_UDP, s.tunnelTarget);err!=nil{
-		conn.Close()
-		return
-	}
-	go func() {
-		for {
-			buf := make([]byte, 1024)
-			conn.conn.SetReadDeadline(time.Now().Add(time.Duration(time.Second * 3)))
-			n, err := conn.ReadFromCompress(buf, DataDecode)
-			if err != nil || err == io.EOF {
-				conn.Close()
-				break
-			}
-			_, err = s.listener.WriteToUDP(buf[:n], addr)
-			if err != nil {
-				conn.Close()
-				break
-			}
-		}
-
-	}()
-	if _, err = conn.WriteCompress(data, DataEncode); err != nil {
-		conn.Close()
-	}
-}

verify.go

@@ -1,12 +0,0 @@
-package main
-
-import (
-	"crypto/sha1"
-	"time"
-)
-
-// 简单的一个校验值
-func getverifyval() []byte {
-	b := sha1.Sum([]byte(time.Now().Format("2006-01-02 15") + *verifyKey))
-	return b[:]
-}

views/index/add.html

@@ -0,0 +1,99 @@
+<div class="row tile">
+    <div class="col-lg-12">
+        <div class="bs-component">
+            <div class="alert alert-dismissible alert-success">
+                <button class="close" type="button" data-dismiss="alert">×</button>
+                <span id="info"></span>
+            </div>
+        </div>
+    </div>
+    <div class="col-md-6 col-md-auto">
+        <div>
+            <h3 class="tile-title">添加</h3>
+            <div class="tile-body">
+                <form>
+                    <div class="form-group">
+                        <label class="control-label">模式</label>
+                        <select class="form-control" name="type" id="type">
+                            <option {{if eq "tunnelServer" .type}}selected{{end}} value="tunnelServer">tcp隧道</option>
+                            <option {{if eq "udpServer" .type}}selected{{end}} value="udpServer">udp隧道</option>
+                            <option {{if eq "sock5Server" .type}}selected{{end}} value="sock5Server">socks5代理</option>
+                            <option {{if eq "httpProxyServer" .type}}selected{{end}} value="httpProxyServer">http代理
+                            <option {{if eq "hostServer" .type}}selected{{end}} value="hostServer">host客户端</option>
+                        </select>
+                    </div>
+                    <div class="form-group" id="port">
+                        <label class="control-label">监听的端口</label>
+                        <input class="form-control" type="text" name="port" placeholder="公网服务器对外访问端口，例如8024">
+                    </div>
+                    <div class="form-group" id="target">
+                        <label class="control-label">内网目标(ip:端口)</label>
+                        <input class="form-control" type="text" name="target" placeholder="内网代理地址，例如10.1.50.203:22">
+                    </div>
+                    <div class="form-group" id="compress">
+                        <label class="control-label">数据压缩方式</label>
+                        <select class="form-control" name="compress">
+                            <option value="">不压缩</option>
+                            <option value="gzip">gzip压缩</option>
+                            <option value="snappy">snappy</option>
+                        </select>
+                    </div>
+                    <div class="form-group" id="u">
+                        <label class="control-label">socks5代理模式验证用户名</label>
+                        <input class="form-control" type="text" name="u" placeholder="不填则无需验证">
+                    </div>
+                    <div class="form-group" id="p">
+                        <label class="control-label">socks5代理模式验证密码</label>
+                        <input class="form-control" type="text" name="p" placeholder="不填则无需验证">
+                    </div>
+                </form>
+            </div>
+            <div class="tile-footer">
+                &nbsp;&nbsp;<button class="btn btn-success" href="#" id="add"><i
+                    class="fa fa-fw fa-lg fa-eye"></i>添加
+            </button>
+            </div>
+        </div>
+    </div>
+</div>
+</main>
+<script>
+    var arr = []
+    arr["all"] = ["type", "port", "compress", "u", "p", "target"]
+    arr["tunnelServer"] = ["type", "port", "target", "compress", "tcp隧道模式，提供一条tcp隧道，适用于ssh、远程桌面等，添加后会自动生成一个客户端验证key<br>在内网机器执行<span style='color: red'>./easyProxy -vkey=生成的key -server=公网服务器ip:下面设定的端口</span><br>建立成功后，访问公网服务器的设定端口，则相当于访问内网目标地址的目标端口"]
+    arr["udpServer"] = ["type", "port", "target", "compress", "udp隧道模式，提供一条udp隧道，适用于dns、内网dns访问等，添加后会自动生成一个客户端验证key<br>在内网机器执行<span style='color: red'>./easyProxy -vkey=生成的key -server=公网服务器ip:下面设定的端口</span><br>建立成功后，访问公网服务器的设定端口，则相当于访问内网目标地址的udp目标端口"]
+    arr["sock5Server"] = ["type", "port", "compress", "u", "p", "socks5代理模式，内网socks5代理，配合proxifer，可如同使用vpn一样访问内网设备或资源，添加后会自动生成一个客户端验证key<br>在内网机器执行<span style='color: red'>./easyProxy -vkey=生成的key -server=公网服务器ip:下面设定的端口</span><br>建立成功后，在外网环境下本机配置socks5代理，即访问内网设备或者资源 "]
+    arr["httpProxyServer"] = ["type", "port", "compress", " http代理模式，内网http代理，可访问内网网站，添加后会自动生成一个客户端验证key<br>在内网机器执行<span style='color: red'>./easyProxy -vkey=生成的key -server=公网服务器ip:下面设定的端口</span><br>建立成功后，在外网环境下本机配置http代理，即访问内网站点"]
+    arr["hostServer"] = ["type", "compress", "域名分发模式，使用域名代理内网服务，适用于小程序开发、公众号开发、站点演示等，添加后会自动生成一个客户端验证key<br>在内网机器执行<span style='color: red'>./easyProxy -vkey=生成的key -server=公网服务器ip:下面设定的端口</span><br>建立成功后，使用nginx将请求反向代理到本程序，再进行域名配置，即可解析"]
+
+        function resetForm() {
+            for (var i = 0; i < arr["all"].length; i++) {
+                $("#" + arr["all"][i]).css("display", "none")
+            }
+            o = $("#type option:selected").val()
+            for (var i = 0; i < arr[o].length - 1; i++) {
+                $("#" + arr[o][i]).css("display", "block")
+            }
+            $("#info").html(arr[o][arr[o].length - 1])
+        }
+
+        $(function () {
+            resetForm()
+            $("#type").on("change", function () {
+                resetForm()
+            })
+            $("#add").on("click", function () {
+                $.ajax({
+                    type: "POST",
+                    url: "/index/add",
+                    data: $("form").serializeArray(),
+                    success: function (res) {
+                        alert(res.msg)
+                        if (res.status) {
+                            history.back(-1)
+                        }
+                    }
+                })
+            })
+        })
+</script>

views/index/edit.html

@@ -0,0 +1,94 @@
+<div class="row tile">
+    <div class="col-md-6 col-md-auto">
+        <div>
+            <h3 class="tile-title">添加</h3>
+            <div class="tile-body">
+                <form>
+                    <input type="hidden" name="vKey" value="{{.t.VerifyKey}}">
+                    <div class="form-group">
+                        <label class="control-label">模式</label>
+                        <select class="form-control" name="type"  id="type">
+                            <option {{if eq "tunnelServer" .t.Mode}}selected{{end}} value="tunnelServer">tcp隧道</option>
+                            <option {{if eq "udpServer" .t.Mode}}selected{{end}} value="udpServer">udp隧道</option>
+                            <option {{if eq "sock5Server" .t.Mode}}selected{{end}} value="sock5Server">socks5代理</option>
+                            <option {{if eq "httpProxyServer" .t.Mode}}selected{{end}} value="httpProxyServer">http代理
+                            <option {{if eq "hostServer" .t.Mode}}selected{{end}} value="hostServer">host客户端</option>
+                        </select>
+                    </div>
+                    <div class="form-group" id="port">
+                        <label class="control-label">监听的端口</label>
+                        <input class="form-control" value="{{.t.TcpPort}}" type="text" name="port"
+                               placeholder="公网服务器对外访问端口，例如8024">
+                    </div>
+                    <div class="form-group" id="target">
+                        <label class="control-label">内网目标(仅tcp、udp隧道模式需填写)</label>
+                        <input class="form-control" value="{{.t.Target}}" type="text" name="target"
+                               placeholder="内网隧道目标，例如10.1.50.203:22">
+                    </div>
+                    <div class="form-group" id="compress">
+                        <label class="control-label">数据压缩方式(所有模式均支持)</label>
+                        <select class="form-control" name="compress">
+                            <option {{if eq "" .t.Compress}}selected{{end}} value="">不压缩</option>
+                            <option {{if eq "gzip" .t.Compress}}selected{{end}} value="gzip">gzip压缩</option>
+                            <option {{if eq "snappy" .t.Compress}}selected{{end}} value="snappy">snappy压缩</option>
+                        </select>
+                    </div>
+                    <div class="form-group" id="u">
+                        <label class="control-label">socks5代理模式验证用户名</label>
+                        <input class="form-control" value="{{.t.U}}" type="text" name="u"
+                               placeholder="不填则无需验证,非socks5模式不填">
+                    </div>
+                    <div class="form-group" id="p">
+                        <label class="control-label">socks5代理模式验证密码</label>
+                        <input class="form-control" value="{{.t.P}}" type="text" name="p"
+                               placeholder="不填则无需验证,非socks5模式不填">
+                    </div>
+                </form>
+            </div>
+            <div class="tile-footer">
+                &nbsp;&nbsp;<button class="btn btn-success" href="#" id="add"><i
+                    class="fa fa-fw fa-lg fa-eye"></i>保存
+            </button>
+            </div>
+        </div>
+    </div>
+</div>
+</main>
+<script>
+    var arr = []
+    arr["all"] = ["type", "port", "compress", "u", "p","target"]
+    arr["tunnelServer"] = ["type", "port", "target", "compress"]
+    arr["udpServer"] = ["type", "port", "target", "compress"]
+    arr["sock5Server"] = ["type", "port", "compress", "u", "p"]
+    arr["httpProxyServer"] = ["type", "port", "compress"]
+    arr["hostServer"] = ["type", "compress"]
+
+    function resetForm() {
+        for (var i = 0; i < arr["all"].length; i++) {
+            $("#" + arr["all"][i]).css("display", "none")
+        }
+        o = $("#type option:selected").val()
+        for (var i = 0; i < arr[o].length; i++) {
+            $("#" + arr[o][i]).css("display", "block")
+        }
+    }
+    $(function () {
+        resetForm()
+        $("#type").on("change", function () {
+            resetForm()
+        })
+        $("#add").on("click", function () {
+            $.ajax({
+                type: "POST",
+                url: "/index/edit",
+                data: $("form").serializeArray(),
+                success: function (res) {
+                    alert(res.msg)
+                    if (res.status) {
+                        history.back(-1)
+                    }
+                }
+            })
+        })
+    })
+</script>

views/index/hadd.html

@@ -0,0 +1,43 @@
+<div class="row tile">
+    <div class="col-md-6 col-md-auto">
+        <div>
+            <h3 class="tile-title">添加</h3>
+            <div class="tile-body">
+                <form>
+                    <input type="hidden" name="vkey" value="{{.vkey}}">
+                    <div class="form-group">
+                        <label class="control-label">域名</label>
+                        <input class="form-control" type="text" name="host" placeholder="域名">
+                    </div>
+                    <div class="form-group">
+                        <label class="control-label">内网目标</label>
+                        <input class="form-control" type="text" name="target" placeholder="内网隧道目标，例如10.1.50.203:22">
+                    </div>
+                </form>
+            </div>
+            <div class="tile-footer">
+                &nbsp;&nbsp;<button class="btn btn-success" href="#" id="add"><i
+                    class="fa fa-fw fa-lg fa-eye"></i>添加
+            </button>
+            </div>
+        </div>
+    </div>
+</div>
+</main>
+<script>
+    $(function () {
+        $("#add").on("click", function () {
+            $.ajax({
+                type: "POST",
+                url: "/index/addhost",
+                data: $("form").serializeArray(),
+                success: function (res) {
+                    alert(res.msg)
+                    if (res.status) {
+                        history.back(-1)
+                    }
+                }
+            })
+        })
+    })
+</script>

views/index/hlist.html

@@ -0,0 +1,81 @@
+<div class="row">
+    <div class="col-md-12">
+        <div class="tile">
+            <div class="tile-body">
+                <table class="table table-hover table-bordered" id="sampleTable">
+                    <thead>
+                    <tr>
+                        <th>客户端key</th>
+                        <th>host</th>
+                        <th>内网目标</th>
+                        <th>操作</th>
+                    </tr>
+                    </thead>
+                    <tbody>
+
+                    </tbody>
+                </table>
+            </div>
+        </div>
+    </div>
+</div>
+</main>
+
+<script type="text/javascript">
+    function del(host) {
+        if (confirm("确定要删除数据吗？")) {
+            $.ajax({
+                type: "POST",
+                url: "/index/delhost",
+                data: {"host": host},
+                success: function (res) {
+                    alert(res.msg)
+                    if (res.status) {
+                        document.location.reload();
+                    }
+                }
+            })
+        }
+    }
+
+    function add() {
+        window.location.href = "/index/addhost?vkey={{.vkey}}"
+    }
+
+    $(document).ready(function () {
+        var table = $('#sampleTable').DataTable({
+            dom: 'Bfrtip',
+            processing: true,
+            serverSide: true,
+            autoWidth: false,
+            ordering: false,
+            ajax: {
+                url: window.location,
+                type: 'POST'
+            },
+            dom: '<"top"fl><"toolbar">rt<"bottom"ip><"clear">',
+            columns: [　//这个是显示到界面上的个数据　格式为 {data:'显示的字段名'}
+                {data: 'Vkey'},
+                {data: 'Host'},
+                {data: 'Target'},
+                {data: 'Target'},
+            ],
+            bFilter: false,
+            columnDefs: [{
+                targets: -1,
+                render: function (data, type, row, meta) {
+
+                    return '<div class="btn-group" role="group" aria-label="..."> ' +
+                            '<button onclick="del(\'' + row.Host + '\')" type="button"   class="btn btn-danger btn-sm">删除</button>' +
+                            ' </div>'
+                }
+            }
+            ],
+            buttons: []
+        });
+        $("#sampleTable_length").html('<button class="btn btn-primary" onclick="add()" type="button">新增</button>')
+    })
+    ;
+
+
+</script>

views/index/index.html

@@ -0,0 +1,152 @@
+<div class="row">
+    <div class="col-md-12">
+        <div class="tile">
+            <iframe src="https://ghbtns.com/github-btn.html?user=cnlh&repo=easyProxy&type=star&count=true&size=large"
+                    frameborder="0" scrolling="0" width="160px" height="30px"></iframe>
+            <iframe src="https://ghbtns.com/github-btn.html?user=cnlh&repo=easyProxy&type=watch&count=true&size=large&v=2"
+                    frameborder="0" scrolling="0" width="160px" height="30px"></iframe>
+            <iframe src="https://ghbtns.com/github-btn.html?user=cnlh&repo=easyProxy&type=fork&count=true&size=large"
+                    frameborder="0" scrolling="0" width="158px" height="30px"></iframe>
+        </div>
+    </div>
+</div>
+
+
+<div class="row">
+    <div class="col-md-12">
+        <div class="tile">
+            <h3 class="tile-title">域名代理模式</h3>
+            <p>
+                <b>适用范围：</b> 小程序开发、微信公众号开发、产品演示
+            </p>
+            <p>
+                <b>假设场景：</b>
+            <li>有一个域名proxy.com，有一台公网机器ip为{{.ip}}</li>
+            <li>两个内网开发站点127.0.0.1:81，127.0.0.1:82</li>
+            <li>想通过a.proxy.com访问127.0.0.1:81，通过b.proxy.com访问127.0.0.1:82</li>
+            </p>
+            <p><b>使用步骤：</b></p>
+            <ul>
+                <li>将a.proxy.com，b.proxy.com解析到公网服务器{{.ip}}</li>
+                <li>使用nginx监听这两个个域名，并配置ssl等……</li>
+                <li>在nginx配置中添加反向代理<br>
+                    <pre><code>
+                    server {
+                        listen 80;
+                        server_name a.proxy.com b.proxy.com;#也可以是泛解析*.proxy.com
+                        #ssl等配置
+                        <b>location / {
+                            proxy_set_header X-Real-IP $remote_addr;
+                            proxy_set_header X-Forwarded-For $proxy_add_x_forwarded_for;
+                            proxy_set_header Host $http_host;
+                            proxy_set_header X-Nginx-Proxy true;
+                            proxy_set_header Connection "";
+                            proxy_pass http://127.0.0.1:{{.proxyPort}};
+                        }</b>
+                    }
+                        </code></pre>
+                </li>
+                <li>在域名代理管理中添加一个客户端，选择压缩方式，保存。 <a href="/index/add?type=hostServer">立即添加</a></li>
+            {{/*<li>在域名代理管理中找到新加的客户端(查看其vkey或者客户端命令)，任意内网机器执行客户端命令</li>*/}}
+                <li>点击该客户端的域名管理，添加两条规则规则：1、域名：a.proxy.com，内网目标：127.0.0.1:81，2、域名：b.proxy.com，内网目标：127.0.0.1:82</li>
+                <li>现在访问a.proxy.com，b.proxy.com即可成功</li>
+            </ul>
+            <p>注：上文中提到公网ip（{{.ip}}）为系统自动识别，如果是在测试环境中请自行对应，默认启动方式为单客户端模式，默认内网客户端已经启动</p>
+        </div>
+    </div>
+</div>
+<div class="row">
+    <div class="col-md-6">
+        <div class="tile">
+            <h3 class="tile-title">tcp隧道模式</h3>
+            <p>
+                <b>适用范围：</b> ssh、远程桌面等tcp连接场景
+            </p>
+            <p>
+                <b>假设场景：</b> 想通过访问公网服务器{{.ip}}的8001端口，连接内网机器10.1.50.101的22端口，实现ssh连接
+            </p>
+            <p><b>使用步骤：</b></p>
+            <ul>
+                <li>在tcp隧道管理中添加一条隧道，填写监听的端口（8001）、内网目标ip和目标端口（10.1.50.101:22），选择压缩方式，保存。 <a
+                        href="/index/add?type=tunnelServer">立即添加</a></li>
+            {{/*<li>在tcp管理列表中找到新加的隧道(查看其vkey或者客户端命令)，任意内网机器执行客户端命令</li>*/}}
+                <li>访问公网服务器ip（{{.ip}}）:填写的监听端口(8001)，相当于访问内网ip(10.1.50.101):目标端口(22)，例如：ssh -p 8001 root@{{.ip}}</li>
+            </ul>
+            <p>注：上文中提到公网ip（{{.ip}}）为系统自动识别，如果是在测试环境中请自行对应，默认启动方式为单客户端模式，默认内网客户端已经启动</p>
+        </div>
+    </div>
+    <div class="col-md-6">
+        <div class="tile">
+            <h3 class="tile-title">udp隧道模式</h3>
+            <p>
+                <b>适用范围：</b> 内网dns解析等udp连接场景
+            </p>
+            <p>
+                <b>假设场景：</b> 内网有一台dns（10.1.50.102:53），在非内网环境下想使用该dns，公网服务器为{{.ip}}
+            </p>
+            <p><b>使用步骤：</b></p>
+            <ul>
+                <li>在udp隧道管理中添加一条隧道，填写监听的端口（8002）、内网目标ip和目标端口（10.1.50.102:53），选择压缩方式，保存。 <a
+                        href="/index/add?type=udpServer">立即添加</a></li>
+            {{/*<li>在udp管理列表中找到新加的隧道(查看其vkey或者客户端命令)，任意内网机器执行客户端命令</li>*/}}
+                <li>修改本机dns为{{.ip}}，则相当于使用10.1.50.202作为dns服务器</li>
+            </ul>
+            <p>注：上文中提到公网ip（{{.ip}}）为系统自动识别，如果是在测试环境中请自行对应，默认启动方式为单客户端模式，默认内网客户端已经启动</p>
+        </div>
+    </div>
+</div>
+<div class="row">
+    <div class="col-md-6">
+        <div class="tile">
+            <h3 class="tile-title">socks5代理模式</h3>
+            <p>
+                <b>适用范围：</b> 在外网环境下如同使用vpn一样访问内网设备或者资源
+            </p>
+            <p>
+                <b>假设场景：</b> 想将公网服务器{{.ip}}的8003端口作为socks5代理，达到访问内网任意设备或者资源的效果
+            </p>
+            <p><b>使用步骤：</b></p>
+            <ul>
+                <li>在socks5隧道管理中添加一条隧道，填写监听的端口（8003），验证用户名和密码自行选择（建议先不填，部分客户端不支持，proxifer支持），选择压缩方式，保存。 <a
+                        href="/index/add?type=sock5Server">立即添加</a></li>
+            {{/*<li>在socks5代理管理列表中找到新加的隧道(查看其vkey或者客户端命令)，任意内网机器执行客户端命令</li>*/}}
+                <li>在外网环境的本机配置socks5代理，ip为公网服务器ip（{{.ip}}），端口为填写的监听端口(8003)，即可畅享内网了</li>
+            </ul>
+            <p>注：上文中提到公网ip（{{.ip}}）为系统自动识别，如果是在测试环境中请自行对应，默认启动方式为单客户端模式，默认内网客户端已经启动</p>
+        </div>
+    </div>
+    <div class="col-md-6">
+        <div class="tile">
+            <h3 class="tile-title">http代理模式</h3>
+            <p>
+                <b>适用范围：</b> 在外网环境下访问内网站点
+            </p>
+            <p>
+                <b>假设场景：</b> 想将公网服务器{{.ip}}的8004端口作为http代理，访问内网网站
+            </p>
+            <p><b>使用步骤：</b></p>
+            <ul>
+                <li>在http隧道管理中添加一条隧道，填写监听的端口（8004），选择压缩方式，保存。 <a
+                        href="/index/add?type=httpProxyServer">立即添加</a></li>
+                <li>在http代理管理列表中找到新加的隧道(查看其vkey或者客户端命令)，任意内网机器执行客户端命令</li>
+                <li>在外网环境的本机配置http代理，ip为公网服务器ip（{{.ip}}），端口为填写的监听端口(8004)，即可访问了</li>
+            </ul>
+            <p>注：上文中提到公网ip（{{.ip}}）为系统自动识别，如果是在测试环境中请自行对应，默认启动方式为单客户端模式，默认内网客户端已经启动</p>
+        </div>
+    </div>
+</div>
+<div class="row">
+    <div class="col-md-12">
+        <div class="tile">
+            <p>
+                <b>多客户端模式：</b>
+            <li>服务端启动：./easyProxy -mode=webServer -tcpport=8284</li>
+            <li>客户端启动：./easyProxy -server={{.ip}}:{{.p}} -vkey=xxx（见管理列表的客户端启动模式）</li>
+            </p>
+            <p><b>支持客户端同时建立多条隧道，例如单个通道时命令为./easyProxy -server={{.ip}}:{{.p}} -vkey=ccc，如果要支持另外一个隧道，则对应的执行命令为./easyProxy
+                -server={{.ip}}:{{.p}} -vkey=ccc,ddd，即用逗号分隔开多个vkey，适用于所有模式！</b></p>
+        </div>
+    </div>
+</div>
+
+</main>

views/index/list.html

@@ -0,0 +1,174 @@
+<div class="row">
+    <div class="col-md-12">
+        <div class="tile">
+            <div class="tile-body">
+                <table class="table table-hover table-bordered" id="sampleTable">
+                    <thead>
+                    <tr>
+                    {{/*<th>模式</th>*/}}
+                        <th>监听端口</th>
+                        <th>内网目标</th>
+                        <th>多客户端模式客户端执行命令</th>
+                        <th>压缩方式</th>
+                        <th>用户名</th>
+                        <th>密码</th>
+                        <th>客户端状态</th>
+                        <th>状态</th>
+                        <th>操作</th>
+                    </tr>
+                    </thead>
+                    <tbody>
+
+                    </tbody>
+                </table>
+            </div>
+        </div>
+    </div>
+</div>
+</main>
+
+<script type="text/javascript">
+    function del(vKey) {
+        if (confirm("确定要删除数据吗？")) {
+            $.ajax({
+                type: "POST",
+                url: "/index/del",
+                data: {"vKey": vKey},
+                success: function (res) {
+                    alert(res.msg)
+                    if (res.status) {
+                        document.location.reload();
+                    }
+                }
+            })
+        }
+    }
+
+    function start(vKey) {
+        if (confirm("确定要开始任务吗？")) {
+            $.ajax({
+                type: "POST",
+                url: "/index/start",
+                data: {"vKey": vKey},
+                success: function (res) {
+                    alert(res.msg)
+                    if (res.status) {
+                        document.location.reload();
+                    }
+                }
+            })
+        }
+    }
+
+    function stop(vKey) {
+        if (confirm("确定要暂停吗？")) {
+            $.ajax({
+                type: "POST",
+                url: "/index/stop",
+                data: {"vKey": vKey},
+                success: function (res) {
+                    alert(res.msg)
+                    if (res.status) {
+                        document.location.reload();
+                    }
+                }
+            })
+        }
+    }
+
+    function edit(vKey) {
+        window.location.href = "/index/edit?vKey=" + vKey
+    }
+
+    function add() {
+        window.location.href = "/index/add?type=" +{{.type}}
+    }
+
+    function hostList(vkey) {
+        window.location.href = "/index/hostlist?vkey=" + vkey
+    }
+
+    $(document).ready(function () {
+        var table = $('#sampleTable').DataTable({
+            dom: 'Bfrtip',
+            processing: true,
+            serverSide: true,
+            autoWidth: false,
+            ordering: false,
+            ajax: {
+                url: '/index/gettasklist?type={{.type}}',
+                type: 'POST'
+            },
+            dom: '<"top"fl><"toolbar">rt<"bottom"ip><"clear">',
+            columns: [　//这个是显示到界面上的个数据　格式为 {data:'显示的字段名'}
+                // {data: 'Mode'},
+                {data: 'TcpPort'},
+                {data: 'Target'},
+                {data: 'VerifyKey'},
+                {data: 'Compress'},
+                {data: 'U'},
+                {data: 'P'},
+                {data: 'ClientStatus'},
+                {data: 'IsRun'},
+                {data: "Id"}
+            ],
+            bFilter: false,
+            columnDefs: [{
+                targets: -1,
+                render: function (data, type, row, meta) {
+                    if (row.IsRun == 1) {
+                        btn = "<button onclick=\"stop('" + row.VerifyKey + "')\" class=\"btn btn-secondary btn-sm\" type=\"button\">关闭</button>"
+                    } else {
+                        btn = "<button onclick=\"start('" + row.VerifyKey + "')\" class=\"btn btn-success btn-sm\" type=\"button\">打开</button>"
+                    }
+                    btn_edit = '<button onclick="edit(\'' + row.VerifyKey + '\')" type="button"   class="btn btn-primary btn-sm">查看编辑</button> '
+                    if ({{.type}} == "hostServer"
+                )
+                    {
+                        btn_host = '<button onclick="hostList(\'' + row.VerifyKey + '\')" type="button"   class="btn btn-info btn-sm">域名管理</button> '
+                    }
+                else
+                    {
+                        btn_host = ""
+                    }
+                    return '<div class="btn-group" role="group" aria-label="..."> ' +
+                            '<button onclick="del(\'' + row.VerifyKey + '\')" type="button"   class="btn btn-danger btn-sm">删除</button>' +
+                            btn_edit + btn + btn_host + ' </div>'
+                }
+            },
+                {
+                    targets: -2,
+                    render: function (data, type, row, meta) {
+                        if (data == 0) {
+                            return "<span class=\"badge badge-pill badge-secondary\">暂停</span>"
+                        } else {
+                            return "<span class=\"badge badge-pill badge-success\">正常</span>"
+                        }
+                    }
+                },
+                {
+                    targets: 2,
+                    render: function (data, type, row, meta) {
+                        return "./easyProxy -server={{.ip}}:{{.p}} -vkey=" + data
+                        // return data
+                    }
+                },
+                {
+                    targets: -3,
+                    render: function (data, type, row, meta) {
+                        if (data == 0) {
+                            return "<span class=\"badge badge-pill badge-secondary\">离线</span>"
+                        } else {
+                            return "<span class=\"badge badge-pill badge-success\">在线</span>"
+                        }
+                    }
+                }
+            ],
+            buttons: []
+        });
+        $("#sampleTable_length").html('<button class="btn btn-primary" onclick="add()" type="button">新增</button>')
+    })
+    ;
+
+
+</script>

views/login/index.html

@@ -0,0 +1,60 @@
+<!DOCTYPE html>
+<html>
+<head>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    <link rel="shortcut icon" href="/static/img/favicon.ico">
+    <!-- Main CSS-->
+    <link rel="stylesheet" type="text/css" href="/static/css/main.css">
+    <!-- Font-icon css-->
+    <link rel="stylesheet" type="text/css" href="/static/css/font-awesome.min.css">
+    <title>easyProxy内网穿透</title>
+</head>
+<body>
+<section class="material-half-bg">
+    <div class="cover"></div>
+</section>
+<section class="login-content">
+    <div class="logo">
+        <h1></h1>
+    </div>
+    <div class="login-box">
+        <form class="login-form" onsubmit="return false">
+            <h3 class="login-head"><i class="fa fa-lg fa-fw fa-user"></i>内网穿透管理登陆</h3>
+            <div class="form-group">
+                <label class="control-label">密码</label>
+                <input class="form-control" name="psd" type="password" placeholder="" autofocus>
+            </div>
+            <div class="form-group btn-container">
+                <button onclick="login()" class="btn btn-primary btn-block"><i class="fa fa-sign-in fa-lg fa-fw"></i>登陆
+                </button>
+            </div>
+        </form>
+    </div>
+</section>
+
+<script type="text/javascript" src="/static/js/pdfmake.min.js"></script>
+<script type="text/javascript" src="/static/js/vfs_fonts.js"></script>
+<script type="text/javascript" src="/static/js/datatables.min.js"></script>
+<script src="/static/js/main.js"></script>
+<script type="text/javascript">
+    // Login Page Flipbox control
+    function login() {
+        $.ajax({
+            type: "POST",
+            url: "/login/verify",
+            data: $("form").serializeArray(),
+            success: function (res) {
+                if (res.status) {
+                    window.location.href = "/index/index"
+                } else {
+                    alert(res.msg)
+                }
+            }
+        })
+        return false
+    }
+</script>
+</body>
+</html>

views/public/error.html

@@ -0,0 +1,5 @@
+<div class="page-error tile">
+    <h1><i class="fa fa-exclamation-circle"></i> Error 404: Page not found</h1>
+    <p>The page you have requested is not found.</p>
+    <p><a class="btn btn-primary" href="javascript:window.history.back();">Go Back</a></p>
+</div>

views/public/layout.html

@@ -0,0 +1,72 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+    <meta name="description"
+          content="Vali is a responsive and free admin theme built with Bootstrap 4, SASS and PUG.js. It's fully customizable and modular.">
+    <link rel="shortcut icon" href="/static/img/favicon.ico">
+    <title>easyProxy内网穿透</title>
+    <meta charset="utf-8">
+    <meta http-equiv="X-UA-Compatible" content="IE=edge">
+    <meta name="viewport" content="width=device-width, initial-scale=1">
+    <!-- Font-icon css-->
+    <link rel="stylesheet" type="text/css" href="/static/css/font-awesome.min.css">
+    <!-- Main CSS-->
+    <link rel="stylesheet" type="text/css" href="/static/css/main.css">
+</head>
+<body class="app sidebar-mini rtl">
+<!-- Navbar-->
+<header class="app-header">
+    <a class="app-header__logo" href="/"></a>
+    <!-- Sidebar toggle button--><a class="app-sidebar__toggle" href="#" data-toggle="sidebar"
+                                    aria-label="Hide Sidebar"></a>
+    <ul class="app-nav">
+        <!--Notification Menu-->
+        <!-- User Menu-->
+        <li class="dropdown"><a class="app-nav__item" href="/login/out" data-toggle="dropdown"
+                                aria-label="Open Profile Menu"><i class="fa fa-sign-out fa-lg"></i>退出登陆</a>
+
+        </li>
+    </ul>
+</header>
+<!-- Sidebar menu-->
+<div class="app-sidebar__overlay" data-toggle="sidebar"></div>
+<aside class="app-sidebar">
+    <div class="app-sidebar__user"><img class="app-sidebar__user-avatar"
+                                        src="/static/img/48.jpg"
+                                        alt="User Image">
+        <div>
+            <p class="app-sidebar__user-name">System</p>
+            <p class="app-sidebar__user-designation">欢迎使用</p>
+        </div>
+    </div>
+    <ul class="app-menu">
+        <li><a class="app-menu__item {{if eq "index" .menu}}active{{end}}" href="/"><i
+                class="app-menu__icon fa fa-dashboard"></i><span class="app-menu__label">使用说明</span></a></li>
+        <li><a class="app-menu__item {{if eq "host" .menu}}active{{end}}" href="/index/host"><i
+                class="app-menu__icon fa fa-lemon-o"></i><span class="app-menu__label">域名代理</span></a></li>
+        <li><a class="app-menu__item {{if eq "tcp" .menu}}active{{end}}" href="/index/tcp"><i
+                class="app-menu__icon fa fa-life-buoy"></i><span class="app-menu__label">tcp隧道管理</span></a></li>
+        <li><a class="app-menu__item {{if eq "udp" .menu}}active{{end}}" href="/index/udp"><i
+                class="app-menu__icon fa fa-laptop"></i><span class="app-menu__label">udp隧道管理</span></a></li>
+        <li><a class="app-menu__item {{if eq "socks5" .menu}}active{{end}}" href="/index/socks5"><i
+                class="app-menu__icon fa fa-lightbulb-o"></i><span class="app-menu__label">socks5代理</span></a></li>
+        <li><a class="app-menu__item {{if eq "http" .menu}}active{{end}}" href="/index/http"><i
+                class="app-menu__icon fa fa-magic"></i><span class="app-menu__label">http代理</span></a></li>
+
+    </ul>
+</aside>
+
+<script type="text/javascript" src="/static/js/datatables.min.js"></script>
+<script src="/static/js/main.js"></script>
+<main class="app-content">
+    <div class="app-title">
+        <div>
+            <h1><i class="fa fa-th-list"></i> {{.name}}</h1>
+            <a href="javascript:history.back(-1);"><i class="fa fa-mail-reply"></i>返回</a>
+        </div>
+
+    </div>
+{{.LayoutContent}}
+
+</body>
+</html>